Wala shell

Advanced PHP File Manager

Server IP: 127.0.0.1 | PHP Version: 8.3.30 | Domains Hosted: 54

Name	Size	Last Modified
📁 ..	-	2026-03-21 15:56
📄 LICENSE Copyright (c) 2020 Will McGugan Permission is hereby granted, free of charge, to any person obtaining a copy of this software and associated documentation files (the "Software"), to deal in the Software without restriction, including without limitation the rights to use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies of the Software, and to permit persons to whom the Software is furnished to do so, subject to the following conditions: The above copyright notice and this permission notice shall be included in all copies or substantial portions of the Software. THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.	1.03 KB	2026-01-20 12:58
📄 __init__.py """Rich text and beautiful formatting in the terminal.""" import os from typing import IO, TYPE_CHECKING, Any, Callable, Optional, Union from ._extension import load_ipython_extension # noqa: F401 __all__ = ["get_console", "reconfigure", "print", "inspect", "print_json"] if TYPE_CHECKING: from .console import Console # Global console used by alternative print _console: Optional["Console"] = None try: _IMPORT_CWD = os.path.abspath(os.getcwd()) except FileNotFoundError: # Can happen if the cwd has been deleted _IMPORT_CWD = "" def get_console() -> "Console": """Get a global :class:`~rich.console.Console` instance. This function is used when Rich requires a Console, and hasn't been explicitly given one. Returns: Console: A console instance. """ global _console if _console is None: from .console import Console _console = Console() return _console def reconfigure(args: Any, kwargs: Any) -> None: """Reconfigures the global console by replacing it with another. Args: args (Any): Positional arguments for the replacement :class:`~rich.console.Console`. *kwargs (Any): Keyword arguments for the replacement :class:`~rich.console.Console`. """ from pip._vendor.rich.console import Console new_console = Console(args, *kwargs) _console = get_console() _console.__dict__ = new_console.__dict__ def print( objects: Any, sep: str = " ", end: str = "\n", file: Optional[IO[str]] = None, flush: bool = False, ) -> None: r"""Print object(s) supplied via positional arguments. This function has an identical signature to the built-in print. For more advanced features, see the :class:`~rich.console.Console` class. Args: sep (str, optional): Separator between printed objects. Defaults to " ". end (str, optional): Character to write at end of output. Defaults to "\\n". file (IO[str], optional): File to write to, or None for stdout. Defaults to None. flush (bool, optional): Has no effect as Rich always flushes output. Defaults to False. """ from .console import Console write_console = get_console() if file is None else Console(file=file) return write_console.print(objects, sep=sep, end=end) def print_json( json: Optional[str] = None, , data: Any = None, indent: Union[None, int, str] = 2, highlight: bool = True, skip_keys: bool = False, ensure_ascii: bool = False, check_circular: bool = True, allow_nan: bool = True, default: Optional[Callable[[Any], Any]] = None, sort_keys: bool = False, ) -> None: """Pretty prints JSON. Output will be valid JSON. Args: json (str): A string containing JSON. data (Any): If json is not supplied, then encode this data. indent (int, optional): Number of spaces to indent. Defaults to 2. highlight (bool, optional): Enable highlighting of output: Defaults to True. skip_keys (bool, optional): Skip keys not of a basic type. Defaults to False. ensure_ascii (bool, optional): Escape all non-ascii characters. Defaults to False. check_circular (bool, optional): Check for circular references. Defaults to True. allow_nan (bool, optional): Allow NaN and Infinity values. Defaults to True. default (Callable, optional): A callable that converts values that can not be encoded in to something that can be JSON encoded. Defaults to None. sort_keys (bool, optional): Sort dictionary keys. Defaults to False. """ get_console().print_json( json, data=data, indent=indent, highlight=highlight, skip_keys=skip_keys, ensure_ascii=ensure_ascii, check_circular=check_circular, allow_nan=allow_nan, default=default, sort_keys=sort_keys, ) def inspect( obj: Any, , console: Optional["Console"] = None, title: Optional[str] = None, help: bool = False, methods: bool = False, docs: bool = True, private: bool = False, dunder: bool = False, sort: bool = True, all: bool = False, value: bool = True, ) -> None: """Inspect any Python object. inspect(<OBJECT>) to see summarized info. * inspect(<OBJECT>, methods=True) to see methods. * inspect(<OBJECT>, help=True) to see full (non-abbreviated) help. * inspect(<OBJECT>, private=True) to see private attributes (single underscore). * inspect(<OBJECT>, dunder=True) to see attributes beginning with double underscore. * inspect(<OBJECT>, all=True) to see all attributes. Args: obj (Any): An object to inspect. title (str, optional): Title to display over inspect result, or None use type. Defaults to None. help (bool, optional): Show full help text rather than just first paragraph. Defaults to False. methods (bool, optional): Enable inspection of callables. Defaults to False. docs (bool, optional): Also render doc strings. Defaults to True. private (bool, optional): Show private attributes (beginning with underscore). Defaults to False. dunder (bool, optional): Show attributes starting with double underscore. Defaults to False. sort (bool, optional): Sort attributes alphabetically. Defaults to True. all (bool, optional): Show all attributes. Defaults to False. value (bool, optional): Pretty print value. Defaults to True. """ _console = console or get_console() from pip._vendor.rich._inspect import Inspect # Special case for inspect(inspect) is_inspect = obj is inspect _inspect = Inspect( obj, title=title, help=is_inspect or help, methods=is_inspect or methods, docs=is_inspect or docs, private=private, dunder=dunder, sort=sort, all=all, value=value, ) _console.print(_inspect) if __name__ == "__main__": # pragma: no cover print("Hello, World")	5.95 KB	2026-01-20 12:58
📄 __main__.py import colorsys import io from time import process_time from pip._vendor.rich import box from pip._vendor.rich.color import Color from pip._vendor.rich.console import Console, ConsoleOptions, Group, RenderableType, RenderResult from pip._vendor.rich.markdown import Markdown from pip._vendor.rich.measure import Measurement from pip._vendor.rich.pretty import Pretty from pip._vendor.rich.segment import Segment from pip._vendor.rich.style import Style from pip._vendor.rich.syntax import Syntax from pip._vendor.rich.table import Table from pip._vendor.rich.text import Text class ColorBox: def __rich_console__( self, console: Console, options: ConsoleOptions ) -> RenderResult: for y in range(0, 5): for x in range(options.max_width): h = x / options.max_width l = 0.1 + ((y / 5) * 0.7) r1, g1, b1 = colorsys.hls_to_rgb(h, l, 1.0) r2, g2, b2 = colorsys.hls_to_rgb(h, l + 0.7 / 10, 1.0) bgcolor = Color.from_rgb(r1 * 255, g1 * 255, b1 * 255) color = Color.from_rgb(r2 * 255, g2 * 255, b2 * 255) yield Segment("▄", Style(color=color, bgcolor=bgcolor)) yield Segment.line() def __rich_measure__( self, console: "Console", options: ConsoleOptions ) -> Measurement: return Measurement(1, options.max_width) def make_test_card() -> Table: """Get a renderable that demonstrates a number of features.""" table = Table.grid(padding=1, pad_edge=True) table.title = "Rich features" table.add_column("Feature", no_wrap=True, justify="center", style="bold red") table.add_column("Demonstration") color_table = Table( box=None, expand=False, show_header=False, show_edge=False, pad_edge=False, ) color_table.add_row( ( "✓ [bold green]4-bit color[/]\n" "✓ [bold blue]8-bit color[/]\n" "✓ [bold magenta]Truecolor (16.7 million)[/]\n" "✓ [bold yellow]Dumb terminals[/]\n" "✓ [bold cyan]Automatic color conversion" ), ColorBox(), ) table.add_row("Colors", color_table) table.add_row( "Styles", "All ansi styles: [bold]bold[/], [dim]dim[/], [italic]italic[/italic], [underline]underline[/], [strike]strikethrough[/], [reverse]reverse[/], and even [blink]blink[/].", ) lorem = "Lorem ipsum dolor sit amet, consectetur adipiscing elit. Quisque in metus sed sapien ultricies pretium a at justo. Maecenas luctus velit et auctor maximus." lorem_table = Table.grid(padding=1, collapse_padding=True) lorem_table.pad_edge = False lorem_table.add_row( Text(lorem, justify="left", style="green"), Text(lorem, justify="center", style="yellow"), Text(lorem, justify="right", style="blue"), Text(lorem, justify="full", style="red"), ) table.add_row( "Text", Group( Text.from_markup( """Word wrap text. Justify [green]left[/], [yellow]center[/], [blue]right[/] or [red]full[/].\n""" ), lorem_table, ), ) def comparison(renderable1: RenderableType, renderable2: RenderableType) -> Table: table = Table(show_header=False, pad_edge=False, box=None, expand=True) table.add_column("1", ratio=1) table.add_column("2", ratio=1) table.add_row(renderable1, renderable2) return table table.add_row( "Asian\nlanguage\nsupport", ":flag_for_china: 该库支持中文，日文和韩文文本！\n:flag_for_japan: ライブラリは中国語、日本語、韓国語のテキストをサポートしています\n:flag_for_south_korea: 이 라이브러리는 중국어, 일본어 및 한국어 텍스트를 지원합니다", ) markup_example = ( "[bold magenta]Rich[/] supports a simple [i]bbcode[/i]-like [b]markup[/b] for [yellow]color[/], [underline]style[/], and emoji! " ":+1: :apple: :ant: :bear: :baguette_bread: :bus: " ) table.add_row("Markup", markup_example) example_table = Table( show_edge=False, show_header=True, expand=False, row_styles=["none", "dim"], box=box.SIMPLE, ) example_table.add_column("[green]Date", style="green", no_wrap=True) example_table.add_column("[blue]Title", style="blue") example_table.add_column( "[cyan]Production Budget", style="cyan", justify="right", no_wrap=True, ) example_table.add_column( "[magenta]Box Office", style="magenta", justify="right", no_wrap=True, ) example_table.add_row( "Dec 20, 2019", "Star Wars: The Rise of Skywalker", "$275,000,000", "$375,126,118", ) example_table.add_row( "May 25, 2018", "[b]Solo[/]: A Star Wars Story", "$275,000,000", "$393,151,347", ) example_table.add_row( "Dec 15, 2017", "Star Wars Ep. VIII: The Last Jedi", "$262,000,000", "[bold]$1,332,539,889[/bold]", ) example_table.add_row( "May 19, 1999", "Star Wars Ep. [b]I[/b]: [i]The phantom Menace", "$115,000,000", "$1,027,044,677", ) table.add_row("Tables", example_table) code = '''\ def iter_last(values: Iterable[T]) -> Iterable[Tuple[bool, T]]: """Iterate and generate a tuple with a flag for last value.""" iter_values = iter(values) try: previous_value = next(iter_values) except StopIteration: return for value in iter_values: yield False, previous_value previous_value = value yield True, previous_value''' pretty_data = { "foo": [ 3.1427, ( "Paul Atreides", "Vladimir Harkonnen", "Thufir Hawat", ), ], "atomic": (False, True, None), } table.add_row( "Syntax\nhighlighting\n&\npretty\nprinting", comparison( Syntax(code, "python3", line_numbers=True, indent_guides=True), Pretty(pretty_data, indent_guides=True), ), ) markdown_example = """\ # Markdown Supports much of the markdown __syntax__! - Headers - Basic formatting: bold, italic, `code` - Block quotes - Lists, and more... """ table.add_row( "Markdown", comparison("[cyan]" + markdown_example, Markdown(markdown_example)) ) table.add_row( "+more!", """Progress bars, columns, styled logging handler, tracebacks, etc...""", ) return table if __name__ == "__main__": # pragma: no cover from pip._vendor.rich.panel import Panel console = Console( file=io.StringIO(), force_terminal=True, ) test_card = make_test_card() # Print once to warm cache start = process_time() console.print(test_card) pre_cache_taken = round((process_time() - start) * 1000.0, 1) console.file = io.StringIO() start = process_time() console.print(test_card) taken = round((process_time() - start) * 1000.0, 1) c = Console(record=True) c.print(test_card) console = Console() console.print(f"[dim]rendered in [not dim]{pre_cache_taken}ms[/] (cold cache)") console.print(f"[dim]rendered in [not dim]{taken}ms[/] (warm cache)") console.print() console.print( Panel.fit( "[b magenta]Hope you enjoy using Rich![/]\n\n" "Please consider sponsoring me if you get value from my work.\n\n" "Even the price of a ☕ can brighten my day!\n\n" "https://github.com/sponsors/willmcgugan", border_style="red", title="Help ensure Rich is maintained", ) )	7.71 KB	2026-01-20 12:58
📁 __pycache__	-	2026-03-21 15:45
📄 _cell_widths.py # Auto generated by make_terminal_widths.py CELL_WIDTHS = [ (0, 0, 0), (1, 31, -1), (127, 159, -1), (173, 173, 0), (768, 879, 0), (1155, 1161, 0), (1425, 1469, 0), (1471, 1471, 0), (1473, 1474, 0), (1476, 1477, 0), (1479, 1479, 0), (1536, 1541, 0), (1552, 1562, 0), (1564, 1564, 0), (1611, 1631, 0), (1648, 1648, 0), (1750, 1757, 0), (1759, 1764, 0), (1767, 1768, 0), (1770, 1773, 0), (1807, 1807, 0), (1809, 1809, 0), (1840, 1866, 0), (1958, 1968, 0), (2027, 2035, 0), (2045, 2045, 0), (2070, 2073, 0), (2075, 2083, 0), (2085, 2087, 0), (2089, 2093, 0), (2137, 2139, 0), (2192, 2193, 0), (2200, 2207, 0), (2250, 2307, 0), (2362, 2364, 0), (2366, 2383, 0), (2385, 2391, 0), (2402, 2403, 0), (2433, 2435, 0), (2492, 2492, 0), (2494, 2500, 0), (2503, 2504, 0), (2507, 2509, 0), (2519, 2519, 0), (2530, 2531, 0), (2558, 2558, 0), (2561, 2563, 0), (2620, 2620, 0), (2622, 2626, 0), (2631, 2632, 0), (2635, 2637, 0), (2641, 2641, 0), (2672, 2673, 0), (2677, 2677, 0), (2689, 2691, 0), (2748, 2748, 0), (2750, 2757, 0), (2759, 2761, 0), (2763, 2765, 0), (2786, 2787, 0), (2810, 2815, 0), (2817, 2819, 0), (2876, 2876, 0), (2878, 2884, 0), (2887, 2888, 0), (2891, 2893, 0), (2901, 2903, 0), (2914, 2915, 0), (2946, 2946, 0), (3006, 3010, 0), (3014, 3016, 0), (3018, 3021, 0), (3031, 3031, 0), (3072, 3076, 0), (3132, 3132, 0), (3134, 3140, 0), (3142, 3144, 0), (3146, 3149, 0), (3157, 3158, 0), (3170, 3171, 0), (3201, 3203, 0), (3260, 3260, 0), (3262, 3268, 0), (3270, 3272, 0), (3274, 3277, 0), (3285, 3286, 0), (3298, 3299, 0), (3315, 3315, 0), (3328, 3331, 0), (3387, 3388, 0), (3390, 3396, 0), (3398, 3400, 0), (3402, 3405, 0), (3415, 3415, 0), (3426, 3427, 0), (3457, 3459, 0), (3530, 3530, 0), (3535, 3540, 0), (3542, 3542, 0), (3544, 3551, 0), (3570, 3571, 0), (3633, 3633, 0), (3636, 3642, 0), (3655, 3662, 0), (3761, 3761, 0), (3764, 3772, 0), (3784, 3790, 0), (3864, 3865, 0), (3893, 3893, 0), (3895, 3895, 0), (3897, 3897, 0), (3902, 3903, 0), (3953, 3972, 0), (3974, 3975, 0), (3981, 3991, 0), (3993, 4028, 0), (4038, 4038, 0), (4139, 4158, 0), (4182, 4185, 0), (4190, 4192, 0), (4194, 4196, 0), (4199, 4205, 0), (4209, 4212, 0), (4226, 4237, 0), (4239, 4239, 0), (4250, 4253, 0), (4352, 4447, 2), (4448, 4607, 0), (4957, 4959, 0), (5906, 5909, 0), (5938, 5940, 0), (5970, 5971, 0), (6002, 6003, 0), (6068, 6099, 0), (6109, 6109, 0), (6155, 6159, 0), (6277, 6278, 0), (6313, 6313, 0), (6432, 6443, 0), (6448, 6459, 0), (6679, 6683, 0), (6741, 6750, 0), (6752, 6780, 0), (6783, 6783, 0), (6832, 6862, 0), (6912, 6916, 0), (6964, 6980, 0), (7019, 7027, 0), (7040, 7042, 0), (7073, 7085, 0), (7142, 7155, 0), (7204, 7223, 0), (7376, 7378, 0), (7380, 7400, 0), (7405, 7405, 0), (7412, 7412, 0), (7415, 7417, 0), (7616, 7679, 0), (8203, 8207, 0), (8232, 8238, 0), (8288, 8292, 0), (8294, 8303, 0), (8400, 8432, 0), (8986, 8987, 2), (9001, 9002, 2), (9193, 9196, 2), (9200, 9200, 2), (9203, 9203, 2), (9725, 9726, 2), (9748, 9749, 2), (9800, 9811, 2), (9855, 9855, 2), (9875, 9875, 2), (9889, 9889, 2), (9898, 9899, 2), (9917, 9918, 2), (9924, 9925, 2), (9934, 9934, 2), (9940, 9940, 2), (9962, 9962, 2), (9970, 9971, 2), (9973, 9973, 2), (9978, 9978, 2), (9981, 9981, 2), (9989, 9989, 2), (9994, 9995, 2), (10024, 10024, 2), (10060, 10060, 2), (10062, 10062, 2), (10067, 10069, 2), (10071, 10071, 2), (10133, 10135, 2), (10160, 10160, 2), (10175, 10175, 2), (11035, 11036, 2), (11088, 11088, 2), (11093, 11093, 2), (11503, 11505, 0), (11647, 11647, 0), (11744, 11775, 0), (11904, 11929, 2), (11931, 12019, 2), (12032, 12245, 2), (12272, 12329, 2), (12330, 12335, 0), (12336, 12350, 2), (12353, 12438, 2), (12441, 12442, 0), (12443, 12543, 2), (12549, 12591, 2), (12593, 12686, 2), (12688, 12771, 2), (12783, 12830, 2), (12832, 12871, 2), (12880, 19903, 2), (19968, 42124, 2), (42128, 42182, 2), (42607, 42610, 0), (42612, 42621, 0), (42654, 42655, 0), (42736, 42737, 0), (43010, 43010, 0), (43014, 43014, 0), (43019, 43019, 0), (43043, 43047, 0), (43052, 43052, 0), (43136, 43137, 0), (43188, 43205, 0), (43232, 43249, 0), (43263, 43263, 0), (43302, 43309, 0), (43335, 43347, 0), (43360, 43388, 2), (43392, 43395, 0), (43443, 43456, 0), (43493, 43493, 0), (43561, 43574, 0), (43587, 43587, 0), (43596, 43597, 0), (43643, 43645, 0), (43696, 43696, 0), (43698, 43700, 0), (43703, 43704, 0), (43710, 43711, 0), (43713, 43713, 0), (43755, 43759, 0), (43765, 43766, 0), (44003, 44010, 0), (44012, 44013, 0), (44032, 55203, 2), (55216, 55295, 0), (63744, 64255, 2), (64286, 64286, 0), (65024, 65039, 0), (65040, 65049, 2), (65056, 65071, 0), (65072, 65106, 2), (65108, 65126, 2), (65128, 65131, 2), (65279, 65279, 0), (65281, 65376, 2), (65504, 65510, 2), (65529, 65531, 0), (66045, 66045, 0), (66272, 66272, 0), (66422, 66426, 0), (68097, 68099, 0), (68101, 68102, 0), (68108, 68111, 0), (68152, 68154, 0), (68159, 68159, 0), (68325, 68326, 0), (68900, 68903, 0), (69291, 69292, 0), (69373, 69375, 0), (69446, 69456, 0), (69506, 69509, 0), (69632, 69634, 0), (69688, 69702, 0), (69744, 69744, 0), (69747, 69748, 0), (69759, 69762, 0), (69808, 69818, 0), (69821, 69821, 0), (69826, 69826, 0), (69837, 69837, 0), (69888, 69890, 0), (69927, 69940, 0), (69957, 69958, 0), (70003, 70003, 0), (70016, 70018, 0), (70067, 70080, 0), (70089, 70092, 0), (70094, 70095, 0), (70188, 70199, 0), (70206, 70206, 0), (70209, 70209, 0), (70367, 70378, 0), (70400, 70403, 0), (70459, 70460, 0), (70462, 70468, 0), (70471, 70472, 0), (70475, 70477, 0), (70487, 70487, 0), (70498, 70499, 0), (70502, 70508, 0), (70512, 70516, 0), (70709, 70726, 0), (70750, 70750, 0), (70832, 70851, 0), (71087, 71093, 0), (71096, 71104, 0), (71132, 71133, 0), (71216, 71232, 0), (71339, 71351, 0), (71453, 71467, 0), (71724, 71738, 0), (71984, 71989, 0), (71991, 71992, 0), (71995, 71998, 0), (72000, 72000, 0), (72002, 72003, 0), (72145, 72151, 0), (72154, 72160, 0), (72164, 72164, 0), (72193, 72202, 0), (72243, 72249, 0), (72251, 72254, 0), (72263, 72263, 0), (72273, 72283, 0), (72330, 72345, 0), (72751, 72758, 0), (72760, 72767, 0), (72850, 72871, 0), (72873, 72886, 0), (73009, 73014, 0), (73018, 73018, 0), (73020, 73021, 0), (73023, 73029, 0), (73031, 73031, 0), (73098, 73102, 0), (73104, 73105, 0), (73107, 73111, 0), (73459, 73462, 0), (73472, 73473, 0), (73475, 73475, 0), (73524, 73530, 0), (73534, 73538, 0), (78896, 78912, 0), (78919, 78933, 0), (92912, 92916, 0), (92976, 92982, 0), (94031, 94031, 0), (94033, 94087, 0), (94095, 94098, 0), (94176, 94179, 2), (94180, 94180, 0), (94192, 94193, 0), (94208, 100343, 2), (100352, 101589, 2), (101632, 101640, 2), (110576, 110579, 2), (110581, 110587, 2), (110589, 110590, 2), (110592, 110882, 2), (110898, 110898, 2), (110928, 110930, 2), (110933, 110933, 2), (110948, 110951, 2), (110960, 111355, 2), (113821, 113822, 0), (113824, 113827, 0), (118528, 118573, 0), (118576, 118598, 0), (119141, 119145, 0), (119149, 119170, 0), (119173, 119179, 0), (119210, 119213, 0), (119362, 119364, 0), (121344, 121398, 0), (121403, 121452, 0), (121461, 121461, 0), (121476, 121476, 0), (121499, 121503, 0), (121505, 121519, 0), (122880, 122886, 0), (122888, 122904, 0), (122907, 122913, 0), (122915, 122916, 0), (122918, 122922, 0), (123023, 123023, 0), (123184, 123190, 0), (123566, 123566, 0), (123628, 123631, 0), (124140, 124143, 0), (125136, 125142, 0), (125252, 125258, 0), (126980, 126980, 2), (127183, 127183, 2), (127374, 127374, 2), (127377, 127386, 2), (127488, 127490, 2), (127504, 127547, 2), (127552, 127560, 2), (127568, 127569, 2), (127584, 127589, 2), (127744, 127776, 2), (127789, 127797, 2), (127799, 127868, 2), (127870, 127891, 2), (127904, 127946, 2), (127951, 127955, 2), (127968, 127984, 2), (127988, 127988, 2), (127992, 127994, 2), (127995, 127999, 0), (128000, 128062, 2), (128064, 128064, 2), (128066, 128252, 2), (128255, 128317, 2), (128331, 128334, 2), (128336, 128359, 2), (128378, 128378, 2), (128405, 128406, 2), (128420, 128420, 2), (128507, 128591, 2), (128640, 128709, 2), (128716, 128716, 2), (128720, 128722, 2), (128725, 128727, 2), (128732, 128735, 2), (128747, 128748, 2), (128756, 128764, 2), (128992, 129003, 2), (129008, 129008, 2), (129292, 129338, 2), (129340, 129349, 2), (129351, 129535, 2), (129648, 129660, 2), (129664, 129672, 2), (129680, 129725, 2), (129727, 129733, 2), (129742, 129755, 2), (129760, 129768, 2), (129776, 129784, 2), (131072, 196605, 2), (196608, 262141, 2), (917505, 917505, 0), (917536, 917631, 0), (917760, 917999, 0), ]	9.97 KB	2026-01-20 12:58
📄 _emoji_codes.py EMOJI = { "1st_place_medal": "🥇", "2nd_place_medal": "🥈", "3rd_place_medal": "🥉", "ab_button_(blood_type)": "🆎", "atm_sign": "🏧", "a_button_(blood_type)": "🅰", "afghanistan": "🇦🇫", "albania": "🇦🇱", "algeria": "🇩🇿", "american_samoa": "🇦🇸", "andorra": "🇦🇩", "angola": "🇦🇴", "anguilla": "🇦🇮", "antarctica": "🇦🇶", "antigua_&_barbuda": "🇦🇬", "aquarius": "♒", "argentina": "🇦🇷", "aries": "♈", "armenia": "🇦🇲", "aruba": "🇦🇼", "ascension_island": "🇦🇨", "australia": "🇦🇺", "austria": "🇦🇹", "azerbaijan": "🇦🇿", "back_arrow": "🔙", "b_button_(blood_type)": "🅱", "bahamas": "🇧🇸", "bahrain": "🇧🇭", "bangladesh": "🇧🇩", "barbados": "🇧🇧", "belarus": "🇧🇾", "belgium": "🇧🇪", "belize": "🇧🇿", "benin": "🇧🇯", "bermuda": "🇧🇲", "bhutan": "🇧🇹", "bolivia": "🇧🇴", "bosnia_&_herzegovina": "🇧🇦", "botswana": "🇧🇼", "bouvet_island": "🇧🇻", "brazil": "🇧🇷", "british_indian_ocean_territory": "🇮🇴", "british_virgin_islands": "🇻🇬", "brunei": "🇧🇳", "bulgaria": "🇧🇬", "burkina_faso": "🇧🇫", "burundi": "🇧🇮", "cl_button": "🆑", "cool_button": "🆒", "cambodia": "🇰🇭", "cameroon": "🇨🇲", "canada": "🇨🇦", "canary_islands": "🇮🇨", "cancer": "♋", "cape_verde": "🇨🇻", "capricorn": "♑", "caribbean_netherlands": "🇧🇶", "cayman_islands": "🇰🇾", "central_african_republic": "🇨🇫", "ceuta_&_melilla": "🇪🇦", "chad": "🇹🇩", "chile": "🇨🇱", "china": "🇨🇳", "christmas_island": "🇨🇽", "christmas_tree": "🎄", "clipperton_island": "🇨🇵", "cocos_(keeling)_islands": "🇨🇨", "colombia": "🇨🇴", "comoros": "🇰🇲", "congo_-_brazzaville": "🇨🇬", "congo_-_kinshasa": "🇨🇩", "cook_islands": "🇨🇰", "costa_rica": "🇨🇷", "croatia": "🇭🇷", "cuba": "🇨🇺", "curaçao": "🇨🇼", "cyprus": "🇨🇾", "czechia": "🇨🇿", "côte_d’ivoire": "🇨🇮", "denmark": "🇩🇰", "diego_garcia": "🇩🇬", "djibouti": "🇩🇯", "dominica": "🇩🇲", "dominican_republic": "🇩🇴", "end_arrow": "🔚", "ecuador": "🇪🇨", "egypt": "🇪🇬", "el_salvador": "🇸🇻", "england": "🏴\U000e0067\U000e0062\U000e0065\U000e006e\U000e0067\U000e007f", "equatorial_guinea": "🇬🇶", "eritrea": "🇪🇷", "estonia": "🇪🇪", "ethiopia": "🇪🇹", "european_union": "🇪🇺", "free_button": "🆓", "falkland_islands": "🇫🇰", "faroe_islands": "🇫🇴", "fiji": "🇫🇯", "finland": "🇫🇮", "france": "🇫🇷", "french_guiana": "🇬🇫", "french_polynesia": "🇵🇫", "french_southern_territories": "🇹🇫", "gabon": "🇬🇦", "gambia": "🇬🇲", "gemini": "♊", "georgia": "🇬🇪", "germany": "🇩🇪", "ghana": "🇬🇭", "gibraltar": "🇬🇮", "greece": "🇬🇷", "greenland": "🇬🇱", "grenada": "🇬🇩", "guadeloupe": "🇬🇵", "guam": "🇬🇺", "guatemala": "🇬🇹", "guernsey": "🇬🇬", "guinea": "🇬🇳", "guinea-bissau": "🇬🇼", "guyana": "🇬🇾", "haiti": "🇭🇹", "heard_&_mcdonald_islands": "🇭🇲", "honduras": "🇭🇳", "hong_kong_sar_china": "🇭🇰", "hungary": "🇭🇺", "id_button": "🆔", "iceland": "🇮🇸", "india": "🇮🇳", "indonesia": "🇮🇩", "iran": "🇮🇷", "iraq": "🇮🇶", "ireland": "🇮🇪", "isle_of_man": "🇮🇲", "israel": "🇮🇱", "italy": "🇮🇹", "jamaica": "🇯🇲", "japan": "🗾", "japanese_acceptable_button": "🉑", "japanese_application_button": "🈸", "japanese_bargain_button": "🉐", "japanese_castle": "🏯", "japanese_congratulations_button": "㊗", "japanese_discount_button": "🈹", "japanese_dolls": "🎎", "japanese_free_of_charge_button": "🈚", "japanese_here_button": "🈁", "japanese_monthly_amount_button": "🈷", "japanese_no_vacancy_button": "🈵", "japanese_not_free_of_charge_button": "🈶", "japanese_open_for_business_button": "🈺", "japanese_passing_grade_button": "🈴", "japanese_post_office": "🏣", "japanese_prohibited_button": "🈲", "japanese_reserved_button": "🈯", "japanese_secret_button": "㊙", "japanese_service_charge_button": "🈂", "japanese_symbol_for_beginner": "🔰", "japanese_vacancy_button": "🈳", "jersey": "🇯🇪", "jordan": "🇯🇴", "kazakhstan": "🇰🇿", "kenya": "🇰🇪", "kiribati": "🇰🇮", "kosovo": "🇽🇰", "kuwait": "🇰🇼", "kyrgyzstan": "🇰🇬", "laos": "🇱🇦", "latvia": "🇱🇻", "lebanon": "🇱🇧", "leo": "♌", "lesotho": "🇱🇸", "liberia": "🇱🇷", "libra": "♎", "libya": "🇱🇾", "liechtenstein": "🇱🇮", "lithuania": "🇱🇹", "luxembourg": "🇱🇺", "macau_sar_china": "🇲🇴", "macedonia": "🇲🇰", "madagascar": "🇲🇬", "malawi": "🇲🇼", "malaysia": "🇲🇾", "maldives": "🇲🇻", "mali": "🇲🇱", "malta": "🇲🇹", "marshall_islands": "🇲🇭", "martinique": "🇲🇶", "mauritania": "🇲🇷", "mauritius": "🇲🇺", "mayotte": "🇾🇹", "mexico": "🇲🇽", "micronesia": "🇫🇲", "moldova": "🇲🇩", "monaco": "🇲🇨", "mongolia": "🇲🇳", "montenegro": "🇲🇪", "montserrat": "🇲🇸", "morocco": "🇲🇦", "mozambique": "🇲🇿", "mrs._claus": "🤶", "mrs._claus_dark_skin_tone": "🤶🏿", "mrs._claus_light_skin_tone": "🤶🏻", "mrs._claus_medium-dark_skin_tone": "🤶🏾", "mrs._claus_medium-light_skin_tone": "🤶🏼", "mrs._claus_medium_skin_tone": "🤶🏽", "myanmar_(burma)": "🇲🇲", "new_button": "🆕", "ng_button": "🆖", "namibia": "🇳🇦", "nauru": "🇳🇷", "nepal": "🇳🇵", "netherlands": "🇳🇱", "new_caledonia": "🇳🇨", "new_zealand": "🇳🇿", "nicaragua": "🇳🇮", "niger": "🇳🇪", "nigeria": "🇳🇬", "niue": "🇳🇺", "norfolk_island": "🇳🇫", "north_korea": "🇰🇵", "northern_mariana_islands": "🇲🇵", "norway": "🇳🇴", "ok_button": "🆗", "ok_hand": "👌", "ok_hand_dark_skin_tone": "👌🏿", "ok_hand_light_skin_tone": "👌🏻", "ok_hand_medium-dark_skin_tone": "👌🏾", "ok_hand_medium-light_skin_tone": "👌🏼", "ok_hand_medium_skin_tone": "👌🏽", "on!_arrow": "🔛", "o_button_(blood_type)": "🅾", "oman": "🇴🇲", "ophiuchus": "⛎", "p_button": "🅿", "pakistan": "🇵🇰", "palau": "🇵🇼", "palestinian_territories": "🇵🇸", "panama": "🇵🇦", "papua_new_guinea": "🇵🇬", "paraguay": "🇵🇾", "peru": "🇵🇪", "philippines": "🇵🇭", "pisces": "♓", "pitcairn_islands": "🇵🇳", "poland": "🇵🇱", "portugal": "🇵🇹", "puerto_rico": "🇵🇷", "qatar": "🇶🇦", "romania": "🇷🇴", "russia": "🇷🇺", "rwanda": "🇷🇼", "réunion": "🇷🇪", "soon_arrow": "🔜", "sos_button": "🆘", "sagittarius": "♐", "samoa": "🇼🇸", "san_marino": "🇸🇲", "santa_claus": "🎅", "santa_claus_dark_skin_tone": "🎅🏿", "santa_claus_light_skin_tone": "🎅🏻", "santa_claus_medium-dark_skin_tone": "🎅🏾", "santa_claus_medium-light_skin_tone": "🎅🏼", "santa_claus_medium_skin_tone": "🎅🏽", "saudi_arabia": "🇸🇦", "scorpio": "♏", "scotland": "🏴\U000e0067\U000e0062\U000e0073\U000e0063\U000e0074\U000e007f", "senegal": "🇸🇳", "serbia": "🇷🇸", "seychelles": "🇸🇨", "sierra_leone": "🇸🇱", "singapore": "🇸🇬", "sint_maarten": "🇸🇽", "slovakia": "🇸🇰", "slovenia": "🇸🇮", "solomon_islands": "🇸🇧", "somalia": "🇸🇴", "south_africa": "🇿🇦", "south_georgia_&_south_sandwich_islands": "🇬🇸", "south_korea": "🇰🇷", "south_sudan": "🇸🇸", "spain": "🇪🇸", "sri_lanka": "🇱🇰", "st._barthélemy": "🇧🇱", "st._helena": "🇸🇭", "st._kitts_&_nevis": "🇰🇳", "st._lucia": "🇱🇨", "st._martin": "🇲🇫", "st._pierre_&_miquelon": "🇵🇲", "st._vincent_&_grenadines": "🇻🇨", "statue_of_liberty": "🗽", "sudan": "🇸🇩", "suriname": "🇸🇷", "svalbard_&_jan_mayen": "🇸🇯", "swaziland": "🇸🇿", "sweden": "🇸🇪", "switzerland": "🇨🇭", "syria": "🇸🇾", "são_tomé_&_príncipe": "🇸🇹", "t-rex": "🦖", "top_arrow": "🔝", "taiwan": "🇹🇼", "tajikistan": "🇹🇯", "tanzania": "🇹🇿", "taurus": "♉", "thailand": "🇹🇭", "timor-leste": "🇹🇱", "togo": "🇹🇬", "tokelau": "🇹🇰", "tokyo_tower": "🗼", "tonga": "🇹🇴", "trinidad_&_tobago": "🇹🇹", "tristan_da_cunha": "🇹🇦", "tunisia": "🇹🇳", "turkey": "🦃", "turkmenistan": "🇹🇲", "turks_&_caicos_islands": "🇹🇨", "tuvalu": "🇹🇻", "u.s._outlying_islands": "🇺🇲", "u.s._virgin_islands": "🇻🇮", "up!_button": "🆙", "uganda": "🇺🇬", "ukraine": "🇺🇦", "united_arab_emirates": "🇦🇪", "united_kingdom": "🇬🇧", "united_nations": "🇺🇳", "united_states": "🇺🇸", "uruguay": "🇺🇾", "uzbekistan": "🇺🇿", "vs_button": "🆚", "vanuatu": "🇻🇺", "vatican_city": "🇻🇦", "venezuela": "🇻🇪", "vietnam": "🇻🇳", "virgo": "♍", "wales": "🏴\U000e0067\U000e0062\U000e0077\U000e006c\U000e0073\U000e007f", "wallis_&_futuna": "🇼🇫", "western_sahara": "🇪🇭", "yemen": "🇾🇪", "zambia": "🇿🇲", "zimbabwe": "🇿🇼", "abacus": "🧮", "adhesive_bandage": "🩹", "admission_tickets": "🎟", "adult": "🧑", "adult_dark_skin_tone": "🧑🏿", "adult_light_skin_tone": "🧑🏻", "adult_medium-dark_skin_tone": "🧑🏾", "adult_medium-light_skin_tone": "🧑🏼", "adult_medium_skin_tone": "🧑🏽", "aerial_tramway": "🚡", "airplane": "✈", "airplane_arrival": "🛬", "airplane_departure": "🛫", "alarm_clock": "⏰", "alembic": "⚗", "alien": "👽", "alien_monster": "👾", "ambulance": "🚑", "american_football": "🏈", "amphora": "🏺", "anchor": "⚓", "anger_symbol": "💢", "angry_face": "😠", "angry_face_with_horns": "👿", "anguished_face": "😧", "ant": "🐜", "antenna_bars": "📶", "anxious_face_with_sweat": "😰", "articulated_lorry": "🚛", "artist_palette": "🎨", "astonished_face": "😲", "atom_symbol": "⚛", "auto_rickshaw": "🛺", "automobile": "🚗", "avocado": "🥑", "axe": "🪓", "baby": "👶", "baby_angel": "👼", "baby_angel_dark_skin_tone": "👼🏿", "baby_angel_light_skin_tone": "👼🏻", "baby_angel_medium-dark_skin_tone": "👼🏾", "baby_angel_medium-light_skin_tone": "👼🏼", "baby_angel_medium_skin_tone": "👼🏽", "baby_bottle": "🍼", "baby_chick": "🐤", "baby_dark_skin_tone": "👶🏿", "baby_light_skin_tone": "👶🏻", "baby_medium-dark_skin_tone": "👶🏾", "baby_medium-light_skin_tone": "👶🏼", "baby_medium_skin_tone": "👶🏽", "baby_symbol": "🚼", "backhand_index_pointing_down": "👇", "backhand_index_pointing_down_dark_skin_tone": "👇🏿", "backhand_index_pointing_down_light_skin_tone": "👇🏻", "backhand_index_pointing_down_medium-dark_skin_tone": "👇🏾", "backhand_index_pointing_down_medium-light_skin_tone": "👇🏼", "backhand_index_pointing_down_medium_skin_tone": "👇🏽", "backhand_index_pointing_left": "👈", "backhand_index_pointing_left_dark_skin_tone": "👈🏿", "backhand_index_pointing_left_light_skin_tone": "👈🏻", "backhand_index_pointing_left_medium-dark_skin_tone": "👈🏾", "backhand_index_pointing_left_medium-light_skin_tone": "👈🏼", "backhand_index_pointing_left_medium_skin_tone": "👈🏽", "backhand_index_pointing_right": "👉", "backhand_index_pointing_right_dark_skin_tone": "👉🏿", "backhand_index_pointing_right_light_skin_tone": "👉🏻", "backhand_index_pointing_right_medium-dark_skin_tone": "👉🏾", "backhand_index_pointing_right_medium-light_skin_tone": "👉🏼", "backhand_index_pointing_right_medium_skin_tone": "👉🏽", "backhand_index_pointing_up": "👆", "backhand_index_pointing_up_dark_skin_tone": "👆🏿", "backhand_index_pointing_up_light_skin_tone": "👆🏻", "backhand_index_pointing_up_medium-dark_skin_tone": "👆🏾", "backhand_index_pointing_up_medium-light_skin_tone": "👆🏼", "backhand_index_pointing_up_medium_skin_tone": "👆🏽", "bacon": "🥓", "badger": "🦡", "badminton": "🏸", "bagel": "🥯", "baggage_claim": "🛄", "baguette_bread": "🥖", "balance_scale": "⚖", "bald": "🦲", "bald_man": "👨\u200d🦲", "bald_woman": "👩\u200d🦲", "ballet_shoes": "🩰", "balloon": "🎈", "ballot_box_with_ballot": "🗳", "ballot_box_with_check": "☑", "banana": "🍌", "banjo": "🪕", "bank": "🏦", "bar_chart": "📊", "barber_pole": "💈", "baseball": "⚾", "basket": "🧺", "basketball": "🏀", "bat": "🦇", "bathtub": "🛁", "battery": "🔋", "beach_with_umbrella": "🏖", "beaming_face_with_smiling_eyes": "😁", "bear_face": "🐻", "bearded_person": "🧔", "bearded_person_dark_skin_tone": "🧔🏿", "bearded_person_light_skin_tone": "🧔🏻", "bearded_person_medium-dark_skin_tone": "🧔🏾", "bearded_person_medium-light_skin_tone": "🧔🏼", "bearded_person_medium_skin_tone": "🧔🏽", "beating_heart": "💓", "bed": "🛏", "beer_mug": "🍺", "bell": "🔔", "bell_with_slash": "🔕", "bellhop_bell": "🛎", "bento_box": "🍱", "beverage_box": "🧃", "bicycle": "🚲", "bikini": "👙", "billed_cap": "🧢", "biohazard": "☣", "bird": "🐦", "birthday_cake": "🎂", "black_circle": "⚫", "black_flag": "🏴", "black_heart": "🖤", "black_large_square": "⬛", "black_medium-small_square": "◾", "black_medium_square": "◼", "black_nib": "✒", "black_small_square": "▪", "black_square_button": "🔲", "blond-haired_man": "👱\u200d♂️", "blond-haired_man_dark_skin_tone": "👱🏿\u200d♂️", "blond-haired_man_light_skin_tone": "👱🏻\u200d♂️", "blond-haired_man_medium-dark_skin_tone": "👱🏾\u200d♂️", "blond-haired_man_medium-light_skin_tone": "👱🏼\u200d♂️", "blond-haired_man_medium_skin_tone": "👱🏽\u200d♂️", "blond-haired_person": "👱", "blond-haired_person_dark_skin_tone": "👱🏿", "blond-haired_person_light_skin_tone": "👱🏻", "blond-haired_person_medium-dark_skin_tone": "👱🏾", "blond-haired_person_medium-light_skin_tone": "👱🏼", "blond-haired_person_medium_skin_tone": "👱🏽", "blond-haired_woman": "👱\u200d♀️", "blond-haired_woman_dark_skin_tone": "👱🏿\u200d♀️", "blond-haired_woman_light_skin_tone": "👱🏻\u200d♀️", "blond-haired_woman_medium-dark_skin_tone": "👱🏾\u200d♀️", "blond-haired_woman_medium-light_skin_tone": "👱🏼\u200d♀️", "blond-haired_woman_medium_skin_tone": "👱🏽\u200d♀️", "blossom": "🌼", "blowfish": "🐡", "blue_book": "📘", "blue_circle": "🔵", "blue_heart": "💙", "blue_square": "🟦", "boar": "🐗", "bomb": "💣", "bone": "🦴", "bookmark": "🔖", "bookmark_tabs": "📑", "books": "📚", "bottle_with_popping_cork": "🍾", "bouquet": "💐", "bow_and_arrow": "🏹", "bowl_with_spoon": "🥣", "bowling": "🎳", "boxing_glove": "🥊", "boy": "👦", "boy_dark_skin_tone": "👦🏿", "boy_light_skin_tone": "👦🏻", "boy_medium-dark_skin_tone": "👦🏾", "boy_medium-light_skin_tone": "👦🏼", "boy_medium_skin_tone": "👦🏽", "brain": "🧠", "bread": "🍞", "breast-feeding": "🤱", "breast-feeding_dark_skin_tone": "🤱🏿", "breast-feeding_light_skin_tone": "🤱🏻", "breast-feeding_medium-dark_skin_tone": "🤱🏾", "breast-feeding_medium-light_skin_tone": "🤱🏼", "breast-feeding_medium_skin_tone": "🤱🏽", "brick": "🧱", "bride_with_veil": "👰", "bride_with_veil_dark_skin_tone": "👰🏿", "bride_with_veil_light_skin_tone": "👰🏻", "bride_with_veil_medium-dark_skin_tone": "👰🏾", "bride_with_veil_medium-light_skin_tone": "👰🏼", "bride_with_veil_medium_skin_tone": "👰🏽", "bridge_at_night": "🌉", "briefcase": "💼", "briefs": "🩲", "bright_button": "🔆", "broccoli": "🥦", "broken_heart": "💔", "broom": "🧹", "brown_circle": "🟤", "brown_heart": "🤎", "brown_square": "🟫", "bug": "🐛", "building_construction": "🏗", "bullet_train": "🚅", "burrito": "🌯", "bus": "🚌", "bus_stop": "🚏", "bust_in_silhouette": "👤", "busts_in_silhouette": "👥", "butter": "🧈", "butterfly": "🦋", "cactus": "🌵", "calendar": "📆", "call_me_hand": "🤙", "call_me_hand_dark_skin_tone": "🤙🏿", "call_me_hand_light_skin_tone": "🤙🏻", "call_me_hand_medium-dark_skin_tone": "🤙🏾", "call_me_hand_medium-light_skin_tone": "🤙🏼", "call_me_hand_medium_skin_tone": "🤙🏽", "camel": "🐫", "camera": "📷", "camera_with_flash": "📸", "camping": "🏕", "candle": "🕯", "candy": "🍬", "canned_food": "🥫", "canoe": "🛶", "card_file_box": "🗃", "card_index": "📇", "card_index_dividers": "🗂", "carousel_horse": "🎠", "carp_streamer": "🎏", "carrot": "🥕", "castle": "🏰", "cat": "🐱", "cat_face": "🐱", "cat_face_with_tears_of_joy": "😹", "cat_face_with_wry_smile": "😼", "chains": "⛓", "chair": "🪑", "chart_decreasing": "📉", "chart_increasing": "📈", "chart_increasing_with_yen": "💹", "cheese_wedge": "🧀", "chequered_flag": "🏁", "cherries": "🍒", "cherry_blossom": "🌸", "chess_pawn": "♟", "chestnut": "🌰", "chicken": "🐔", "child": "🧒", "child_dark_skin_tone": "🧒🏿", "child_light_skin_tone": "🧒🏻", "child_medium-dark_skin_tone": "🧒🏾", "child_medium-light_skin_tone": "🧒🏼", "child_medium_skin_tone": "🧒🏽", "children_crossing": "🚸", "chipmunk": "🐿", "chocolate_bar": "🍫", "chopsticks": "🥢", "church": "⛪", "cigarette": "🚬", "cinema": "🎦", "circled_m": "Ⓜ", "circus_tent": "🎪", "cityscape": "🏙", "cityscape_at_dusk": "🌆", "clamp": "🗜", "clapper_board": "🎬", "clapping_hands": "👏", "clapping_hands_dark_skin_tone": "👏🏿", "clapping_hands_light_skin_tone": "👏🏻", "clapping_hands_medium-dark_skin_tone": "👏🏾", "clapping_hands_medium-light_skin_tone": "👏🏼", "clapping_hands_medium_skin_tone": "👏🏽", "classical_building": "🏛", "clinking_beer_mugs": "🍻", "clinking_glasses": "🥂", "clipboard": "📋", "clockwise_vertical_arrows": "🔃", "closed_book": "📕", "closed_mailbox_with_lowered_flag": "📪", "closed_mailbox_with_raised_flag": "📫", "closed_umbrella": "🌂", "cloud": "☁", "cloud_with_lightning": "🌩", "cloud_with_lightning_and_rain": "⛈", "cloud_with_rain": "🌧", "cloud_with_snow": "🌨", "clown_face": "🤡", "club_suit": "♣", "clutch_bag": "👝", "coat": "🧥", "cocktail_glass": "🍸", "coconut": "🥥", "coffin": "⚰", "cold_face": "🥶", "collision": "💥", "comet": "☄", "compass": "🧭", "computer_disk": "💽", "computer_mouse": "🖱", "confetti_ball": "🎊", "confounded_face": "😖", "confused_face": "😕", "construction": "🚧", "construction_worker": "👷", "construction_worker_dark_skin_tone": "👷🏿", "construction_worker_light_skin_tone": "👷🏻", "construction_worker_medium-dark_skin_tone": "👷🏾", "construction_worker_medium-light_skin_tone": "👷🏼", "construction_worker_medium_skin_tone": "👷🏽", "control_knobs": "🎛", "convenience_store": "🏪", "cooked_rice": "🍚", "cookie": "🍪", "cooking": "🍳", "copyright": "©", "couch_and_lamp": "🛋", "counterclockwise_arrows_button": "🔄", "couple_with_heart": "💑", "couple_with_heart_man_man": "👨\u200d❤️\u200d👨", "couple_with_heart_woman_man": "👩\u200d❤️\u200d👨", "couple_with_heart_woman_woman": "👩\u200d❤️\u200d👩", "cow": "🐮", "cow_face": "🐮", "cowboy_hat_face": "🤠", "crab": "🦀", "crayon": "🖍", "credit_card": "💳", "crescent_moon": "🌙", "cricket": "🦗", "cricket_game": "🏏", "crocodile": "🐊", "croissant": "🥐", "cross_mark": "❌", "cross_mark_button": "❎", "crossed_fingers": "🤞", "crossed_fingers_dark_skin_tone": "🤞🏿", "crossed_fingers_light_skin_tone": "🤞🏻", "crossed_fingers_medium-dark_skin_tone": "🤞🏾", "crossed_fingers_medium-light_skin_tone": "🤞🏼", "crossed_fingers_medium_skin_tone": "🤞🏽", "crossed_flags": "🎌", "crossed_swords": "⚔", "crown": "👑", "crying_cat_face": "😿", "crying_face": "😢", "crystal_ball": "🔮", "cucumber": "🥒", "cupcake": "🧁", "cup_with_straw": "🥤", "curling_stone": "🥌", "curly_hair": "🦱", "curly-haired_man": "👨\u200d🦱", "curly-haired_woman": "👩\u200d🦱", "curly_loop": "➰", "currency_exchange": "💱", "curry_rice": "🍛", "custard": "🍮", "customs": "🛃", "cut_of_meat": "🥩", "cyclone": "🌀", "dagger": "🗡", "dango": "🍡", "dashing_away": "💨", "deaf_person": "🧏", "deciduous_tree": "🌳", "deer": "🦌", "delivery_truck": "🚚", "department_store": "🏬", "derelict_house": "🏚", "desert": "🏜", "desert_island": "🏝", "desktop_computer": "🖥", "detective": "🕵", "detective_dark_skin_tone": "🕵🏿", "detective_light_skin_tone": "🕵🏻", "detective_medium-dark_skin_tone": "🕵🏾", "detective_medium-light_skin_tone": "🕵🏼", "detective_medium_skin_tone": "🕵🏽", "diamond_suit": "♦", "diamond_with_a_dot": "💠", "dim_button": "🔅", "direct_hit": "🎯", "disappointed_face": "😞", "diving_mask": "🤿", "diya_lamp": "🪔", "dizzy": "💫", "dizzy_face": "😵", "dna": "🧬", "dog": "🐶", "dog_face": "🐶", "dollar_banknote": "💵", "dolphin": "🐬", "door": "🚪", "dotted_six-pointed_star": "🔯", "double_curly_loop": "➿", "double_exclamation_mark": "‼", "doughnut": "🍩", "dove": "🕊", "down-left_arrow": "↙", "down-right_arrow": "↘", "down_arrow": "⬇", "downcast_face_with_sweat": "😓", "downwards_button": "🔽", "dragon": "🐉", "dragon_face": "🐲", "dress": "👗", "drooling_face": "🤤", "drop_of_blood": "🩸", "droplet": "💧", "drum": "🥁", "duck": "🦆", "dumpling": "🥟", "dvd": "📀", "e-mail": "📧", "eagle": "🦅", "ear": "👂", "ear_dark_skin_tone": "👂🏿", "ear_light_skin_tone": "👂🏻", "ear_medium-dark_skin_tone": "👂🏾", "ear_medium-light_skin_tone": "👂🏼", "ear_medium_skin_tone": "👂🏽", "ear_of_corn": "🌽", "ear_with_hearing_aid": "🦻", "egg": "🍳", "eggplant": "🍆", "eight-pointed_star": "✴", "eight-spoked_asterisk": "✳", "eight-thirty": "🕣", "eight_o’clock": "🕗", "eject_button": "⏏", "electric_plug": "🔌", "elephant": "🐘", "eleven-thirty": "🕦", "eleven_o’clock": "🕚", "elf": "🧝", "elf_dark_skin_tone": "🧝🏿", "elf_light_skin_tone": "🧝🏻", "elf_medium-dark_skin_tone": "🧝🏾", "elf_medium-light_skin_tone": "🧝🏼", "elf_medium_skin_tone": "🧝🏽", "envelope": "✉", "envelope_with_arrow": "📩", "euro_banknote": "💶", "evergreen_tree": "🌲", "ewe": "🐑", "exclamation_mark": "❗", "exclamation_question_mark": "⁉", "exploding_head": "🤯", "expressionless_face": "😑", "eye": "👁", "eye_in_speech_bubble": "👁️\u200d🗨️", "eyes": "👀", "face_blowing_a_kiss": "😘", "face_savoring_food": "😋", "face_screaming_in_fear": "😱", "face_vomiting": "🤮", "face_with_hand_over_mouth": "🤭", "face_with_head-bandage": "🤕", "face_with_medical_mask": "😷", "face_with_monocle": "🧐", "face_with_open_mouth": "😮", "face_with_raised_eyebrow": "🤨", "face_with_rolling_eyes": "🙄", "face_with_steam_from_nose": "😤", "face_with_symbols_on_mouth": "🤬", "face_with_tears_of_joy": "😂", "face_with_thermometer": "🤒", "face_with_tongue": "😛", "face_without_mouth": "😶", "factory": "🏭", "fairy": "🧚", "fairy_dark_skin_tone": "🧚🏿", "fairy_light_skin_tone": "🧚🏻", "fairy_medium-dark_skin_tone": "🧚🏾", "fairy_medium-light_skin_tone": "🧚🏼", "fairy_medium_skin_tone": "🧚🏽", "falafel": "🧆", "fallen_leaf": "🍂", "family": "👪", "family_man_boy": "👨\u200d👦", "family_man_boy_boy": "👨\u200d👦\u200d👦", "family_man_girl": "👨\u200d👧", "family_man_girl_boy": "👨\u200d👧\u200d👦", "family_man_girl_girl": "👨\u200d👧\u200d👧", "family_man_man_boy": "👨\u200d👨\u200d👦", "family_man_man_boy_boy": "👨\u200d👨\u200d👦\u200d👦", "family_man_man_girl": "👨\u200d👨\u200d👧", "family_man_man_girl_boy": "👨\u200d👨\u200d👧\u200d👦", "family_man_man_girl_girl": "👨\u200d👨\u200d👧\u200d👧", "family_man_woman_boy": "👨\u200d👩\u200d👦", "family_man_woman_boy_boy": "👨\u200d👩\u200d👦\u200d👦", "family_man_woman_girl": "👨\u200d👩\u200d👧", "family_man_woman_girl_boy": "👨\u200d👩\u200d👧\u200d👦", "family_man_woman_girl_girl": "👨\u200d👩\u200d👧\u200d👧", "family_woman_boy": "👩\u200d👦", "family_woman_boy_boy": "👩\u200d👦\u200d👦", "family_woman_girl": "👩\u200d👧", "family_woman_girl_boy": "👩\u200d👧\u200d👦", "family_woman_girl_girl": "👩\u200d👧\u200d👧", "family_woman_woman_boy": "👩\u200d👩\u200d👦", "family_woman_woman_boy_boy": "👩\u200d👩\u200d👦\u200d👦", "family_woman_woman_girl": "👩\u200d👩\u200d👧", "family_woman_woman_girl_boy": "👩\u200d👩\u200d👧\u200d👦", "family_woman_woman_girl_girl": "👩\u200d👩\u200d👧\u200d👧", "fast-forward_button": "⏩", "fast_down_button": "⏬", "fast_reverse_button": "⏪", "fast_up_button": "⏫", "fax_machine": "📠", "fearful_face": "😨", "female_sign": "♀", "ferris_wheel": "🎡", "ferry": "⛴", "field_hockey": "🏑", "file_cabinet": "🗄", "file_folder": "📁", "film_frames": "🎞", "film_projector": "📽", "fire": "🔥", "fire_extinguisher": "🧯", "firecracker": "🧨", "fire_engine": "🚒", "fireworks": "🎆", "first_quarter_moon": "🌓", "first_quarter_moon_face": "🌛", "fish": "🐟", "fish_cake_with_swirl": "🍥", "fishing_pole": "🎣", "five-thirty": "🕠", "five_o’clock": "🕔", "flag_in_hole": "⛳", "flamingo": "🦩", "flashlight": "🔦", "flat_shoe": "🥿", "fleur-de-lis": "⚜", "flexed_biceps": "💪", "flexed_biceps_dark_skin_tone": "💪🏿", "flexed_biceps_light_skin_tone": "💪🏻", "flexed_biceps_medium-dark_skin_tone": "💪🏾", "flexed_biceps_medium-light_skin_tone": "💪🏼", "flexed_biceps_medium_skin_tone": "💪🏽", "floppy_disk": "💾", "flower_playing_cards": "🎴", "flushed_face": "😳", "flying_disc": "🥏", "flying_saucer": "🛸", "fog": "🌫", "foggy": "🌁", "folded_hands": "🙏", "folded_hands_dark_skin_tone": "🙏🏿", "folded_hands_light_skin_tone": "🙏🏻", "folded_hands_medium-dark_skin_tone": "🙏🏾", "folded_hands_medium-light_skin_tone": "🙏🏼", "folded_hands_medium_skin_tone": "🙏🏽", "foot": "🦶", "footprints": "👣", "fork_and_knife": "🍴", "fork_and_knife_with_plate": "🍽", "fortune_cookie": "🥠", "fountain": "⛲", "fountain_pen": "🖋", "four-thirty": "🕟", "four_leaf_clover": "🍀", "four_o’clock": "🕓", "fox_face": "🦊", "framed_picture": "🖼", "french_fries": "🍟", "fried_shrimp": "🍤", "frog_face": "🐸", "front-facing_baby_chick": "🐥", "frowning_face": "☹", "frowning_face_with_open_mouth": "😦", "fuel_pump": "⛽", "full_moon": "🌕", "full_moon_face": "🌝", "funeral_urn": "⚱", "game_die": "🎲", "garlic": "🧄", "gear": "⚙", "gem_stone": "💎", "genie": "🧞", "ghost": "👻", "giraffe": "🦒", "girl": "👧", "girl_dark_skin_tone": "👧🏿", "girl_light_skin_tone": "👧🏻", "girl_medium-dark_skin_tone": "👧🏾", "girl_medium-light_skin_tone": "👧🏼", "girl_medium_skin_tone": "👧🏽", "glass_of_milk": "🥛", "glasses": "👓", "globe_showing_americas": "🌎", "globe_showing_asia-australia": "🌏", "globe_showing_europe-africa": "🌍", "globe_with_meridians": "🌐", "gloves": "🧤", "glowing_star": "🌟", "goal_net": "🥅", "goat": "🐐", "goblin": "👺", "goggles": "🥽", "gorilla": "🦍", "graduation_cap": "🎓", "grapes": "🍇", "green_apple": "🍏", "green_book": "📗", "green_circle": "🟢", "green_heart": "💚", "green_salad": "🥗", "green_square": "🟩", "grimacing_face": "😬", "grinning_cat_face": "😺", "grinning_cat_face_with_smiling_eyes": "😸", "grinning_face": "😀", "grinning_face_with_big_eyes": "😃", "grinning_face_with_smiling_eyes": "😄", "grinning_face_with_sweat": "😅", "grinning_squinting_face": "😆", "growing_heart": "💗", "guard": "💂", "guard_dark_skin_tone": "💂🏿", "guard_light_skin_tone": "💂🏻", "guard_medium-dark_skin_tone": "💂🏾", "guard_medium-light_skin_tone": "💂🏼", "guard_medium_skin_tone": "💂🏽", "guide_dog": "🦮", "guitar": "🎸", "hamburger": "🍔", "hammer": "🔨", "hammer_and_pick": "⚒", "hammer_and_wrench": "🛠", "hamster_face": "🐹", "hand_with_fingers_splayed": "🖐", "hand_with_fingers_splayed_dark_skin_tone": "🖐🏿", "hand_with_fingers_splayed_light_skin_tone": "🖐🏻", "hand_with_fingers_splayed_medium-dark_skin_tone": "🖐🏾", "hand_with_fingers_splayed_medium-light_skin_tone": "🖐🏼", "hand_with_fingers_splayed_medium_skin_tone": "🖐🏽", "handbag": "👜", "handshake": "🤝", "hatching_chick": "🐣", "headphone": "🎧", "hear-no-evil_monkey": "🙉", "heart_decoration": "💟", "heart_suit": "♥", "heart_with_arrow": "💘", "heart_with_ribbon": "💝", "heavy_check_mark": "✔", "heavy_division_sign": "➗", "heavy_dollar_sign": "💲", "heavy_heart_exclamation": "❣", "heavy_large_circle": "⭕", "heavy_minus_sign": "➖", "heavy_multiplication_x": "✖", "heavy_plus_sign": "➕", "hedgehog": "🦔", "helicopter": "🚁", "herb": "🌿", "hibiscus": "🌺", "high-heeled_shoe": "👠", "high-speed_train": "🚄", "high_voltage": "⚡", "hiking_boot": "🥾", "hindu_temple": "🛕", "hippopotamus": "🦛", "hole": "🕳", "honey_pot": "🍯", "honeybee": "🐝", "horizontal_traffic_light": "🚥", "horse": "🐴", "horse_face": "🐴", "horse_racing": "🏇", "horse_racing_dark_skin_tone": "🏇🏿", "horse_racing_light_skin_tone": "🏇🏻", "horse_racing_medium-dark_skin_tone": "🏇🏾", "horse_racing_medium-light_skin_tone": "🏇🏼", "horse_racing_medium_skin_tone": "🏇🏽", "hospital": "🏥", "hot_beverage": "☕", "hot_dog": "🌭", "hot_face": "🥵", "hot_pepper": "🌶", "hot_springs": "♨", "hotel": "🏨", "hourglass_done": "⌛", "hourglass_not_done": "⏳", "house": "🏠", "house_with_garden": "🏡", "houses": "🏘", "hugging_face": "🤗", "hundred_points": "💯", "hushed_face": "😯", "ice": "🧊", "ice_cream": "🍨", "ice_hockey": "🏒", "ice_skate": "⛸", "inbox_tray": "📥", "incoming_envelope": "📨", "index_pointing_up": "☝", "index_pointing_up_dark_skin_tone": "☝🏿", "index_pointing_up_light_skin_tone": "☝🏻", "index_pointing_up_medium-dark_skin_tone": "☝🏾", "index_pointing_up_medium-light_skin_tone": "☝🏼", "index_pointing_up_medium_skin_tone": "☝🏽", "infinity": "♾", "information": "ℹ", "input_latin_letters": "🔤", "input_latin_lowercase": "🔡", "input_latin_uppercase": "🔠", "input_numbers": "🔢", "input_symbols": "🔣", "jack-o-lantern": "🎃", "jeans": "👖", "jigsaw": "🧩", "joker": "🃏", "joystick": "🕹", "kaaba": "🕋", "kangaroo": "🦘", "key": "🔑", "keyboard": "⌨", "keycap_#": "#️⃣", "keycap_": "️⃣", "keycap_0": "0️⃣", "keycap_1": "1️⃣", "keycap_10": "🔟", "keycap_2": "2️⃣", "keycap_3": "3️⃣", "keycap_4": "4️⃣", "keycap_5": "5️⃣", "keycap_6": "6️⃣", "keycap_7": "7️⃣", "keycap_8": "8️⃣", "keycap_9": "9️⃣", "kick_scooter": "🛴", "kimono": "👘", "kiss": "💋", "kiss_man_man": "👨\u200d❤️\u200d💋\u200d👨", "kiss_mark": "💋", "kiss_woman_man": "👩\u200d❤️\u200d💋\u200d👨", "kiss_woman_woman": "👩\u200d❤️\u200d💋\u200d👩", "kissing_cat_face": "😽", "kissing_face": "😗", "kissing_face_with_closed_eyes": "😚", "kissing_face_with_smiling_eyes": "😙", "kitchen_knife": "🔪", "kite": "🪁", "kiwi_fruit": "🥝", "koala": "🐨", "lab_coat": "🥼", "label": "🏷", "lacrosse": "🥍", "lady_beetle": "🐞", "laptop_computer": "💻", "large_blue_diamond": "🔷", "large_orange_diamond": "🔶", "last_quarter_moon": "🌗", "last_quarter_moon_face": "🌜", "last_track_button": "⏮", "latin_cross": "✝", "leaf_fluttering_in_wind": "🍃", "leafy_green": "🥬", "ledger": "📒", "left-facing_fist": "🤛", "left-facing_fist_dark_skin_tone": "🤛🏿", "left-facing_fist_light_skin_tone": "🤛🏻", "left-facing_fist_medium-dark_skin_tone": "🤛🏾", "left-facing_fist_medium-light_skin_tone": "🤛🏼", "left-facing_fist_medium_skin_tone": "🤛🏽", "left-right_arrow": "↔", "left_arrow": "⬅", "left_arrow_curving_right": "↪", "left_luggage": "🛅", "left_speech_bubble": "🗨", "leg": "🦵", "lemon": "🍋", "leopard": "🐆", "level_slider": "🎚", "light_bulb": "💡", "light_rail": "🚈", "link": "🔗", "linked_paperclips": "🖇", "lion_face": "🦁", "lipstick": "💄", "litter_in_bin_sign": "🚮", "lizard": "🦎", "llama": "🦙", "lobster": "🦞", "locked": "🔒", "locked_with_key": "🔐", "locked_with_pen": "🔏", "locomotive": "🚂", "lollipop": "🍭", "lotion_bottle": "🧴", "loudly_crying_face": "😭", "loudspeaker": "📢", "love-you_gesture": "🤟", "love-you_gesture_dark_skin_tone": "🤟🏿", "love-you_gesture_light_skin_tone": "🤟🏻", "love-you_gesture_medium-dark_skin_tone": "🤟🏾", "love-you_gesture_medium-light_skin_tone": "🤟🏼", "love-you_gesture_medium_skin_tone": "🤟🏽", "love_hotel": "🏩", "love_letter": "💌", "luggage": "🧳", "lying_face": "🤥", "mage": "🧙", "mage_dark_skin_tone": "🧙🏿", "mage_light_skin_tone": "🧙🏻", "mage_medium-dark_skin_tone": "🧙🏾", "mage_medium-light_skin_tone": "🧙🏼", "mage_medium_skin_tone": "🧙🏽", "magnet": "🧲", "magnifying_glass_tilted_left": "🔍", "magnifying_glass_tilted_right": "🔎", "mahjong_red_dragon": "🀄", "male_sign": "♂", "man": "👨", "man_and_woman_holding_hands": "👫", "man_artist": "👨\u200d🎨", "man_artist_dark_skin_tone": "👨🏿\u200d🎨", "man_artist_light_skin_tone": "👨🏻\u200d🎨", "man_artist_medium-dark_skin_tone": "👨🏾\u200d🎨", "man_artist_medium-light_skin_tone": "👨🏼\u200d🎨", "man_artist_medium_skin_tone": "👨🏽\u200d🎨", "man_astronaut": "👨\u200d🚀", "man_astronaut_dark_skin_tone": "👨🏿\u200d🚀", "man_astronaut_light_skin_tone": "👨🏻\u200d🚀", "man_astronaut_medium-dark_skin_tone": "👨🏾\u200d🚀", "man_astronaut_medium-light_skin_tone": "👨🏼\u200d🚀", "man_astronaut_medium_skin_tone": "👨🏽\u200d🚀", "man_biking": "🚴\u200d♂️", "man_biking_dark_skin_tone": "🚴🏿\u200d♂️", "man_biking_light_skin_tone": "🚴🏻\u200d♂️", "man_biking_medium-dark_skin_tone": "🚴🏾\u200d♂️", "man_biking_medium-light_skin_tone": "🚴🏼\u200d♂️", "man_biking_medium_skin_tone": "🚴🏽\u200d♂️", "man_bouncing_ball": "⛹️\u200d♂️", "man_bouncing_ball_dark_skin_tone": "⛹🏿\u200d♂️", "man_bouncing_ball_light_skin_tone": "⛹🏻\u200d♂️", "man_bouncing_ball_medium-dark_skin_tone": "⛹🏾\u200d♂️", "man_bouncing_ball_medium-light_skin_tone": "⛹🏼\u200d♂️", "man_bouncing_ball_medium_skin_tone": "⛹🏽\u200d♂️", "man_bowing": "🙇\u200d♂️", "man_bowing_dark_skin_tone": "🙇🏿\u200d♂️", "man_bowing_light_skin_tone": "🙇🏻\u200d♂️", "man_bowing_medium-dark_skin_tone": "🙇🏾\u200d♂️", "man_bowing_medium-light_skin_tone": "🙇🏼\u200d♂️", "man_bowing_medium_skin_tone": "🙇🏽\u200d♂️", "man_cartwheeling": "🤸\u200d♂️", "man_cartwheeling_dark_skin_tone": "🤸🏿\u200d♂️", "man_cartwheeling_light_skin_tone": "🤸🏻\u200d♂️", "man_cartwheeling_medium-dark_skin_tone": "🤸🏾\u200d♂️", "man_cartwheeling_medium-light_skin_tone": "🤸🏼\u200d♂️", "man_cartwheeling_medium_skin_tone": "🤸🏽\u200d♂️", "man_climbing": "🧗\u200d♂️", "man_climbing_dark_skin_tone": "🧗🏿\u200d♂️", "man_climbing_light_skin_tone": "🧗🏻\u200d♂️", "man_climbing_medium-dark_skin_tone": "🧗🏾\u200d♂️", "man_climbing_medium-light_skin_tone": "🧗🏼\u200d♂️", "man_climbing_medium_skin_tone": "🧗🏽\u200d♂️", "man_construction_worker": "👷\u200d♂️", "man_construction_worker_dark_skin_tone": "👷🏿\u200d♂️", "man_construction_worker_light_skin_tone": "👷🏻\u200d♂️", "man_construction_worker_medium-dark_skin_tone": "👷🏾\u200d♂️", "man_construction_worker_medium-light_skin_tone": "👷🏼\u200d♂️", "man_construction_worker_medium_skin_tone": "👷🏽\u200d♂️", "man_cook": "👨\u200d🍳", "man_cook_dark_skin_tone": "👨🏿\u200d🍳", "man_cook_light_skin_tone": "👨🏻\u200d🍳", "man_cook_medium-dark_skin_tone": "👨🏾\u200d🍳", "man_cook_medium-light_skin_tone": "👨🏼\u200d🍳", "man_cook_medium_skin_tone": "👨🏽\u200d🍳", "man_dancing": "🕺", "man_dancing_dark_skin_tone": "🕺🏿", "man_dancing_light_skin_tone": "🕺🏻", "man_dancing_medium-dark_skin_tone": "🕺🏾", "man_dancing_medium-light_skin_tone": "🕺🏼", "man_dancing_medium_skin_tone": "🕺🏽", "man_dark_skin_tone": "👨🏿", "man_detective": "🕵️\u200d♂️", "man_detective_dark_skin_tone": "🕵🏿\u200d♂️", "man_detective_light_skin_tone": "🕵🏻\u200d♂️", "man_detective_medium-dark_skin_tone": "🕵🏾\u200d♂️", "man_detective_medium-light_skin_tone": "🕵🏼\u200d♂️", "man_detective_medium_skin_tone": "🕵🏽\u200d♂️", "man_elf": "🧝\u200d♂️", "man_elf_dark_skin_tone": "🧝🏿\u200d♂️", "man_elf_light_skin_tone": "🧝🏻\u200d♂️", "man_elf_medium-dark_skin_tone": "🧝🏾\u200d♂️", "man_elf_medium-light_skin_tone": "🧝🏼\u200d♂️", "man_elf_medium_skin_tone": "🧝🏽\u200d♂️", "man_facepalming": "🤦\u200d♂️", "man_facepalming_dark_skin_tone": "🤦🏿\u200d♂️", "man_facepalming_light_skin_tone": "🤦🏻\u200d♂️", "man_facepalming_medium-dark_skin_tone": "🤦🏾\u200d♂️", "man_facepalming_medium-light_skin_tone": "🤦🏼\u200d♂️", "man_facepalming_medium_skin_tone": "🤦🏽\u200d♂️", "man_factory_worker": "👨\u200d🏭", "man_factory_worker_dark_skin_tone": "👨🏿\u200d🏭", "man_factory_worker_light_skin_tone": "👨🏻\u200d🏭", "man_factory_worker_medium-dark_skin_tone": "👨🏾\u200d🏭", "man_factory_worker_medium-light_skin_tone": "👨🏼\u200d🏭", "man_factory_worker_medium_skin_tone": "👨🏽\u200d🏭", "man_fairy": "🧚\u200d♂️", "man_fairy_dark_skin_tone": "🧚🏿\u200d♂️", "man_fairy_light_skin_tone": "🧚🏻\u200d♂️", "man_fairy_medium-dark_skin_tone": "🧚🏾\u200d♂️", "man_fairy_medium-light_skin_tone": "🧚🏼\u200d♂️", "man_fairy_medium_skin_tone": "🧚🏽\u200d♂️", "man_farmer": "👨\u200d🌾", "man_farmer_dark_skin_tone": "👨🏿\u200d🌾", "man_farmer_light_skin_tone": "👨🏻\u200d🌾", "man_farmer_medium-dark_skin_tone": "👨🏾\u200d🌾", "man_farmer_medium-light_skin_tone": "👨🏼\u200d🌾", "man_farmer_medium_skin_tone": "👨🏽\u200d🌾", "man_firefighter": "👨\u200d🚒", "man_firefighter_dark_skin_tone": "👨🏿\u200d🚒", "man_firefighter_light_skin_tone": "👨🏻\u200d🚒", "man_firefighter_medium-dark_skin_tone": "👨🏾\u200d🚒", "man_firefighter_medium-light_skin_tone": "👨🏼\u200d🚒", "man_firefighter_medium_skin_tone": "👨🏽\u200d🚒", "man_frowning": "🙍\u200d♂️", "man_frowning_dark_skin_tone": "🙍🏿\u200d♂️", "man_frowning_light_skin_tone": "🙍🏻\u200d♂️", "man_frowning_medium-dark_skin_tone": "🙍🏾\u200d♂️", "man_frowning_medium-light_skin_tone": "🙍🏼\u200d♂️", "man_frowning_medium_skin_tone": "🙍🏽\u200d♂️", "man_genie": "🧞\u200d♂️", "man_gesturing_no": "🙅\u200d♂️", "man_gesturing_no_dark_skin_tone": "🙅🏿\u200d♂️", "man_gesturing_no_light_skin_tone": "🙅🏻\u200d♂️", "man_gesturing_no_medium-dark_skin_tone": "🙅🏾\u200d♂️", "man_gesturing_no_medium-light_skin_tone": "🙅🏼\u200d♂️", "man_gesturing_no_medium_skin_tone": "🙅🏽\u200d♂️", "man_gesturing_ok": "🙆\u200d♂️", "man_gesturing_ok_dark_skin_tone": "🙆🏿\u200d♂️", "man_gesturing_ok_light_skin_tone": "🙆🏻\u200d♂️", "man_gesturing_ok_medium-dark_skin_tone": "🙆🏾\u200d♂️", "man_gesturing_ok_medium-light_skin_tone": "🙆🏼\u200d♂️", "man_gesturing_ok_medium_skin_tone": "🙆🏽\u200d♂️", "man_getting_haircut": "💇\u200d♂️", "man_getting_haircut_dark_skin_tone": "💇🏿\u200d♂️", "man_getting_haircut_light_skin_tone": "💇🏻\u200d♂️", "man_getting_haircut_medium-dark_skin_tone": "💇🏾\u200d♂️", "man_getting_haircut_medium-light_skin_tone": "💇🏼\u200d♂️", "man_getting_haircut_medium_skin_tone": "💇🏽\u200d♂️", "man_getting_massage": "💆\u200d♂️", "man_getting_massage_dark_skin_tone": "💆🏿\u200d♂️", "man_getting_massage_light_skin_tone": "💆🏻\u200d♂️", "man_getting_massage_medium-dark_skin_tone": "💆🏾\u200d♂️", "man_getting_massage_medium-light_skin_tone": "💆🏼\u200d♂️", "man_getting_massage_medium_skin_tone": "💆🏽\u200d♂️", "man_golfing": "🏌️\u200d♂️", "man_golfing_dark_skin_tone": "🏌🏿\u200d♂️", "man_golfing_light_skin_tone": "🏌🏻\u200d♂️", "man_golfing_medium-dark_skin_tone": "🏌🏾\u200d♂️", "man_golfing_medium-light_skin_tone": "🏌🏼\u200d♂️", "man_golfing_medium_skin_tone": "🏌🏽\u200d♂️", "man_guard": "💂\u200d♂️", "man_guard_dark_skin_tone": "💂🏿\u200d♂️", "man_guard_light_skin_tone": "💂🏻\u200d♂️", "man_guard_medium-dark_skin_tone": "💂🏾\u200d♂️", "man_guard_medium-light_skin_tone": "💂🏼\u200d♂️", "man_guard_medium_skin_tone": "💂🏽\u200d♂️", "man_health_worker": "👨\u200d⚕️", "man_health_worker_dark_skin_tone": "👨🏿\u200d⚕️", "man_health_worker_light_skin_tone": "👨🏻\u200d⚕️", "man_health_worker_medium-dark_skin_tone": "👨🏾\u200d⚕️", "man_health_worker_medium-light_skin_tone": "👨🏼\u200d⚕️", "man_health_worker_medium_skin_tone": "👨🏽\u200d⚕️", "man_in_lotus_position": "🧘\u200d♂️", "man_in_lotus_position_dark_skin_tone": "🧘🏿\u200d♂️", "man_in_lotus_position_light_skin_tone": "🧘🏻\u200d♂️", "man_in_lotus_position_medium-dark_skin_tone": "🧘🏾\u200d♂️", "man_in_lotus_position_medium-light_skin_tone": "🧘🏼\u200d♂️", "man_in_lotus_position_medium_skin_tone": "🧘🏽\u200d♂️", "man_in_manual_wheelchair": "👨\u200d🦽", "man_in_motorized_wheelchair": "👨\u200d🦼", "man_in_steamy_room": "🧖\u200d♂️", "man_in_steamy_room_dark_skin_tone": "🧖🏿\u200d♂️", "man_in_steamy_room_light_skin_tone": "🧖🏻\u200d♂️", "man_in_steamy_room_medium-dark_skin_tone": "🧖🏾\u200d♂️", "man_in_steamy_room_medium-light_skin_tone": "🧖🏼\u200d♂️", "man_in_steamy_room_medium_skin_tone": "🧖🏽\u200d♂️", "man_in_suit_levitating": "🕴", "man_in_suit_levitating_dark_skin_tone": "🕴🏿", "man_in_suit_levitating_light_skin_tone": "🕴🏻", "man_in_suit_levitating_medium-dark_skin_tone": "🕴🏾", "man_in_suit_levitating_medium-light_skin_tone": "🕴🏼", "man_in_suit_levitating_medium_skin_tone": "🕴🏽", "man_in_tuxedo": "🤵", "man_in_tuxedo_dark_skin_tone": "🤵🏿", "man_in_tuxedo_light_skin_tone": "🤵🏻", "man_in_tuxedo_medium-dark_skin_tone": "🤵🏾", "man_in_tuxedo_medium-light_skin_tone": "🤵🏼", "man_in_tuxedo_medium_skin_tone": "🤵🏽", "man_judge": "👨\u200d⚖️", "man_judge_dark_skin_tone": "👨🏿\u200d⚖️", "man_judge_light_skin_tone": "👨🏻\u200d⚖️", "man_judge_medium-dark_skin_tone": "👨🏾\u200d⚖️", "man_judge_medium-light_skin_tone": "👨🏼\u200d⚖️", "man_judge_medium_skin_tone": "👨🏽\u200d⚖️", "man_juggling": "🤹\u200d♂️", "man_juggling_dark_skin_tone": "🤹🏿\u200d♂️", "man_juggling_light_skin_tone": "🤹🏻\u200d♂️", "man_juggling_medium-dark_skin_tone": "🤹🏾\u200d♂️", "man_juggling_medium-light_skin_tone": "🤹🏼\u200d♂️", "man_juggling_medium_skin_tone": "🤹🏽\u200d♂️", "man_lifting_weights": "🏋️\u200d♂️", "man_lifting_weights_dark_skin_tone": "🏋🏿\u200d♂️", "man_lifting_weights_light_skin_tone": "🏋🏻\u200d♂️", "man_lifting_weights_medium-dark_skin_tone": "🏋🏾\u200d♂️", "man_lifting_weights_medium-light_skin_tone": "🏋🏼\u200d♂️", "man_lifting_weights_medium_skin_tone": "🏋🏽\u200d♂️", "man_light_skin_tone": "👨🏻", "man_mage": "🧙\u200d♂️", "man_mage_dark_skin_tone": "🧙🏿\u200d♂️", "man_mage_light_skin_tone": "🧙🏻\u200d♂️", "man_mage_medium-dark_skin_tone": "🧙🏾\u200d♂️", "man_mage_medium-light_skin_tone": "🧙🏼\u200d♂️", "man_mage_medium_skin_tone": "🧙🏽\u200d♂️", "man_mechanic": "👨\u200d🔧", "man_mechanic_dark_skin_tone": "👨🏿\u200d🔧", "man_mechanic_light_skin_tone": "👨🏻\u200d🔧", "man_mechanic_medium-dark_skin_tone": "👨🏾\u200d🔧", "man_mechanic_medium-light_skin_tone": "👨🏼\u200d🔧", "man_mechanic_medium_skin_tone": "👨🏽\u200d🔧", "man_medium-dark_skin_tone": "👨🏾", "man_medium-light_skin_tone": "👨🏼", "man_medium_skin_tone": "👨🏽", "man_mountain_biking": "🚵\u200d♂️", "man_mountain_biking_dark_skin_tone": "🚵🏿\u200d♂️", "man_mountain_biking_light_skin_tone": "🚵🏻\u200d♂️", "man_mountain_biking_medium-dark_skin_tone": "🚵🏾\u200d♂️", "man_mountain_biking_medium-light_skin_tone": "🚵🏼\u200d♂️", "man_mountain_biking_medium_skin_tone": "🚵🏽\u200d♂️", "man_office_worker": "👨\u200d💼", "man_office_worker_dark_skin_tone": "👨🏿\u200d💼", "man_office_worker_light_skin_tone": "👨🏻\u200d💼", "man_office_worker_medium-dark_skin_tone": "👨🏾\u200d💼", "man_office_worker_medium-light_skin_tone": "👨🏼\u200d💼", "man_office_worker_medium_skin_tone": "👨🏽\u200d💼", "man_pilot": "👨\u200d✈️", "man_pilot_dark_skin_tone": "👨🏿\u200d✈️", "man_pilot_light_skin_tone": "👨🏻\u200d✈️", "man_pilot_medium-dark_skin_tone": "👨🏾\u200d✈️", "man_pilot_medium-light_skin_tone": "👨🏼\u200d✈️", "man_pilot_medium_skin_tone": "👨🏽\u200d✈️", "man_playing_handball": "🤾\u200d♂️", "man_playing_handball_dark_skin_tone": "🤾🏿\u200d♂️", "man_playing_handball_light_skin_tone": "🤾🏻\u200d♂️", "man_playing_handball_medium-dark_skin_tone": "🤾🏾\u200d♂️", "man_playing_handball_medium-light_skin_tone": "🤾🏼\u200d♂️", "man_playing_handball_medium_skin_tone": "🤾🏽\u200d♂️", "man_playing_water_polo": "🤽\u200d♂️", "man_playing_water_polo_dark_skin_tone": "🤽🏿\u200d♂️", "man_playing_water_polo_light_skin_tone": "🤽🏻\u200d♂️", "man_playing_water_polo_medium-dark_skin_tone": "🤽🏾\u200d♂️", "man_playing_water_polo_medium-light_skin_tone": "🤽🏼\u200d♂️", "man_playing_water_polo_medium_skin_tone": "🤽🏽\u200d♂️", "man_police_officer": "👮\u200d♂️", "man_police_officer_dark_skin_tone": "👮🏿\u200d♂️", "man_police_officer_light_skin_tone": "👮🏻\u200d♂️", "man_police_officer_medium-dark_skin_tone": "👮🏾\u200d♂️", "man_police_officer_medium-light_skin_tone": "👮🏼\u200d♂️", "man_police_officer_medium_skin_tone": "👮🏽\u200d♂️", "man_pouting": "🙎\u200d♂️", "man_pouting_dark_skin_tone": "🙎🏿\u200d♂️", "man_pouting_light_skin_tone": "🙎🏻\u200d♂️", "man_pouting_medium-dark_skin_tone": "🙎🏾\u200d♂️", "man_pouting_medium-light_skin_tone": "🙎🏼\u200d♂️", "man_pouting_medium_skin_tone": "🙎🏽\u200d♂️", "man_raising_hand": "🙋\u200d♂️", "man_raising_hand_dark_skin_tone": "🙋🏿\u200d♂️", "man_raising_hand_light_skin_tone": "🙋🏻\u200d♂️", "man_raising_hand_medium-dark_skin_tone": "🙋🏾\u200d♂️", "man_raising_hand_medium-light_skin_tone": "🙋🏼\u200d♂️", "man_raising_hand_medium_skin_tone": "🙋🏽\u200d♂️", "man_rowing_boat": "🚣\u200d♂️", "man_rowing_boat_dark_skin_tone": "🚣🏿\u200d♂️", "man_rowing_boat_light_skin_tone": "🚣🏻\u200d♂️", "man_rowing_boat_medium-dark_skin_tone": "🚣🏾\u200d♂️", "man_rowing_boat_medium-light_skin_tone": "🚣🏼\u200d♂️", "man_rowing_boat_medium_skin_tone": "🚣🏽\u200d♂️", "man_running": "🏃\u200d♂️", "man_running_dark_skin_tone": "🏃🏿\u200d♂️", "man_running_light_skin_tone": "🏃🏻\u200d♂️", "man_running_medium-dark_skin_tone": "🏃🏾\u200d♂️", "man_running_medium-light_skin_tone": "🏃🏼\u200d♂️", "man_running_medium_skin_tone": "🏃🏽\u200d♂️", "man_scientist": "👨\u200d🔬", "man_scientist_dark_skin_tone": "👨🏿\u200d🔬", "man_scientist_light_skin_tone": "👨🏻\u200d🔬", "man_scientist_medium-dark_skin_tone": "👨🏾\u200d🔬", "man_scientist_medium-light_skin_tone": "👨🏼\u200d🔬", "man_scientist_medium_skin_tone": "👨🏽\u200d🔬", "man_shrugging": "🤷\u200d♂️", "man_shrugging_dark_skin_tone": "🤷🏿\u200d♂️", "man_shrugging_light_skin_tone": "🤷🏻\u200d♂️", "man_shrugging_medium-dark_skin_tone": "🤷🏾\u200d♂️", "man_shrugging_medium-light_skin_tone": "🤷🏼\u200d♂️", "man_shrugging_medium_skin_tone": "🤷🏽\u200d♂️", "man_singer": "👨\u200d🎤", "man_singer_dark_skin_tone": "👨🏿\u200d🎤", "man_singer_light_skin_tone": "👨🏻\u200d🎤", "man_singer_medium-dark_skin_tone": "👨🏾\u200d🎤", "man_singer_medium-light_skin_tone": "👨🏼\u200d🎤", "man_singer_medium_skin_tone": "👨🏽\u200d🎤", "man_student": "👨\u200d🎓", "man_student_dark_skin_tone": "👨🏿\u200d🎓", "man_student_light_skin_tone": "👨🏻\u200d🎓", "man_student_medium-dark_skin_tone": "👨🏾\u200d🎓", "man_student_medium-light_skin_tone": "👨🏼\u200d🎓", "man_student_medium_skin_tone": "👨🏽\u200d🎓", "man_surfing": "🏄\u200d♂️", "man_surfing_dark_skin_tone": "🏄🏿\u200d♂️", "man_surfing_light_skin_tone": "🏄🏻\u200d♂️", "man_surfing_medium-dark_skin_tone": "🏄🏾\u200d♂️", "man_surfing_medium-light_skin_tone": "🏄🏼\u200d♂️", "man_surfing_medium_skin_tone": "🏄🏽\u200d♂️", "man_swimming": "🏊\u200d♂️", "man_swimming_dark_skin_tone": "🏊🏿\u200d♂️", "man_swimming_light_skin_tone": "🏊🏻\u200d♂️", "man_swimming_medium-dark_skin_tone": "🏊🏾\u200d♂️", "man_swimming_medium-light_skin_tone": "🏊🏼\u200d♂️", "man_swimming_medium_skin_tone": "🏊🏽\u200d♂️", "man_teacher": "👨\u200d🏫", "man_teacher_dark_skin_tone": "👨🏿\u200d🏫", "man_teacher_light_skin_tone": "👨🏻\u200d🏫", "man_teacher_medium-dark_skin_tone": "👨🏾\u200d🏫", "man_teacher_medium-light_skin_tone": "👨🏼\u200d🏫", "man_teacher_medium_skin_tone": "👨🏽\u200d🏫", "man_technologist": "👨\u200d💻", "man_technologist_dark_skin_tone": "👨🏿\u200d💻", "man_technologist_light_skin_tone": "👨🏻\u200d💻", "man_technologist_medium-dark_skin_tone": "👨🏾\u200d💻", "man_technologist_medium-light_skin_tone": "👨🏼\u200d💻", "man_technologist_medium_skin_tone": "👨🏽\u200d💻", "man_tipping_hand": "💁\u200d♂️", "man_tipping_hand_dark_skin_tone": "💁🏿\u200d♂️", "man_tipping_hand_light_skin_tone": "💁🏻\u200d♂️", "man_tipping_hand_medium-dark_skin_tone": "💁🏾\u200d♂️", "man_tipping_hand_medium-light_skin_tone": "💁🏼\u200d♂️", "man_tipping_hand_medium_skin_tone": "💁🏽\u200d♂️", "man_vampire": "🧛\u200d♂️", "man_vampire_dark_skin_tone": "🧛🏿\u200d♂️", "man_vampire_light_skin_tone": "🧛🏻\u200d♂️", "man_vampire_medium-dark_skin_tone": "🧛🏾\u200d♂️", "man_vampire_medium-light_skin_tone": "🧛🏼\u200d♂️", "man_vampire_medium_skin_tone": "🧛🏽\u200d♂️", "man_walking": "🚶\u200d♂️", "man_walking_dark_skin_tone": "🚶🏿\u200d♂️", "man_walking_light_skin_tone": "🚶🏻\u200d♂️", "man_walking_medium-dark_skin_tone": "🚶🏾\u200d♂️", "man_walking_medium-light_skin_tone": "🚶🏼\u200d♂️", "man_walking_medium_skin_tone": "🚶🏽\u200d♂️", "man_wearing_turban": "👳\u200d♂️", "man_wearing_turban_dark_skin_tone": "👳🏿\u200d♂️", "man_wearing_turban_light_skin_tone": "👳🏻\u200d♂️", "man_wearing_turban_medium-dark_skin_tone": "👳🏾\u200d♂️", "man_wearing_turban_medium-light_skin_tone": "👳🏼\u200d♂️", "man_wearing_turban_medium_skin_tone": "👳🏽\u200d♂️", "man_with_probing_cane": "👨\u200d🦯", "man_with_chinese_cap": "👲", "man_with_chinese_cap_dark_skin_tone": "👲🏿", "man_with_chinese_cap_light_skin_tone": "👲🏻", "man_with_chinese_cap_medium-dark_skin_tone": "👲🏾", "man_with_chinese_cap_medium-light_skin_tone": "👲🏼", "man_with_chinese_cap_medium_skin_tone": "👲🏽", "man_zombie": "🧟\u200d♂️", "mango": "🥭", "mantelpiece_clock": "🕰", "manual_wheelchair": "🦽", "man’s_shoe": "👞", "map_of_japan": "🗾", "maple_leaf": "🍁", "martial_arts_uniform": "🥋", "mate": "🧉", "meat_on_bone": "🍖", "mechanical_arm": "🦾", "mechanical_leg": "🦿", "medical_symbol": "⚕", "megaphone": "📣", "melon": "🍈", "memo": "📝", "men_with_bunny_ears": "👯\u200d♂️", "men_wrestling": "🤼\u200d♂️", "menorah": "🕎", "men’s_room": "🚹", "mermaid": "🧜\u200d♀️", "mermaid_dark_skin_tone": "🧜🏿\u200d♀️", "mermaid_light_skin_tone": "🧜🏻\u200d♀️", "mermaid_medium-dark_skin_tone": "🧜🏾\u200d♀️", "mermaid_medium-light_skin_tone": "🧜🏼\u200d♀️", "mermaid_medium_skin_tone": "🧜🏽\u200d♀️", "merman": "🧜\u200d♂️", "merman_dark_skin_tone": "🧜🏿\u200d♂️", "merman_light_skin_tone": "🧜🏻\u200d♂️", "merman_medium-dark_skin_tone": "🧜🏾\u200d♂️", "merman_medium-light_skin_tone": "🧜🏼\u200d♂️", "merman_medium_skin_tone": "🧜🏽\u200d♂️", "merperson": "🧜", "merperson_dark_skin_tone": "🧜🏿", "merperson_light_skin_tone": "🧜🏻", "merperson_medium-dark_skin_tone": "🧜🏾", "merperson_medium-light_skin_tone": "🧜🏼", "merperson_medium_skin_tone": "🧜🏽", "metro": "🚇", "microbe": "🦠", "microphone": "🎤", "microscope": "🔬", "middle_finger": "🖕", "middle_finger_dark_skin_tone": "🖕🏿", "middle_finger_light_skin_tone": "🖕🏻", "middle_finger_medium-dark_skin_tone": "🖕🏾", "middle_finger_medium-light_skin_tone": "🖕🏼", "middle_finger_medium_skin_tone": "🖕🏽", "military_medal": "🎖", "milky_way": "🌌", "minibus": "🚐", "moai": "🗿", "mobile_phone": "📱", "mobile_phone_off": "📴", "mobile_phone_with_arrow": "📲", "money-mouth_face": "🤑", "money_bag": "💰", "money_with_wings": "💸", "monkey": "🐒", "monkey_face": "🐵", "monorail": "🚝", "moon_cake": "🥮", "moon_viewing_ceremony": "🎑", "mosque": "🕌", "mosquito": "🦟", "motor_boat": "🛥", "motor_scooter": "🛵", "motorcycle": "🏍", "motorized_wheelchair": "🦼", "motorway": "🛣", "mount_fuji": "🗻", "mountain": "⛰", "mountain_cableway": "🚠", "mountain_railway": "🚞", "mouse": "🐭", "mouse_face": "🐭", "mouth": "👄", "movie_camera": "🎥", "mushroom": "🍄", "musical_keyboard": "🎹", "musical_note": "🎵", "musical_notes": "🎶", "musical_score": "🎼", "muted_speaker": "🔇", "nail_polish": "💅", "nail_polish_dark_skin_tone": "💅🏿", "nail_polish_light_skin_tone": "💅🏻", "nail_polish_medium-dark_skin_tone": "💅🏾", "nail_polish_medium-light_skin_tone": "💅🏼", "nail_polish_medium_skin_tone": "💅🏽", "name_badge": "📛", "national_park": "🏞", "nauseated_face": "🤢", "nazar_amulet": "🧿", "necktie": "👔", "nerd_face": "🤓", "neutral_face": "😐", "new_moon": "🌑", "new_moon_face": "🌚", "newspaper": "📰", "next_track_button": "⏭", "night_with_stars": "🌃", "nine-thirty": "🕤", "nine_o’clock": "🕘", "no_bicycles": "🚳", "no_entry": "⛔", "no_littering": "🚯", "no_mobile_phones": "📵", "no_one_under_eighteen": "🔞", "no_pedestrians": "🚷", "no_smoking": "🚭", "non-potable_water": "🚱", "nose": "👃", "nose_dark_skin_tone": "👃🏿", "nose_light_skin_tone": "👃🏻", "nose_medium-dark_skin_tone": "👃🏾", "nose_medium-light_skin_tone": "👃🏼", "nose_medium_skin_tone": "👃🏽", "notebook": "📓", "notebook_with_decorative_cover": "📔", "nut_and_bolt": "🔩", "octopus": "🐙", "oden": "🍢", "office_building": "🏢", "ogre": "👹", "oil_drum": "🛢", "old_key": "🗝", "old_man": "👴", "old_man_dark_skin_tone": "👴🏿", "old_man_light_skin_tone": "👴🏻", "old_man_medium-dark_skin_tone": "👴🏾", "old_man_medium-light_skin_tone": "👴🏼", "old_man_medium_skin_tone": "👴🏽", "old_woman": "👵", "old_woman_dark_skin_tone": "👵🏿", "old_woman_light_skin_tone": "👵🏻", "old_woman_medium-dark_skin_tone": "👵🏾", "old_woman_medium-light_skin_tone": "👵🏼", "old_woman_medium_skin_tone": "👵🏽", "older_adult": "🧓", "older_adult_dark_skin_tone": "🧓🏿", "older_adult_light_skin_tone": "🧓🏻", "older_adult_medium-dark_skin_tone": "🧓🏾", "older_adult_medium-light_skin_tone": "🧓🏼", "older_adult_medium_skin_tone": "🧓🏽", "om": "🕉", "oncoming_automobile": "🚘", "oncoming_bus": "🚍", "oncoming_fist": "👊", "oncoming_fist_dark_skin_tone": "👊🏿", "oncoming_fist_light_skin_tone": "👊🏻", "oncoming_fist_medium-dark_skin_tone": "👊🏾", "oncoming_fist_medium-light_skin_tone": "👊🏼", "oncoming_fist_medium_skin_tone": "👊🏽", "oncoming_police_car": "🚔", "oncoming_taxi": "🚖", "one-piece_swimsuit": "🩱", "one-thirty": "🕜", "one_o’clock": "🕐", "onion": "🧅", "open_book": "📖", "open_file_folder": "📂", "open_hands": "👐", "open_hands_dark_skin_tone": "👐🏿", "open_hands_light_skin_tone": "👐🏻", "open_hands_medium-dark_skin_tone": "👐🏾", "open_hands_medium-light_skin_tone": "👐🏼", "open_hands_medium_skin_tone": "👐🏽", "open_mailbox_with_lowered_flag": "📭", "open_mailbox_with_raised_flag": "📬", "optical_disk": "💿", "orange_book": "📙", "orange_circle": "🟠", "orange_heart": "🧡", "orange_square": "🟧", "orangutan": "🦧", "orthodox_cross": "☦", "otter": "🦦", "outbox_tray": "📤", "owl": "🦉", "ox": "🐂", "oyster": "🦪", "package": "📦", "page_facing_up": "📄", "page_with_curl": "📃", "pager": "📟", "paintbrush": "🖌", "palm_tree": "🌴", "palms_up_together": "🤲", "palms_up_together_dark_skin_tone": "🤲🏿", "palms_up_together_light_skin_tone": "🤲🏻", "palms_up_together_medium-dark_skin_tone": "🤲🏾", "palms_up_together_medium-light_skin_tone": "🤲🏼", "palms_up_together_medium_skin_tone": "🤲🏽", "pancakes": "🥞", "panda_face": "🐼", "paperclip": "📎", "parrot": "🦜", "part_alternation_mark": "〽", "party_popper": "🎉", "partying_face": "🥳", "passenger_ship": "🛳", "passport_control": "🛂", "pause_button": "⏸", "paw_prints": "🐾", "peace_symbol": "☮", "peach": "🍑", "peacock": "🦚", "peanuts": "🥜", "pear": "🍐", "pen": "🖊", "pencil": "📝", "penguin": "🐧", "pensive_face": "😔", "people_holding_hands": "🧑\u200d🤝\u200d🧑", "people_with_bunny_ears": "👯", "people_wrestling": "🤼", "performing_arts": "🎭", "persevering_face": "😣", "person_biking": "🚴", "person_biking_dark_skin_tone": "🚴🏿", "person_biking_light_skin_tone": "🚴🏻", "person_biking_medium-dark_skin_tone": "🚴🏾", "person_biking_medium-light_skin_tone": "🚴🏼", "person_biking_medium_skin_tone": "🚴🏽", "person_bouncing_ball": "⛹", "person_bouncing_ball_dark_skin_tone": "⛹🏿", "person_bouncing_ball_light_skin_tone": "⛹🏻", "person_bouncing_ball_medium-dark_skin_tone": "⛹🏾", "person_bouncing_ball_medium-light_skin_tone": "⛹🏼", "person_bouncing_ball_medium_skin_tone": "⛹🏽", "person_bowing": "🙇", "person_bowing_dark_skin_tone": "🙇🏿", "person_bowing_light_skin_tone": "🙇🏻", "person_bowing_medium-dark_skin_tone": "🙇🏾", "person_bowing_medium-light_skin_tone": "🙇🏼", "person_bowing_medium_skin_tone": "🙇🏽", "person_cartwheeling": "🤸", "person_cartwheeling_dark_skin_tone": "🤸🏿", "person_cartwheeling_light_skin_tone": "🤸🏻", "person_cartwheeling_medium-dark_skin_tone": "🤸🏾", "person_cartwheeling_medium-light_skin_tone": "🤸🏼", "person_cartwheeling_medium_skin_tone": "🤸🏽", "person_climbing": "🧗", "person_climbing_dark_skin_tone": "🧗🏿", "person_climbing_light_skin_tone": "🧗🏻", "person_climbing_medium-dark_skin_tone": "🧗🏾", "person_climbing_medium-light_skin_tone": "🧗🏼", "person_climbing_medium_skin_tone": "🧗🏽", "person_facepalming": "🤦", "person_facepalming_dark_skin_tone": "🤦🏿", "person_facepalming_light_skin_tone": "🤦🏻", "person_facepalming_medium-dark_skin_tone": "🤦🏾", "person_facepalming_medium-light_skin_tone": "🤦🏼", "person_facepalming_medium_skin_tone": "🤦🏽", "person_fencing": "🤺", "person_frowning": "🙍", "person_frowning_dark_skin_tone": "🙍🏿", "person_frowning_light_skin_tone": "🙍🏻", "person_frowning_medium-dark_skin_tone": "🙍🏾", "person_frowning_medium-light_skin_tone": "🙍🏼", "person_frowning_medium_skin_tone": "🙍🏽", "person_gesturing_no": "🙅", "person_gesturing_no_dark_skin_tone": "🙅🏿", "person_gesturing_no_light_skin_tone": "🙅🏻", "person_gesturing_no_medium-dark_skin_tone": "🙅🏾", "person_gesturing_no_medium-light_skin_tone": "🙅🏼", "person_gesturing_no_medium_skin_tone": "🙅🏽", "person_gesturing_ok": "🙆", "person_gesturing_ok_dark_skin_tone": "🙆🏿", "person_gesturing_ok_light_skin_tone": "🙆🏻", "person_gesturing_ok_medium-dark_skin_tone": "🙆🏾", "person_gesturing_ok_medium-light_skin_tone": "🙆🏼", "person_gesturing_ok_medium_skin_tone": "🙆🏽", "person_getting_haircut": "💇", "person_getting_haircut_dark_skin_tone": "💇🏿", "person_getting_haircut_light_skin_tone": "💇🏻", "person_getting_haircut_medium-dark_skin_tone": "💇🏾", "person_getting_haircut_medium-light_skin_tone": "💇🏼", "person_getting_haircut_medium_skin_tone": "💇🏽", "person_getting_massage": "💆", "person_getting_massage_dark_skin_tone": "💆🏿", "person_getting_massage_light_skin_tone": "💆🏻", "person_getting_massage_medium-dark_skin_tone": "💆🏾", "person_getting_massage_medium-light_skin_tone": "💆🏼", "person_getting_massage_medium_skin_tone": "💆🏽", "person_golfing": "🏌", "person_golfing_dark_skin_tone": "🏌🏿", "person_golfing_light_skin_tone": "🏌🏻", "person_golfing_medium-dark_skin_tone": "🏌🏾", "person_golfing_medium-light_skin_tone": "🏌🏼", "person_golfing_medium_skin_tone": "🏌🏽", "person_in_bed": "🛌", "person_in_bed_dark_skin_tone": "🛌🏿", "person_in_bed_light_skin_tone": "🛌🏻", "person_in_bed_medium-dark_skin_tone": "🛌🏾", "person_in_bed_medium-light_skin_tone": "🛌🏼", "person_in_bed_medium_skin_tone": "🛌🏽", "person_in_lotus_position": "🧘", "person_in_lotus_position_dark_skin_tone": "🧘🏿", "person_in_lotus_position_light_skin_tone": "🧘🏻", "person_in_lotus_position_medium-dark_skin_tone": "🧘🏾", "person_in_lotus_position_medium-light_skin_tone": "🧘🏼", "person_in_lotus_position_medium_skin_tone": "🧘🏽", "person_in_steamy_room": "🧖", "person_in_steamy_room_dark_skin_tone": "🧖🏿", "person_in_steamy_room_light_skin_tone": "🧖🏻", "person_in_steamy_room_medium-dark_skin_tone": "🧖🏾", "person_in_steamy_room_medium-light_skin_tone": "🧖🏼", "person_in_steamy_room_medium_skin_tone": "🧖🏽", "person_juggling": "🤹", "person_juggling_dark_skin_tone": "🤹🏿", "person_juggling_light_skin_tone": "🤹🏻", "person_juggling_medium-dark_skin_tone": "🤹🏾", "person_juggling_medium-light_skin_tone": "🤹🏼", "person_juggling_medium_skin_tone": "🤹🏽", "person_kneeling": "🧎", "person_lifting_weights": "🏋", "person_lifting_weights_dark_skin_tone": "🏋🏿", "person_lifting_weights_light_skin_tone": "🏋🏻", "person_lifting_weights_medium-dark_skin_tone": "🏋🏾", "person_lifting_weights_medium-light_skin_tone": "🏋🏼", "person_lifting_weights_medium_skin_tone": "🏋🏽", "person_mountain_biking": "🚵", "person_mountain_biking_dark_skin_tone": "🚵🏿", "person_mountain_biking_light_skin_tone": "🚵🏻", "person_mountain_biking_medium-dark_skin_tone": "🚵🏾", "person_mountain_biking_medium-light_skin_tone": "🚵🏼", "person_mountain_biking_medium_skin_tone": "🚵🏽", "person_playing_handball": "🤾", "person_playing_handball_dark_skin_tone": "🤾🏿", "person_playing_handball_light_skin_tone": "🤾🏻", "person_playing_handball_medium-dark_skin_tone": "🤾🏾", "person_playing_handball_medium-light_skin_tone": "🤾🏼", "person_playing_handball_medium_skin_tone": "🤾🏽", "person_playing_water_polo": "🤽", "person_playing_water_polo_dark_skin_tone": "🤽🏿", "person_playing_water_polo_light_skin_tone": "🤽🏻", "person_playing_water_polo_medium-dark_skin_tone": "🤽🏾", "person_playing_water_polo_medium-light_skin_tone": "🤽🏼", "person_playing_water_polo_medium_skin_tone": "🤽🏽", "person_pouting": "🙎", "person_pouting_dark_skin_tone": "🙎🏿", "person_pouting_light_skin_tone": "🙎🏻", "person_pouting_medium-dark_skin_tone": "🙎🏾", "person_pouting_medium-light_skin_tone": "🙎🏼", "person_pouting_medium_skin_tone": "🙎🏽", "person_raising_hand": "🙋", "person_raising_hand_dark_skin_tone": "🙋🏿", "person_raising_hand_light_skin_tone": "🙋🏻", "person_raising_hand_medium-dark_skin_tone": "🙋🏾", "person_raising_hand_medium-light_skin_tone": "🙋🏼", "person_raising_hand_medium_skin_tone": "🙋🏽", "person_rowing_boat": "🚣", "person_rowing_boat_dark_skin_tone": "🚣🏿", "person_rowing_boat_light_skin_tone": "🚣🏻", "person_rowing_boat_medium-dark_skin_tone": "🚣🏾", "person_rowing_boat_medium-light_skin_tone": "🚣🏼", "person_rowing_boat_medium_skin_tone": "🚣🏽", "person_running": "🏃", "person_running_dark_skin_tone": "🏃🏿", "person_running_light_skin_tone": "🏃🏻", "person_running_medium-dark_skin_tone": "🏃🏾", "person_running_medium-light_skin_tone": "🏃🏼", "person_running_medium_skin_tone": "🏃🏽", "person_shrugging": "🤷", "person_shrugging_dark_skin_tone": "🤷🏿", "person_shrugging_light_skin_tone": "🤷🏻", "person_shrugging_medium-dark_skin_tone": "🤷🏾", "person_shrugging_medium-light_skin_tone": "🤷🏼", "person_shrugging_medium_skin_tone": "🤷🏽", "person_standing": "🧍", "person_surfing": "🏄", "person_surfing_dark_skin_tone": "🏄🏿", "person_surfing_light_skin_tone": "🏄🏻", "person_surfing_medium-dark_skin_tone": "🏄🏾", "person_surfing_medium-light_skin_tone": "🏄🏼", "person_surfing_medium_skin_tone": "🏄🏽", "person_swimming": "🏊", "person_swimming_dark_skin_tone": "🏊🏿", "person_swimming_light_skin_tone": "🏊🏻", "person_swimming_medium-dark_skin_tone": "🏊🏾", "person_swimming_medium-light_skin_tone": "🏊🏼", "person_swimming_medium_skin_tone": "🏊🏽", "person_taking_bath": "🛀", "person_taking_bath_dark_skin_tone": "🛀🏿", "person_taking_bath_light_skin_tone": "🛀🏻", "person_taking_bath_medium-dark_skin_tone": "🛀🏾", "person_taking_bath_medium-light_skin_tone": "🛀🏼", "person_taking_bath_medium_skin_tone": "🛀🏽", "person_tipping_hand": "💁", "person_tipping_hand_dark_skin_tone": "💁🏿", "person_tipping_hand_light_skin_tone": "💁🏻", "person_tipping_hand_medium-dark_skin_tone": "💁🏾", "person_tipping_hand_medium-light_skin_tone": "💁🏼", "person_tipping_hand_medium_skin_tone": "💁🏽", "person_walking": "🚶", "person_walking_dark_skin_tone": "🚶🏿", "person_walking_light_skin_tone": "🚶🏻", "person_walking_medium-dark_skin_tone": "🚶🏾", "person_walking_medium-light_skin_tone": "🚶🏼", "person_walking_medium_skin_tone": "🚶🏽", "person_wearing_turban": "👳", "person_wearing_turban_dark_skin_tone": "👳🏿", "person_wearing_turban_light_skin_tone": "👳🏻", "person_wearing_turban_medium-dark_skin_tone": "👳🏾", "person_wearing_turban_medium-light_skin_tone": "👳🏼", "person_wearing_turban_medium_skin_tone": "👳🏽", "petri_dish": "🧫", "pick": "⛏", "pie": "🥧", "pig": "🐷", "pig_face": "🐷", "pig_nose": "🐽", "pile_of_poo": "💩", "pill": "💊", "pinching_hand": "🤏", "pine_decoration": "🎍", "pineapple": "🍍", "ping_pong": "🏓", "pirate_flag": "🏴\u200d☠️", "pistol": "🔫", "pizza": "🍕", "place_of_worship": "🛐", "play_button": "▶", "play_or_pause_button": "⏯", "pleading_face": "🥺", "police_car": "🚓", "police_car_light": "🚨", "police_officer": "👮", "police_officer_dark_skin_tone": "👮🏿", "police_officer_light_skin_tone": "👮🏻", "police_officer_medium-dark_skin_tone": "👮🏾", "police_officer_medium-light_skin_tone": "👮🏼", "police_officer_medium_skin_tone": "👮🏽", "poodle": "🐩", "pool_8_ball": "🎱", "popcorn": "🍿", "post_office": "🏣", "postal_horn": "📯", "postbox": "📮", "pot_of_food": "🍲", "potable_water": "🚰", "potato": "🥔", "poultry_leg": "🍗", "pound_banknote": "💷", "pouting_cat_face": "😾", "pouting_face": "😡", "prayer_beads": "📿", "pregnant_woman": "🤰", "pregnant_woman_dark_skin_tone": "🤰🏿", "pregnant_woman_light_skin_tone": "🤰🏻", "pregnant_woman_medium-dark_skin_tone": "🤰🏾", "pregnant_woman_medium-light_skin_tone": "🤰🏼", "pregnant_woman_medium_skin_tone": "🤰🏽", "pretzel": "🥨", "probing_cane": "🦯", "prince": "🤴", "prince_dark_skin_tone": "🤴🏿", "prince_light_skin_tone": "🤴🏻", "prince_medium-dark_skin_tone": "🤴🏾", "prince_medium-light_skin_tone": "🤴🏼", "prince_medium_skin_tone": "🤴🏽", "princess": "👸", "princess_dark_skin_tone": "👸🏿", "princess_light_skin_tone": "👸🏻", "princess_medium-dark_skin_tone": "👸🏾", "princess_medium-light_skin_tone": "👸🏼", "princess_medium_skin_tone": "👸🏽", "printer": "🖨", "prohibited": "🚫", "purple_circle": "🟣", "purple_heart": "💜", "purple_square": "🟪", "purse": "👛", "pushpin": "📌", "question_mark": "❓", "rabbit": "🐰", "rabbit_face": "🐰", "raccoon": "🦝", "racing_car": "🏎", "radio": "📻", "radio_button": "🔘", "radioactive": "☢", "railway_car": "🚃", "railway_track": "🛤", "rainbow": "🌈", "rainbow_flag": "🏳️\u200d🌈", "raised_back_of_hand": "🤚", "raised_back_of_hand_dark_skin_tone": "🤚🏿", "raised_back_of_hand_light_skin_tone": "🤚🏻", "raised_back_of_hand_medium-dark_skin_tone": "🤚🏾", "raised_back_of_hand_medium-light_skin_tone": "🤚🏼", "raised_back_of_hand_medium_skin_tone": "🤚🏽", "raised_fist": "✊", "raised_fist_dark_skin_tone": "✊🏿", "raised_fist_light_skin_tone": "✊🏻", "raised_fist_medium-dark_skin_tone": "✊🏾", "raised_fist_medium-light_skin_tone": "✊🏼", "raised_fist_medium_skin_tone": "✊🏽", "raised_hand": "✋", "raised_hand_dark_skin_tone": "✋🏿", "raised_hand_light_skin_tone": "✋🏻", "raised_hand_medium-dark_skin_tone": "✋🏾", "raised_hand_medium-light_skin_tone": "✋🏼", "raised_hand_medium_skin_tone": "✋🏽", "raising_hands": "🙌", "raising_hands_dark_skin_tone": "🙌🏿", "raising_hands_light_skin_tone": "🙌🏻", "raising_hands_medium-dark_skin_tone": "🙌🏾", "raising_hands_medium-light_skin_tone": "🙌🏼", "raising_hands_medium_skin_tone": "🙌🏽", "ram": "🐏", "rat": "🐀", "razor": "🪒", "ringed_planet": "🪐", "receipt": "🧾", "record_button": "⏺", "recycling_symbol": "♻", "red_apple": "🍎", "red_circle": "🔴", "red_envelope": "🧧", "red_hair": "🦰", "red-haired_man": "👨\u200d🦰", "red-haired_woman": "👩\u200d🦰", "red_heart": "❤", "red_paper_lantern": "🏮", "red_square": "🟥", "red_triangle_pointed_down": "🔻", "red_triangle_pointed_up": "🔺", "registered": "®", "relieved_face": "😌", "reminder_ribbon": "🎗", "repeat_button": "🔁", "repeat_single_button": "🔂", "rescue_worker’s_helmet": "⛑", "restroom": "🚻", "reverse_button": "◀", "revolving_hearts": "💞", "rhinoceros": "🦏", "ribbon": "🎀", "rice_ball": "🍙", "rice_cracker": "🍘", "right-facing_fist": "🤜", "right-facing_fist_dark_skin_tone": "🤜🏿", "right-facing_fist_light_skin_tone": "🤜🏻", "right-facing_fist_medium-dark_skin_tone": "🤜🏾", "right-facing_fist_medium-light_skin_tone": "🤜🏼", "right-facing_fist_medium_skin_tone": "🤜🏽", "right_anger_bubble": "🗯", "right_arrow": "➡", "right_arrow_curving_down": "⤵", "right_arrow_curving_left": "↩", "right_arrow_curving_up": "⤴", "ring": "💍", "roasted_sweet_potato": "🍠", "robot_face": "🤖", "rocket": "🚀", "roll_of_paper": "🧻", "rolled-up_newspaper": "🗞", "roller_coaster": "🎢", "rolling_on_the_floor_laughing": "🤣", "rooster": "🐓", "rose": "🌹", "rosette": "🏵", "round_pushpin": "📍", "rugby_football": "🏉", "running_shirt": "🎽", "running_shoe": "👟", "sad_but_relieved_face": "😥", "safety_pin": "🧷", "safety_vest": "🦺", "salt": "🧂", "sailboat": "⛵", "sake": "🍶", "sandwich": "🥪", "sari": "🥻", "satellite": "📡", "satellite_antenna": "📡", "sauropod": "🦕", "saxophone": "🎷", "scarf": "🧣", "school": "🏫", "school_backpack": "🎒", "scissors": "✂", "scorpion": "🦂", "scroll": "📜", "seat": "💺", "see-no-evil_monkey": "🙈", "seedling": "🌱", "selfie": "🤳", "selfie_dark_skin_tone": "🤳🏿", "selfie_light_skin_tone": "🤳🏻", "selfie_medium-dark_skin_tone": "🤳🏾", "selfie_medium-light_skin_tone": "🤳🏼", "selfie_medium_skin_tone": "🤳🏽", "service_dog": "🐕\u200d🦺", "seven-thirty": "🕢", "seven_o’clock": "🕖", "shallow_pan_of_food": "🥘", "shamrock": "☘", "shark": "🦈", "shaved_ice": "🍧", "sheaf_of_rice": "🌾", "shield": "🛡", "shinto_shrine": "⛩", "ship": "🚢", "shooting_star": "🌠", "shopping_bags": "🛍", "shopping_cart": "🛒", "shortcake": "🍰", "shorts": "🩳", "shower": "🚿", "shrimp": "🦐", "shuffle_tracks_button": "🔀", "shushing_face": "🤫", "sign_of_the_horns": "🤘", "sign_of_the_horns_dark_skin_tone": "🤘🏿", "sign_of_the_horns_light_skin_tone": "🤘🏻", "sign_of_the_horns_medium-dark_skin_tone": "🤘🏾", "sign_of_the_horns_medium-light_skin_tone": "🤘🏼", "sign_of_the_horns_medium_skin_tone": "🤘🏽", "six-thirty": "🕡", "six_o’clock": "🕕", "skateboard": "🛹", "skier": "⛷", "skis": "🎿", "skull": "💀", "skull_and_crossbones": "☠", "skunk": "🦨", "sled": "🛷", "sleeping_face": "😴", "sleepy_face": "😪", "slightly_frowning_face": "🙁", "slightly_smiling_face": "🙂", "slot_machine": "🎰", "sloth": "🦥", "small_airplane": "🛩", "small_blue_diamond": "🔹", "small_orange_diamond": "🔸", "smiling_cat_face_with_heart-eyes": "😻", "smiling_face": "☺", "smiling_face_with_halo": "😇", "smiling_face_with_3_hearts": "🥰", "smiling_face_with_heart-eyes": "😍", "smiling_face_with_horns": "😈", "smiling_face_with_smiling_eyes": "😊", "smiling_face_with_sunglasses": "😎", "smirking_face": "😏", "snail": "🐌", "snake": "🐍", "sneezing_face": "🤧", "snow-capped_mountain": "🏔", "snowboarder": "🏂", "snowboarder_dark_skin_tone": "🏂🏿", "snowboarder_light_skin_tone": "🏂🏻", "snowboarder_medium-dark_skin_tone": "🏂🏾", "snowboarder_medium-light_skin_tone": "🏂🏼", "snowboarder_medium_skin_tone": "🏂🏽", "snowflake": "❄", "snowman": "☃", "snowman_without_snow": "⛄", "soap": "🧼", "soccer_ball": "⚽", "socks": "🧦", "softball": "🥎", "soft_ice_cream": "🍦", "spade_suit": "♠", "spaghetti": "🍝", "sparkle": "❇", "sparkler": "🎇", "sparkles": "✨", "sparkling_heart": "💖", "speak-no-evil_monkey": "🙊", "speaker_high_volume": "🔊", "speaker_low_volume": "🔈", "speaker_medium_volume": "🔉", "speaking_head": "🗣", "speech_balloon": "💬", "speedboat": "🚤", "spider": "🕷", "spider_web": "🕸", "spiral_calendar": "🗓", "spiral_notepad": "🗒", "spiral_shell": "🐚", "spoon": "🥄", "sponge": "🧽", "sport_utility_vehicle": "🚙", "sports_medal": "🏅", "spouting_whale": "🐳", "squid": "🦑", "squinting_face_with_tongue": "😝", "stadium": "🏟", "star-struck": "🤩", "star_and_crescent": "☪", "star_of_david": "✡", "station": "🚉", "steaming_bowl": "🍜", "stethoscope": "🩺", "stop_button": "⏹", "stop_sign": "🛑", "stopwatch": "⏱", "straight_ruler": "📏", "strawberry": "🍓", "studio_microphone": "🎙", "stuffed_flatbread": "🥙", "sun": "☀", "sun_behind_cloud": "⛅", "sun_behind_large_cloud": "🌥", "sun_behind_rain_cloud": "🌦", "sun_behind_small_cloud": "🌤", "sun_with_face": "🌞", "sunflower": "🌻", "sunglasses": "😎", "sunrise": "🌅", "sunrise_over_mountains": "🌄", "sunset": "🌇", "superhero": "🦸", "supervillain": "🦹", "sushi": "🍣", "suspension_railway": "🚟", "swan": "🦢", "sweat_droplets": "💦", "synagogue": "🕍", "syringe": "💉", "t-shirt": "👕", "taco": "🌮", "takeout_box": "🥡", "tanabata_tree": "🎋", "tangerine": "🍊", "taxi": "🚕", "teacup_without_handle": "🍵", "tear-off_calendar": "📆", "teddy_bear": "🧸", "telephone": "☎", "telephone_receiver": "📞", "telescope": "🔭", "television": "📺", "ten-thirty": "🕥", "ten_o’clock": "🕙", "tennis": "🎾", "tent": "⛺", "test_tube": "🧪", "thermometer": "🌡", "thinking_face": "🤔", "thought_balloon": "💭", "thread": "🧵", "three-thirty": "🕞", "three_o’clock": "🕒", "thumbs_down": "👎", "thumbs_down_dark_skin_tone": "👎🏿", "thumbs_down_light_skin_tone": "👎🏻", "thumbs_down_medium-dark_skin_tone": "👎🏾", "thumbs_down_medium-light_skin_tone": "👎🏼", "thumbs_down_medium_skin_tone": "👎🏽", "thumbs_up": "👍", "thumbs_up_dark_skin_tone": "👍🏿", "thumbs_up_light_skin_tone": "👍🏻", "thumbs_up_medium-dark_skin_tone": "👍🏾", "thumbs_up_medium-light_skin_tone": "👍🏼", "thumbs_up_medium_skin_tone": "👍🏽", "ticket": "🎫", "tiger": "🐯", "tiger_face": "🐯", "timer_clock": "⏲", "tired_face": "😫", "toolbox": "🧰", "toilet": "🚽", "tomato": "🍅", "tongue": "👅", "tooth": "🦷", "top_hat": "🎩", "tornado": "🌪", "trackball": "🖲", "tractor": "🚜", "trade_mark": "™", "train": "🚋", "tram": "🚊", "tram_car": "🚋", "triangular_flag": "🚩", "triangular_ruler": "📐", "trident_emblem": "🔱", "trolleybus": "🚎", "trophy": "🏆", "tropical_drink": "🍹", "tropical_fish": "🐠", "trumpet": "🎺", "tulip": "🌷", "tumbler_glass": "🥃", "turtle": "🐢", "twelve-thirty": "🕧", "twelve_o’clock": "🕛", "two-hump_camel": "🐫", "two-thirty": "🕝", "two_hearts": "💕", "two_men_holding_hands": "👬", "two_o’clock": "🕑", "two_women_holding_hands": "👭", "umbrella": "☂", "umbrella_on_ground": "⛱", "umbrella_with_rain_drops": "☔", "unamused_face": "😒", "unicorn_face": "🦄", "unlocked": "🔓", "up-down_arrow": "↕", "up-left_arrow": "↖", "up-right_arrow": "↗", "up_arrow": "⬆", "upside-down_face": "🙃", "upwards_button": "🔼", "vampire": "🧛", "vampire_dark_skin_tone": "🧛🏿", "vampire_light_skin_tone": "🧛🏻", "vampire_medium-dark_skin_tone": "🧛🏾", "vampire_medium-light_skin_tone": "🧛🏼", "vampire_medium_skin_tone": "🧛🏽", "vertical_traffic_light": "🚦", "vibration_mode": "📳", "victory_hand": "✌", "victory_hand_dark_skin_tone": "✌🏿", "victory_hand_light_skin_tone": "✌🏻", "victory_hand_medium-dark_skin_tone": "✌🏾", "victory_hand_medium-light_skin_tone": "✌🏼", "victory_hand_medium_skin_tone": "✌🏽", "video_camera": "📹", "video_game": "🎮", "videocassette": "📼", "violin": "🎻", "volcano": "🌋", "volleyball": "🏐", "vulcan_salute": "🖖", "vulcan_salute_dark_skin_tone": "🖖🏿", "vulcan_salute_light_skin_tone": "🖖🏻", "vulcan_salute_medium-dark_skin_tone": "🖖🏾", "vulcan_salute_medium-light_skin_tone": "🖖🏼", "vulcan_salute_medium_skin_tone": "🖖🏽", "waffle": "🧇", "waning_crescent_moon": "🌘", "waning_gibbous_moon": "🌖", "warning": "⚠", "wastebasket": "🗑", "watch": "⌚", "water_buffalo": "🐃", "water_closet": "🚾", "water_wave": "🌊", "watermelon": "🍉", "waving_hand": "👋", "waving_hand_dark_skin_tone": "👋🏿", "waving_hand_light_skin_tone": "👋🏻", "waving_hand_medium-dark_skin_tone": "👋🏾", "waving_hand_medium-light_skin_tone": "👋🏼", "waving_hand_medium_skin_tone": "👋🏽", "wavy_dash": "〰", "waxing_crescent_moon": "🌒", "waxing_gibbous_moon": "🌔", "weary_cat_face": "🙀", "weary_face": "😩", "wedding": "💒", "whale": "🐳", "wheel_of_dharma": "☸", "wheelchair_symbol": "♿", "white_circle": "⚪", "white_exclamation_mark": "❕", "white_flag": "🏳", "white_flower": "💮", "white_hair": "🦳", "white-haired_man": "👨\u200d🦳", "white-haired_woman": "👩\u200d🦳", "white_heart": "🤍", "white_heavy_check_mark": "✅", "white_large_square": "⬜", "white_medium-small_square": "◽", "white_medium_square": "◻", "white_medium_star": "⭐", "white_question_mark": "❔", "white_small_square": "▫", "white_square_button": "🔳", "wilted_flower": "🥀", "wind_chime": "🎐", "wind_face": "🌬", "wine_glass": "🍷", "winking_face": "😉", "winking_face_with_tongue": "😜", "wolf_face": "🐺", "woman": "👩", "woman_artist": "👩\u200d🎨", "woman_artist_dark_skin_tone": "👩🏿\u200d🎨", "woman_artist_light_skin_tone": "👩🏻\u200d🎨", "woman_artist_medium-dark_skin_tone": "👩🏾\u200d🎨", "woman_artist_medium-light_skin_tone": "👩🏼\u200d🎨", "woman_artist_medium_skin_tone": "👩🏽\u200d🎨", "woman_astronaut": "👩\u200d🚀", "woman_astronaut_dark_skin_tone": "👩🏿\u200d🚀", "woman_astronaut_light_skin_tone": "👩🏻\u200d🚀", "woman_astronaut_medium-dark_skin_tone": "👩🏾\u200d🚀", "woman_astronaut_medium-light_skin_tone": "👩🏼\u200d🚀", "woman_astronaut_medium_skin_tone": "👩🏽\u200d🚀", "woman_biking": "🚴\u200d♀️", "woman_biking_dark_skin_tone": "🚴🏿\u200d♀️", "woman_biking_light_skin_tone": "🚴🏻\u200d♀️", "woman_biking_medium-dark_skin_tone": "🚴🏾\u200d♀️", "woman_biking_medium-light_skin_tone": "🚴🏼\u200d♀️", "woman_biking_medium_skin_tone": "🚴🏽\u200d♀️", "woman_bouncing_ball": "⛹️\u200d♀️", "woman_bouncing_ball_dark_skin_tone": "⛹🏿\u200d♀️", "woman_bouncing_ball_light_skin_tone": "⛹🏻\u200d♀️", "woman_bouncing_ball_medium-dark_skin_tone": "⛹🏾\u200d♀️", "woman_bouncing_ball_medium-light_skin_tone": "⛹🏼\u200d♀️", "woman_bouncing_ball_medium_skin_tone": "⛹🏽\u200d♀️", "woman_bowing": "🙇\u200d♀️", "woman_bowing_dark_skin_tone": "🙇🏿\u200d♀️", "woman_bowing_light_skin_tone": "🙇🏻\u200d♀️", "woman_bowing_medium-dark_skin_tone": "🙇🏾\u200d♀️", "woman_bowing_medium-light_skin_tone": "🙇🏼\u200d♀️", "woman_bowing_medium_skin_tone": "🙇🏽\u200d♀️", "woman_cartwheeling": "🤸\u200d♀️", "woman_cartwheeling_dark_skin_tone": "🤸🏿\u200d♀️", "woman_cartwheeling_light_skin_tone": "🤸🏻\u200d♀️", "woman_cartwheeling_medium-dark_skin_tone": "🤸🏾\u200d♀️", "woman_cartwheeling_medium-light_skin_tone": "🤸🏼\u200d♀️", "woman_cartwheeling_medium_skin_tone": "🤸🏽\u200d♀️", "woman_climbing": "🧗\u200d♀️", "woman_climbing_dark_skin_tone": "🧗🏿\u200d♀️", "woman_climbing_light_skin_tone": "🧗🏻\u200d♀️", "woman_climbing_medium-dark_skin_tone": "🧗🏾\u200d♀️", "woman_climbing_medium-light_skin_tone": "🧗🏼\u200d♀️", "woman_climbing_medium_skin_tone": "🧗🏽\u200d♀️", "woman_construction_worker": "👷\u200d♀️", "woman_construction_worker_dark_skin_tone": "👷🏿\u200d♀️", "woman_construction_worker_light_skin_tone": "👷🏻\u200d♀️", "woman_construction_worker_medium-dark_skin_tone": "👷🏾\u200d♀️", "woman_construction_worker_medium-light_skin_tone": "👷🏼\u200d♀️", "woman_construction_worker_medium_skin_tone": "👷🏽\u200d♀️", "woman_cook": "👩\u200d🍳", "woman_cook_dark_skin_tone": "👩🏿\u200d🍳", "woman_cook_light_skin_tone": "👩🏻\u200d🍳", "woman_cook_medium-dark_skin_tone": "👩🏾\u200d🍳", "woman_cook_medium-light_skin_tone": "👩🏼\u200d🍳", "woman_cook_medium_skin_tone": "👩🏽\u200d🍳", "woman_dancing": "💃", "woman_dancing_dark_skin_tone": "💃🏿", "woman_dancing_light_skin_tone": "💃🏻", "woman_dancing_medium-dark_skin_tone": "💃🏾", "woman_dancing_medium-light_skin_tone": "💃🏼", "woman_dancing_medium_skin_tone": "💃🏽", "woman_dark_skin_tone": "👩🏿", "woman_detective": "🕵️\u200d♀️", "woman_detective_dark_skin_tone": "🕵🏿\u200d♀️", "woman_detective_light_skin_tone": "🕵🏻\u200d♀️", "woman_detective_medium-dark_skin_tone": "🕵🏾\u200d♀️", "woman_detective_medium-light_skin_tone": "🕵🏼\u200d♀️", "woman_detective_medium_skin_tone": "🕵🏽\u200d♀️", "woman_elf": "🧝\u200d♀️", "woman_elf_dark_skin_tone": "🧝🏿\u200d♀️", "woman_elf_light_skin_tone": "🧝🏻\u200d♀️", "woman_elf_medium-dark_skin_tone": "🧝🏾\u200d♀️", "woman_elf_medium-light_skin_tone": "🧝🏼\u200d♀️", "woman_elf_medium_skin_tone": "🧝🏽\u200d♀️", "woman_facepalming": "🤦\u200d♀️", "woman_facepalming_dark_skin_tone": "🤦🏿\u200d♀️", "woman_facepalming_light_skin_tone": "🤦🏻\u200d♀️", "woman_facepalming_medium-dark_skin_tone": "🤦🏾\u200d♀️", "woman_facepalming_medium-light_skin_tone": "🤦🏼\u200d♀️", "woman_facepalming_medium_skin_tone": "🤦🏽\u200d♀️", "woman_factory_worker": "👩\u200d🏭", "woman_factory_worker_dark_skin_tone": "👩🏿\u200d🏭", "woman_factory_worker_light_skin_tone": "👩🏻\u200d🏭", "woman_factory_worker_medium-dark_skin_tone": "👩🏾\u200d🏭", "woman_factory_worker_medium-light_skin_tone": "👩🏼\u200d🏭", "woman_factory_worker_medium_skin_tone": "👩🏽\u200d🏭", "woman_fairy": "🧚\u200d♀️", "woman_fairy_dark_skin_tone": "🧚🏿\u200d♀️", "woman_fairy_light_skin_tone": "🧚🏻\u200d♀️", "woman_fairy_medium-dark_skin_tone": "🧚🏾\u200d♀️", "woman_fairy_medium-light_skin_tone": "🧚🏼\u200d♀️", "woman_fairy_medium_skin_tone": "🧚🏽\u200d♀️", "woman_farmer": "👩\u200d🌾", "woman_farmer_dark_skin_tone": "👩🏿\u200d🌾", "woman_farmer_light_skin_tone": "👩🏻\u200d🌾", "woman_farmer_medium-dark_skin_tone": "👩🏾\u200d🌾", "woman_farmer_medium-light_skin_tone": "👩🏼\u200d🌾", "woman_farmer_medium_skin_tone": "👩🏽\u200d🌾", "woman_firefighter": "👩\u200d🚒", "woman_firefighter_dark_skin_tone": "👩🏿\u200d🚒", "woman_firefighter_light_skin_tone": "👩🏻\u200d🚒", "woman_firefighter_medium-dark_skin_tone": "👩🏾\u200d🚒", "woman_firefighter_medium-light_skin_tone": "👩🏼\u200d🚒", "woman_firefighter_medium_skin_tone": "👩🏽\u200d🚒", "woman_frowning": "🙍\u200d♀️", "woman_frowning_dark_skin_tone": "🙍🏿\u200d♀️", "woman_frowning_light_skin_tone": "🙍🏻\u200d♀️", "woman_frowning_medium-dark_skin_tone": "🙍🏾\u200d♀️", "woman_frowning_medium-light_skin_tone": "🙍🏼\u200d♀️", "woman_frowning_medium_skin_tone": "🙍🏽\u200d♀️", "woman_genie": "🧞\u200d♀️", "woman_gesturing_no": "🙅\u200d♀️", "woman_gesturing_no_dark_skin_tone": "🙅🏿\u200d♀️", "woman_gesturing_no_light_skin_tone": "🙅🏻\u200d♀️", "woman_gesturing_no_medium-dark_skin_tone": "🙅🏾\u200d♀️", "woman_gesturing_no_medium-light_skin_tone": "🙅🏼\u200d♀️", "woman_gesturing_no_medium_skin_tone": "🙅🏽\u200d♀️", "woman_gesturing_ok": "🙆\u200d♀️", "woman_gesturing_ok_dark_skin_tone": "🙆🏿\u200d♀️", "woman_gesturing_ok_light_skin_tone": "🙆🏻\u200d♀️", "woman_gesturing_ok_medium-dark_skin_tone": "🙆🏾\u200d♀️", "woman_gesturing_ok_medium-light_skin_tone": "🙆🏼\u200d♀️", "woman_gesturing_ok_medium_skin_tone": "🙆🏽\u200d♀️", "woman_getting_haircut": "💇\u200d♀️", "woman_getting_haircut_dark_skin_tone": "💇🏿\u200d♀️", "woman_getting_haircut_light_skin_tone": "💇🏻\u200d♀️", "woman_getting_haircut_medium-dark_skin_tone": "💇🏾\u200d♀️", "woman_getting_haircut_medium-light_skin_tone": "💇🏼\u200d♀️", "woman_getting_haircut_medium_skin_tone": "💇🏽\u200d♀️", "woman_getting_massage": "💆\u200d♀️", "woman_getting_massage_dark_skin_tone": "💆🏿\u200d♀️", "woman_getting_massage_light_skin_tone": "💆🏻\u200d♀️", "woman_getting_massage_medium-dark_skin_tone": "💆🏾\u200d♀️", "woman_getting_massage_medium-light_skin_tone": "💆🏼\u200d♀️", "woman_getting_massage_medium_skin_tone": "💆🏽\u200d♀️", "woman_golfing": "🏌️\u200d♀️", "woman_golfing_dark_skin_tone": "🏌🏿\u200d♀️", "woman_golfing_light_skin_tone": "🏌🏻\u200d♀️", "woman_golfing_medium-dark_skin_tone": "🏌🏾\u200d♀️", "woman_golfing_medium-light_skin_tone": "🏌🏼\u200d♀️", "woman_golfing_medium_skin_tone": "🏌🏽\u200d♀️", "woman_guard": "💂\u200d♀️", "woman_guard_dark_skin_tone": "💂🏿\u200d♀️", "woman_guard_light_skin_tone": "💂🏻\u200d♀️", "woman_guard_medium-dark_skin_tone": "💂🏾\u200d♀️", "woman_guard_medium-light_skin_tone": "💂🏼\u200d♀️", "woman_guard_medium_skin_tone": "💂🏽\u200d♀️", "woman_health_worker": "👩\u200d⚕️", "woman_health_worker_dark_skin_tone": "👩🏿\u200d⚕️", "woman_health_worker_light_skin_tone": "👩🏻\u200d⚕️", "woman_health_worker_medium-dark_skin_tone": "👩🏾\u200d⚕️", "woman_health_worker_medium-light_skin_tone": "👩🏼\u200d⚕️", "woman_health_worker_medium_skin_tone": "👩🏽\u200d⚕️", "woman_in_lotus_position": "🧘\u200d♀️", "woman_in_lotus_position_dark_skin_tone": "🧘🏿\u200d♀️", "woman_in_lotus_position_light_skin_tone": "🧘🏻\u200d♀️", "woman_in_lotus_position_medium-dark_skin_tone": "🧘🏾\u200d♀️", "woman_in_lotus_position_medium-light_skin_tone": "🧘🏼\u200d♀️", "woman_in_lotus_position_medium_skin_tone": "🧘🏽\u200d♀️", "woman_in_manual_wheelchair": "👩\u200d🦽", "woman_in_motorized_wheelchair": "👩\u200d🦼", "woman_in_steamy_room": "🧖\u200d♀️", "woman_in_steamy_room_dark_skin_tone": "🧖🏿\u200d♀️", "woman_in_steamy_room_light_skin_tone": "🧖🏻\u200d♀️", "woman_in_steamy_room_medium-dark_skin_tone": "🧖🏾\u200d♀️", "woman_in_steamy_room_medium-light_skin_tone": "🧖🏼\u200d♀️", "woman_in_steamy_room_medium_skin_tone": "🧖🏽\u200d♀️", "woman_judge": "👩\u200d⚖️", "woman_judge_dark_skin_tone": "👩🏿\u200d⚖️", "woman_judge_light_skin_tone": "👩🏻\u200d⚖️", "woman_judge_medium-dark_skin_tone": "👩🏾\u200d⚖️", "woman_judge_medium-light_skin_tone": "👩🏼\u200d⚖️", "woman_judge_medium_skin_tone": "👩🏽\u200d⚖️", "woman_juggling": "🤹\u200d♀️", "woman_juggling_dark_skin_tone": "🤹🏿\u200d♀️", "woman_juggling_light_skin_tone": "🤹🏻\u200d♀️", "woman_juggling_medium-dark_skin_tone": "🤹🏾\u200d♀️", "woman_juggling_medium-light_skin_tone": "🤹🏼\u200d♀️", "woman_juggling_medium_skin_tone": "🤹🏽\u200d♀️", "woman_lifting_weights": "🏋️\u200d♀️", "woman_lifting_weights_dark_skin_tone": "🏋🏿\u200d♀️", "woman_lifting_weights_light_skin_tone": "🏋🏻\u200d♀️", "woman_lifting_weights_medium-dark_skin_tone": "🏋🏾\u200d♀️", "woman_lifting_weights_medium-light_skin_tone": "🏋🏼\u200d♀️", "woman_lifting_weights_medium_skin_tone": "🏋🏽\u200d♀️", "woman_light_skin_tone": "👩🏻", "woman_mage": "🧙\u200d♀️", "woman_mage_dark_skin_tone": "🧙🏿\u200d♀️", "woman_mage_light_skin_tone": "🧙🏻\u200d♀️", "woman_mage_medium-dark_skin_tone": "🧙🏾\u200d♀️", "woman_mage_medium-light_skin_tone": "🧙🏼\u200d♀️", "woman_mage_medium_skin_tone": "🧙🏽\u200d♀️", "woman_mechanic": "👩\u200d🔧", "woman_mechanic_dark_skin_tone": "👩🏿\u200d🔧", "woman_mechanic_light_skin_tone": "👩🏻\u200d🔧", "woman_mechanic_medium-dark_skin_tone": "👩🏾\u200d🔧", "woman_mechanic_medium-light_skin_tone": "👩🏼\u200d🔧", "woman_mechanic_medium_skin_tone": "👩🏽\u200d🔧", "woman_medium-dark_skin_tone": "👩🏾", "woman_medium-light_skin_tone": "👩🏼", "woman_medium_skin_tone": "👩🏽", "woman_mountain_biking": "🚵\u200d♀️", "woman_mountain_biking_dark_skin_tone": "🚵🏿\u200d♀️", "woman_mountain_biking_light_skin_tone": "🚵🏻\u200d♀️", "woman_mountain_biking_medium-dark_skin_tone": "🚵🏾\u200d♀️", "woman_mountain_biking_medium-light_skin_tone": "🚵🏼\u200d♀️", "woman_mountain_biking_medium_skin_tone": "🚵🏽\u200d♀️", "woman_office_worker": "👩\u200d💼", "woman_office_worker_dark_skin_tone": "👩🏿\u200d💼", "woman_office_worker_light_skin_tone": "👩🏻\u200d💼", "woman_office_worker_medium-dark_skin_tone": "👩🏾\u200d💼", "woman_office_worker_medium-light_skin_tone": "👩🏼\u200d💼", "woman_office_worker_medium_skin_tone": "👩🏽\u200d💼", "woman_pilot": "👩\u200d✈️", "woman_pilot_dark_skin_tone": "👩🏿\u200d✈️", "woman_pilot_light_skin_tone": "👩🏻\u200d✈️", "woman_pilot_medium-dark_skin_tone": "👩🏾\u200d✈️", "woman_pilot_medium-light_skin_tone": "👩🏼\u200d✈️", "woman_pilot_medium_skin_tone": "👩🏽\u200d✈️", "woman_playing_handball": "🤾\u200d♀️", "woman_playing_handball_dark_skin_tone": "🤾🏿\u200d♀️", "woman_playing_handball_light_skin_tone": "🤾🏻\u200d♀️", "woman_playing_handball_medium-dark_skin_tone": "🤾🏾\u200d♀️", "woman_playing_handball_medium-light_skin_tone": "🤾🏼\u200d♀️", "woman_playing_handball_medium_skin_tone": "🤾🏽\u200d♀️", "woman_playing_water_polo": "🤽\u200d♀️", "woman_playing_water_polo_dark_skin_tone": "🤽🏿\u200d♀️", "woman_playing_water_polo_light_skin_tone": "🤽🏻\u200d♀️", "woman_playing_water_polo_medium-dark_skin_tone": "🤽🏾\u200d♀️", "woman_playing_water_polo_medium-light_skin_tone": "🤽🏼\u200d♀️", "woman_playing_water_polo_medium_skin_tone": "🤽🏽\u200d♀️", "woman_police_officer": "👮\u200d♀️", "woman_police_officer_dark_skin_tone": "👮🏿\u200d♀️", "woman_police_officer_light_skin_tone": "👮🏻\u200d♀️", "woman_police_officer_medium-dark_skin_tone": "👮🏾\u200d♀️", "woman_police_officer_medium-light_skin_tone": "👮🏼\u200d♀️", "woman_police_officer_medium_skin_tone": "👮🏽\u200d♀️", "woman_pouting": "🙎\u200d♀️", "woman_pouting_dark_skin_tone": "🙎🏿\u200d♀️", "woman_pouting_light_skin_tone": "🙎🏻\u200d♀️", "woman_pouting_medium-dark_skin_tone": "🙎🏾\u200d♀️", "woman_pouting_medium-light_skin_tone": "🙎🏼\u200d♀️", "woman_pouting_medium_skin_tone": "🙎🏽\u200d♀️", "woman_raising_hand": "🙋\u200d♀️", "woman_raising_hand_dark_skin_tone": "🙋🏿\u200d♀️", "woman_raising_hand_light_skin_tone": "🙋🏻\u200d♀️", "woman_raising_hand_medium-dark_skin_tone": "🙋🏾\u200d♀️", "woman_raising_hand_medium-light_skin_tone": "🙋🏼\u200d♀️", "woman_raising_hand_medium_skin_tone": "🙋🏽\u200d♀️", "woman_rowing_boat": "🚣\u200d♀️", "woman_rowing_boat_dark_skin_tone": "🚣🏿\u200d♀️", "woman_rowing_boat_light_skin_tone": "🚣🏻\u200d♀️", "woman_rowing_boat_medium-dark_skin_tone": "🚣🏾\u200d♀️", "woman_rowing_boat_medium-light_skin_tone": "🚣🏼\u200d♀️", "woman_rowing_boat_medium_skin_tone": "🚣🏽\u200d♀️", "woman_running": "🏃\u200d♀️", "woman_running_dark_skin_tone": "🏃🏿\u200d♀️", "woman_running_light_skin_tone": "🏃🏻\u200d♀️", "woman_running_medium-dark_skin_tone": "🏃🏾\u200d♀️", "woman_running_medium-light_skin_tone": "🏃🏼\u200d♀️", "woman_running_medium_skin_tone": "🏃🏽\u200d♀️", "woman_scientist": "👩\u200d🔬", "woman_scientist_dark_skin_tone": "👩🏿\u200d🔬", "woman_scientist_light_skin_tone": "👩🏻\u200d🔬", "woman_scientist_medium-dark_skin_tone": "👩🏾\u200d🔬", "woman_scientist_medium-light_skin_tone": "👩🏼\u200d🔬", "woman_scientist_medium_skin_tone": "👩🏽\u200d🔬", "woman_shrugging": "🤷\u200d♀️", "woman_shrugging_dark_skin_tone": "🤷🏿\u200d♀️", "woman_shrugging_light_skin_tone": "🤷🏻\u200d♀️", "woman_shrugging_medium-dark_skin_tone": "🤷🏾\u200d♀️", "woman_shrugging_medium-light_skin_tone": "🤷🏼\u200d♀️", "woman_shrugging_medium_skin_tone": "🤷🏽\u200d♀️", "woman_singer": "👩\u200d🎤", "woman_singer_dark_skin_tone": "👩🏿\u200d🎤", "woman_singer_light_skin_tone": "👩🏻\u200d🎤", "woman_singer_medium-dark_skin_tone": "👩🏾\u200d🎤", "woman_singer_medium-light_skin_tone": "👩🏼\u200d🎤", "woman_singer_medium_skin_tone": "👩🏽\u200d🎤", "woman_student": "👩\u200d🎓", "woman_student_dark_skin_tone": "👩🏿\u200d🎓", "woman_student_light_skin_tone": "👩🏻\u200d🎓", "woman_student_medium-dark_skin_tone": "👩🏾\u200d🎓", "woman_student_medium-light_skin_tone": "👩🏼\u200d🎓", "woman_student_medium_skin_tone": "👩🏽\u200d🎓", "woman_surfing": "🏄\u200d♀️", "woman_surfing_dark_skin_tone": "🏄🏿\u200d♀️", "woman_surfing_light_skin_tone": "🏄🏻\u200d♀️", "woman_surfing_medium-dark_skin_tone": "🏄🏾\u200d♀️", "woman_surfing_medium-light_skin_tone": "🏄🏼\u200d♀️", "woman_surfing_medium_skin_tone": "🏄🏽\u200d♀️", "woman_swimming": "🏊\u200d♀️", "woman_swimming_dark_skin_tone": "🏊🏿\u200d♀️", "woman_swimming_light_skin_tone": "🏊🏻\u200d♀️", "woman_swimming_medium-dark_skin_tone": "🏊🏾\u200d♀️", "woman_swimming_medium-light_skin_tone": "🏊🏼\u200d♀️", "woman_swimming_medium_skin_tone": "🏊🏽\u200d♀️", "woman_teacher": "👩\u200d🏫", "woman_teacher_dark_skin_tone": "👩🏿\u200d🏫", "woman_teacher_light_skin_tone": "👩🏻\u200d🏫", "woman_teacher_medium-dark_skin_tone": "👩🏾\u200d🏫", "woman_teacher_medium-light_skin_tone": "👩🏼\u200d🏫", "woman_teacher_medium_skin_tone": "👩🏽\u200d🏫", "woman_technologist": "👩\u200d💻", "woman_technologist_dark_skin_tone": "👩🏿\u200d💻", "woman_technologist_light_skin_tone": "👩🏻\u200d💻", "woman_technologist_medium-dark_skin_tone": "👩🏾\u200d💻", "woman_technologist_medium-light_skin_tone": "👩🏼\u200d💻", "woman_technologist_medium_skin_tone": "👩🏽\u200d💻", "woman_tipping_hand": "💁\u200d♀️", "woman_tipping_hand_dark_skin_tone": "💁🏿\u200d♀️", "woman_tipping_hand_light_skin_tone": "💁🏻\u200d♀️", "woman_tipping_hand_medium-dark_skin_tone": "💁🏾\u200d♀️", "woman_tipping_hand_medium-light_skin_tone": "💁🏼\u200d♀️", "woman_tipping_hand_medium_skin_tone": "💁🏽\u200d♀️", "woman_vampire": "🧛\u200d♀️", "woman_vampire_dark_skin_tone": "🧛🏿\u200d♀️", "woman_vampire_light_skin_tone": "🧛🏻\u200d♀️", "woman_vampire_medium-dark_skin_tone": "🧛🏾\u200d♀️", "woman_vampire_medium-light_skin_tone": "🧛🏼\u200d♀️", "woman_vampire_medium_skin_tone": "🧛🏽\u200d♀️", "woman_walking": "🚶\u200d♀️", "woman_walking_dark_skin_tone": "🚶🏿\u200d♀️", "woman_walking_light_skin_tone": "🚶🏻\u200d♀️", "woman_walking_medium-dark_skin_tone": "🚶🏾\u200d♀️", "woman_walking_medium-light_skin_tone": "🚶🏼\u200d♀️", "woman_walking_medium_skin_tone": "🚶🏽\u200d♀️", "woman_wearing_turban": "👳\u200d♀️", "woman_wearing_turban_dark_skin_tone": "👳🏿\u200d♀️", "woman_wearing_turban_light_skin_tone": "👳🏻\u200d♀️", "woman_wearing_turban_medium-dark_skin_tone": "👳🏾\u200d♀️", "woman_wearing_turban_medium-light_skin_tone": "👳🏼\u200d♀️", "woman_wearing_turban_medium_skin_tone": "👳🏽\u200d♀️", "woman_with_headscarf": "🧕", "woman_with_headscarf_dark_skin_tone": "🧕🏿", "woman_with_headscarf_light_skin_tone": "🧕🏻", "woman_with_headscarf_medium-dark_skin_tone": "🧕🏾", "woman_with_headscarf_medium-light_skin_tone": "🧕🏼", "woman_with_headscarf_medium_skin_tone": "🧕🏽", "woman_with_probing_cane": "👩\u200d🦯", "woman_zombie": "🧟\u200d♀️", "woman’s_boot": "👢", "woman’s_clothes": "👚", "woman’s_hat": "👒", "woman’s_sandal": "👡", "women_with_bunny_ears": "👯\u200d♀️", "women_wrestling": "🤼\u200d♀️", "women’s_room": "🚺", "woozy_face": "🥴", "world_map": "🗺", "worried_face": "😟", "wrapped_gift": "🎁", "wrench": "🔧", "writing_hand": "✍", "writing_hand_dark_skin_tone": "✍🏿", "writing_hand_light_skin_tone": "✍🏻", "writing_hand_medium-dark_skin_tone": "✍🏾", "writing_hand_medium-light_skin_tone": "✍🏼", "writing_hand_medium_skin_tone": "✍🏽", "yarn": "🧶", "yawning_face": "🥱", "yellow_circle": "🟡", "yellow_heart": "💛", "yellow_square": "🟨", "yen_banknote": "💴", "yo-yo": "🪀", "yin_yang": "☯", "zany_face": "🤪", "zebra": "🦓", "zipper-mouth_face": "🤐", "zombie": "🧟", "zzz": "💤", "åland_islands": "🇦🇽", "keycap_asterisk": "*⃣", "keycap_digit_eight": "8⃣", "keycap_digit_five": "5⃣", "keycap_digit_four": "4⃣", "keycap_digit_nine": "9⃣", "keycap_digit_one": "1⃣", "keycap_digit_seven": "7⃣", "keycap_digit_six": "6⃣", "keycap_digit_three": "3⃣", "keycap_digit_two": "2⃣", "keycap_digit_zero": "0⃣", "keycap_number_sign": "#⃣", "light_skin_tone": "🏻", "medium_light_skin_tone": "🏼", "medium_skin_tone": "🏽", "medium_dark_skin_tone": "🏾", "dark_skin_tone": "🏿", "regional_indicator_symbol_letter_a": "🇦", "regional_indicator_symbol_letter_b": "🇧", "regional_indicator_symbol_letter_c": "🇨", "regional_indicator_symbol_letter_d": "🇩", "regional_indicator_symbol_letter_e": "🇪", "regional_indicator_symbol_letter_f": "🇫", "regional_indicator_symbol_letter_g": "🇬", "regional_indicator_symbol_letter_h": "🇭", "regional_indicator_symbol_letter_i": "🇮", "regional_indicator_symbol_letter_j": "🇯", "regional_indicator_symbol_letter_k": "🇰", "regional_indicator_symbol_letter_l": "🇱", "regional_indicator_symbol_letter_m": "🇲", "regional_indicator_symbol_letter_n": "🇳", "regional_indicator_symbol_letter_o": "🇴", "regional_indicator_symbol_letter_p": "🇵", "regional_indicator_symbol_letter_q": "🇶", "regional_indicator_symbol_letter_r": "🇷", "regional_indicator_symbol_letter_s": "🇸", "regional_indicator_symbol_letter_t": "🇹", "regional_indicator_symbol_letter_u": "🇺", "regional_indicator_symbol_letter_v": "🇻", "regional_indicator_symbol_letter_w": "🇼", "regional_indicator_symbol_letter_x": "🇽", "regional_indicator_symbol_letter_y": "🇾", "regional_indicator_symbol_letter_z": "🇿", "airplane_arriving": "🛬", "space_invader": "👾", "football": "🏈", "anger": "💢", "angry": "😠", "anguished": "😧", "signal_strength": "📶", "arrows_counterclockwise": "🔄", "arrow_heading_down": "⤵", "arrow_heading_up": "⤴", "art": "🎨", "astonished": "😲", "athletic_shoe": "👟", "atm": "🏧", "car": "🚗", "red_car": "🚗", "angel": "👼", "back": "🔙", "badminton_racquet_and_shuttlecock": "🏸", "dollar": "💵", "euro": "💶", "pound": "💷", "yen": "💴", "barber": "💈", "bath": "🛀", "bear": "🐻", "heartbeat": "💓", "beer": "🍺", "no_bell": "🔕", "bento": "🍱", "bike": "🚲", "bicyclist": "🚴", "8ball": "🎱", "biohazard_sign": "☣", "birthday": "🎂", "black_circle_for_record": "⏺", "clubs": "♣", "diamonds": "♦", "arrow_double_down": "⏬", "hearts": "♥", "rewind": "⏪", "black_left__pointing_double_triangle_with_vertical_bar": "⏮", "arrow_backward": "◀", "black_medium_small_square": "◾", "question": "❓", "fast_forward": "⏩", "black_right__pointing_double_triangle_with_vertical_bar": "⏭", "arrow_forward": "▶", "black_right__pointing_triangle_with_double_vertical_bar": "⏯", "arrow_right": "➡", "spades": "♠", "black_square_for_stop": "⏹", "sunny": "☀", "phone": "☎", "recycle": "♻", "arrow_double_up": "⏫", "busstop": "🚏", "date": "📅", "flags": "🎏", "cat2": "🐈", "joy_cat": "😹", "smirk_cat": "😼", "chart_with_downwards_trend": "📉", "chart_with_upwards_trend": "📈", "chart": "💹", "mega": "📣", "checkered_flag": "🏁", "accept": "🉑", "ideograph_advantage": "🉐", "congratulations": "㊗", "secret": "㊙", "m": "Ⓜ", "city_sunset": "🌆", "clapper": "🎬", "clap": "👏", "beers": "🍻", "clock830": "🕣", "clock8": "🕗", "clock1130": "🕦", "clock11": "🕚", "clock530": "🕠", "clock5": "🕔", "clock430": "🕟", "clock4": "🕓", "clock930": "🕤", "clock9": "🕘", "clock130": "🕜", "clock1": "🕐", "clock730": "🕢", "clock7": "🕖", "clock630": "🕡", "clock6": "🕕", "clock1030": "🕥", "clock10": "🕙", "clock330": "🕞", "clock3": "🕒", "clock1230": "🕧", "clock12": "🕛", "clock230": "🕝", "clock2": "🕑", "arrows_clockwise": "🔃", "repeat": "🔁", "repeat_one": "🔂", "closed_lock_with_key": "🔐", "mailbox_closed": "📪", "mailbox": "📫", "cloud_with_tornado": "🌪", "cocktail": "🍸", "boom": "💥", "compression": "🗜", "confounded": "😖", "confused": "😕", "rice": "🍚", "cow2": "🐄", "cricket_bat_and_ball": "🏏", "x": "❌", "cry": "😢", "curry": "🍛", "dagger_knife": "🗡", "dancer": "💃", "dark_sunglasses": "🕶", "dash": "💨", "truck": "🚚", "derelict_house_building": "🏚", "diamond_shape_with_a_dot_inside": "💠", "dart": "🎯", "disappointed_relieved": "😥", "disappointed": "😞", "do_not_litter": "🚯", "dog2": "🐕", "flipper": "🐬", "loop": "➿", "bangbang": "‼", "double_vertical_bar": "⏸", "dove_of_peace": "🕊", "small_red_triangle_down": "🔻", "arrow_down_small": "🔽", "arrow_down": "⬇", "dromedary_camel": "🐪", "e__mail": "📧", "corn": "🌽", "ear_of_rice": "🌾", "earth_americas": "🌎", "earth_asia": "🌏", "earth_africa": "🌍", "eight_pointed_black_star": "✴", "eight_spoked_asterisk": "✳", "eject_symbol": "⏏", "bulb": "💡", "emoji_modifier_fitzpatrick_type__1__2": "🏻", "emoji_modifier_fitzpatrick_type__3": "🏼", "emoji_modifier_fitzpatrick_type__4": "🏽", "emoji_modifier_fitzpatrick_type__5": "🏾", "emoji_modifier_fitzpatrick_type__6": "🏿", "end": "🔚", "email": "✉", "european_castle": "🏰", "european_post_office": "🏤", "interrobang": "⁉", "expressionless": "😑", "eyeglasses": "👓", "massage": "💆", "yum": "😋", "scream": "😱", "kissing_heart": "😘", "sweat": "😓", "face_with_head__bandage": "🤕", "triumph": "😤", "mask": "😷", "no_good": "🙅", "ok_woman": "🙆", "open_mouth": "😮", "cold_sweat": "😰", "stuck_out_tongue": "😛", "stuck_out_tongue_closed_eyes": "😝", "stuck_out_tongue_winking_eye": "😜", "joy": "😂", "no_mouth": "😶", "santa": "🎅", "fax": "📠", "fearful": "😨", "field_hockey_stick_and_ball": "🏑", "first_quarter_moon_with_face": "🌛", "fish_cake": "🍥", "fishing_pole_and_fish": "🎣", "facepunch": "👊", "punch": "👊", "flag_for_afghanistan": "🇦🇫", "flag_for_albania": "🇦🇱", "flag_for_algeria": "🇩🇿", "flag_for_american_samoa": "🇦🇸", "flag_for_andorra": "🇦🇩", "flag_for_angola": "🇦🇴", "flag_for_anguilla": "🇦🇮", "flag_for_antarctica": "🇦🇶", "flag_for_antigua_&_barbuda": "🇦🇬", "flag_for_argentina": "🇦🇷", "flag_for_armenia": "🇦🇲", "flag_for_aruba": "🇦🇼", "flag_for_ascension_island": "🇦🇨", "flag_for_australia": "🇦🇺", "flag_for_austria": "🇦🇹", "flag_for_azerbaijan": "🇦🇿", "flag_for_bahamas": "🇧🇸", "flag_for_bahrain": "🇧🇭", "flag_for_bangladesh": "🇧🇩", "flag_for_barbados": "🇧🇧", "flag_for_belarus": "🇧🇾", "flag_for_belgium": "🇧🇪", "flag_for_belize": "🇧🇿", "flag_for_benin": "🇧🇯", "flag_for_bermuda": "🇧🇲", "flag_for_bhutan": "🇧🇹", "flag_for_bolivia": "🇧🇴", "flag_for_bosnia_&_herzegovina": "🇧🇦", "flag_for_botswana": "🇧🇼", "flag_for_bouvet_island": "🇧🇻", "flag_for_brazil": "🇧🇷", "flag_for_british_indian_ocean_territory": "🇮🇴", "flag_for_british_virgin_islands": "🇻🇬", "flag_for_brunei": "🇧🇳", "flag_for_bulgaria": "🇧🇬", "flag_for_burkina_faso": "🇧🇫", "flag_for_burundi": "🇧🇮", "flag_for_cambodia": "🇰🇭", "flag_for_cameroon": "🇨🇲", "flag_for_canada": "🇨🇦", "flag_for_canary_islands": "🇮🇨", "flag_for_cape_verde": "🇨🇻", "flag_for_caribbean_netherlands": "🇧🇶", "flag_for_cayman_islands": "🇰🇾", "flag_for_central_african_republic": "🇨🇫", "flag_for_ceuta_&_melilla": "🇪🇦", "flag_for_chad": "🇹🇩", "flag_for_chile": "🇨🇱", "flag_for_china": "🇨🇳", "flag_for_christmas_island": "🇨🇽", "flag_for_clipperton_island": "🇨🇵", "flag_for_cocos__islands": "🇨🇨", "flag_for_colombia": "🇨🇴", "flag_for_comoros": "🇰🇲", "flag_for_congo____brazzaville": "🇨🇬", "flag_for_congo____kinshasa": "🇨🇩", "flag_for_cook_islands": "🇨🇰", "flag_for_costa_rica": "🇨🇷", "flag_for_croatia": "🇭🇷", "flag_for_cuba": "🇨🇺", "flag_for_curaçao": "🇨🇼", "flag_for_cyprus": "🇨🇾", "flag_for_czech_republic": "🇨🇿", "flag_for_côte_d’ivoire": "🇨🇮", "flag_for_denmark": "🇩🇰", "flag_for_diego_garcia": "🇩🇬", "flag_for_djibouti": "🇩🇯", "flag_for_dominica": "🇩🇲", "flag_for_dominican_republic": "🇩🇴", "flag_for_ecuador": "🇪🇨", "flag_for_egypt": "🇪🇬", "flag_for_el_salvador": "🇸🇻", "flag_for_equatorial_guinea": "🇬🇶", "flag_for_eritrea": "🇪🇷", "flag_for_estonia": "🇪🇪", "flag_for_ethiopia": "🇪🇹", "flag_for_european_union": "🇪🇺", "flag_for_falkland_islands": "🇫🇰", "flag_for_faroe_islands": "🇫🇴", "flag_for_fiji": "🇫🇯", "flag_for_finland": "🇫🇮", "flag_for_france": "🇫🇷", "flag_for_french_guiana": "🇬🇫", "flag_for_french_polynesia": "🇵🇫", "flag_for_french_southern_territories": "🇹🇫", "flag_for_gabon": "🇬🇦", "flag_for_gambia": "🇬🇲", "flag_for_georgia": "🇬🇪", "flag_for_germany": "🇩🇪", "flag_for_ghana": "🇬🇭", "flag_for_gibraltar": "🇬🇮", "flag_for_greece": "🇬🇷", "flag_for_greenland": "🇬🇱", "flag_for_grenada": "🇬🇩", "flag_for_guadeloupe": "🇬🇵", "flag_for_guam": "🇬🇺", "flag_for_guatemala": "🇬🇹", "flag_for_guernsey": "🇬🇬", "flag_for_guinea": "🇬🇳", "flag_for_guinea__bissau": "🇬🇼", "flag_for_guyana": "🇬🇾", "flag_for_haiti": "🇭🇹", "flag_for_heard_&_mcdonald_islands": "🇭🇲", "flag_for_honduras": "🇭🇳", "flag_for_hong_kong": "🇭🇰", "flag_for_hungary": "🇭🇺", "flag_for_iceland": "🇮🇸", "flag_for_india": "🇮🇳", "flag_for_indonesia": "🇮🇩", "flag_for_iran": "🇮🇷", "flag_for_iraq": "🇮🇶", "flag_for_ireland": "🇮🇪", "flag_for_isle_of_man": "🇮🇲", "flag_for_israel": "🇮🇱", "flag_for_italy": "🇮🇹", "flag_for_jamaica": "🇯🇲", "flag_for_japan": "🇯🇵", "flag_for_jersey": "🇯🇪", "flag_for_jordan": "🇯🇴", "flag_for_kazakhstan": "🇰🇿", "flag_for_kenya": "🇰🇪", "flag_for_kiribati": "🇰🇮", "flag_for_kosovo": "🇽🇰", "flag_for_kuwait": "🇰🇼", "flag_for_kyrgyzstan": "🇰🇬", "flag_for_laos": "🇱🇦", "flag_for_latvia": "🇱🇻", "flag_for_lebanon": "🇱🇧", "flag_for_lesotho": "🇱🇸", "flag_for_liberia": "🇱🇷", "flag_for_libya": "🇱🇾", "flag_for_liechtenstein": "🇱🇮", "flag_for_lithuania": "🇱🇹", "flag_for_luxembourg": "🇱🇺", "flag_for_macau": "🇲🇴", "flag_for_macedonia": "🇲🇰", "flag_for_madagascar": "🇲🇬", "flag_for_malawi": "🇲🇼", "flag_for_malaysia": "🇲🇾", "flag_for_maldives": "🇲🇻", "flag_for_mali": "🇲🇱", "flag_for_malta": "🇲🇹", "flag_for_marshall_islands": "🇲🇭", "flag_for_martinique": "🇲🇶", "flag_for_mauritania": "🇲🇷", "flag_for_mauritius": "🇲🇺", "flag_for_mayotte": "🇾🇹", "flag_for_mexico": "🇲🇽", "flag_for_micronesia": "🇫🇲", "flag_for_moldova": "🇲🇩", "flag_for_monaco": "🇲🇨", "flag_for_mongolia": "🇲🇳", "flag_for_montenegro": "🇲🇪", "flag_for_montserrat": "🇲🇸", "flag_for_morocco": "🇲🇦", "flag_for_mozambique": "🇲🇿", "flag_for_myanmar": "🇲🇲", "flag_for_namibia": "🇳🇦", "flag_for_nauru": "🇳🇷", "flag_for_nepal": "🇳🇵", "flag_for_netherlands": "🇳🇱", "flag_for_new_caledonia": "🇳🇨", "flag_for_new_zealand": "🇳🇿", "flag_for_nicaragua": "🇳🇮", "flag_for_niger": "🇳🇪", "flag_for_nigeria": "🇳🇬", "flag_for_niue": "🇳🇺", "flag_for_norfolk_island": "🇳🇫", "flag_for_north_korea": "🇰🇵", "flag_for_northern_mariana_islands": "🇲🇵", "flag_for_norway": "🇳🇴", "flag_for_oman": "🇴🇲", "flag_for_pakistan": "🇵🇰", "flag_for_palau": "🇵🇼", "flag_for_palestinian_territories": "🇵🇸", "flag_for_panama": "🇵🇦", "flag_for_papua_new_guinea": "🇵🇬", "flag_for_paraguay": "🇵🇾", "flag_for_peru": "🇵🇪", "flag_for_philippines": "🇵🇭", "flag_for_pitcairn_islands": "🇵🇳", "flag_for_poland": "🇵🇱", "flag_for_portugal": "🇵🇹", "flag_for_puerto_rico": "🇵🇷", "flag_for_qatar": "🇶🇦", "flag_for_romania": "🇷🇴", "flag_for_russia": "🇷🇺", "flag_for_rwanda": "🇷🇼", "flag_for_réunion": "🇷🇪", "flag_for_samoa": "🇼🇸", "flag_for_san_marino": "🇸🇲", "flag_for_saudi_arabia": "🇸🇦", "flag_for_senegal": "🇸🇳", "flag_for_serbia": "🇷🇸", "flag_for_seychelles": "🇸🇨", "flag_for_sierra_leone": "🇸🇱", "flag_for_singapore": "🇸🇬", "flag_for_sint_maarten": "🇸🇽", "flag_for_slovakia": "🇸🇰", "flag_for_slovenia": "🇸🇮", "flag_for_solomon_islands": "🇸🇧", "flag_for_somalia": "🇸🇴", "flag_for_south_africa": "🇿🇦", "flag_for_south_georgia_&_south_sandwich_islands": "🇬🇸", "flag_for_south_korea": "🇰🇷", "flag_for_south_sudan": "🇸🇸", "flag_for_spain": "🇪🇸", "flag_for_sri_lanka": "🇱🇰", "flag_for_st._barthélemy": "🇧🇱", "flag_for_st._helena": "🇸🇭", "flag_for_st._kitts_&_nevis": "🇰🇳", "flag_for_st._lucia": "🇱🇨", "flag_for_st._martin": "🇲🇫", "flag_for_st._pierre_&_miquelon": "🇵🇲", "flag_for_st._vincent_&_grenadines": "🇻🇨", "flag_for_sudan": "🇸🇩", "flag_for_suriname": "🇸🇷", "flag_for_svalbard_&_jan_mayen": "🇸🇯", "flag_for_swaziland": "🇸🇿", "flag_for_sweden": "🇸🇪", "flag_for_switzerland": "🇨🇭", "flag_for_syria": "🇸🇾", "flag_for_são_tomé_&_príncipe": "🇸🇹", "flag_for_taiwan": "🇹🇼", "flag_for_tajikistan": "🇹🇯", "flag_for_tanzania": "🇹🇿", "flag_for_thailand": "🇹🇭", "flag_for_timor__leste": "🇹🇱", "flag_for_togo": "🇹🇬", "flag_for_tokelau": "🇹🇰", "flag_for_tonga": "🇹🇴", "flag_for_trinidad_&_tobago": "🇹🇹", "flag_for_tristan_da_cunha": "🇹🇦", "flag_for_tunisia": "🇹🇳", "flag_for_turkey": "🇹🇷", "flag_for_turkmenistan": "🇹🇲", "flag_for_turks_&_caicos_islands": "🇹🇨", "flag_for_tuvalu": "🇹🇻", "flag_for_u.s._outlying_islands": "🇺🇲", "flag_for_u.s._virgin_islands": "🇻🇮", "flag_for_uganda": "🇺🇬", "flag_for_ukraine": "🇺🇦", "flag_for_united_arab_emirates": "🇦🇪", "flag_for_united_kingdom": "🇬🇧", "flag_for_united_states": "🇺🇸", "flag_for_uruguay": "🇺🇾", "flag_for_uzbekistan": "🇺🇿", "flag_for_vanuatu": "🇻🇺", "flag_for_vatican_city": "🇻🇦", "flag_for_venezuela": "🇻🇪", "flag_for_vietnam": "🇻🇳", "flag_for_wallis_&_futuna": "🇼🇫", "flag_for_western_sahara": "🇪🇭", "flag_for_yemen": "🇾🇪", "flag_for_zambia": "🇿🇲", "flag_for_zimbabwe": "🇿🇼", "flag_for_åland_islands": "🇦🇽", "golf": "⛳", "fleur__de__lis": "⚜", "muscle": "💪", "flushed": "😳", "frame_with_picture": "🖼", "fries": "🍟", "frog": "🐸", "hatched_chick": "🐥", "frowning": "😦", "fuelpump": "⛽", "full_moon_with_face": "🌝", "gem": "💎", "star2": "🌟", "golfer": "🏌", "mortar_board": "🎓", "grimacing": "😬", "smile_cat": "😸", "grinning": "😀", "grin": "😁", "heartpulse": "💗", "guardsman": "💂", "haircut": "💇", "hamster": "🐹", "raising_hand": "🙋", "headphones": "🎧", "hear_no_evil": "🙉", "cupid": "💘", "gift_heart": "💝", "heart": "❤", "exclamation": "❗", "heavy_exclamation_mark": "❗", "heavy_heart_exclamation_mark_ornament": "❣", "o": "⭕", "helm_symbol": "⎈", "helmet_with_white_cross": "⛑", "high_heel": "👠", "bullettrain_side": "🚄", "bullettrain_front": "🚅", "high_brightness": "🔆", "zap": "⚡", "hocho": "🔪", "knife": "🔪", "bee": "🐝", "traffic_light": "🚥", "racehorse": "🐎", "coffee": "☕", "hotsprings": "♨", "hourglass": "⌛", "hourglass_flowing_sand": "⏳", "house_buildings": "🏘", "100": "💯", "hushed": "😯", "ice_hockey_stick_and_puck": "🏒", "imp": "👿", "information_desk_person": "💁", "information_source": "ℹ", "capital_abcd": "🔠", "abc": "🔤", "abcd": "🔡", "1234": "🔢", "symbols": "🔣", "izakaya_lantern": "🏮", "lantern": "🏮", "jack_o_lantern": "🎃", "dolls": "🎎", "japanese_goblin": "👺", "japanese_ogre": "👹", "beginner": "🔰", "zero": "0️⃣", "one": "1️⃣", "ten": "🔟", "two": "2️⃣", "three": "3️⃣", "four": "4️⃣", "five": "5️⃣", "six": "6️⃣", "seven": "7️⃣", "eight": "8️⃣", "nine": "9️⃣", "couplekiss": "💏", "kissing_cat": "😽", "kissing": "😗", "kissing_closed_eyes": "😚", "kissing_smiling_eyes": "😙", "beetle": "🐞", "large_blue_circle": "🔵", "last_quarter_moon_with_face": "🌜", "leaves": "🍃", "mag": "🔍", "left_right_arrow": "↔", "leftwards_arrow_with_hook": "↩", "arrow_left": "⬅", "lock": "🔒", "lock_with_ink_pen": "🔏", "sob": "😭", "low_brightness": "🔅", "lower_left_ballpoint_pen": "🖊", "lower_left_crayon": "🖍", "lower_left_fountain_pen": "🖋", "lower_left_paintbrush": "🖌", "mahjong": "🀄", "couple": "👫", "man_in_business_suit_levitating": "🕴", "man_with_gua_pi_mao": "👲", "man_with_turban": "👳", "mans_shoe": "👞", "shoe": "👞", "menorah_with_nine_branches": "🕎", "mens": "🚹", "minidisc": "💽", "iphone": "📱", "calling": "📲", "money__mouth_face": "🤑", "moneybag": "💰", "rice_scene": "🎑", "mountain_bicyclist": "🚵", "mouse2": "🐁", "lips": "👄", "moyai": "🗿", "notes": "🎶", "nail_care": "💅", "ab": "🆎", "negative_squared_cross_mark": "❎", "a": "🅰", "b": "🅱", "o2": "🅾", "parking": "🅿", "new_moon_with_face": "🌚", "no_entry_sign": "🚫", "underage": "🔞", "non__potable_water": "🚱", "arrow_upper_right": "↗", "arrow_upper_left": "↖", "office": "🏢", "older_man": "👴", "older_woman": "👵", "om_symbol": "🕉", "on": "🔛", "book": "📖", "unlock": "🔓", "mailbox_with_no_mail": "📭", "mailbox_with_mail": "📬", "cd": "💿", "tada": "🎉", "feet": "🐾", "walking": "🚶", "pencil2": "✏", "pensive": "😔", "persevere": "😣", "bow": "🙇", "raised_hands": "🙌", "person_with_ball": "⛹", "person_with_blond_hair": "👱", "pray": "🙏", "person_with_pouting_face": "🙎", "computer": "💻", "pig2": "🐖", "hankey": "💩", "poop": "💩", "shit": "💩", "bamboo": "🎍", "gun": "🔫", "black_joker": "🃏", "rotating_light": "🚨", "cop": "👮", "stew": "🍲", "pouch": "👝", "pouting_cat": "😾", "rage": "😡", "put_litter_in_its_place": "🚮", "rabbit2": "🐇", "racing_motorcycle": "🏍", "radioactive_sign": "☢", "fist": "✊", "hand": "✋", "raised_hand_with_fingers_splayed": "🖐", "raised_hand_with_part_between_middle_and_ring_fingers": "🖖", "blue_car": "🚙", "apple": "🍎", "relieved": "😌", "reversed_hand_with_middle_finger_extended": "🖕", "mag_right": "🔎", "arrow_right_hook": "↪", "sweet_potato": "🍠", "robot": "🤖", "rolled__up_newspaper": "🗞", "rowboat": "🚣", "runner": "🏃", "running": "🏃", "running_shirt_with_sash": "🎽", "boat": "⛵", "scales": "⚖", "school_satchel": "🎒", "scorpius": "♏", "see_no_evil": "🙈", "sheep": "🐑", "stars": "🌠", "cake": "🍰", "six_pointed_star": "🔯", "ski": "🎿", "sleeping_accommodation": "🛌", "sleeping": "😴", "sleepy": "😪", "sleuth_or_spy": "🕵", "heart_eyes_cat": "😻", "smiley_cat": "😺", "innocent": "😇", "heart_eyes": "😍", "smiling_imp": "😈", "smiley": "😃", "sweat_smile": "😅", "smile": "😄", "laughing": "😆", "satisfied": "😆", "blush": "😊", "smirk": "😏", "smoking": "🚬", "snow_capped_mountain": "🏔", "soccer": "⚽", "icecream": "🍦", "soon": "🔜", "arrow_lower_right": "↘", "arrow_lower_left": "↙", "speak_no_evil": "🙊", "speaker": "🔈", "mute": "🔇", "sound": "🔉", "loud_sound": "🔊", "speaking_head_in_silhouette": "🗣", "spiral_calendar_pad": "🗓", "spiral_note_pad": "🗒", "shell": "🐚", "sweat_drops": "💦", "u5272": "🈹", "u5408": "🈴", "u55b6": "🈺", "u6307": "🈯", "u6708": "🈷", "u6709": "🈶", "u6e80": "🈵", "u7121": "🈚", "u7533": "🈸", "u7981": "🈲", "u7a7a": "🈳", "cl": "🆑", "cool": "🆒", "free": "🆓", "id": "🆔", "koko": "🈁", "sa": "🈂", "new": "🆕", "ng": "🆖", "ok": "🆗", "sos": "🆘", "up": "🆙", "vs": "🆚", "steam_locomotive": "🚂", "ramen": "🍜", "partly_sunny": "⛅", "city_sunrise": "🌇", "surfer": "🏄", "swimmer": "🏊", "shirt": "👕", "tshirt": "👕", "table_tennis_paddle_and_ball": "🏓", "tea": "🍵", "tv": "📺", "three_button_mouse": "🖱", "+1": "👍", "thumbsup": "👍", "__1": "👎", "-1": "👎", "thumbsdown": "👎", "thunder_cloud_and_rain": "⛈", "tiger2": "🐅", "tophat": "🎩", "top": "🔝", "tm": "™", "train2": "🚆", "triangular_flag_on_post": "🚩", "trident": "🔱", "twisted_rightwards_arrows": "🔀", "unamused": "😒", "small_red_triangle": "🔺", "arrow_up_small": "🔼", "arrow_up_down": "↕", "upside__down_face": "🙃", "arrow_up": "⬆", "v": "✌", "vhs": "📼", "wc": "🚾", "ocean": "🌊", "waving_black_flag": "🏴", "wave": "👋", "waving_white_flag": "🏳", "moon": "🌔", "scream_cat": "🙀", "weary": "😩", "weight_lifter": "🏋", "whale2": "🐋", "wheelchair": "♿", "point_down": "👇", "grey_exclamation": "❕", "white_frowning_face": "☹", "white_check_mark": "✅", "point_left": "👈", "white_medium_small_square": "◽", "star": "⭐", "grey_question": "❔", "point_right": "👉", "relaxed": "☺", "white_sun_behind_cloud": "🌥", "white_sun_behind_cloud_with_rain": "🌦", "white_sun_with_small_cloud": "🌤", "point_up_2": "👆", "point_up": "☝", "wind_blowing_face": "🌬", "wink": "😉", "wolf": "🐺", "dancers": "👯", "boot": "👢", "womans_clothes": "👚", "womans_hat": "👒", "sandal": "👡", "womens": "🚺", "worried": "😟", "gift": "🎁", "zipper__mouth_face": "🤐", "regional_indicator_a": "🇦", "regional_indicator_b": "🇧", "regional_indicator_c": "🇨", "regional_indicator_d": "🇩", "regional_indicator_e": "🇪", "regional_indicator_f": "🇫", "regional_indicator_g": "🇬", "regional_indicator_h": "🇭", "regional_indicator_i": "🇮", "regional_indicator_j": "🇯", "regional_indicator_k": "🇰", "regional_indicator_l": "🇱", "regional_indicator_m": "🇲", "regional_indicator_n": "🇳", "regional_indicator_o": "🇴", "regional_indicator_p": "🇵", "regional_indicator_q": "🇶", "regional_indicator_r": "🇷", "regional_indicator_s": "🇸", "regional_indicator_t": "🇹", "regional_indicator_u": "🇺", "regional_indicator_v": "🇻", "regional_indicator_w": "🇼", "regional_indicator_x": "🇽", "regional_indicator_y": "🇾", "regional_indicator_z": "🇿", }	136.95 KB	2026-01-20 12:58
📄 _emoji_replace.py from typing import Callable, Match, Optional import re from ._emoji_codes import EMOJI _ReStringMatch = Match[str] # regex match object _ReSubCallable = Callable[[_ReStringMatch], str] # Callable invoked by re.sub _EmojiSubMethod = Callable[[_ReSubCallable, str], str] # Sub method of a compiled re def _emoji_replace( text: str, default_variant: Optional[str] = None, _emoji_sub: _EmojiSubMethod = re.compile(r"(:(\S*?)(?:(?:\-)(emoji\|text))?:)").sub, ) -> str: """Replace emoji code in text.""" get_emoji = EMOJI.__getitem__ variants = {"text": "\uFE0E", "emoji": "\uFE0F"} get_variant = variants.get default_variant_code = variants.get(default_variant, "") if default_variant else "" def do_replace(match: Match[str]) -> str: emoji_code, emoji_name, variant = match.groups() try: return get_emoji(emoji_name.lower()) + get_variant( variant, default_variant_code ) except KeyError: return emoji_code return _emoji_sub(do_replace, text)	1.04 KB	2026-01-20 12:58
📄 _export_format.py CONSOLE_HTML_FORMAT = """\ <!DOCTYPE html> <html> <head> <meta charset="UTF-8"> <style> {stylesheet} body {{ color: {foreground}; background-color: {background}; }} </style> </head> <body> <pre style="font-family:Menlo,'DejaVu Sans Mono',consolas,'Courier New',monospace"><code style="font-family:inherit">{code}</code></pre> </body> </html> """ CONSOLE_SVG_FORMAT = """\ <svg class="rich-terminal" viewBox="0 0 {width} {height}" xmlns="http://www.w3.org/2000/svg"> <!-- Generated with Rich https://www.textualize.io --> <style> @font-face {{ font-family: "Fira Code"; src: local("FiraCode-Regular"), url("https://cdnjs.cloudflare.com/ajax/libs/firacode/6.2.0/woff2/FiraCode-Regular.woff2") format("woff2"), url("https://cdnjs.cloudflare.com/ajax/libs/firacode/6.2.0/woff/FiraCode-Regular.woff") format("woff"); font-style: normal; font-weight: 400; }} @font-face {{ font-family: "Fira Code"; src: local("FiraCode-Bold"), url("https://cdnjs.cloudflare.com/ajax/libs/firacode/6.2.0/woff2/FiraCode-Bold.woff2") format("woff2"), url("https://cdnjs.cloudflare.com/ajax/libs/firacode/6.2.0/woff/FiraCode-Bold.woff") format("woff"); font-style: bold; font-weight: 700; }} .{unique_id}-matrix {{ font-family: Fira Code, monospace; font-size: {char_height}px; line-height: {line_height}px; font-variant-east-asian: full-width; }} .{unique_id}-title {{ font-size: 18px; font-weight: bold; font-family: arial; }} {styles} </style> <defs> <clipPath id="{unique_id}-clip-terminal"> <rect x="0" y="0" width="{terminal_width}" height="{terminal_height}" /> </clipPath> {lines} </defs> {chrome} <g transform="translate({terminal_x}, {terminal_y})" clip-path="url(#{unique_id}-clip-terminal)"> {backgrounds} <g class="{unique_id}-matrix"> {matrix} </g> </g> </svg> """ _SVG_FONT_FAMILY = "Rich Fira Code" _SVG_CLASSES_PREFIX = "rich-svg"	2.08 KB	2026-01-20 12:58
📄 _extension.py from typing import Any def load_ipython_extension(ip: Any) -> None: # pragma: no cover # prevent circular import from pip._vendor.rich.pretty import install from pip._vendor.rich.traceback import install as tr_install install() tr_install()	265 B	2026-01-20 12:58
📄 _fileno.py from __future__ import annotations from typing import IO, Callable def get_fileno(file_like: IO[str]) -> int \| None: """Get fileno() from a file, accounting for poorly implemented file-like objects. Args: file_like (IO): A file-like object. Returns: int \| None: The result of fileno if available, or None if operation failed. """ fileno: Callable[[], int] \| None = getattr(file_like, "fileno", None) if fileno is not None: try: return fileno() except Exception: # `fileno` is documented as potentially raising a OSError # Alas, from the issues, there are so many poorly implemented file-like objects, # that `fileno()` can raise just about anything. return None return None	799 B	2026-01-20 12:58
📄 _inspect.py import inspect from inspect import cleandoc, getdoc, getfile, isclass, ismodule, signature from typing import Any, Collection, Iterable, Optional, Tuple, Type, Union from .console import Group, RenderableType from .control import escape_control_codes from .highlighter import ReprHighlighter from .jupyter import JupyterMixin from .panel import Panel from .pretty import Pretty from .table import Table from .text import Text, TextType def _first_paragraph(doc: str) -> str: """Get the first paragraph from a docstring.""" paragraph, _, _ = doc.partition("\n\n") return paragraph class Inspect(JupyterMixin): """A renderable to inspect any Python Object. Args: obj (Any): An object to inspect. title (str, optional): Title to display over inspect result, or None use type. Defaults to None. help (bool, optional): Show full help text rather than just first paragraph. Defaults to False. methods (bool, optional): Enable inspection of callables. Defaults to False. docs (bool, optional): Also render doc strings. Defaults to True. private (bool, optional): Show private attributes (beginning with underscore). Defaults to False. dunder (bool, optional): Show attributes starting with double underscore. Defaults to False. sort (bool, optional): Sort attributes alphabetically. Defaults to True. all (bool, optional): Show all attributes. Defaults to False. value (bool, optional): Pretty print value of object. Defaults to True. """ def __init__( self, obj: Any, , title: Optional[TextType] = None, help: bool = False, methods: bool = False, docs: bool = True, private: bool = False, dunder: bool = False, sort: bool = True, all: bool = True, value: bool = True, ) -> None: self.highlighter = ReprHighlighter() self.obj = obj self.title = title or self._make_title(obj) if all: methods = private = dunder = True self.help = help self.methods = methods self.docs = docs or help self.private = private or dunder self.dunder = dunder self.sort = sort self.value = value def _make_title(self, obj: Any) -> Text: """Make a default title.""" title_str = ( str(obj) if (isclass(obj) or callable(obj) or ismodule(obj)) else str(type(obj)) ) title_text = self.highlighter(title_str) return title_text def __rich__(self) -> Panel: return Panel.fit( Group(self._render()), title=self.title, border_style="scope.border", padding=(0, 1), ) def _get_signature(self, name: str, obj: Any) -> Optional[Text]: """Get a signature for a callable.""" try: _signature = str(signature(obj)) + ":" except ValueError: _signature = "(...)" except TypeError: return None source_filename: Optional[str] = None try: source_filename = getfile(obj) except (OSError, TypeError): # OSError is raised if obj has no source file, e.g. when defined in REPL. pass callable_name = Text(name, style="inspect.callable") if source_filename: callable_name.stylize(f"link file://{source_filename}") signature_text = self.highlighter(_signature) qualname = name or getattr(obj, "__qualname__", name) # If obj is a module, there may be classes (which are callable) to display if inspect.isclass(obj): prefix = "class" elif inspect.iscoroutinefunction(obj): prefix = "async def" else: prefix = "def" qual_signature = Text.assemble( (f"{prefix} ", f"inspect.{prefix.replace(' ', '_')}"), (qualname, "inspect.callable"), signature_text, ) return qual_signature def _render(self) -> Iterable[RenderableType]: """Render object.""" def sort_items(item: Tuple[str, Any]) -> Tuple[bool, str]: key, (_error, value) = item return (callable(value), key.strip("_").lower()) def safe_getattr(attr_name: str) -> Tuple[Any, Any]: """Get attribute or any exception.""" try: return (None, getattr(obj, attr_name)) except Exception as error: return (error, None) obj = self.obj keys = dir(obj) total_items = len(keys) if not self.dunder: keys = [key for key in keys if not key.startswith("__")] if not self.private: keys = [key for key in keys if not key.startswith("_")] not_shown_count = total_items - len(keys) items = [(key, safe_getattr(key)) for key in keys] if self.sort: items.sort(key=sort_items) items_table = Table.grid(padding=(0, 1), expand=False) items_table.add_column(justify="right") add_row = items_table.add_row highlighter = self.highlighter if callable(obj): signature = self._get_signature("", obj) if signature is not None: yield signature yield "" if self.docs: _doc = self._get_formatted_doc(obj) if _doc is not None: doc_text = Text(_doc, style="inspect.help") doc_text = highlighter(doc_text) yield doc_text yield "" if self.value and not (isclass(obj) or callable(obj) or ismodule(obj)): yield Panel( Pretty(obj, indent_guides=True, max_length=10, max_string=60), border_style="inspect.value.border", ) yield "" for key, (error, value) in items: key_text = Text.assemble( ( key, "inspect.attr.dunder" if key.startswith("__") else "inspect.attr", ), (" =", "inspect.equals"), ) if error is not None: warning = key_text.copy() warning.stylize("inspect.error") add_row(warning, highlighter(repr(error))) continue if callable(value): if not self.methods: continue _signature_text = self._get_signature(key, value) if _signature_text is None: add_row(key_text, Pretty(value, highlighter=highlighter)) else: if self.docs: docs = self._get_formatted_doc(value) if docs is not None: _signature_text.append("\n" if "\n" in docs else " ") doc = highlighter(docs) doc.stylize("inspect.doc") _signature_text.append(doc) add_row(key_text, _signature_text) else: add_row(key_text, Pretty(value, highlighter=highlighter)) if items_table.row_count: yield items_table elif not_shown_count: yield Text.from_markup( f"[b cyan]{not_shown_count}[/][i] attribute(s) not shown.[/i] " f"Run [b][magenta]inspect[/]([not b]inspect[/])[/b] for options." ) def _get_formatted_doc(self, object_: Any) -> Optional[str]: """ Extract the docstring of an object, process it and returns it. The processing consists in cleaning up the docstring's indentation, taking only its 1st paragraph if `self.help` is not True, and escape its control codes. Args: object_ (Any): the object to get the docstring from. Returns: Optional[str]: the processed docstring, or None if no docstring was found. """ docs = getdoc(object_) if docs is None: return None docs = cleandoc(docs).strip() if not self.help: docs = _first_paragraph(docs) return escape_control_codes(docs) def get_object_types_mro(obj: Union[object, Type[Any]]) -> Tuple[type, ...]: """Returns the MRO of an object's class, or of the object itself if it's a class.""" if not hasattr(obj, "__mro__"): # N.B. we cannot use `if type(obj) is type` here because it doesn't work with # some types of classes, such as the ones that use abc.ABCMeta. obj = type(obj) return getattr(obj, "__mro__", ()) def get_object_types_mro_as_strings(obj: object) -> Collection[str]: """ Returns the MRO of an object's class as full qualified names, or of the object itself if it's a class. Examples: `object_types_mro_as_strings(JSONDecoder)` will return `['json.decoder.JSONDecoder', 'builtins.object']` """ return [ f'{getattr(type_, "__module__", "")}.{getattr(type_, "__qualname__", "")}' for type_ in get_object_types_mro(obj) ] def is_object_one_of_types( obj: object, fully_qualified_types_names: Collection[str] ) -> bool: """ Returns `True` if the given object's class (or the object itself, if it's a class) has one of the fully qualified names in its MRO. """ for type_name in get_object_types_mro_as_strings(obj): if type_name in fully_qualified_types_names: return True return False	9.43 KB	2026-01-20 12:58
📄 _log_render.py from datetime import datetime from typing import Iterable, List, Optional, TYPE_CHECKING, Union, Callable from .text import Text, TextType if TYPE_CHECKING: from .console import Console, ConsoleRenderable, RenderableType from .table import Table FormatTimeCallable = Callable[[datetime], Text] class LogRender: def __init__( self, show_time: bool = True, show_level: bool = False, show_path: bool = True, time_format: Union[str, FormatTimeCallable] = "[%x %X]", omit_repeated_times: bool = True, level_width: Optional[int] = 8, ) -> None: self.show_time = show_time self.show_level = show_level self.show_path = show_path self.time_format = time_format self.omit_repeated_times = omit_repeated_times self.level_width = level_width self._last_time: Optional[Text] = None def __call__( self, console: "Console", renderables: Iterable["ConsoleRenderable"], log_time: Optional[datetime] = None, time_format: Optional[Union[str, FormatTimeCallable]] = None, level: TextType = "", path: Optional[str] = None, line_no: Optional[int] = None, link_path: Optional[str] = None, ) -> "Table": from .containers import Renderables from .table import Table output = Table.grid(padding=(0, 1)) output.expand = True if self.show_time: output.add_column(style="log.time") if self.show_level: output.add_column(style="log.level", width=self.level_width) output.add_column(ratio=1, style="log.message", overflow="fold") if self.show_path and path: output.add_column(style="log.path") row: List["RenderableType"] = [] if self.show_time: log_time = log_time or console.get_datetime() time_format = time_format or self.time_format if callable(time_format): log_time_display = time_format(log_time) else: log_time_display = Text(log_time.strftime(time_format)) if log_time_display == self._last_time and self.omit_repeated_times: row.append(Text(" " * len(log_time_display))) else: row.append(log_time_display) self._last_time = log_time_display if self.show_level: row.append(level) row.append(Renderables(renderables)) if self.show_path and path: path_text = Text() path_text.append( path, style=f"link file://{link_path}" if link_path else "" ) if line_no: path_text.append(":") path_text.append( f"{line_no}", style=f"link file://{link_path}#{line_no}" if link_path else "", ) row.append(path_text) output.add_row(*row) return output if __name__ == "__main__": # pragma: no cover from pip._vendor.rich.console import Console c = Console() c.print("[on blue]Hello", justify="right") c.log("[on blue]hello", justify="right")	3.15 KB	2026-01-20 12:58
📄 _loop.py from typing import Iterable, Tuple, TypeVar T = TypeVar("T") def loop_first(values: Iterable[T]) -> Iterable[Tuple[bool, T]]: """Iterate and generate a tuple with a flag for first value.""" iter_values = iter(values) try: value = next(iter_values) except StopIteration: return yield True, value for value in iter_values: yield False, value def loop_last(values: Iterable[T]) -> Iterable[Tuple[bool, T]]: """Iterate and generate a tuple with a flag for last value.""" iter_values = iter(values) try: previous_value = next(iter_values) except StopIteration: return for value in iter_values: yield False, previous_value previous_value = value yield True, previous_value def loop_first_last(values: Iterable[T]) -> Iterable[Tuple[bool, bool, T]]: """Iterate and generate a tuple with a flag for first and last value.""" iter_values = iter(values) try: previous_value = next(iter_values) except StopIteration: return first = True for value in iter_values: yield first, False, previous_value first = False previous_value = value yield first, True, previous_value	1.21 KB	2026-01-20 12:58
📄 _null_file.py from types import TracebackType from typing import IO, Iterable, Iterator, List, Optional, Type class NullFile(IO[str]): def close(self) -> None: pass def isatty(self) -> bool: return False def read(self, __n: int = 1) -> str: return "" def readable(self) -> bool: return False def readline(self, __limit: int = 1) -> str: return "" def readlines(self, __hint: int = 1) -> List[str]: return [] def seek(self, __offset: int, __whence: int = 1) -> int: return 0 def seekable(self) -> bool: return False def tell(self) -> int: return 0 def truncate(self, __size: Optional[int] = 1) -> int: return 0 def writable(self) -> bool: return False def writelines(self, __lines: Iterable[str]) -> None: pass def __next__(self) -> str: return "" def __iter__(self) -> Iterator[str]: return iter([""]) def __enter__(self) -> IO[str]: return self def __exit__( self, __t: Optional[Type[BaseException]], __value: Optional[BaseException], __traceback: Optional[TracebackType], ) -> None: pass def write(self, text: str) -> int: return 0 def flush(self) -> None: pass def fileno(self) -> int: return -1 NULL_FILE = NullFile()	1.36 KB	2026-01-20 12:58
📄 _palettes.py from .palette import Palette # Taken from https://en.wikipedia.org/wiki/ANSI_escape_code (Windows 10 column) WINDOWS_PALETTE = Palette( [ (12, 12, 12), (197, 15, 31), (19, 161, 14), (193, 156, 0), (0, 55, 218), (136, 23, 152), (58, 150, 221), (204, 204, 204), (118, 118, 118), (231, 72, 86), (22, 198, 12), (249, 241, 165), (59, 120, 255), (180, 0, 158), (97, 214, 214), (242, 242, 242), ] ) # # The standard ansi colors (including bright variants) STANDARD_PALETTE = Palette( [ (0, 0, 0), (170, 0, 0), (0, 170, 0), (170, 85, 0), (0, 0, 170), (170, 0, 170), (0, 170, 170), (170, 170, 170), (85, 85, 85), (255, 85, 85), (85, 255, 85), (255, 255, 85), (85, 85, 255), (255, 85, 255), (85, 255, 255), (255, 255, 255), ] ) # The 256 color palette EIGHT_BIT_PALETTE = Palette( [ (0, 0, 0), (128, 0, 0), (0, 128, 0), (128, 128, 0), (0, 0, 128), (128, 0, 128), (0, 128, 128), (192, 192, 192), (128, 128, 128), (255, 0, 0), (0, 255, 0), (255, 255, 0), (0, 0, 255), (255, 0, 255), (0, 255, 255), (255, 255, 255), (0, 0, 0), (0, 0, 95), (0, 0, 135), (0, 0, 175), (0, 0, 215), (0, 0, 255), (0, 95, 0), (0, 95, 95), (0, 95, 135), (0, 95, 175), (0, 95, 215), (0, 95, 255), (0, 135, 0), (0, 135, 95), (0, 135, 135), (0, 135, 175), (0, 135, 215), (0, 135, 255), (0, 175, 0), (0, 175, 95), (0, 175, 135), (0, 175, 175), (0, 175, 215), (0, 175, 255), (0, 215, 0), (0, 215, 95), (0, 215, 135), (0, 215, 175), (0, 215, 215), (0, 215, 255), (0, 255, 0), (0, 255, 95), (0, 255, 135), (0, 255, 175), (0, 255, 215), (0, 255, 255), (95, 0, 0), (95, 0, 95), (95, 0, 135), (95, 0, 175), (95, 0, 215), (95, 0, 255), (95, 95, 0), (95, 95, 95), (95, 95, 135), (95, 95, 175), (95, 95, 215), (95, 95, 255), (95, 135, 0), (95, 135, 95), (95, 135, 135), (95, 135, 175), (95, 135, 215), (95, 135, 255), (95, 175, 0), (95, 175, 95), (95, 175, 135), (95, 175, 175), (95, 175, 215), (95, 175, 255), (95, 215, 0), (95, 215, 95), (95, 215, 135), (95, 215, 175), (95, 215, 215), (95, 215, 255), (95, 255, 0), (95, 255, 95), (95, 255, 135), (95, 255, 175), (95, 255, 215), (95, 255, 255), (135, 0, 0), (135, 0, 95), (135, 0, 135), (135, 0, 175), (135, 0, 215), (135, 0, 255), (135, 95, 0), (135, 95, 95), (135, 95, 135), (135, 95, 175), (135, 95, 215), (135, 95, 255), (135, 135, 0), (135, 135, 95), (135, 135, 135), (135, 135, 175), (135, 135, 215), (135, 135, 255), (135, 175, 0), (135, 175, 95), (135, 175, 135), (135, 175, 175), (135, 175, 215), (135, 175, 255), (135, 215, 0), (135, 215, 95), (135, 215, 135), (135, 215, 175), (135, 215, 215), (135, 215, 255), (135, 255, 0), (135, 255, 95), (135, 255, 135), (135, 255, 175), (135, 255, 215), (135, 255, 255), (175, 0, 0), (175, 0, 95), (175, 0, 135), (175, 0, 175), (175, 0, 215), (175, 0, 255), (175, 95, 0), (175, 95, 95), (175, 95, 135), (175, 95, 175), (175, 95, 215), (175, 95, 255), (175, 135, 0), (175, 135, 95), (175, 135, 135), (175, 135, 175), (175, 135, 215), (175, 135, 255), (175, 175, 0), (175, 175, 95), (175, 175, 135), (175, 175, 175), (175, 175, 215), (175, 175, 255), (175, 215, 0), (175, 215, 95), (175, 215, 135), (175, 215, 175), (175, 215, 215), (175, 215, 255), (175, 255, 0), (175, 255, 95), (175, 255, 135), (175, 255, 175), (175, 255, 215), (175, 255, 255), (215, 0, 0), (215, 0, 95), (215, 0, 135), (215, 0, 175), (215, 0, 215), (215, 0, 255), (215, 95, 0), (215, 95, 95), (215, 95, 135), (215, 95, 175), (215, 95, 215), (215, 95, 255), (215, 135, 0), (215, 135, 95), (215, 135, 135), (215, 135, 175), (215, 135, 215), (215, 135, 255), (215, 175, 0), (215, 175, 95), (215, 175, 135), (215, 175, 175), (215, 175, 215), (215, 175, 255), (215, 215, 0), (215, 215, 95), (215, 215, 135), (215, 215, 175), (215, 215, 215), (215, 215, 255), (215, 255, 0), (215, 255, 95), (215, 255, 135), (215, 255, 175), (215, 255, 215), (215, 255, 255), (255, 0, 0), (255, 0, 95), (255, 0, 135), (255, 0, 175), (255, 0, 215), (255, 0, 255), (255, 95, 0), (255, 95, 95), (255, 95, 135), (255, 95, 175), (255, 95, 215), (255, 95, 255), (255, 135, 0), (255, 135, 95), (255, 135, 135), (255, 135, 175), (255, 135, 215), (255, 135, 255), (255, 175, 0), (255, 175, 95), (255, 175, 135), (255, 175, 175), (255, 175, 215), (255, 175, 255), (255, 215, 0), (255, 215, 95), (255, 215, 135), (255, 215, 175), (255, 215, 215), (255, 215, 255), (255, 255, 0), (255, 255, 95), (255, 255, 135), (255, 255, 175), (255, 255, 215), (255, 255, 255), (8, 8, 8), (18, 18, 18), (28, 28, 28), (38, 38, 38), (48, 48, 48), (58, 58, 58), (68, 68, 68), (78, 78, 78), (88, 88, 88), (98, 98, 98), (108, 108, 108), (118, 118, 118), (128, 128, 128), (138, 138, 138), (148, 148, 148), (158, 158, 158), (168, 168, 168), (178, 178, 178), (188, 188, 188), (198, 198, 198), (208, 208, 208), (218, 218, 218), (228, 228, 228), (238, 238, 238), ] )	6.9 KB	2026-01-20 12:58
📄 _pick.py from typing import Optional def pick_bool(values: Optional[bool]) -> bool: """Pick the first non-none bool or return the last value. Args: values (bool): Any number of boolean or None values. Returns: bool: First non-none boolean. """ assert values, "1 or more values required" for value in values: if value is not None: return value return bool(value)	423 B	2026-01-20 12:58
📄 _ratio.py from fractions import Fraction from math import ceil from typing import cast, List, Optional, Sequence, Protocol class Edge(Protocol): """Any object that defines an edge (such as Layout).""" size: Optional[int] = None ratio: int = 1 minimum_size: int = 1 def ratio_resolve(total: int, edges: Sequence[Edge]) -> List[int]: """Divide total space to satisfy size, ratio, and minimum_size, constraints. The returned list of integers should add up to total in most cases, unless it is impossible to satisfy all the constraints. For instance, if there are two edges with a minimum size of 20 each and `total` is 30 then the returned list will be greater than total. In practice, this would mean that a Layout object would clip the rows that would overflow the screen height. Args: total (int): Total number of characters. edges (List[Edge]): Edges within total space. Returns: List[int]: Number of characters for each edge. """ # Size of edge or None for yet to be determined sizes = [(edge.size or None) for edge in edges] _Fraction = Fraction # While any edges haven't been calculated while None in sizes: # Get flexible edges and index to map these back on to sizes list flexible_edges = [ (index, edge) for index, (size, edge) in enumerate(zip(sizes, edges)) if size is None ] # Remaining space in total remaining = total - sum(size or 0 for size in sizes) if remaining <= 0: # No room for flexible edges return [ ((edge.minimum_size or 1) if size is None else size) for size, edge in zip(sizes, edges) ] # Calculate number of characters in a ratio portion portion = _Fraction( remaining, sum((edge.ratio or 1) for _, edge in flexible_edges) ) # If any edges will be less than their minimum, replace size with the minimum for index, edge in flexible_edges: if portion * edge.ratio <= edge.minimum_size: sizes[index] = edge.minimum_size # New fixed size will invalidate calculations, so we need to repeat the process break else: # Distribute flexible space and compensate for rounding error # Since edge sizes can only be integers we need to add the remainder # to the following line remainder = _Fraction(0) for index, edge in flexible_edges: size, remainder = divmod(portion * edge.ratio + remainder, 1) sizes[index] = size break # Sizes now contains integers only return cast(List[int], sizes) def ratio_reduce( total: int, ratios: List[int], maximums: List[int], values: List[int] ) -> List[int]: """Divide an integer total in to parts based on ratios. Args: total (int): The total to divide. ratios (List[int]): A list of integer ratios. maximums (List[int]): List of maximums values for each slot. values (List[int]): List of values Returns: List[int]: A list of integers guaranteed to sum to total. """ ratios = [ratio if _max else 0 for ratio, _max in zip(ratios, maximums)] total_ratio = sum(ratios) if not total_ratio: return values[:] total_remaining = total result: List[int] = [] append = result.append for ratio, maximum, value in zip(ratios, maximums, values): if ratio and total_ratio > 0: distributed = min(maximum, round(ratio * total_remaining / total_ratio)) append(value - distributed) total_remaining -= distributed total_ratio -= ratio else: append(value) return result def ratio_distribute( total: int, ratios: List[int], minimums: Optional[List[int]] = None ) -> List[int]: """Distribute an integer total in to parts based on ratios. Args: total (int): The total to divide. ratios (List[int]): A list of integer ratios. minimums (List[int]): List of minimum values for each slot. Returns: List[int]: A list of integers guaranteed to sum to total. """ if minimums: ratios = [ratio if _min else 0 for ratio, _min in zip(ratios, minimums)] total_ratio = sum(ratios) assert total_ratio > 0, "Sum of ratios must be > 0" total_remaining = total distributed_total: List[int] = [] append = distributed_total.append if minimums is None: _minimums = [0] * len(ratios) else: _minimums = minimums for ratio, minimum in zip(ratios, _minimums): if total_ratio > 0: distributed = max(minimum, ceil(ratio * total_remaining / total_ratio)) else: distributed = total_remaining append(distributed) total_ratio -= ratio total_remaining -= distributed return distributed_total if __name__ == "__main__": from dataclasses import dataclass @dataclass class E: size: Optional[int] = None ratio: int = 1 minimum_size: int = 1 resolved = ratio_resolve(110, [E(None, 1, 1), E(None, 1, 1), E(None, 1, 1)]) print(sum(resolved))	5.2 KB	2026-01-20 12:58
📄 _spinners.py """ Spinners are from: * cli-spinners: MIT License Copyright (c) Sindre Sorhus <sindresorhus@gmail.com> (sindresorhus.com) Permission is hereby granted, free of charge, to any person obtaining a copy of this software and associated documentation files (the "Software"), to deal in the Software without restriction, including without limitation the rights to use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies of the Software, and to permit persons to whom the Software is furnished to do so, subject to the following conditions: The above copyright notice and this permission notice shall be included in all copies or substantial portions of the Software. THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. """ SPINNERS = { "dots": { "interval": 80, "frames": "⠋⠙⠹⠸⠼⠴⠦⠧⠇⠏", }, "dots2": {"interval": 80, "frames": "⣾⣽⣻⢿⡿⣟⣯⣷"}, "dots3": { "interval": 80, "frames": "⠋⠙⠚⠞⠖⠦⠴⠲⠳⠓", }, "dots4": { "interval": 80, "frames": "⠄⠆⠇⠋⠙⠸⠰⠠⠰⠸⠙⠋⠇⠆", }, "dots5": { "interval": 80, "frames": "⠋⠙⠚⠒⠂⠂⠒⠲⠴⠦⠖⠒⠐⠐⠒⠓⠋", }, "dots6": { "interval": 80, "frames": "⠁⠉⠙⠚⠒⠂⠂⠒⠲⠴⠤⠄⠄⠤⠴⠲⠒⠂⠂⠒⠚⠙⠉⠁", }, "dots7": { "interval": 80, "frames": "⠈⠉⠋⠓⠒⠐⠐⠒⠖⠦⠤⠠⠠⠤⠦⠖⠒⠐⠐⠒⠓⠋⠉⠈", }, "dots8": { "interval": 80, "frames": "⠁⠁⠉⠙⠚⠒⠂⠂⠒⠲⠴⠤⠄⠄⠤⠠⠠⠤⠦⠖⠒⠐⠐⠒⠓⠋⠉⠈⠈", }, "dots9": {"interval": 80, "frames": "⢹⢺⢼⣸⣇⡧⡗⡏"}, "dots10": {"interval": 80, "frames": "⢄⢂⢁⡁⡈⡐⡠"}, "dots11": {"interval": 100, "frames": "⠁⠂⠄⡀⢀⠠⠐⠈"}, "dots12": { "interval": 80, "frames": [ "⢀⠀", "⡀⠀", "⠄⠀", "⢂⠀", "⡂⠀", "⠅⠀", "⢃⠀", "⡃⠀", "⠍⠀", "⢋⠀", "⡋⠀", "⠍⠁", "⢋⠁", "⡋⠁", "⠍⠉", "⠋⠉", "⠋⠉", "⠉⠙", "⠉⠙", "⠉⠩", "⠈⢙", "⠈⡙", "⢈⠩", "⡀⢙", "⠄⡙", "⢂⠩", "⡂⢘", "⠅⡘", "⢃⠨", "⡃⢐", "⠍⡐", "⢋⠠", "⡋⢀", "⠍⡁", "⢋⠁", "⡋⠁", "⠍⠉", "⠋⠉", "⠋⠉", "⠉⠙", "⠉⠙", "⠉⠩", "⠈⢙", "⠈⡙", "⠈⠩", "⠀⢙", "⠀⡙", "⠀⠩", "⠀⢘", "⠀⡘", "⠀⠨", "⠀⢐", "⠀⡐", "⠀⠠", "⠀⢀", "⠀⡀", ], }, "dots8Bit": { "interval": 80, "frames": "⠀⠁⠂⠃⠄⠅⠆⠇⡀⡁⡂⡃⡄⡅⡆⡇⠈⠉⠊⠋⠌⠍⠎⠏⡈⡉⡊⡋⡌⡍⡎⡏⠐⠑⠒⠓⠔⠕⠖⠗⡐⡑⡒⡓⡔⡕⡖⡗⠘⠙⠚⠛⠜⠝⠞⠟⡘⡙" "⡚⡛⡜⡝⡞⡟⠠⠡⠢⠣⠤⠥⠦⠧⡠⡡⡢⡣⡤⡥⡦⡧⠨⠩⠪⠫⠬⠭⠮⠯⡨⡩⡪⡫⡬⡭⡮⡯⠰⠱⠲⠳⠴⠵⠶⠷⡰⡱⡲⡳⡴⡵⡶⡷⠸⠹⠺⠻" "⠼⠽⠾⠿⡸⡹⡺⡻⡼⡽⡾⡿⢀⢁⢂⢃⢄⢅⢆⢇⣀⣁⣂⣃⣄⣅⣆⣇⢈⢉⢊⢋⢌⢍⢎⢏⣈⣉⣊⣋⣌⣍⣎⣏⢐⢑⢒⢓⢔⢕⢖⢗⣐⣑⣒⣓⣔⣕" "⣖⣗⢘⢙⢚⢛⢜⢝⢞⢟⣘⣙⣚⣛⣜⣝⣞⣟⢠⢡⢢⢣⢤⢥⢦⢧⣠⣡⣢⣣⣤⣥⣦⣧⢨⢩⢪⢫⢬⢭⢮⢯⣨⣩⣪⣫⣬⣭⣮⣯⢰⢱⢲⢳⢴⢵⢶⢷" "⣰⣱⣲⣳⣴⣵⣶⣷⢸⢹⢺⢻⢼⢽⢾⢿⣸⣹⣺⣻⣼⣽⣾⣿", }, "line": {"interval": 130, "frames": ["-", "\\", "\|", "/"]}, "line2": {"interval": 100, "frames": "⠂-–—–-"}, "pipe": {"interval": 100, "frames": "┤┘┴└├┌┬┐"}, "simpleDots": {"interval": 400, "frames": [". ", ".. ", "...", " "]}, "simpleDotsScrolling": { "interval": 200, "frames": [". ", ".. ", "...", " ..", " .", " "], }, "star": {"interval": 70, "frames": "✶✸✹✺✹✷"}, "star2": {"interval": 80, "frames": "+x"}, "flip": { "interval": 70, "frames": "___-``'´-___", }, "hamburger": {"interval": 100, "frames": "☱☲☴"}, "growVertical": { "interval": 120, "frames": "▁▃▄▅▆▇▆▅▄▃", }, "growHorizontal": { "interval": 120, "frames": "▏▎▍▌▋▊▉▊▋▌▍▎", }, "balloon": {"interval": 140, "frames": " .oO@ "}, "balloon2": {"interval": 120, "frames": ".oO°Oo."}, "noise": {"interval": 100, "frames": "▓▒░"}, "bounce": {"interval": 120, "frames": "⠁⠂⠄⠂"}, "boxBounce": {"interval": 120, "frames": "▖▘▝▗"}, "boxBounce2": {"interval": 100, "frames": "▌▀▐▄"}, "triangle": {"interval": 50, "frames": "◢◣◤◥"}, "arc": {"interval": 100, "frames": "◜◠◝◞◡◟"}, "circle": {"interval": 120, "frames": "◡⊙◠"}, "squareCorners": {"interval": 180, "frames": "◰◳◲◱"}, "circleQuarters": {"interval": 120, "frames": "◴◷◶◵"}, "circleHalves": {"interval": 50, "frames": "◐◓◑◒"}, "squish": {"interval": 100, "frames": "╫╪"}, "toggle": {"interval": 250, "frames": "⊶⊷"}, "toggle2": {"interval": 80, "frames": "▫▪"}, "toggle3": {"interval": 120, "frames": "□■"}, "toggle4": {"interval": 100, "frames": "■□▪▫"}, "toggle5": {"interval": 100, "frames": "▮▯"}, "toggle6": {"interval": 300, "frames": "ဝ၀"}, "toggle7": {"interval": 80, "frames": "⦾⦿"}, "toggle8": {"interval": 100, "frames": "◍◌"}, "toggle9": {"interval": 100, "frames": "◉◎"}, "toggle10": {"interval": 100, "frames": "㊂㊀㊁"}, "toggle11": {"interval": 50, "frames": "⧇⧆"}, "toggle12": {"interval": 120, "frames": "☗☖"}, "toggle13": {"interval": 80, "frames": "=*-"}, "arrow": {"interval": 100, "frames": "←↖↑↗→↘↓↙"}, "arrow2": { "interval": 80, "frames": ["⬆️ ", "↗️ ", "➡️ ", "↘️ ", "⬇️ ", "↙️ ", "⬅️ ", "↖️ "], }, "arrow3": { "interval": 120, "frames": ["▹▹▹▹▹", "▸▹▹▹▹", "▹▸▹▹▹", "▹▹▸▹▹", "▹▹▹▸▹", "▹▹▹▹▸"], }, "bouncingBar": { "interval": 80, "frames": [ "[ ]", "[= ]", "[== ]", "[=== ]", "[ ===]", "[ ==]", "[ =]", "[ ]", "[ =]", "[ ==]", "[ ===]", "[====]", "[=== ]", "[== ]", "[= ]", ], }, "bouncingBall": { "interval": 80, "frames": [ "( ● )", "( ● )", "( ● )", "( ● )", "( ●)", "( ● )", "( ● )", "( ● )", "( ● )", "(● )", ], }, "smiley": {"interval": 200, "frames": ["😄 ", "😝 "]}, "monkey": {"interval": 300, "frames": ["🙈 ", "🙈 ", "🙉 ", "🙊 "]}, "hearts": {"interval": 100, "frames": ["💛 ", "💙 ", "💜 ", "💚 ", "❤️ "]}, "clock": { "interval": 100, "frames": [ "🕛 ", "🕐 ", "🕑 ", "🕒 ", "🕓 ", "🕔 ", "🕕 ", "🕖 ", "🕗 ", "🕘 ", "🕙 ", "🕚 ", ], }, "earth": {"interval": 180, "frames": ["🌍 ", "🌎 ", "🌏 "]}, "material": { "interval": 17, "frames": [ "█▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁", "██▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁", "███▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁", "████▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁", "██████▁▁▁▁▁▁▁▁▁▁▁▁▁▁", "██████▁▁▁▁▁▁▁▁▁▁▁▁▁▁", "███████▁▁▁▁▁▁▁▁▁▁▁▁▁", "████████▁▁▁▁▁▁▁▁▁▁▁▁", "█████████▁▁▁▁▁▁▁▁▁▁▁", "█████████▁▁▁▁▁▁▁▁▁▁▁", "██████████▁▁▁▁▁▁▁▁▁▁", "███████████▁▁▁▁▁▁▁▁▁", "█████████████▁▁▁▁▁▁▁", "██████████████▁▁▁▁▁▁", "██████████████▁▁▁▁▁▁", "▁██████████████▁▁▁▁▁", "▁██████████████▁▁▁▁▁", "▁██████████████▁▁▁▁▁", "▁▁██████████████▁▁▁▁", "▁▁▁██████████████▁▁▁", "▁▁▁▁█████████████▁▁▁", "▁▁▁▁██████████████▁▁", "▁▁▁▁██████████████▁▁", "▁▁▁▁▁██████████████▁", "▁▁▁▁▁██████████████▁", "▁▁▁▁▁██████████████▁", "▁▁▁▁▁▁██████████████", "▁▁▁▁▁▁██████████████", "▁▁▁▁▁▁▁█████████████", "▁▁▁▁▁▁▁█████████████", "▁▁▁▁▁▁▁▁████████████", "▁▁▁▁▁▁▁▁████████████", "▁▁▁▁▁▁▁▁▁███████████", "▁▁▁▁▁▁▁▁▁███████████", "▁▁▁▁▁▁▁▁▁▁██████████", "▁▁▁▁▁▁▁▁▁▁██████████", "▁▁▁▁▁▁▁▁▁▁▁▁████████", "▁▁▁▁▁▁▁▁▁▁▁▁▁███████", "▁▁▁▁▁▁▁▁▁▁▁▁▁▁██████", "▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁█████", "▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁█████", "█▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁████", "██▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁███", "██▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁███", "███▁▁▁▁▁▁▁▁▁▁▁▁▁▁███", "████▁▁▁▁▁▁▁▁▁▁▁▁▁▁██", "█████▁▁▁▁▁▁▁▁▁▁▁▁▁▁█", "█████▁▁▁▁▁▁▁▁▁▁▁▁▁▁█", "██████▁▁▁▁▁▁▁▁▁▁▁▁▁█", "████████▁▁▁▁▁▁▁▁▁▁▁▁", "█████████▁▁▁▁▁▁▁▁▁▁▁", "█████████▁▁▁▁▁▁▁▁▁▁▁", "█████████▁▁▁▁▁▁▁▁▁▁▁", "█████████▁▁▁▁▁▁▁▁▁▁▁", "███████████▁▁▁▁▁▁▁▁▁", "████████████▁▁▁▁▁▁▁▁", "████████████▁▁▁▁▁▁▁▁", "██████████████▁▁▁▁▁▁", "██████████████▁▁▁▁▁▁", "▁██████████████▁▁▁▁▁", "▁██████████████▁▁▁▁▁", "▁▁▁█████████████▁▁▁▁", "▁▁▁▁▁████████████▁▁▁", "▁▁▁▁▁████████████▁▁▁", "▁▁▁▁▁▁███████████▁▁▁", "▁▁▁▁▁▁▁▁█████████▁▁▁", "▁▁▁▁▁▁▁▁█████████▁▁▁", "▁▁▁▁▁▁▁▁▁█████████▁▁", "▁▁▁▁▁▁▁▁▁█████████▁▁", "▁▁▁▁▁▁▁▁▁▁█████████▁", "▁▁▁▁▁▁▁▁▁▁▁████████▁", "▁▁▁▁▁▁▁▁▁▁▁████████▁", "▁▁▁▁▁▁▁▁▁▁▁▁███████▁", "▁▁▁▁▁▁▁▁▁▁▁▁███████▁", "▁▁▁▁▁▁▁▁▁▁▁▁▁███████", "▁▁▁▁▁▁▁▁▁▁▁▁▁███████", "▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁█████", "▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁████", "▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁████", "▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁████", "▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁███", "▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁███", "▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁██", "▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁██", "▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁██", "▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁█", "▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁█", "▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁█", "▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁", "▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁", "▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁", "▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁", ], }, "moon": { "interval": 80, "frames": ["🌑 ", "🌒 ", "🌓 ", "🌔 ", "🌕 ", "🌖 ", "🌗 ", "🌘 "], }, "runner": {"interval": 140, "frames": ["🚶 ", "🏃 "]}, "pong": { "interval": 80, "frames": [ "▐⠂ ▌", "▐⠈ ▌", "▐ ⠂ ▌", "▐ ⠠ ▌", "▐ ⡀ ▌", "▐ ⠠ ▌", "▐ ⠂ ▌", "▐ ⠈ ▌", "▐ ⠂ ▌", "▐ ⠠ ▌", "▐ ⡀ ▌", "▐ ⠠ ▌", "▐ ⠂ ▌", "▐ ⠈ ▌", "▐ ⠂▌", "▐ ⠠▌", "▐ ⡀▌", "▐ ⠠ ▌", "▐ ⠂ ▌", "▐ ⠈ ▌", "▐ ⠂ ▌", "▐ ⠠ ▌", "▐ ⡀ ▌", "▐ ⠠ ▌", "▐ ⠂ ▌", "▐ ⠈ ▌", "▐ ⠂ ▌", "▐ ⠠ ▌", "▐ ⡀ ▌", "▐⠠ ▌", ], }, "shark": { "interval": 120, "frames": [ "▐\|\\____________▌", "▐_\|\\___________▌", "▐__\|\\__________▌", "▐___\|\\_________▌", "▐____\|\\________▌", "▐_____\|\\_______▌", "▐______\|\\______▌", "▐_______\|\\_____▌", "▐________\|\\____▌", "▐_________\|\\___▌", "▐__________\|\\__▌", "▐___________\|\\_▌", "▐____________\|\\▌", "▐____________/\|▌", "▐___________/\|_▌", "▐__________/\|__▌", "▐_________/\|___▌", "▐________/\|____▌", "▐_______/\|_____▌", "▐______/\|______▌", "▐_____/\|_______▌", "▐____/\|________▌", "▐___/\|_________▌", "▐__/\|__________▌", "▐_/\|___________▌", "▐/\|____________▌", ], }, "dqpb": {"interval": 100, "frames": "dqpb"}, "weather": { "interval": 100, "frames": [ "☀️ ", "☀️ ", "☀️ ", "🌤 ", "⛅️ ", "🌥 ", "☁️ ", "🌧 ", "🌨 ", "🌧 ", "🌨 ", "🌧 ", "🌨 ", "⛈ ", "🌨 ", "🌧 ", "🌨 ", "☁️ ", "🌥 ", "⛅️ ", "🌤 ", "☀️ ", "☀️ ", ], }, "christmas": {"interval": 400, "frames": "🌲🎄"}, "grenade": { "interval": 80, "frames": [ "، ", "′ ", " ´ ", " ‾ ", " ⸌", " ⸊", " \|", " ⁎", " ⁕", " ෴ ", " ⁓", " ", " ", " ", ], }, "point": {"interval": 125, "frames": ["∙∙∙", "●∙∙", "∙●∙", "∙∙●", "∙∙∙"]}, "layer": {"interval": 150, "frames": "-=≡"}, "betaWave": { "interval": 80, "frames": [ "ρββββββ", "βρβββββ", "ββρββββ", "βββρβββ", "ββββρββ", "βββββρβ", "ββββββρ", ], }, "aesthetic": { "interval": 80, "frames": [ "▰▱▱▱▱▱▱", "▰▰▱▱▱▱▱", "▰▰▰▱▱▱▱", "▰▰▰▰▱▱▱", "▰▰▰▰▰▱▱", "▰▰▰▰▰▰▱", "▰▰▰▰▰▰▰", "▰▱▱▱▱▱▱", ], }, }	19.45 KB	2026-01-20 12:58
📄 _stack.py from typing import List, TypeVar T = TypeVar("T") class Stack(List[T]): """A small shim over builtin list.""" @property def top(self) -> T: """Get top of stack.""" return self[-1] def push(self, item: T) -> None: """Push an item on to the stack (append in stack nomenclature).""" self.append(item)	351 B	2026-01-20 12:58
📄 _timer.py """ Timer context manager, only used in debug. """ from time import time import contextlib from typing import Generator @contextlib.contextmanager def timer(subject: str = "time") -> Generator[None, None, None]: """print the elapsed time. (only used in debugging)""" start = time() yield elapsed = time() - start elapsed_ms = elapsed * 1000 print(f"{subject} elapsed {elapsed_ms:.1f}ms")	417 B	2026-01-20 12:58
📄 _win32_console.py """Light wrapper around the Win32 Console API - this module should only be imported on Windows The API that this module wraps is documented at https://docs.microsoft.com/en-us/windows/console/console-functions """ import ctypes import sys from typing import Any windll: Any = None if sys.platform == "win32": windll = ctypes.LibraryLoader(ctypes.WinDLL) else: raise ImportError(f"{__name__} can only be imported on Windows") import time from ctypes import Structure, byref, wintypes from typing import IO, NamedTuple, Type, cast from pip._vendor.rich.color import ColorSystem from pip._vendor.rich.style import Style STDOUT = -11 ENABLE_VIRTUAL_TERMINAL_PROCESSING = 4 COORD = wintypes._COORD class LegacyWindowsError(Exception): pass class WindowsCoordinates(NamedTuple): """Coordinates in the Windows Console API are (y, x), not (x, y). This class is intended to prevent that confusion. Rows and columns are indexed from 0. This class can be used in place of wintypes._COORD in arguments and argtypes. """ row: int col: int @classmethod def from_param(cls, value: "WindowsCoordinates") -> COORD: """Converts a WindowsCoordinates into a wintypes _COORD structure. This classmethod is internally called by ctypes to perform the conversion. Args: value (WindowsCoordinates): The input coordinates to convert. Returns: wintypes._COORD: The converted coordinates struct. """ return COORD(value.col, value.row) class CONSOLE_SCREEN_BUFFER_INFO(Structure): _fields_ = [ ("dwSize", COORD), ("dwCursorPosition", COORD), ("wAttributes", wintypes.WORD), ("srWindow", wintypes.SMALL_RECT), ("dwMaximumWindowSize", COORD), ] class CONSOLE_CURSOR_INFO(ctypes.Structure): _fields_ = [("dwSize", wintypes.DWORD), ("bVisible", wintypes.BOOL)] _GetStdHandle = windll.kernel32.GetStdHandle _GetStdHandle.argtypes = [ wintypes.DWORD, ] _GetStdHandle.restype = wintypes.HANDLE def GetStdHandle(handle: int = STDOUT) -> wintypes.HANDLE: """Retrieves a handle to the specified standard device (standard input, standard output, or standard error). Args: handle (int): Integer identifier for the handle. Defaults to -11 (stdout). Returns: wintypes.HANDLE: The handle """ return cast(wintypes.HANDLE, _GetStdHandle(handle)) _GetConsoleMode = windll.kernel32.GetConsoleMode _GetConsoleMode.argtypes = [wintypes.HANDLE, wintypes.LPDWORD] _GetConsoleMode.restype = wintypes.BOOL def GetConsoleMode(std_handle: wintypes.HANDLE) -> int: """Retrieves the current input mode of a console's input buffer or the current output mode of a console screen buffer. Args: std_handle (wintypes.HANDLE): A handle to the console input buffer or the console screen buffer. Raises: LegacyWindowsError: If any error occurs while calling the Windows console API. Returns: int: Value representing the current console mode as documented at https://docs.microsoft.com/en-us/windows/console/getconsolemode#parameters """ console_mode = wintypes.DWORD() success = bool(_GetConsoleMode(std_handle, console_mode)) if not success: raise LegacyWindowsError("Unable to get legacy Windows Console Mode") return console_mode.value _FillConsoleOutputCharacterW = windll.kernel32.FillConsoleOutputCharacterW _FillConsoleOutputCharacterW.argtypes = [ wintypes.HANDLE, ctypes.c_char, wintypes.DWORD, cast(Type[COORD], WindowsCoordinates), ctypes.POINTER(wintypes.DWORD), ] _FillConsoleOutputCharacterW.restype = wintypes.BOOL def FillConsoleOutputCharacter( std_handle: wintypes.HANDLE, char: str, length: int, start: WindowsCoordinates, ) -> int: """Writes a character to the console screen buffer a specified number of times, beginning at the specified coordinates. Args: std_handle (wintypes.HANDLE): A handle to the console input buffer or the console screen buffer. char (str): The character to write. Must be a string of length 1. length (int): The number of times to write the character. start (WindowsCoordinates): The coordinates to start writing at. Returns: int: The number of characters written. """ character = ctypes.c_char(char.encode()) num_characters = wintypes.DWORD(length) num_written = wintypes.DWORD(0) _FillConsoleOutputCharacterW( std_handle, character, num_characters, start, byref(num_written), ) return num_written.value _FillConsoleOutputAttribute = windll.kernel32.FillConsoleOutputAttribute _FillConsoleOutputAttribute.argtypes = [ wintypes.HANDLE, wintypes.WORD, wintypes.DWORD, cast(Type[COORD], WindowsCoordinates), ctypes.POINTER(wintypes.DWORD), ] _FillConsoleOutputAttribute.restype = wintypes.BOOL def FillConsoleOutputAttribute( std_handle: wintypes.HANDLE, attributes: int, length: int, start: WindowsCoordinates, ) -> int: """Sets the character attributes for a specified number of character cells, beginning at the specified coordinates in a screen buffer. Args: std_handle (wintypes.HANDLE): A handle to the console input buffer or the console screen buffer. attributes (int): Integer value representing the foreground and background colours of the cells. length (int): The number of cells to set the output attribute of. start (WindowsCoordinates): The coordinates of the first cell whose attributes are to be set. Returns: int: The number of cells whose attributes were actually set. """ num_cells = wintypes.DWORD(length) style_attrs = wintypes.WORD(attributes) num_written = wintypes.DWORD(0) _FillConsoleOutputAttribute( std_handle, style_attrs, num_cells, start, byref(num_written) ) return num_written.value _SetConsoleTextAttribute = windll.kernel32.SetConsoleTextAttribute _SetConsoleTextAttribute.argtypes = [ wintypes.HANDLE, wintypes.WORD, ] _SetConsoleTextAttribute.restype = wintypes.BOOL def SetConsoleTextAttribute( std_handle: wintypes.HANDLE, attributes: wintypes.WORD ) -> bool: """Set the colour attributes for all text written after this function is called. Args: std_handle (wintypes.HANDLE): A handle to the console input buffer or the console screen buffer. attributes (int): Integer value representing the foreground and background colours. Returns: bool: True if the attribute was set successfully, otherwise False. """ return bool(_SetConsoleTextAttribute(std_handle, attributes)) _GetConsoleScreenBufferInfo = windll.kernel32.GetConsoleScreenBufferInfo _GetConsoleScreenBufferInfo.argtypes = [ wintypes.HANDLE, ctypes.POINTER(CONSOLE_SCREEN_BUFFER_INFO), ] _GetConsoleScreenBufferInfo.restype = wintypes.BOOL def GetConsoleScreenBufferInfo( std_handle: wintypes.HANDLE, ) -> CONSOLE_SCREEN_BUFFER_INFO: """Retrieves information about the specified console screen buffer. Args: std_handle (wintypes.HANDLE): A handle to the console input buffer or the console screen buffer. Returns: CONSOLE_SCREEN_BUFFER_INFO: A CONSOLE_SCREEN_BUFFER_INFO ctype struct contain information about screen size, cursor position, colour attributes, and more.""" console_screen_buffer_info = CONSOLE_SCREEN_BUFFER_INFO() _GetConsoleScreenBufferInfo(std_handle, byref(console_screen_buffer_info)) return console_screen_buffer_info _SetConsoleCursorPosition = windll.kernel32.SetConsoleCursorPosition _SetConsoleCursorPosition.argtypes = [ wintypes.HANDLE, cast(Type[COORD], WindowsCoordinates), ] _SetConsoleCursorPosition.restype = wintypes.BOOL def SetConsoleCursorPosition( std_handle: wintypes.HANDLE, coords: WindowsCoordinates ) -> bool: """Set the position of the cursor in the console screen Args: std_handle (wintypes.HANDLE): A handle to the console input buffer or the console screen buffer. coords (WindowsCoordinates): The coordinates to move the cursor to. Returns: bool: True if the function succeeds, otherwise False. """ return bool(_SetConsoleCursorPosition(std_handle, coords)) _GetConsoleCursorInfo = windll.kernel32.GetConsoleCursorInfo _GetConsoleCursorInfo.argtypes = [ wintypes.HANDLE, ctypes.POINTER(CONSOLE_CURSOR_INFO), ] _GetConsoleCursorInfo.restype = wintypes.BOOL def GetConsoleCursorInfo( std_handle: wintypes.HANDLE, cursor_info: CONSOLE_CURSOR_INFO ) -> bool: """Get the cursor info - used to get cursor visibility and width Args: std_handle (wintypes.HANDLE): A handle to the console input buffer or the console screen buffer. cursor_info (CONSOLE_CURSOR_INFO): CONSOLE_CURSOR_INFO ctype struct that receives information about the console's cursor. Returns: bool: True if the function succeeds, otherwise False. """ return bool(_GetConsoleCursorInfo(std_handle, byref(cursor_info))) _SetConsoleCursorInfo = windll.kernel32.SetConsoleCursorInfo _SetConsoleCursorInfo.argtypes = [ wintypes.HANDLE, ctypes.POINTER(CONSOLE_CURSOR_INFO), ] _SetConsoleCursorInfo.restype = wintypes.BOOL def SetConsoleCursorInfo( std_handle: wintypes.HANDLE, cursor_info: CONSOLE_CURSOR_INFO ) -> bool: """Set the cursor info - used for adjusting cursor visibility and width Args: std_handle (wintypes.HANDLE): A handle to the console input buffer or the console screen buffer. cursor_info (CONSOLE_CURSOR_INFO): CONSOLE_CURSOR_INFO ctype struct containing the new cursor info. Returns: bool: True if the function succeeds, otherwise False. """ return bool(_SetConsoleCursorInfo(std_handle, byref(cursor_info))) _SetConsoleTitle = windll.kernel32.SetConsoleTitleW _SetConsoleTitle.argtypes = [wintypes.LPCWSTR] _SetConsoleTitle.restype = wintypes.BOOL def SetConsoleTitle(title: str) -> bool: """Sets the title of the current console window Args: title (str): The new title of the console window. Returns: bool: True if the function succeeds, otherwise False. """ return bool(_SetConsoleTitle(title)) class LegacyWindowsTerm: """This class allows interaction with the legacy Windows Console API. It should only be used in the context of environments where virtual terminal processing is not available. However, if it is used in a Windows environment, the entire API should work. Args: file (IO[str]): The file which the Windows Console API HANDLE is retrieved from, defaults to sys.stdout. """ BRIGHT_BIT = 8 # Indices are ANSI color numbers, values are the corresponding Windows Console API color numbers ANSI_TO_WINDOWS = [ 0, # black The Windows colours are defined in wincon.h as follows: 4, # red define FOREGROUND_BLUE 0x0001 -- 0000 0001 2, # green define FOREGROUND_GREEN 0x0002 -- 0000 0010 6, # yellow define FOREGROUND_RED 0x0004 -- 0000 0100 1, # blue define FOREGROUND_INTENSITY 0x0008 -- 0000 1000 5, # magenta define BACKGROUND_BLUE 0x0010 -- 0001 0000 3, # cyan define BACKGROUND_GREEN 0x0020 -- 0010 0000 7, # white define BACKGROUND_RED 0x0040 -- 0100 0000 8, # bright black (grey) define BACKGROUND_INTENSITY 0x0080 -- 1000 0000 12, # bright red 10, # bright green 14, # bright yellow 9, # bright blue 13, # bright magenta 11, # bright cyan 15, # bright white ] def __init__(self, file: "IO[str]") -> None: handle = GetStdHandle(STDOUT) self._handle = handle default_text = GetConsoleScreenBufferInfo(handle).wAttributes self._default_text = default_text self._default_fore = default_text & 7 self._default_back = (default_text >> 4) & 7 self._default_attrs = self._default_fore \| (self._default_back << 4) self._file = file self.write = file.write self.flush = file.flush @property def cursor_position(self) -> WindowsCoordinates: """Returns the current position of the cursor (0-based) Returns: WindowsCoordinates: The current cursor position. """ coord: COORD = GetConsoleScreenBufferInfo(self._handle).dwCursorPosition return WindowsCoordinates(row=coord.Y, col=coord.X) @property def screen_size(self) -> WindowsCoordinates: """Returns the current size of the console screen buffer, in character columns and rows Returns: WindowsCoordinates: The width and height of the screen as WindowsCoordinates. """ screen_size: COORD = GetConsoleScreenBufferInfo(self._handle).dwSize return WindowsCoordinates(row=screen_size.Y, col=screen_size.X) def write_text(self, text: str) -> None: """Write text directly to the terminal without any modification of styles Args: text (str): The text to write to the console """ self.write(text) self.flush() def write_styled(self, text: str, style: Style) -> None: """Write styled text to the terminal. Args: text (str): The text to write style (Style): The style of the text """ color = style.color bgcolor = style.bgcolor if style.reverse: color, bgcolor = bgcolor, color if color: fore = color.downgrade(ColorSystem.WINDOWS).number fore = fore if fore is not None else 7 # Default to ANSI 7: White if style.bold: fore = fore \| self.BRIGHT_BIT if style.dim: fore = fore & ~self.BRIGHT_BIT fore = self.ANSI_TO_WINDOWS[fore] else: fore = self._default_fore if bgcolor: back = bgcolor.downgrade(ColorSystem.WINDOWS).number back = back if back is not None else 0 # Default to ANSI 0: Black back = self.ANSI_TO_WINDOWS[back] else: back = self._default_back assert fore is not None assert back is not None SetConsoleTextAttribute( self._handle, attributes=ctypes.c_ushort(fore \| (back << 4)) ) self.write_text(text) SetConsoleTextAttribute(self._handle, attributes=self._default_text) def move_cursor_to(self, new_position: WindowsCoordinates) -> None: """Set the position of the cursor Args: new_position (WindowsCoordinates): The WindowsCoordinates representing the new position of the cursor. """ if new_position.col < 0 or new_position.row < 0: return SetConsoleCursorPosition(self._handle, coords=new_position) def erase_line(self) -> None: """Erase all content on the line the cursor is currently located at""" screen_size = self.screen_size cursor_position = self.cursor_position cells_to_erase = screen_size.col start_coordinates = WindowsCoordinates(row=cursor_position.row, col=0) FillConsoleOutputCharacter( self._handle, " ", length=cells_to_erase, start=start_coordinates ) FillConsoleOutputAttribute( self._handle, self._default_attrs, length=cells_to_erase, start=start_coordinates, ) def erase_end_of_line(self) -> None: """Erase all content from the cursor position to the end of that line""" cursor_position = self.cursor_position cells_to_erase = self.screen_size.col - cursor_position.col FillConsoleOutputCharacter( self._handle, " ", length=cells_to_erase, start=cursor_position ) FillConsoleOutputAttribute( self._handle, self._default_attrs, length=cells_to_erase, start=cursor_position, ) def erase_start_of_line(self) -> None: """Erase all content from the cursor position to the start of that line""" row, col = self.cursor_position start = WindowsCoordinates(row, 0) FillConsoleOutputCharacter(self._handle, " ", length=col, start=start) FillConsoleOutputAttribute( self._handle, self._default_attrs, length=col, start=start ) def move_cursor_up(self) -> None: """Move the cursor up a single cell""" cursor_position = self.cursor_position SetConsoleCursorPosition( self._handle, coords=WindowsCoordinates( row=cursor_position.row - 1, col=cursor_position.col ), ) def move_cursor_down(self) -> None: """Move the cursor down a single cell""" cursor_position = self.cursor_position SetConsoleCursorPosition( self._handle, coords=WindowsCoordinates( row=cursor_position.row + 1, col=cursor_position.col, ), ) def move_cursor_forward(self) -> None: """Move the cursor forward a single cell. Wrap to the next line if required.""" row, col = self.cursor_position if col == self.screen_size.col - 1: row += 1 col = 0 else: col += 1 SetConsoleCursorPosition( self._handle, coords=WindowsCoordinates(row=row, col=col) ) def move_cursor_to_column(self, column: int) -> None: """Move cursor to the column specified by the zero-based column index, staying on the same row Args: column (int): The zero-based column index to move the cursor to. """ row, _ = self.cursor_position SetConsoleCursorPosition(self._handle, coords=WindowsCoordinates(row, column)) def move_cursor_backward(self) -> None: """Move the cursor backward a single cell. Wrap to the previous line if required.""" row, col = self.cursor_position if col == 0: row -= 1 col = self.screen_size.col - 1 else: col -= 1 SetConsoleCursorPosition( self._handle, coords=WindowsCoordinates(row=row, col=col) ) def hide_cursor(self) -> None: """Hide the cursor""" current_cursor_size = self._get_cursor_size() invisible_cursor = CONSOLE_CURSOR_INFO(dwSize=current_cursor_size, bVisible=0) SetConsoleCursorInfo(self._handle, cursor_info=invisible_cursor) def show_cursor(self) -> None: """Show the cursor""" current_cursor_size = self._get_cursor_size() visible_cursor = CONSOLE_CURSOR_INFO(dwSize=current_cursor_size, bVisible=1) SetConsoleCursorInfo(self._handle, cursor_info=visible_cursor) def set_title(self, title: str) -> None: """Set the title of the terminal window Args: title (str): The new title of the console window """ assert len(title) < 255, "Console title must be less than 255 characters" SetConsoleTitle(title) def _get_cursor_size(self) -> int: """Get the percentage of the character cell that is filled by the cursor""" cursor_info = CONSOLE_CURSOR_INFO() GetConsoleCursorInfo(self._handle, cursor_info=cursor_info) return int(cursor_info.dwSize) if __name__ == "__main__": handle = GetStdHandle() from pip._vendor.rich.console import Console console = Console() term = LegacyWindowsTerm(sys.stdout) term.set_title("Win32 Console Examples") style = Style(color="black", bgcolor="red") heading = Style.parse("black on green") # Check colour output console.rule("Checking colour output") console.print("[on red]on red!") console.print("[blue]blue!") console.print("[yellow]yellow!") console.print("[bold yellow]bold yellow!") console.print("[bright_yellow]bright_yellow!") console.print("[dim bright_yellow]dim bright_yellow!") console.print("[italic cyan]italic cyan!") console.print("[bold white on blue]bold white on blue!") console.print("[reverse bold white on blue]reverse bold white on blue!") console.print("[bold black on cyan]bold black on cyan!") console.print("[black on green]black on green!") console.print("[blue on green]blue on green!") console.print("[white on black]white on black!") console.print("[black on white]black on white!") console.print("[#1BB152 on #DA812D]#1BB152 on #DA812D!") # Check cursor movement console.rule("Checking cursor movement") console.print() term.move_cursor_backward() term.move_cursor_backward() term.write_text("went back and wrapped to prev line") time.sleep(1) term.move_cursor_up() term.write_text("we go up") time.sleep(1) term.move_cursor_down() term.write_text("and down") time.sleep(1) term.move_cursor_up() term.move_cursor_backward() term.move_cursor_backward() term.write_text("we went up and back 2") time.sleep(1) term.move_cursor_down() term.move_cursor_backward() term.move_cursor_backward() term.write_text("we went down and back 2") time.sleep(1) # Check erasing of lines term.hide_cursor() console.print() console.rule("Checking line erasing") console.print("\n...Deleting to the start of the line...") term.write_text("The red arrow shows the cursor location, and direction of erase") time.sleep(1) term.move_cursor_to_column(16) term.write_styled("<", Style.parse("black on red")) term.move_cursor_backward() time.sleep(1) term.erase_start_of_line() time.sleep(1) console.print("\n\n...And to the end of the line...") term.write_text("The red arrow shows the cursor location, and direction of erase") time.sleep(1) term.move_cursor_to_column(16) term.write_styled(">", Style.parse("black on red")) time.sleep(1) term.erase_end_of_line() time.sleep(1) console.print("\n\n...Now the whole line will be erased...") term.write_styled("I'm going to disappear!", style=Style.parse("black on cyan")) time.sleep(1) term.erase_line() term.show_cursor() print("\n")	22.22 KB	2026-01-20 12:58
📄 _windows.py import sys from dataclasses import dataclass @dataclass class WindowsConsoleFeatures: """Windows features available.""" vt: bool = False """The console supports VT codes.""" truecolor: bool = False """The console supports truecolor.""" try: import ctypes from ctypes import LibraryLoader if sys.platform == "win32": windll = LibraryLoader(ctypes.WinDLL) else: windll = None raise ImportError("Not windows") from pip._vendor.rich._win32_console import ( ENABLE_VIRTUAL_TERMINAL_PROCESSING, GetConsoleMode, GetStdHandle, LegacyWindowsError, ) except (AttributeError, ImportError, ValueError): # Fallback if we can't load the Windows DLL def get_windows_console_features() -> WindowsConsoleFeatures: features = WindowsConsoleFeatures() return features else: def get_windows_console_features() -> WindowsConsoleFeatures: """Get windows console features. Returns: WindowsConsoleFeatures: An instance of WindowsConsoleFeatures. """ handle = GetStdHandle() try: console_mode = GetConsoleMode(handle) success = True except LegacyWindowsError: console_mode = 0 success = False vt = bool(success and console_mode & ENABLE_VIRTUAL_TERMINAL_PROCESSING) truecolor = False if vt: win_version = sys.getwindowsversion() truecolor = win_version.major > 10 or ( win_version.major == 10 and win_version.build >= 15063 ) features = WindowsConsoleFeatures(vt=vt, truecolor=truecolor) return features if __name__ == "__main__": import platform features = get_windows_console_features() from pip._vendor.rich import print print(f'platform="{platform.system()}"') print(repr(features))	1.88 KB	2026-01-20 12:58
📄 _windows_renderer.py from typing import Iterable, Sequence, Tuple, cast from pip._vendor.rich._win32_console import LegacyWindowsTerm, WindowsCoordinates from pip._vendor.rich.segment import ControlCode, ControlType, Segment def legacy_windows_render(buffer: Iterable[Segment], term: LegacyWindowsTerm) -> None: """Makes appropriate Windows Console API calls based on the segments in the buffer. Args: buffer (Iterable[Segment]): Iterable of Segments to convert to Win32 API calls. term (LegacyWindowsTerm): Used to call the Windows Console API. """ for text, style, control in buffer: if not control: if style: term.write_styled(text, style) else: term.write_text(text) else: control_codes: Sequence[ControlCode] = control for control_code in control_codes: control_type = control_code[0] if control_type == ControlType.CURSOR_MOVE_TO: _, x, y = cast(Tuple[ControlType, int, int], control_code) term.move_cursor_to(WindowsCoordinates(row=y - 1, col=x - 1)) elif control_type == ControlType.CARRIAGE_RETURN: term.write_text("\r") elif control_type == ControlType.HOME: term.move_cursor_to(WindowsCoordinates(0, 0)) elif control_type == ControlType.CURSOR_UP: term.move_cursor_up() elif control_type == ControlType.CURSOR_DOWN: term.move_cursor_down() elif control_type == ControlType.CURSOR_FORWARD: term.move_cursor_forward() elif control_type == ControlType.CURSOR_BACKWARD: term.move_cursor_backward() elif control_type == ControlType.CURSOR_MOVE_TO_COLUMN: _, column = cast(Tuple[ControlType, int], control_code) term.move_cursor_to_column(column - 1) elif control_type == ControlType.HIDE_CURSOR: term.hide_cursor() elif control_type == ControlType.SHOW_CURSOR: term.show_cursor() elif control_type == ControlType.ERASE_IN_LINE: _, mode = cast(Tuple[ControlType, int], control_code) if mode == 0: term.erase_end_of_line() elif mode == 1: term.erase_start_of_line() elif mode == 2: term.erase_line() elif control_type == ControlType.SET_WINDOW_TITLE: _, title = cast(Tuple[ControlType, str], control_code) term.set_title(title)	2.72 KB	2026-01-20 12:58
📄 _wrap.py from __future__ import annotations import re from typing import Iterable from ._loop import loop_last from .cells import cell_len, chop_cells re_word = re.compile(r"\s\S+\s") def words(text: str) -> Iterable[tuple[int, int, str]]: """Yields each word from the text as a tuple containing (start_index, end_index, word). A "word" in this context may include the actual word and any whitespace to the right. """ position = 0 word_match = re_word.match(text, position) while word_match is not None: start, end = word_match.span() word = word_match.group(0) yield start, end, word word_match = re_word.match(text, end) def divide_line(text: str, width: int, fold: bool = True) -> list[int]: """Given a string of text, and a width (measured in cells), return a list of cell offsets which the string should be split at in order for it to fit within the given width. Args: text: The text to examine. width: The available cell width. fold: If True, words longer than `width` will be folded onto a new line. Returns: A list of indices to break the line at. """ break_positions: list[int] = [] # offsets to insert the breaks at append = break_positions.append cell_offset = 0 _cell_len = cell_len for start, _end, word in words(text): word_length = _cell_len(word.rstrip()) remaining_space = width - cell_offset word_fits_remaining_space = remaining_space >= word_length if word_fits_remaining_space: # Simplest case - the word fits within the remaining width for this line. cell_offset += _cell_len(word) else: # Not enough space remaining for this word on the current line. if word_length > width: # The word doesn't fit on any line, so we can't simply # place it on the next line... if fold: # Fold the word across multiple lines. folded_word = chop_cells(word, width=width) for last, line in loop_last(folded_word): if start: append(start) if last: cell_offset = _cell_len(line) else: start += len(line) else: # Folding isn't allowed, so crop the word. if start: append(start) cell_offset = _cell_len(word) elif cell_offset and start: # The word doesn't fit within the remaining space on the current # line, but it can fit on to the next (empty) line. append(start) cell_offset = _cell_len(word) return break_positions if __name__ == "__main__": # pragma: no cover from .console import Console console = Console(width=10) console.print("12345 abcdefghijklmnopqrstuvwyxzABCDEFGHIJKLMNOPQRSTUVWXYZ 12345") print(chop_cells("abcdefghijklmnopqrstuvwxyz", 10)) console = Console(width=20) console.rule() console.print("TextualはPythonの高速アプリケーション開発フレームワークです") console.rule() console.print("アプリケーションは1670万色を使用でき")	3.32 KB	2026-01-20 12:58
📄 abc.py from abc import ABC class RichRenderable(ABC): """An abstract base class for Rich renderables. Note that there is no need to extend this class, the intended use is to check if an object supports the Rich renderable protocol. For example:: if isinstance(my_object, RichRenderable): console.print(my_object) """ @classmethod def __subclasshook__(cls, other: type) -> bool: """Check if this class supports the rich render protocol.""" return hasattr(other, "__rich_console__") or hasattr(other, "__rich__") if __name__ == "__main__": # pragma: no cover from pip._vendor.rich.text import Text t = Text() print(isinstance(Text, RichRenderable)) print(isinstance(t, RichRenderable)) class Foo: pass f = Foo() print(isinstance(f, RichRenderable)) print(isinstance("", RichRenderable))	890 B	2026-01-20 12:58
📄 align.py from itertools import chain from typing import TYPE_CHECKING, Iterable, Optional, Literal from .constrain import Constrain from .jupyter import JupyterMixin from .measure import Measurement from .segment import Segment from .style import StyleType if TYPE_CHECKING: from .console import Console, ConsoleOptions, RenderableType, RenderResult AlignMethod = Literal["left", "center", "right"] VerticalAlignMethod = Literal["top", "middle", "bottom"] class Align(JupyterMixin): """Align a renderable by adding spaces if necessary. Args: renderable (RenderableType): A console renderable. align (AlignMethod): One of "left", "center", or "right"" style (StyleType, optional): An optional style to apply to the background. vertical (Optional[VerticalAlignMethod], optional): Optional vertical align, one of "top", "middle", or "bottom". Defaults to None. pad (bool, optional): Pad the right with spaces. Defaults to True. width (int, optional): Restrict contents to given width, or None to use default width. Defaults to None. height (int, optional): Set height of align renderable, or None to fit to contents. Defaults to None. Raises: ValueError: if ``align`` is not one of the expected values. """ def __init__( self, renderable: "RenderableType", align: AlignMethod = "left", style: Optional[StyleType] = None, , vertical: Optional[VerticalAlignMethod] = None, pad: bool = True, width: Optional[int] = None, height: Optional[int] = None, ) -> None: if align not in ("left", "center", "right"): raise ValueError( f'invalid value for align, expected "left", "center", or "right" (not {align!r})' ) if vertical is not None and vertical not in ("top", "middle", "bottom"): raise ValueError( f'invalid value for vertical, expected "top", "middle", or "bottom" (not {vertical!r})' ) self.renderable = renderable self.align = align self.style = style self.vertical = vertical self.pad = pad self.width = width self.height = height def __repr__(self) -> str: return f"Align({self.renderable!r}, {self.align!r})" @classmethod def left( cls, renderable: "RenderableType", style: Optional[StyleType] = None, , vertical: Optional[VerticalAlignMethod] = None, pad: bool = True, width: Optional[int] = None, height: Optional[int] = None, ) -> "Align": """Align a renderable to the left.""" return cls( renderable, "left", style=style, vertical=vertical, pad=pad, width=width, height=height, ) @classmethod def center( cls, renderable: "RenderableType", style: Optional[StyleType] = None, , vertical: Optional[VerticalAlignMethod] = None, pad: bool = True, width: Optional[int] = None, height: Optional[int] = None, ) -> "Align": """Align a renderable to the center.""" return cls( renderable, "center", style=style, vertical=vertical, pad=pad, width=width, height=height, ) @classmethod def right( cls, renderable: "RenderableType", style: Optional[StyleType] = None, , vertical: Optional[VerticalAlignMethod] = None, pad: bool = True, width: Optional[int] = None, height: Optional[int] = None, ) -> "Align": """Align a renderable to the right.""" return cls( renderable, "right", style=style, vertical=vertical, pad=pad, width=width, height=height, ) def __rich_console__( self, console: "Console", options: "ConsoleOptions" ) -> "RenderResult": align = self.align width = console.measure(self.renderable, options=options).maximum rendered = console.render( Constrain( self.renderable, width if self.width is None else min(width, self.width) ), options.update(height=None), ) lines = list(Segment.split_lines(rendered)) width, height = Segment.get_shape(lines) lines = Segment.set_shape(lines, width, height) new_line = Segment.line() excess_space = options.max_width - width style = console.get_style(self.style) if self.style is not None else None def generate_segments() -> Iterable[Segment]: if excess_space <= 0: # Exact fit for line in lines: yield from line yield new_line elif align == "left": # Pad on the right pad = Segment(" " * excess_space, style) if self.pad else None for line in lines: yield from line if pad: yield pad yield new_line elif align == "center": # Pad left and right left = excess_space // 2 pad = Segment(" " * left, style) pad_right = ( Segment(" " * (excess_space - left), style) if self.pad else None ) for line in lines: if left: yield pad yield from line if pad_right: yield pad_right yield new_line elif align == "right": # Padding on left pad = Segment(" " * excess_space, style) for line in lines: yield pad yield from line yield new_line blank_line = ( Segment(f"{' ' * (self.width or options.max_width)}\n", style) if self.pad else Segment("\n") ) def blank_lines(count: int) -> Iterable[Segment]: if count > 0: for _ in range(count): yield blank_line vertical_height = self.height or options.height iter_segments: Iterable[Segment] if self.vertical and vertical_height is not None: if self.vertical == "top": bottom_space = vertical_height - height iter_segments = chain(generate_segments(), blank_lines(bottom_space)) elif self.vertical == "middle": top_space = (vertical_height - height) // 2 bottom_space = vertical_height - top_space - height iter_segments = chain( blank_lines(top_space), generate_segments(), blank_lines(bottom_space), ) else: # self.vertical == "bottom": top_space = vertical_height - height iter_segments = chain(blank_lines(top_space), generate_segments()) else: iter_segments = generate_segments() if self.style: style = console.get_style(self.style) iter_segments = Segment.apply_style(iter_segments, style) yield from iter_segments def __rich_measure__( self, console: "Console", options: "ConsoleOptions" ) -> Measurement: measurement = Measurement.get(console, options, self.renderable) return measurement class VerticalCenter(JupyterMixin): """Vertically aligns a renderable. Warn: This class is deprecated and may be removed in a future version. Use Align class with `vertical="middle"`. Args: renderable (RenderableType): A renderable object. style (StyleType, optional): An optional style to apply to the background. Defaults to None. """ def __init__( self, renderable: "RenderableType", style: Optional[StyleType] = None, ) -> None: self.renderable = renderable self.style = style def __repr__(self) -> str: return f"VerticalCenter({self.renderable!r})" def __rich_console__( self, console: "Console", options: "ConsoleOptions" ) -> "RenderResult": style = console.get_style(self.style) if self.style is not None else None lines = console.render_lines( self.renderable, options.update(height=None), pad=False ) width, _height = Segment.get_shape(lines) new_line = Segment.line() height = options.height or options.size.height top_space = (height - len(lines)) // 2 bottom_space = height - top_space - len(lines) blank_line = Segment(f"{' ' * width}", style) def blank_lines(count: int) -> Iterable[Segment]: for _ in range(count): yield blank_line yield new_line if top_space > 0: yield from blank_lines(top_space) for line in lines: yield from line yield new_line if bottom_space > 0: yield from blank_lines(bottom_space) def __rich_measure__( self, console: "Console", options: "ConsoleOptions" ) -> Measurement: measurement = Measurement.get(console, options, self.renderable) return measurement if __name__ == "__main__": # pragma: no cover from pip._vendor.rich.console import Console, Group from pip._vendor.rich.highlighter import ReprHighlighter from pip._vendor.rich.panel import Panel highlighter = ReprHighlighter() console = Console() panel = Panel( Group( Align.left(highlighter("align='left'")), Align.center(highlighter("align='center'")), Align.right(highlighter("align='right'")), ), width=60, style="on dark_blue", title="Align", ) console.print( Align.center(panel, vertical="middle", style="on red", height=console.height) )	10.08 KB	2026-01-20 12:58
📄 ansi.py import re import sys from contextlib import suppress from typing import Iterable, NamedTuple, Optional from .color import Color from .style import Style from .text import Text re_ansi = re.compile( r""" (?:\x1b[0-?])\| (?:\x1b\](.?)\x1b\\)\| (?:\x1b([(@-Z\\-_]\|\[[0-?][ -/]*[@-~])) """, re.VERBOSE, ) class _AnsiToken(NamedTuple): """Result of ansi tokenized string.""" plain: str = "" sgr: Optional[str] = "" osc: Optional[str] = "" def _ansi_tokenize(ansi_text: str) -> Iterable[_AnsiToken]: """Tokenize a string in to plain text and ANSI codes. Args: ansi_text (str): A String containing ANSI codes. Yields: AnsiToken: A named tuple of (plain, sgr, osc) """ position = 0 sgr: Optional[str] osc: Optional[str] for match in re_ansi.finditer(ansi_text): start, end = match.span(0) osc, sgr = match.groups() if start > position: yield _AnsiToken(ansi_text[position:start]) if sgr: if sgr == "(": position = end + 1 continue if sgr.endswith("m"): yield _AnsiToken("", sgr[1:-1], osc) else: yield _AnsiToken("", sgr, osc) position = end if position < len(ansi_text): yield _AnsiToken(ansi_text[position:]) SGR_STYLE_MAP = { 1: "bold", 2: "dim", 3: "italic", 4: "underline", 5: "blink", 6: "blink2", 7: "reverse", 8: "conceal", 9: "strike", 21: "underline2", 22: "not dim not bold", 23: "not italic", 24: "not underline", 25: "not blink", 26: "not blink2", 27: "not reverse", 28: "not conceal", 29: "not strike", 30: "color(0)", 31: "color(1)", 32: "color(2)", 33: "color(3)", 34: "color(4)", 35: "color(5)", 36: "color(6)", 37: "color(7)", 39: "default", 40: "on color(0)", 41: "on color(1)", 42: "on color(2)", 43: "on color(3)", 44: "on color(4)", 45: "on color(5)", 46: "on color(6)", 47: "on color(7)", 49: "on default", 51: "frame", 52: "encircle", 53: "overline", 54: "not frame not encircle", 55: "not overline", 90: "color(8)", 91: "color(9)", 92: "color(10)", 93: "color(11)", 94: "color(12)", 95: "color(13)", 96: "color(14)", 97: "color(15)", 100: "on color(8)", 101: "on color(9)", 102: "on color(10)", 103: "on color(11)", 104: "on color(12)", 105: "on color(13)", 106: "on color(14)", 107: "on color(15)", } class AnsiDecoder: """Translate ANSI code in to styled Text.""" def __init__(self) -> None: self.style = Style.null() def decode(self, terminal_text: str) -> Iterable[Text]: """Decode ANSI codes in an iterable of lines. Args: lines (Iterable[str]): An iterable of lines of terminal output. Yields: Text: Marked up Text. """ for line in terminal_text.splitlines(): yield self.decode_line(line) def decode_line(self, line: str) -> Text: """Decode a line containing ansi codes. Args: line (str): A line of terminal output. Returns: Text: A Text instance marked up according to ansi codes. """ from_ansi = Color.from_ansi from_rgb = Color.from_rgb _Style = Style text = Text() append = text.append line = line.rsplit("\r", 1)[-1] for plain_text, sgr, osc in _ansi_tokenize(line): if plain_text: append(plain_text, self.style or None) elif osc is not None: if osc.startswith("8;"): _params, semicolon, link = osc[2:].partition(";") if semicolon: self.style = self.style.update_link(link or None) elif sgr is not None: # Translate in to semi-colon separated codes # Ignore invalid codes, because we want to be lenient codes = [ min(255, int(_code) if _code else 0) for _code in sgr.split(";") if _code.isdigit() or _code == "" ] iter_codes = iter(codes) for code in iter_codes: if code == 0: # reset self.style = _Style.null() elif code in SGR_STYLE_MAP: # styles self.style += _Style.parse(SGR_STYLE_MAP[code]) elif code == 38: # Foreground with suppress(StopIteration): color_type = next(iter_codes) if color_type == 5: self.style += _Style.from_color( from_ansi(next(iter_codes)) ) elif color_type == 2: self.style += _Style.from_color( from_rgb( next(iter_codes), next(iter_codes), next(iter_codes), ) ) elif code == 48: # Background with suppress(StopIteration): color_type = next(iter_codes) if color_type == 5: self.style += _Style.from_color( None, from_ansi(next(iter_codes)) ) elif color_type == 2: self.style += _Style.from_color( None, from_rgb( next(iter_codes), next(iter_codes), next(iter_codes), ), ) return text if sys.platform != "win32" and __name__ == "__main__": # pragma: no cover import io import os import pty import sys decoder = AnsiDecoder() stdout = io.BytesIO() def read(fd: int) -> bytes: data = os.read(fd, 1024) stdout.write(data) return data pty.spawn(sys.argv[1:], read) from .console import Console console = Console(record=True) stdout_result = stdout.getvalue().decode("utf-8") print(stdout_result) for line in decoder.decode(stdout_result): console.print(line) console.save_html("stdout.html")	6.76 KB	2026-01-20 12:58
📄 bar.py from typing import Optional, Union from .color import Color from .console import Console, ConsoleOptions, RenderResult from .jupyter import JupyterMixin from .measure import Measurement from .segment import Segment from .style import Style # There are left-aligned characters for 1/8 to 7/8, but # the right-aligned characters exist only for 1/8 and 4/8. BEGIN_BLOCK_ELEMENTS = ["█", "█", "█", "▐", "▐", "▐", "▕", "▕"] END_BLOCK_ELEMENTS = [" ", "▏", "▎", "▍", "▌", "▋", "▊", "▉"] FULL_BLOCK = "█" class Bar(JupyterMixin): """Renders a solid block bar. Args: size (float): Value for the end of the bar. begin (float): Begin point (between 0 and size, inclusive). end (float): End point (between 0 and size, inclusive). width (int, optional): Width of the bar, or ``None`` for maximum width. Defaults to None. color (Union[Color, str], optional): Color of the bar. Defaults to "default". bgcolor (Union[Color, str], optional): Color of bar background. Defaults to "default". """ def __init__( self, size: float, begin: float, end: float, , width: Optional[int] = None, color: Union[Color, str] = "default", bgcolor: Union[Color, str] = "default", ): self.size = size self.begin = max(begin, 0) self.end = min(end, size) self.width = width self.style = Style(color=color, bgcolor=bgcolor) def __repr__(self) -> str: return f"Bar({self.size}, {self.begin}, {self.end})" def __rich_console__( self, console: Console, options: ConsoleOptions ) -> RenderResult: width = min( self.width if self.width is not None else options.max_width, options.max_width, ) if self.begin >= self.end: yield Segment(" " width, self.style) yield Segment.line() return prefix_complete_eights = int(width * 8 * self.begin / self.size) prefix_bar_count = prefix_complete_eights // 8 prefix_eights_count = prefix_complete_eights % 8 body_complete_eights = int(width * 8 * self.end / self.size) body_bar_count = body_complete_eights // 8 body_eights_count = body_complete_eights % 8 # When start and end fall into the same cell, we ideally should render # a symbol that's "center-aligned", but there is no good symbol in Unicode. # In this case, we fall back to right-aligned block symbol for simplicity. prefix = " " * prefix_bar_count if prefix_eights_count: prefix += BEGIN_BLOCK_ELEMENTS[prefix_eights_count] body = FULL_BLOCK * body_bar_count if body_eights_count: body += END_BLOCK_ELEMENTS[body_eights_count] suffix = " " * (width - len(body)) yield Segment(prefix + body[len(prefix) :] + suffix, self.style) yield Segment.line() def __rich_measure__( self, console: Console, options: ConsoleOptions ) -> Measurement: return ( Measurement(self.width, self.width) if self.width is not None else Measurement(4, options.max_width) )	3.19 KB	2026-01-20 12:58
📄 box.py from typing import TYPE_CHECKING, Iterable, List, Literal from ._loop import loop_last if TYPE_CHECKING: from pip._vendor.rich.console import ConsoleOptions class Box: """Defines characters to render boxes. ┌─┬┐ top │ ││ head ├─┼┤ head_row │ ││ mid ├─┼┤ row ├─┼┤ foot_row │ ││ foot └─┴┘ bottom Args: box (str): Characters making up box. ascii (bool, optional): True if this box uses ascii characters only. Default is False. """ def __init__(self, box: str, , ascii: bool = False) -> None: self._box = box self.ascii = ascii line1, line2, line3, line4, line5, line6, line7, line8 = box.splitlines() # top self.top_left, self.top, self.top_divider, self.top_right = iter(line1) # head self.head_left, _, self.head_vertical, self.head_right = iter(line2) # head_row ( self.head_row_left, self.head_row_horizontal, self.head_row_cross, self.head_row_right, ) = iter(line3) # mid self.mid_left, _, self.mid_vertical, self.mid_right = iter(line4) # row self.row_left, self.row_horizontal, self.row_cross, self.row_right = iter(line5) # foot_row ( self.foot_row_left, self.foot_row_horizontal, self.foot_row_cross, self.foot_row_right, ) = iter(line6) # foot self.foot_left, _, self.foot_vertical, self.foot_right = iter(line7) # bottom self.bottom_left, self.bottom, self.bottom_divider, self.bottom_right = iter( line8 ) def __repr__(self) -> str: return "Box(...)" def __str__(self) -> str: return self._box def substitute(self, options: "ConsoleOptions", safe: bool = True) -> "Box": """Substitute this box for another if it won't render due to platform issues. Args: options (ConsoleOptions): Console options used in rendering. safe (bool, optional): Substitute this for another Box if there are known problems displaying on the platform (currently only relevant on Windows). Default is True. Returns: Box: A different Box or the same Box. """ box = self if options.legacy_windows and safe: box = LEGACY_WINDOWS_SUBSTITUTIONS.get(box, box) if options.ascii_only and not box.ascii: box = ASCII return box def get_plain_headed_box(self) -> "Box": """If this box uses special characters for the borders of the header, then return the equivalent box that does not. Returns: Box: The most similar Box that doesn't use header-specific box characters. If the current Box already satisfies this criterion, then it's returned. """ return PLAIN_HEADED_SUBSTITUTIONS.get(self, self) def get_top(self, widths: Iterable[int]) -> str: """Get the top of a simple box. Args: widths (List[int]): Widths of columns. Returns: str: A string of box characters. """ parts: List[str] = [] append = parts.append append(self.top_left) for last, width in loop_last(widths): append(self.top width) if not last: append(self.top_divider) append(self.top_right) return "".join(parts) def get_row( self, widths: Iterable[int], level: Literal["head", "row", "foot", "mid"] = "row", edge: bool = True, ) -> str: """Get the top of a simple box. Args: width (List[int]): Widths of columns. Returns: str: A string of box characters. """ if level == "head": left = self.head_row_left horizontal = self.head_row_horizontal cross = self.head_row_cross right = self.head_row_right elif level == "row": left = self.row_left horizontal = self.row_horizontal cross = self.row_cross right = self.row_right elif level == "mid": left = self.mid_left horizontal = " " cross = self.mid_vertical right = self.mid_right elif level == "foot": left = self.foot_row_left horizontal = self.foot_row_horizontal cross = self.foot_row_cross right = self.foot_row_right else: raise ValueError("level must be 'head', 'row' or 'foot'") parts: List[str] = [] append = parts.append if edge: append(left) for last, width in loop_last(widths): append(horizontal * width) if not last: append(cross) if edge: append(right) return "".join(parts) def get_bottom(self, widths: Iterable[int]) -> str: """Get the bottom of a simple box. Args: widths (List[int]): Widths of columns. Returns: str: A string of box characters. """ parts: List[str] = [] append = parts.append append(self.bottom_left) for last, width in loop_last(widths): append(self.bottom * width) if not last: append(self.bottom_divider) append(self.bottom_right) return "".join(parts) # fmt: off ASCII: Box = Box( "+--+\n" "\| \|\|\n" "\|-+\|\n" "\| \|\|\n" "\|-+\|\n" "\|-+\|\n" "\| \|\|\n" "+--+\n", ascii=True, ) ASCII2: Box = Box( "+-++\n" "\| \|\|\n" "+-++\n" "\| \|\|\n" "+-++\n" "+-++\n" "\| \|\|\n" "+-++\n", ascii=True, ) ASCII_DOUBLE_HEAD: Box = Box( "+-++\n" "\| \|\|\n" "+=++\n" "\| \|\|\n" "+-++\n" "+-++\n" "\| \|\|\n" "+-++\n", ascii=True, ) SQUARE: Box = Box( "┌─┬┐\n" "│ ││\n" "├─┼┤\n" "│ ││\n" "├─┼┤\n" "├─┼┤\n" "│ ││\n" "└─┴┘\n" ) SQUARE_DOUBLE_HEAD: Box = Box( "┌─┬┐\n" "│ ││\n" "╞═╪╡\n" "│ ││\n" "├─┼┤\n" "├─┼┤\n" "│ ││\n" "└─┴┘\n" ) MINIMAL: Box = Box( " ╷ \n" " │ \n" "╶─┼╴\n" " │ \n" "╶─┼╴\n" "╶─┼╴\n" " │ \n" " ╵ \n" ) MINIMAL_HEAVY_HEAD: Box = Box( " ╷ \n" " │ \n" "╺━┿╸\n" " │ \n" "╶─┼╴\n" "╶─┼╴\n" " │ \n" " ╵ \n" ) MINIMAL_DOUBLE_HEAD: Box = Box( " ╷ \n" " │ \n" " ═╪ \n" " │ \n" " ─┼ \n" " ─┼ \n" " │ \n" " ╵ \n" ) SIMPLE: Box = Box( " \n" " \n" " ── \n" " \n" " \n" " ── \n" " \n" " \n" ) SIMPLE_HEAD: Box = Box( " \n" " \n" " ── \n" " \n" " \n" " \n" " \n" " \n" ) SIMPLE_HEAVY: Box = Box( " \n" " \n" " ━━ \n" " \n" " \n" " ━━ \n" " \n" " \n" ) HORIZONTALS: Box = Box( " ── \n" " \n" " ── \n" " \n" " ── \n" " ── \n" " \n" " ── \n" ) ROUNDED: Box = Box( "╭─┬╮\n" "│ ││\n" "├─┼┤\n" "│ ││\n" "├─┼┤\n" "├─┼┤\n" "│ ││\n" "╰─┴╯\n" ) HEAVY: Box = Box( "┏━┳┓\n" "┃ ┃┃\n" "┣━╋┫\n" "┃ ┃┃\n" "┣━╋┫\n" "┣━╋┫\n" "┃ ┃┃\n" "┗━┻┛\n" ) HEAVY_EDGE: Box = Box( "┏━┯┓\n" "┃ │┃\n" "┠─┼┨\n" "┃ │┃\n" "┠─┼┨\n" "┠─┼┨\n" "┃ │┃\n" "┗━┷┛\n" ) HEAVY_HEAD: Box = Box( "┏━┳┓\n" "┃ ┃┃\n" "┡━╇┩\n" "│ ││\n" "├─┼┤\n" "├─┼┤\n" "│ ││\n" "└─┴┘\n" ) DOUBLE: Box = Box( "╔═╦╗\n" "║ ║║\n" "╠═╬╣\n" "║ ║║\n" "╠═╬╣\n" "╠═╬╣\n" "║ ║║\n" "╚═╩╝\n" ) DOUBLE_EDGE: Box = Box( "╔═╤╗\n" "║ │║\n" "╟─┼╢\n" "║ │║\n" "╟─┼╢\n" "╟─┼╢\n" "║ │║\n" "╚═╧╝\n" ) MARKDOWN: Box = Box( " \n" "\| \|\|\n" "\|-\|\|\n" "\| \|\|\n" "\|-\|\|\n" "\|-\|\|\n" "\| \|\|\n" " \n", ascii=True, ) # fmt: on # Map Boxes that don't render with raster fonts on to equivalent that do LEGACY_WINDOWS_SUBSTITUTIONS = { ROUNDED: SQUARE, MINIMAL_HEAVY_HEAD: MINIMAL, SIMPLE_HEAVY: SIMPLE, HEAVY: SQUARE, HEAVY_EDGE: SQUARE, HEAVY_HEAD: SQUARE, } # Map headed boxes to their headerless equivalents PLAIN_HEADED_SUBSTITUTIONS = { HEAVY_HEAD: SQUARE, SQUARE_DOUBLE_HEAD: SQUARE, MINIMAL_DOUBLE_HEAD: MINIMAL, MINIMAL_HEAVY_HEAD: MINIMAL, ASCII_DOUBLE_HEAD: ASCII2, } if __name__ == "__main__": # pragma: no cover from pip._vendor.rich.columns import Columns from pip._vendor.rich.panel import Panel from . import box as box from .console import Console from .table import Table from .text import Text console = Console(record=True) BOXES = [ "ASCII", "ASCII2", "ASCII_DOUBLE_HEAD", "SQUARE", "SQUARE_DOUBLE_HEAD", "MINIMAL", "MINIMAL_HEAVY_HEAD", "MINIMAL_DOUBLE_HEAD", "SIMPLE", "SIMPLE_HEAD", "SIMPLE_HEAVY", "HORIZONTALS", "ROUNDED", "HEAVY", "HEAVY_EDGE", "HEAVY_HEAD", "DOUBLE", "DOUBLE_EDGE", "MARKDOWN", ] console.print(Panel("[bold green]Box Constants", style="green"), justify="center") console.print() columns = Columns(expand=True, padding=2) for box_name in sorted(BOXES): table = Table( show_footer=True, style="dim", border_style="not dim", expand=True ) table.add_column("Header 1", "Footer 1") table.add_column("Header 2", "Footer 2") table.add_row("Cell", "Cell") table.add_row("Cell", "Cell") table.box = getattr(box, box_name) table.title = Text(f"box.{box_name}", style="magenta") columns.add_renderable(table) console.print(columns) # console.save_svg("box.svg")	10.44 KB	2026-01-20 12:58
📄 cells.py from __future__ import annotations from functools import lru_cache from typing import Callable from ._cell_widths import CELL_WIDTHS # Ranges of unicode ordinals that produce a 1-cell wide character # This is non-exhaustive, but covers most common Western characters _SINGLE_CELL_UNICODE_RANGES: list[tuple[int, int]] = [ (0x20, 0x7E), # Latin (excluding non-printable) (0xA0, 0xAC), (0xAE, 0x002FF), (0x00370, 0x00482), # Greek / Cyrillic (0x02500, 0x025FC), # Box drawing, box elements, geometric shapes (0x02800, 0x028FF), # Braille ] # A set of characters that are a single cell wide _SINGLE_CELLS = frozenset( [ character for _start, _end in _SINGLE_CELL_UNICODE_RANGES for character in map(chr, range(_start, _end + 1)) ] ) # When called with a string this will return True if all # characters are single-cell, otherwise False _is_single_cell_widths: Callable[[str], bool] = _SINGLE_CELLS.issuperset @lru_cache(4096) def cached_cell_len(text: str) -> int: """Get the number of cells required to display text. This method always caches, which may use up a lot of memory. It is recommended to use `cell_len` over this method. Args: text (str): Text to display. Returns: int: Get the number of cells required to display text. """ if _is_single_cell_widths(text): return len(text) return sum(map(get_character_cell_size, text)) def cell_len(text: str, _cell_len: Callable[[str], int] = cached_cell_len) -> int: """Get the number of cells required to display text. Args: text (str): Text to display. Returns: int: Get the number of cells required to display text. """ if len(text) < 512: return _cell_len(text) if _is_single_cell_widths(text): return len(text) return sum(map(get_character_cell_size, text)) @lru_cache(maxsize=4096) def get_character_cell_size(character: str) -> int: """Get the cell size of a character. Args: character (str): A single character. Returns: int: Number of cells (0, 1 or 2) occupied by that character. """ codepoint = ord(character) _table = CELL_WIDTHS lower_bound = 0 upper_bound = len(_table) - 1 index = (lower_bound + upper_bound) // 2 while True: start, end, width = _table[index] if codepoint < start: upper_bound = index - 1 elif codepoint > end: lower_bound = index + 1 else: return 0 if width == -1 else width if upper_bound < lower_bound: break index = (lower_bound + upper_bound) // 2 return 1 def set_cell_size(text: str, total: int) -> str: """Set the length of a string to fit within given number of cells.""" if _is_single_cell_widths(text): size = len(text) if size < total: return text + " " * (total - size) return text[:total] if total <= 0: return "" cell_size = cell_len(text) if cell_size == total: return text if cell_size < total: return text + " " * (total - cell_size) start = 0 end = len(text) # Binary search until we find the right size while True: pos = (start + end) // 2 before = text[: pos + 1] before_len = cell_len(before) if before_len == total + 1 and cell_len(before[-1]) == 2: return before[:-1] + " " if before_len == total: return before if before_len > total: end = pos else: start = pos def chop_cells( text: str, width: int, ) -> list[str]: """Split text into lines such that each line fits within the available (cell) width. Args: text: The text to fold such that it fits in the given width. width: The width available (number of cells). Returns: A list of strings such that each string in the list has cell width less than or equal to the available width. """ _get_character_cell_size = get_character_cell_size lines: list[list[str]] = [[]] append_new_line = lines.append append_to_last_line = lines[-1].append total_width = 0 for character in text: cell_width = _get_character_cell_size(character) char_doesnt_fit = total_width + cell_width > width if char_doesnt_fit: append_new_line([character]) append_to_last_line = lines[-1].append total_width = cell_width else: append_to_last_line(character) total_width += cell_width return ["".join(line) for line in lines] if __name__ == "__main__": # pragma: no cover print(get_character_cell_size("😽")) for line in chop_cells("""这是对亚洲语言支持的测试。面对模棱两可的想法，拒绝猜测的诱惑。""", 8): print(line) for n in range(80, 1, -1): print(set_cell_size("""这是对亚洲语言支持的测试。面对模棱两可的想法，拒绝猜测的诱惑。""", n) + "\|") print("x" * n)	5.01 KB	2026-01-20 12:58
📄 color.py import re import sys from colorsys import rgb_to_hls from enum import IntEnum from functools import lru_cache from typing import TYPE_CHECKING, NamedTuple, Optional, Tuple from ._palettes import EIGHT_BIT_PALETTE, STANDARD_PALETTE, WINDOWS_PALETTE from .color_triplet import ColorTriplet from .repr import Result, rich_repr from .terminal_theme import DEFAULT_TERMINAL_THEME if TYPE_CHECKING: # pragma: no cover from .terminal_theme import TerminalTheme from .text import Text WINDOWS = sys.platform == "win32" class ColorSystem(IntEnum): """One of the 3 color system supported by terminals.""" STANDARD = 1 EIGHT_BIT = 2 TRUECOLOR = 3 WINDOWS = 4 def __repr__(self) -> str: return f"ColorSystem.{self.name}" def __str__(self) -> str: return repr(self) class ColorType(IntEnum): """Type of color stored in Color class.""" DEFAULT = 0 STANDARD = 1 EIGHT_BIT = 2 TRUECOLOR = 3 WINDOWS = 4 def __repr__(self) -> str: return f"ColorType.{self.name}" ANSI_COLOR_NAMES = { "black": 0, "red": 1, "green": 2, "yellow": 3, "blue": 4, "magenta": 5, "cyan": 6, "white": 7, "bright_black": 8, "bright_red": 9, "bright_green": 10, "bright_yellow": 11, "bright_blue": 12, "bright_magenta": 13, "bright_cyan": 14, "bright_white": 15, "grey0": 16, "gray0": 16, "navy_blue": 17, "dark_blue": 18, "blue3": 20, "blue1": 21, "dark_green": 22, "deep_sky_blue4": 25, "dodger_blue3": 26, "dodger_blue2": 27, "green4": 28, "spring_green4": 29, "turquoise4": 30, "deep_sky_blue3": 32, "dodger_blue1": 33, "green3": 40, "spring_green3": 41, "dark_cyan": 36, "light_sea_green": 37, "deep_sky_blue2": 38, "deep_sky_blue1": 39, "spring_green2": 47, "cyan3": 43, "dark_turquoise": 44, "turquoise2": 45, "green1": 46, "spring_green1": 48, "medium_spring_green": 49, "cyan2": 50, "cyan1": 51, "dark_red": 88, "deep_pink4": 125, "purple4": 55, "purple3": 56, "blue_violet": 57, "orange4": 94, "grey37": 59, "gray37": 59, "medium_purple4": 60, "slate_blue3": 62, "royal_blue1": 63, "chartreuse4": 64, "dark_sea_green4": 71, "pale_turquoise4": 66, "steel_blue": 67, "steel_blue3": 68, "cornflower_blue": 69, "chartreuse3": 76, "cadet_blue": 73, "sky_blue3": 74, "steel_blue1": 81, "pale_green3": 114, "sea_green3": 78, "aquamarine3": 79, "medium_turquoise": 80, "chartreuse2": 112, "sea_green2": 83, "sea_green1": 85, "aquamarine1": 122, "dark_slate_gray2": 87, "dark_magenta": 91, "dark_violet": 128, "purple": 129, "light_pink4": 95, "plum4": 96, "medium_purple3": 98, "slate_blue1": 99, "yellow4": 106, "wheat4": 101, "grey53": 102, "gray53": 102, "light_slate_grey": 103, "light_slate_gray": 103, "medium_purple": 104, "light_slate_blue": 105, "dark_olive_green3": 149, "dark_sea_green": 108, "light_sky_blue3": 110, "sky_blue2": 111, "dark_sea_green3": 150, "dark_slate_gray3": 116, "sky_blue1": 117, "chartreuse1": 118, "light_green": 120, "pale_green1": 156, "dark_slate_gray1": 123, "red3": 160, "medium_violet_red": 126, "magenta3": 164, "dark_orange3": 166, "indian_red": 167, "hot_pink3": 168, "medium_orchid3": 133, "medium_orchid": 134, "medium_purple2": 140, "dark_goldenrod": 136, "light_salmon3": 173, "rosy_brown": 138, "grey63": 139, "gray63": 139, "medium_purple1": 141, "gold3": 178, "dark_khaki": 143, "navajo_white3": 144, "grey69": 145, "gray69": 145, "light_steel_blue3": 146, "light_steel_blue": 147, "yellow3": 184, "dark_sea_green2": 157, "light_cyan3": 152, "light_sky_blue1": 153, "green_yellow": 154, "dark_olive_green2": 155, "dark_sea_green1": 193, "pale_turquoise1": 159, "deep_pink3": 162, "magenta2": 200, "hot_pink2": 169, "orchid": 170, "medium_orchid1": 207, "orange3": 172, "light_pink3": 174, "pink3": 175, "plum3": 176, "violet": 177, "light_goldenrod3": 179, "tan": 180, "misty_rose3": 181, "thistle3": 182, "plum2": 183, "khaki3": 185, "light_goldenrod2": 222, "light_yellow3": 187, "grey84": 188, "gray84": 188, "light_steel_blue1": 189, "yellow2": 190, "dark_olive_green1": 192, "honeydew2": 194, "light_cyan1": 195, "red1": 196, "deep_pink2": 197, "deep_pink1": 199, "magenta1": 201, "orange_red1": 202, "indian_red1": 204, "hot_pink": 206, "dark_orange": 208, "salmon1": 209, "light_coral": 210, "pale_violet_red1": 211, "orchid2": 212, "orchid1": 213, "orange1": 214, "sandy_brown": 215, "light_salmon1": 216, "light_pink1": 217, "pink1": 218, "plum1": 219, "gold1": 220, "navajo_white1": 223, "misty_rose1": 224, "thistle1": 225, "yellow1": 226, "light_goldenrod1": 227, "khaki1": 228, "wheat1": 229, "cornsilk1": 230, "grey100": 231, "gray100": 231, "grey3": 232, "gray3": 232, "grey7": 233, "gray7": 233, "grey11": 234, "gray11": 234, "grey15": 235, "gray15": 235, "grey19": 236, "gray19": 236, "grey23": 237, "gray23": 237, "grey27": 238, "gray27": 238, "grey30": 239, "gray30": 239, "grey35": 240, "gray35": 240, "grey39": 241, "gray39": 241, "grey42": 242, "gray42": 242, "grey46": 243, "gray46": 243, "grey50": 244, "gray50": 244, "grey54": 245, "gray54": 245, "grey58": 246, "gray58": 246, "grey62": 247, "gray62": 247, "grey66": 248, "gray66": 248, "grey70": 249, "gray70": 249, "grey74": 250, "gray74": 250, "grey78": 251, "gray78": 251, "grey82": 252, "gray82": 252, "grey85": 253, "gray85": 253, "grey89": 254, "gray89": 254, "grey93": 255, "gray93": 255, } class ColorParseError(Exception): """The color could not be parsed.""" RE_COLOR = re.compile( r"""^ \#([0-9a-f]{6})$\| color$([0-9]{1,3})$$\| rgb$([\d\s,]+)$$ """, re.VERBOSE, ) @rich_repr class Color(NamedTuple): """Terminal color definition.""" name: str """The name of the color (typically the input to Color.parse).""" type: ColorType """The type of the color.""" number: Optional[int] = None """The color number, if a standard color, or None.""" triplet: Optional[ColorTriplet] = None """A triplet of color components, if an RGB color.""" def __rich__(self) -> "Text": """Displays the actual color if Rich printed.""" from .style import Style from .text import Text return Text.assemble( f"<color {self.name!r} ({self.type.name.lower()})", ("⬤", Style(color=self)), " >", ) def __rich_repr__(self) -> Result: yield self.name yield self.type yield "number", self.number, None yield "triplet", self.triplet, None @property def system(self) -> ColorSystem: """Get the native color system for this color.""" if self.type == ColorType.DEFAULT: return ColorSystem.STANDARD return ColorSystem(int(self.type)) @property def is_system_defined(self) -> bool: """Check if the color is ultimately defined by the system.""" return self.system not in (ColorSystem.EIGHT_BIT, ColorSystem.TRUECOLOR) @property def is_default(self) -> bool: """Check if the color is a default color.""" return self.type == ColorType.DEFAULT def get_truecolor( self, theme: Optional["TerminalTheme"] = None, foreground: bool = True ) -> ColorTriplet: """Get an equivalent color triplet for this color. Args: theme (TerminalTheme, optional): Optional terminal theme, or None to use default. Defaults to None. foreground (bool, optional): True for a foreground color, or False for background. Defaults to True. Returns: ColorTriplet: A color triplet containing RGB components. """ if theme is None: theme = DEFAULT_TERMINAL_THEME if self.type == ColorType.TRUECOLOR: assert self.triplet is not None return self.triplet elif self.type == ColorType.EIGHT_BIT: assert self.number is not None return EIGHT_BIT_PALETTE[self.number] elif self.type == ColorType.STANDARD: assert self.number is not None return theme.ansi_colors[self.number] elif self.type == ColorType.WINDOWS: assert self.number is not None return WINDOWS_PALETTE[self.number] else: # self.type == ColorType.DEFAULT: assert self.number is None return theme.foreground_color if foreground else theme.background_color @classmethod def from_ansi(cls, number: int) -> "Color": """Create a Color number from it's 8-bit ansi number. Args: number (int): A number between 0-255 inclusive. Returns: Color: A new Color instance. """ return cls( name=f"color({number})", type=(ColorType.STANDARD if number < 16 else ColorType.EIGHT_BIT), number=number, ) @classmethod def from_triplet(cls, triplet: "ColorTriplet") -> "Color": """Create a truecolor RGB color from a triplet of values. Args: triplet (ColorTriplet): A color triplet containing red, green and blue components. Returns: Color: A new color object. """ return cls(name=triplet.hex, type=ColorType.TRUECOLOR, triplet=triplet) @classmethod def from_rgb(cls, red: float, green: float, blue: float) -> "Color": """Create a truecolor from three color components in the range(0->255). Args: red (float): Red component in range 0-255. green (float): Green component in range 0-255. blue (float): Blue component in range 0-255. Returns: Color: A new color object. """ return cls.from_triplet(ColorTriplet(int(red), int(green), int(blue))) @classmethod def default(cls) -> "Color": """Get a Color instance representing the default color. Returns: Color: Default color. """ return cls(name="default", type=ColorType.DEFAULT) @classmethod @lru_cache(maxsize=1024) def parse(cls, color: str) -> "Color": """Parse a color definition.""" original_color = color color = color.lower().strip() if color == "default": return cls(color, type=ColorType.DEFAULT) color_number = ANSI_COLOR_NAMES.get(color) if color_number is not None: return cls( color, type=(ColorType.STANDARD if color_number < 16 else ColorType.EIGHT_BIT), number=color_number, ) color_match = RE_COLOR.match(color) if color_match is None: raise ColorParseError(f"{original_color!r} is not a valid color") color_24, color_8, color_rgb = color_match.groups() if color_24: triplet = ColorTriplet( int(color_24[0:2], 16), int(color_24[2:4], 16), int(color_24[4:6], 16) ) return cls(color, ColorType.TRUECOLOR, triplet=triplet) elif color_8: number = int(color_8) if number > 255: raise ColorParseError(f"color number must be <= 255 in {color!r}") return cls( color, type=(ColorType.STANDARD if number < 16 else ColorType.EIGHT_BIT), number=number, ) else: # color_rgb: components = color_rgb.split(",") if len(components) != 3: raise ColorParseError( f"expected three components in {original_color!r}" ) red, green, blue = components triplet = ColorTriplet(int(red), int(green), int(blue)) if not all(component <= 255 for component in triplet): raise ColorParseError( f"color components must be <= 255 in {original_color!r}" ) return cls(color, ColorType.TRUECOLOR, triplet=triplet) @lru_cache(maxsize=1024) def get_ansi_codes(self, foreground: bool = True) -> Tuple[str, ...]: """Get the ANSI escape codes for this color.""" _type = self.type if _type == ColorType.DEFAULT: return ("39" if foreground else "49",) elif _type == ColorType.WINDOWS: number = self.number assert number is not None fore, back = (30, 40) if number < 8 else (82, 92) return (str(fore + number if foreground else back + number),) elif _type == ColorType.STANDARD: number = self.number assert number is not None fore, back = (30, 40) if number < 8 else (82, 92) return (str(fore + number if foreground else back + number),) elif _type == ColorType.EIGHT_BIT: assert self.number is not None return ("38" if foreground else "48", "5", str(self.number)) else: # self.standard == ColorStandard.TRUECOLOR: assert self.triplet is not None red, green, blue = self.triplet return ("38" if foreground else "48", "2", str(red), str(green), str(blue)) @lru_cache(maxsize=1024) def downgrade(self, system: ColorSystem) -> "Color": """Downgrade a color system to a system with fewer colors.""" if self.type in (ColorType.DEFAULT, system): return self # Convert to 8-bit color from truecolor color if system == ColorSystem.EIGHT_BIT and self.system == ColorSystem.TRUECOLOR: assert self.triplet is not None _h, l, s = rgb_to_hls(self.triplet.normalized) # If saturation is under 15% assume it is grayscale if s < 0.15: gray = round(l 25.0) if gray == 0: color_number = 16 elif gray == 25: color_number = 231 else: color_number = 231 + gray return Color(self.name, ColorType.EIGHT_BIT, number=color_number) red, green, blue = self.triplet six_red = red / 95 if red < 95 else 1 + (red - 95) / 40 six_green = green / 95 if green < 95 else 1 + (green - 95) / 40 six_blue = blue / 95 if blue < 95 else 1 + (blue - 95) / 40 color_number = ( 16 + 36 * round(six_red) + 6 * round(six_green) + round(six_blue) ) return Color(self.name, ColorType.EIGHT_BIT, number=color_number) # Convert to standard from truecolor or 8-bit elif system == ColorSystem.STANDARD: if self.system == ColorSystem.TRUECOLOR: assert self.triplet is not None triplet = self.triplet else: # self.system == ColorSystem.EIGHT_BIT assert self.number is not None triplet = ColorTriplet(EIGHT_BIT_PALETTE[self.number]) color_number = STANDARD_PALETTE.match(triplet) return Color(self.name, ColorType.STANDARD, number=color_number) elif system == ColorSystem.WINDOWS: if self.system == ColorSystem.TRUECOLOR: assert self.triplet is not None triplet = self.triplet else: # self.system == ColorSystem.EIGHT_BIT assert self.number is not None if self.number < 16: return Color(self.name, ColorType.WINDOWS, number=self.number) triplet = ColorTriplet(EIGHT_BIT_PALETTE[self.number]) color_number = WINDOWS_PALETTE.match(triplet) return Color(self.name, ColorType.WINDOWS, number=color_number) return self def parse_rgb_hex(hex_color: str) -> ColorTriplet: """Parse six hex characters in to RGB triplet.""" assert len(hex_color) == 6, "must be 6 characters" color = ColorTriplet( int(hex_color[0:2], 16), int(hex_color[2:4], 16), int(hex_color[4:6], 16) ) return color def blend_rgb( color1: ColorTriplet, color2: ColorTriplet, cross_fade: float = 0.5 ) -> ColorTriplet: """Blend one RGB color in to another.""" r1, g1, b1 = color1 r2, g2, b2 = color2 new_color = ColorTriplet( int(r1 + (r2 - r1) * cross_fade), int(g1 + (g2 - g1) * cross_fade), int(b1 + (b2 - b1) * cross_fade), ) return new_color if __name__ == "__main__": # pragma: no cover from .console import Console from .table import Table from .text import Text console = Console() table = Table(show_footer=False, show_edge=True) table.add_column("Color", width=10, overflow="ellipsis") table.add_column("Number", justify="right", style="yellow") table.add_column("Name", style="green") table.add_column("Hex", style="blue") table.add_column("RGB", style="magenta") colors = sorted((v, k) for k, v in ANSI_COLOR_NAMES.items()) for color_number, name in colors: if "grey" in name: continue color_cell = Text(" " * 10, style=f"on {name}") if color_number < 16: table.add_row(color_cell, f"{color_number}", Text(f'"{name}"')) else: color = EIGHT_BIT_PALETTE[color_number] # type: ignore[has-type] table.add_row( color_cell, str(color_number), Text(f'"{name}"'), color.hex, color.rgb ) console.print(table)	17.78 KB	2026-01-20 12:58
📄 color_triplet.py from typing import NamedTuple, Tuple class ColorTriplet(NamedTuple): """The red, green, and blue components of a color.""" red: int """Red component in 0 to 255 range.""" green: int """Green component in 0 to 255 range.""" blue: int """Blue component in 0 to 255 range.""" @property def hex(self) -> str: """get the color triplet in CSS style.""" red, green, blue = self return f"#{red:02x}{green:02x}{blue:02x}" @property def rgb(self) -> str: """The color in RGB format. Returns: str: An rgb color, e.g. ``"rgb(100,23,255)"``. """ red, green, blue = self return f"rgb({red},{green},{blue})" @property def normalized(self) -> Tuple[float, float, float]: """Convert components into floats between 0 and 1. Returns: Tuple[float, float, float]: A tuple of three normalized colour components. """ red, green, blue = self return red / 255.0, green / 255.0, blue / 255.0	1.03 KB	2026-01-20 12:58
📄 columns.py from collections import defaultdict from itertools import chain from operator import itemgetter from typing import Dict, Iterable, List, Optional, Tuple from .align import Align, AlignMethod from .console import Console, ConsoleOptions, RenderableType, RenderResult from .constrain import Constrain from .measure import Measurement from .padding import Padding, PaddingDimensions from .table import Table from .text import TextType from .jupyter import JupyterMixin class Columns(JupyterMixin): """Display renderables in neat columns. Args: renderables (Iterable[RenderableType]): Any number of Rich renderables (including str). width (int, optional): The desired width of the columns, or None to auto detect. Defaults to None. padding (PaddingDimensions, optional): Optional padding around cells. Defaults to (0, 1). expand (bool, optional): Expand columns to full width. Defaults to False. equal (bool, optional): Arrange in to equal sized columns. Defaults to False. column_first (bool, optional): Align items from top to bottom (rather than left to right). Defaults to False. right_to_left (bool, optional): Start column from right hand side. Defaults to False. align (str, optional): Align value ("left", "right", or "center") or None for default. Defaults to None. title (TextType, optional): Optional title for Columns. """ def __init__( self, renderables: Optional[Iterable[RenderableType]] = None, padding: PaddingDimensions = (0, 1), , width: Optional[int] = None, expand: bool = False, equal: bool = False, column_first: bool = False, right_to_left: bool = False, align: Optional[AlignMethod] = None, title: Optional[TextType] = None, ) -> None: self.renderables = list(renderables or []) self.width = width self.padding = padding self.expand = expand self.equal = equal self.column_first = column_first self.right_to_left = right_to_left self.align: Optional[AlignMethod] = align self.title = title def add_renderable(self, renderable: RenderableType) -> None: """Add a renderable to the columns. Args: renderable (RenderableType): Any renderable object. """ self.renderables.append(renderable) def __rich_console__( self, console: Console, options: ConsoleOptions ) -> RenderResult: render_str = console.render_str renderables = [ render_str(renderable) if isinstance(renderable, str) else renderable for renderable in self.renderables ] if not renderables: return _top, right, _bottom, left = Padding.unpack(self.padding) width_padding = max(left, right) max_width = options.max_width widths: Dict[int, int] = defaultdict(int) column_count = len(renderables) get_measurement = Measurement.get renderable_widths = [ get_measurement(console, options, renderable).maximum for renderable in renderables ] if self.equal: renderable_widths = [max(renderable_widths)] len(renderable_widths) def iter_renderables( column_count: int, ) -> Iterable[Tuple[int, Optional[RenderableType]]]: item_count = len(renderables) if self.column_first: width_renderables = list(zip(renderable_widths, renderables)) column_lengths: List[int] = [item_count // column_count] * column_count for col_no in range(item_count % column_count): column_lengths[col_no] += 1 row_count = (item_count + column_count - 1) // column_count cells = [[-1] * column_count for _ in range(row_count)] row = col = 0 for index in range(item_count): cells[row][col] = index column_lengths[col] -= 1 if column_lengths[col]: row += 1 else: col += 1 row = 0 for index in chain.from_iterable(cells): if index == -1: break yield width_renderables[index] else: yield from zip(renderable_widths, renderables) # Pad odd elements with spaces if item_count % column_count: for _ in range(column_count - (item_count % column_count)): yield 0, None table = Table.grid(padding=self.padding, collapse_padding=True, pad_edge=False) table.expand = self.expand table.title = self.title if self.width is not None: column_count = (max_width) // (self.width + width_padding) for _ in range(column_count): table.add_column(width=self.width) else: while column_count > 1: widths.clear() column_no = 0 for renderable_width, _ in iter_renderables(column_count): widths[column_no] = max(widths[column_no], renderable_width) total_width = sum(widths.values()) + width_padding * ( len(widths) - 1 ) if total_width > max_width: column_count = len(widths) - 1 break else: column_no = (column_no + 1) % column_count else: break get_renderable = itemgetter(1) _renderables = [ get_renderable(_renderable) for _renderable in iter_renderables(column_count) ] if self.equal: _renderables = [ None if renderable is None else Constrain(renderable, renderable_widths[0]) for renderable in _renderables ] if self.align: align = self.align _Align = Align _renderables = [ None if renderable is None else _Align(renderable, align) for renderable in _renderables ] right_to_left = self.right_to_left add_row = table.add_row for start in range(0, len(_renderables), column_count): row = _renderables[start : start + column_count] if right_to_left: row = row[::-1] add_row(*row) yield table if __name__ == "__main__": # pragma: no cover import os console = Console() files = [f"{i} {s}" for i, s in enumerate(sorted(os.listdir()))] columns = Columns(files, padding=(0, 1), expand=False, equal=False) console.print(columns) console.rule() columns.column_first = True console.print(columns) columns.right_to_left = True console.rule() console.print(columns)	6.96 KB	2026-01-20 12:58
📄 console.py import inspect import os import sys import threading import zlib from abc import ABC, abstractmethod from dataclasses import dataclass, field from datetime import datetime from functools import wraps from getpass import getpass from html import escape from inspect import isclass from itertools import islice from math import ceil from time import monotonic from types import FrameType, ModuleType, TracebackType from typing import ( IO, TYPE_CHECKING, Any, Callable, Dict, Iterable, List, Literal, Mapping, NamedTuple, Optional, Protocol, TextIO, Tuple, Type, Union, cast, runtime_checkable, ) from pip._vendor.rich._null_file import NULL_FILE from . import errors, themes from ._emoji_replace import _emoji_replace from ._export_format import CONSOLE_HTML_FORMAT, CONSOLE_SVG_FORMAT from ._fileno import get_fileno from ._log_render import FormatTimeCallable, LogRender from .align import Align, AlignMethod from .color import ColorSystem, blend_rgb from .control import Control from .emoji import EmojiVariant from .highlighter import NullHighlighter, ReprHighlighter from .markup import render as render_markup from .measure import Measurement, measure_renderables from .pager import Pager, SystemPager from .pretty import Pretty, is_expandable from .protocol import rich_cast from .region import Region from .scope import render_scope from .screen import Screen from .segment import Segment from .style import Style, StyleType from .styled import Styled from .terminal_theme import DEFAULT_TERMINAL_THEME, SVG_EXPORT_THEME, TerminalTheme from .text import Text, TextType from .theme import Theme, ThemeStack if TYPE_CHECKING: from ._windows import WindowsConsoleFeatures from .live import Live from .status import Status JUPYTER_DEFAULT_COLUMNS = 115 JUPYTER_DEFAULT_LINES = 100 WINDOWS = sys.platform == "win32" HighlighterType = Callable[[Union[str, "Text"]], "Text"] JustifyMethod = Literal["default", "left", "center", "right", "full"] OverflowMethod = Literal["fold", "crop", "ellipsis", "ignore"] class NoChange: pass NO_CHANGE = NoChange() try: _STDIN_FILENO = sys.__stdin__.fileno() # type: ignore[union-attr] except Exception: _STDIN_FILENO = 0 try: _STDOUT_FILENO = sys.__stdout__.fileno() # type: ignore[union-attr] except Exception: _STDOUT_FILENO = 1 try: _STDERR_FILENO = sys.__stderr__.fileno() # type: ignore[union-attr] except Exception: _STDERR_FILENO = 2 _STD_STREAMS = (_STDIN_FILENO, _STDOUT_FILENO, _STDERR_FILENO) _STD_STREAMS_OUTPUT = (_STDOUT_FILENO, _STDERR_FILENO) _TERM_COLORS = { "kitty": ColorSystem.EIGHT_BIT, "256color": ColorSystem.EIGHT_BIT, "16color": ColorSystem.STANDARD, } class ConsoleDimensions(NamedTuple): """Size of the terminal.""" width: int """The width of the console in 'cells'.""" height: int """The height of the console in lines.""" @dataclass class ConsoleOptions: """Options for __rich_console__ method.""" size: ConsoleDimensions """Size of console.""" legacy_windows: bool """legacy_windows: flag for legacy windows.""" min_width: int """Minimum width of renderable.""" max_width: int """Maximum width of renderable.""" is_terminal: bool """True if the target is a terminal, otherwise False.""" encoding: str """Encoding of terminal.""" max_height: int """Height of container (starts as terminal)""" justify: Optional[JustifyMethod] = None """Justify value override for renderable.""" overflow: Optional[OverflowMethod] = None """Overflow value override for renderable.""" no_wrap: Optional[bool] = False """Disable wrapping for text.""" highlight: Optional[bool] = None """Highlight override for render_str.""" markup: Optional[bool] = None """Enable markup when rendering strings.""" height: Optional[int] = None @property def ascii_only(self) -> bool: """Check if renderables should use ascii only.""" return not self.encoding.startswith("utf") def copy(self) -> "ConsoleOptions": """Return a copy of the options. Returns: ConsoleOptions: a copy of self. """ options: ConsoleOptions = ConsoleOptions.__new__(ConsoleOptions) options.__dict__ = self.__dict__.copy() return options def update( self, , width: Union[int, NoChange] = NO_CHANGE, min_width: Union[int, NoChange] = NO_CHANGE, max_width: Union[int, NoChange] = NO_CHANGE, justify: Union[Optional[JustifyMethod], NoChange] = NO_CHANGE, overflow: Union[Optional[OverflowMethod], NoChange] = NO_CHANGE, no_wrap: Union[Optional[bool], NoChange] = NO_CHANGE, highlight: Union[Optional[bool], NoChange] = NO_CHANGE, markup: Union[Optional[bool], NoChange] = NO_CHANGE, height: Union[Optional[int], NoChange] = NO_CHANGE, ) -> "ConsoleOptions": """Update values, return a copy.""" options = self.copy() if not isinstance(width, NoChange): options.min_width = options.max_width = max(0, width) if not isinstance(min_width, NoChange): options.min_width = min_width if not isinstance(max_width, NoChange): options.max_width = max_width if not isinstance(justify, NoChange): options.justify = justify if not isinstance(overflow, NoChange): options.overflow = overflow if not isinstance(no_wrap, NoChange): options.no_wrap = no_wrap if not isinstance(highlight, NoChange): options.highlight = highlight if not isinstance(markup, NoChange): options.markup = markup if not isinstance(height, NoChange): if height is not None: options.max_height = height options.height = None if height is None else max(0, height) return options def update_width(self, width: int) -> "ConsoleOptions": """Update just the width, return a copy. Args: width (int): New width (sets both min_width and max_width) Returns: ~ConsoleOptions: New console options instance. """ options = self.copy() options.min_width = options.max_width = max(0, width) return options def update_height(self, height: int) -> "ConsoleOptions": """Update the height, and return a copy. Args: height (int): New height Returns: ~ConsoleOptions: New Console options instance. """ options = self.copy() options.max_height = options.height = height return options def reset_height(self) -> "ConsoleOptions": """Return a copy of the options with height set to ``None``. Returns: ~ConsoleOptions: New console options instance. """ options = self.copy() options.height = None return options def update_dimensions(self, width: int, height: int) -> "ConsoleOptions": """Update the width and height, and return a copy. Args: width (int): New width (sets both min_width and max_width). height (int): New height. Returns: ~ConsoleOptions: New console options instance. """ options = self.copy() options.min_width = options.max_width = max(0, width) options.height = options.max_height = height return options @runtime_checkable class RichCast(Protocol): """An object that may be 'cast' to a console renderable.""" def __rich__( self, ) -> Union["ConsoleRenderable", "RichCast", str]: # pragma: no cover ... @runtime_checkable class ConsoleRenderable(Protocol): """An object that supports the console protocol.""" def __rich_console__( self, console: "Console", options: "ConsoleOptions" ) -> "RenderResult": # pragma: no cover ... # A type that may be rendered by Console. RenderableType = Union[ConsoleRenderable, RichCast, str] """A string or any object that may be rendered by Rich.""" # The result of calling a __rich_console__ method. RenderResult = Iterable[Union[RenderableType, Segment]] _null_highlighter = NullHighlighter() class CaptureError(Exception): """An error in the Capture context manager.""" class NewLine: """A renderable to generate new line(s)""" def __init__(self, count: int = 1) -> None: self.count = count def __rich_console__( self, console: "Console", options: "ConsoleOptions" ) -> Iterable[Segment]: yield Segment("\n" self.count) class ScreenUpdate: """Render a list of lines at a given offset.""" def __init__(self, lines: List[List[Segment]], x: int, y: int) -> None: self._lines = lines self.x = x self.y = y def __rich_console__( self, console: "Console", options: ConsoleOptions ) -> RenderResult: x = self.x move_to = Control.move_to for offset, line in enumerate(self._lines, self.y): yield move_to(x, offset) yield from line class Capture: """Context manager to capture the result of printing to the console. See :meth:`~rich.console.Console.capture` for how to use. Args: console (Console): A console instance to capture output. """ def __init__(self, console: "Console") -> None: self._console = console self._result: Optional[str] = None def __enter__(self) -> "Capture": self._console.begin_capture() return self def __exit__( self, exc_type: Optional[Type[BaseException]], exc_val: Optional[BaseException], exc_tb: Optional[TracebackType], ) -> None: self._result = self._console.end_capture() def get(self) -> str: """Get the result of the capture.""" if self._result is None: raise CaptureError( "Capture result is not available until context manager exits." ) return self._result class ThemeContext: """A context manager to use a temporary theme. See :meth:`~rich.console.Console.use_theme` for usage.""" def __init__(self, console: "Console", theme: Theme, inherit: bool = True) -> None: self.console = console self.theme = theme self.inherit = inherit def __enter__(self) -> "ThemeContext": self.console.push_theme(self.theme) return self def __exit__( self, exc_type: Optional[Type[BaseException]], exc_val: Optional[BaseException], exc_tb: Optional[TracebackType], ) -> None: self.console.pop_theme() class PagerContext: """A context manager that 'pages' content. See :meth:`~rich.console.Console.pager` for usage.""" def __init__( self, console: "Console", pager: Optional[Pager] = None, styles: bool = False, links: bool = False, ) -> None: self._console = console self.pager = SystemPager() if pager is None else pager self.styles = styles self.links = links def __enter__(self) -> "PagerContext": self._console._enter_buffer() return self def __exit__( self, exc_type: Optional[Type[BaseException]], exc_val: Optional[BaseException], exc_tb: Optional[TracebackType], ) -> None: if exc_type is None: with self._console._lock: buffer: List[Segment] = self._console._buffer[:] del self._console._buffer[:] segments: Iterable[Segment] = buffer if not self.styles: segments = Segment.strip_styles(segments) elif not self.links: segments = Segment.strip_links(segments) content = self._console._render_buffer(segments) self.pager.show(content) self._console._exit_buffer() class ScreenContext: """A context manager that enables an alternative screen. See :meth:`~rich.console.Console.screen` for usage.""" def __init__( self, console: "Console", hide_cursor: bool, style: StyleType = "" ) -> None: self.console = console self.hide_cursor = hide_cursor self.screen = Screen(style=style) self._changed = False def update( self, renderables: RenderableType, style: Optional[StyleType] = None ) -> None: """Update the screen. Args: renderable (RenderableType, optional): Optional renderable to replace current renderable, or None for no change. Defaults to None. style: (Style, optional): Replacement style, or None for no change. Defaults to None. """ if renderables: self.screen.renderable = ( Group(renderables) if len(renderables) > 1 else renderables[0] ) if style is not None: self.screen.style = style self.console.print(self.screen, end="") def __enter__(self) -> "ScreenContext": self._changed = self.console.set_alt_screen(True) if self._changed and self.hide_cursor: self.console.show_cursor(False) return self def __exit__( self, exc_type: Optional[Type[BaseException]], exc_val: Optional[BaseException], exc_tb: Optional[TracebackType], ) -> None: if self._changed: self.console.set_alt_screen(False) if self.hide_cursor: self.console.show_cursor(True) class Group: """Takes a group of renderables and returns a renderable object that renders the group. Args: renderables (Iterable[RenderableType]): An iterable of renderable objects. fit (bool, optional): Fit dimension of group to contents, or fill available space. Defaults to True. """ def __init__(self, renderables: "RenderableType", fit: bool = True) -> None: self._renderables = renderables self.fit = fit self._render: Optional[List[RenderableType]] = None @property def renderables(self) -> List["RenderableType"]: if self._render is None: self._render = list(self._renderables) return self._render def __rich_measure__( self, console: "Console", options: "ConsoleOptions" ) -> "Measurement": if self.fit: return measure_renderables(console, options, self.renderables) else: return Measurement(options.max_width, options.max_width) def __rich_console__( self, console: "Console", options: "ConsoleOptions" ) -> RenderResult: yield from self.renderables def group(fit: bool = True) -> Callable[..., Callable[..., Group]]: """A decorator that turns an iterable of renderables in to a group. Args: fit (bool, optional): Fit dimension of group to contents, or fill available space. Defaults to True. """ def decorator( method: Callable[..., Iterable[RenderableType]], ) -> Callable[..., Group]: """Convert a method that returns an iterable of renderables in to a Group.""" @wraps(method) def _replace(args: Any, *kwargs: Any) -> Group: renderables = method(args, *kwargs) return Group(renderables, fit=fit) return _replace return decorator def _is_jupyter() -> bool: # pragma: no cover """Check if we're running in a Jupyter notebook.""" try: get_ipython # type: ignore[name-defined] except NameError: return False ipython = get_ipython() # type: ignore[name-defined] shell = ipython.__class__.__name__ if ( "google.colab" in str(ipython.__class__) or os.getenv("DATABRICKS_RUNTIME_VERSION") or shell == "ZMQInteractiveShell" ): return True # Jupyter notebook or qtconsole elif shell == "TerminalInteractiveShell": return False # Terminal running IPython else: return False # Other type (?) COLOR_SYSTEMS = { "standard": ColorSystem.STANDARD, "256": ColorSystem.EIGHT_BIT, "truecolor": ColorSystem.TRUECOLOR, "windows": ColorSystem.WINDOWS, } _COLOR_SYSTEMS_NAMES = {system: name for name, system in COLOR_SYSTEMS.items()} @dataclass class ConsoleThreadLocals(threading.local): """Thread local values for Console context.""" theme_stack: ThemeStack buffer: List[Segment] = field(default_factory=list) buffer_index: int = 0 class RenderHook(ABC): """Provides hooks in to the render process.""" @abstractmethod def process_renderables( self, renderables: List[ConsoleRenderable] ) -> List[ConsoleRenderable]: """Called with a list of objects to render. This method can return a new list of renderables, or modify and return the same list. Args: renderables (List[ConsoleRenderable]): A number of renderable objects. Returns: List[ConsoleRenderable]: A replacement list of renderables. """ _windows_console_features: Optional["WindowsConsoleFeatures"] = None def get_windows_console_features() -> "WindowsConsoleFeatures": # pragma: no cover global _windows_console_features if _windows_console_features is not None: return _windows_console_features from ._windows import get_windows_console_features _windows_console_features = get_windows_console_features() return _windows_console_features def detect_legacy_windows() -> bool: """Detect legacy Windows.""" return WINDOWS and not get_windows_console_features().vt class Console: """A high level console interface. Args: color_system (str, optional): The color system supported by your terminal, either ``"standard"``, ``"256"`` or ``"truecolor"``. Leave as ``"auto"`` to autodetect. force_terminal (Optional[bool], optional): Enable/disable terminal control codes, or None to auto-detect terminal. Defaults to None. force_jupyter (Optional[bool], optional): Enable/disable Jupyter rendering, or None to auto-detect Jupyter. Defaults to None. force_interactive (Optional[bool], optional): Enable/disable interactive mode, or None to auto detect. Defaults to None. soft_wrap (Optional[bool], optional): Set soft wrap default on print method. Defaults to False. theme (Theme, optional): An optional style theme object, or ``None`` for default theme. stderr (bool, optional): Use stderr rather than stdout if ``file`` is not specified. Defaults to False. file (IO, optional): A file object where the console should write to. Defaults to stdout. quiet (bool, Optional): Boolean to suppress all output. Defaults to False. width (int, optional): The width of the terminal. Leave as default to auto-detect width. height (int, optional): The height of the terminal. Leave as default to auto-detect height. style (StyleType, optional): Style to apply to all output, or None for no style. Defaults to None. no_color (Optional[bool], optional): Enabled no color mode, or None to auto detect. Defaults to None. tab_size (int, optional): Number of spaces used to replace a tab character. Defaults to 8. record (bool, optional): Boolean to enable recording of terminal output, required to call :meth:`export_html`, :meth:`export_svg`, and :meth:`export_text`. Defaults to False. markup (bool, optional): Boolean to enable :ref:`console_markup`. Defaults to True. emoji (bool, optional): Enable emoji code. Defaults to True. emoji_variant (str, optional): Optional emoji variant, either "text" or "emoji". Defaults to None. highlight (bool, optional): Enable automatic highlighting. Defaults to True. log_time (bool, optional): Boolean to enable logging of time by :meth:`log` methods. Defaults to True. log_path (bool, optional): Boolean to enable the logging of the caller by :meth:`log`. Defaults to True. log_time_format (Union[str, TimeFormatterCallable], optional): If ``log_time`` is enabled, either string for strftime or callable that formats the time. Defaults to "[%X] ". highlighter (HighlighterType, optional): Default highlighter. legacy_windows (bool, optional): Enable legacy Windows mode, or ``None`` to auto detect. Defaults to ``None``. safe_box (bool, optional): Restrict box options that don't render on legacy Windows. get_datetime (Callable[[], datetime], optional): Callable that gets the current time as a datetime.datetime object (used by Console.log), or None for datetime.now. get_time (Callable[[], time], optional): Callable that gets the current time in seconds, default uses time.monotonic. """ _environ: Mapping[str, str] = os.environ def __init__( self, , color_system: Optional[ Literal["auto", "standard", "256", "truecolor", "windows"] ] = "auto", force_terminal: Optional[bool] = None, force_jupyter: Optional[bool] = None, force_interactive: Optional[bool] = None, soft_wrap: bool = False, theme: Optional[Theme] = None, stderr: bool = False, file: Optional[IO[str]] = None, quiet: bool = False, width: Optional[int] = None, height: Optional[int] = None, style: Optional[StyleType] = None, no_color: Optional[bool] = None, tab_size: int = 8, record: bool = False, markup: bool = True, emoji: bool = True, emoji_variant: Optional[EmojiVariant] = None, highlight: bool = True, log_time: bool = True, log_path: bool = True, log_time_format: Union[str, FormatTimeCallable] = "[%X]", highlighter: Optional["HighlighterType"] = ReprHighlighter(), legacy_windows: Optional[bool] = None, safe_box: bool = True, get_datetime: Optional[Callable[[], datetime]] = None, get_time: Optional[Callable[[], float]] = None, _environ: Optional[Mapping[str, str]] = None, ): # Copy of os.environ allows us to replace it for testing if _environ is not None: self._environ = _environ self.is_jupyter = _is_jupyter() if force_jupyter is None else force_jupyter if self.is_jupyter: if width is None: jupyter_columns = self._environ.get("JUPYTER_COLUMNS") if jupyter_columns is not None and jupyter_columns.isdigit(): width = int(jupyter_columns) else: width = JUPYTER_DEFAULT_COLUMNS if height is None: jupyter_lines = self._environ.get("JUPYTER_LINES") if jupyter_lines is not None and jupyter_lines.isdigit(): height = int(jupyter_lines) else: height = JUPYTER_DEFAULT_LINES self.tab_size = tab_size self.record = record self._markup = markup self._emoji = emoji self._emoji_variant: Optional[EmojiVariant] = emoji_variant self._highlight = highlight self.legacy_windows: bool = ( (detect_legacy_windows() and not self.is_jupyter) if legacy_windows is None else legacy_windows ) if width is None: columns = self._environ.get("COLUMNS") if columns is not None and columns.isdigit(): width = int(columns) - self.legacy_windows if height is None: lines = self._environ.get("LINES") if lines is not None and lines.isdigit(): height = int(lines) self.soft_wrap = soft_wrap self._width = width self._height = height self._color_system: Optional[ColorSystem] self._force_terminal = None if force_terminal is not None: self._force_terminal = force_terminal self._file = file self.quiet = quiet self.stderr = stderr if color_system is None: self._color_system = None elif color_system == "auto": self._color_system = self._detect_color_system() else: self._color_system = COLOR_SYSTEMS[color_system] self._lock = threading.RLock() self._log_render = LogRender( show_time=log_time, show_path=log_path, time_format=log_time_format, ) self.highlighter: HighlighterType = highlighter or _null_highlighter self.safe_box = safe_box self.get_datetime = get_datetime or datetime.now self.get_time = get_time or monotonic self.style = style self.no_color = ( no_color if no_color is not None else self._environ.get("NO_COLOR", "") != "" ) if force_interactive is None: tty_interactive = self._environ.get("TTY_INTERACTIVE", None) if tty_interactive is not None: if tty_interactive == "0": force_interactive = False elif tty_interactive == "1": force_interactive = True self.is_interactive = ( (self.is_terminal and not self.is_dumb_terminal) if force_interactive is None else force_interactive ) self._record_buffer_lock = threading.RLock() self._thread_locals = ConsoleThreadLocals( theme_stack=ThemeStack(themes.DEFAULT if theme is None else theme) ) self._record_buffer: List[Segment] = [] self._render_hooks: List[RenderHook] = [] self._live_stack: List[Live] = [] self._is_alt_screen = False def __repr__(self) -> str: return f"<console width={self.width} {self._color_system!s}>" @property def file(self) -> IO[str]: """Get the file object to write to.""" file = self._file or (sys.stderr if self.stderr else sys.stdout) file = getattr(file, "rich_proxied_file", file) if file is None: file = NULL_FILE return file @file.setter def file(self, new_file: IO[str]) -> None: """Set a new file object.""" self._file = new_file @property def _buffer(self) -> List[Segment]: """Get a thread local buffer.""" return self._thread_locals.buffer @property def _buffer_index(self) -> int: """Get a thread local buffer.""" return self._thread_locals.buffer_index @_buffer_index.setter def _buffer_index(self, value: int) -> None: self._thread_locals.buffer_index = value @property def _theme_stack(self) -> ThemeStack: """Get the thread local theme stack.""" return self._thread_locals.theme_stack def _detect_color_system(self) -> Optional[ColorSystem]: """Detect color system from env vars.""" if self.is_jupyter: return ColorSystem.TRUECOLOR if not self.is_terminal or self.is_dumb_terminal: return None if WINDOWS: # pragma: no cover if self.legacy_windows: # pragma: no cover return ColorSystem.WINDOWS windows_console_features = get_windows_console_features() return ( ColorSystem.TRUECOLOR if windows_console_features.truecolor else ColorSystem.EIGHT_BIT ) else: color_term = self._environ.get("COLORTERM", "").strip().lower() if color_term in ("truecolor", "24bit"): return ColorSystem.TRUECOLOR term = self._environ.get("TERM", "").strip().lower() _term_name, _hyphen, colors = term.rpartition("-") color_system = _TERM_COLORS.get(colors, ColorSystem.STANDARD) return color_system def _enter_buffer(self) -> None: """Enter in to a buffer context, and buffer all output.""" self._buffer_index += 1 def _exit_buffer(self) -> None: """Leave buffer context, and render content if required.""" self._buffer_index -= 1 self._check_buffer() def set_live(self, live: "Live") -> bool: """Set Live instance. Used by Live context manager (no need to call directly). Args: live (Live): Live instance using this Console. Returns: Boolean that indicates if the live is the topmost of the stack. Raises: errors.LiveError: If this Console has a Live context currently active. """ with self._lock: self._live_stack.append(live) return len(self._live_stack) == 1 def clear_live(self) -> None: """Clear the Live instance. Used by the Live context manager (no need to call directly).""" with self._lock: self._live_stack.pop() def push_render_hook(self, hook: RenderHook) -> None: """Add a new render hook to the stack. Args: hook (RenderHook): Render hook instance. """ with self._lock: self._render_hooks.append(hook) def pop_render_hook(self) -> None: """Pop the last renderhook from the stack.""" with self._lock: self._render_hooks.pop() def __enter__(self) -> "Console": """Own context manager to enter buffer context.""" self._enter_buffer() return self def __exit__(self, exc_type: Any, exc_value: Any, traceback: Any) -> None: """Exit buffer context.""" self._exit_buffer() def begin_capture(self) -> None: """Begin capturing console output. Call :meth:`end_capture` to exit capture mode and return output.""" self._enter_buffer() def end_capture(self) -> str: """End capture mode and return captured string. Returns: str: Console output. """ render_result = self._render_buffer(self._buffer) del self._buffer[:] self._exit_buffer() return render_result def push_theme(self, theme: Theme, , inherit: bool = True) -> None: """Push a new theme on to the top of the stack, replacing the styles from the previous theme. Generally speaking, you should call :meth:`~rich.console.Console.use_theme` to get a context manager, rather than calling this method directly. Args: theme (Theme): A theme instance. inherit (bool, optional): Inherit existing styles. Defaults to True. """ self._theme_stack.push_theme(theme, inherit=inherit) def pop_theme(self) -> None: """Remove theme from top of stack, restoring previous theme.""" self._theme_stack.pop_theme() def use_theme(self, theme: Theme, , inherit: bool = True) -> ThemeContext: """Use a different theme for the duration of the context manager. Args: theme (Theme): Theme instance to user. inherit (bool, optional): Inherit existing console styles. Defaults to True. Returns: ThemeContext: [description] """ return ThemeContext(self, theme, inherit) @property def color_system(self) -> Optional[str]: """Get color system string. Returns: Optional[str]: "standard", "256" or "truecolor". """ if self._color_system is not None: return _COLOR_SYSTEMS_NAMES[self._color_system] else: return None @property def encoding(self) -> str: """Get the encoding of the console file, e.g. ``"utf-8"``. Returns: str: A standard encoding string. """ return (getattr(self.file, "encoding", "utf-8") or "utf-8").lower() @property def is_terminal(self) -> bool: """Check if the console is writing to a terminal. Returns: bool: True if the console writing to a device capable of understanding escape sequences, otherwise False. """ # If dev has explicitly set this value, return it if self._force_terminal is not None: return self._force_terminal # Fudge for Idle if hasattr(sys.stdin, "__module__") and sys.stdin.__module__.startswith( "idlelib" ): # Return False for Idle which claims to be a tty but can't handle ansi codes return False if self.is_jupyter: # return False for Jupyter, which may have FORCE_COLOR set return False environ = self._environ tty_compatible = environ.get("TTY_COMPATIBLE", "") # 0 indicates device is not tty compatible if tty_compatible == "0": return False # 1 indicates device is tty compatible if tty_compatible == "1": return True # https://force-color.org/ force_color = environ.get("FORCE_COLOR") if force_color is not None: return force_color != "" # Any other value defaults to auto detect isatty: Optional[Callable[[], bool]] = getattr(self.file, "isatty", None) try: return False if isatty is None else isatty() except ValueError: # in some situation (at the end of a pytest run for example) isatty() can raise # ValueError: I/O operation on closed file # return False because we aren't in a terminal anymore return False @property def is_dumb_terminal(self) -> bool: """Detect dumb terminal. Returns: bool: True if writing to a dumb terminal, otherwise False. """ _term = self._environ.get("TERM", "") is_dumb = _term.lower() in ("dumb", "unknown") return self.is_terminal and is_dumb @property def options(self) -> ConsoleOptions: """Get default console options.""" size = self.size return ConsoleOptions( max_height=size.height, size=size, legacy_windows=self.legacy_windows, min_width=1, max_width=size.width, encoding=self.encoding, is_terminal=self.is_terminal, ) @property def size(self) -> ConsoleDimensions: """Get the size of the console. Returns: ConsoleDimensions: A named tuple containing the dimensions. """ if self._width is not None and self._height is not None: return ConsoleDimensions(self._width - self.legacy_windows, self._height) if self.is_dumb_terminal: return ConsoleDimensions(80, 25) width: Optional[int] = None height: Optional[int] = None streams = _STD_STREAMS_OUTPUT if WINDOWS else _STD_STREAMS for file_descriptor in streams: try: width, height = os.get_terminal_size(file_descriptor) except (AttributeError, ValueError, OSError): # Probably not a terminal pass else: break columns = self._environ.get("COLUMNS") if columns is not None and columns.isdigit(): width = int(columns) lines = self._environ.get("LINES") if lines is not None and lines.isdigit(): height = int(lines) # get_terminal_size can report 0, 0 if run from pseudo-terminal width = width or 80 height = height or 25 return ConsoleDimensions( width - self.legacy_windows if self._width is None else self._width, height if self._height is None else self._height, ) @size.setter def size(self, new_size: Tuple[int, int]) -> None: """Set a new size for the terminal. Args: new_size (Tuple[int, int]): New width and height. """ width, height = new_size self._width = width self._height = height @property def width(self) -> int: """Get the width of the console. Returns: int: The width (in characters) of the console. """ return self.size.width @width.setter def width(self, width: int) -> None: """Set width. Args: width (int): New width. """ self._width = width @property def height(self) -> int: """Get the height of the console. Returns: int: The height (in lines) of the console. """ return self.size.height @height.setter def height(self, height: int) -> None: """Set height. Args: height (int): new height. """ self._height = height def bell(self) -> None: """Play a 'bell' sound (if supported by the terminal).""" self.control(Control.bell()) def capture(self) -> Capture: """A context manager to capture* the result of print() or log() in a string, rather than writing it to the console. Example: >>> from rich.console import Console >>> console = Console() >>> with console.capture() as capture: ... console.print("[bold magenta]Hello World[/]") >>> print(capture.get()) Returns: Capture: Context manager with disables writing to the terminal. """ capture = Capture(self) return capture def pager( self, pager: Optional[Pager] = None, styles: bool = False, links: bool = False ) -> PagerContext: """A context manager to display anything printed within a "pager". The pager application is defined by the system and will typically support at least pressing a key to scroll. Args: pager (Pager, optional): A pager object, or None to use :class:`~rich.pager.SystemPager`. Defaults to None. styles (bool, optional): Show styles in pager. Defaults to False. links (bool, optional): Show links in pager. Defaults to False. Example: >>> from rich.console import Console >>> from rich.__main__ import make_test_card >>> console = Console() >>> with console.pager(): console.print(make_test_card()) Returns: PagerContext: A context manager. """ return PagerContext(self, pager=pager, styles=styles, links=links) def line(self, count: int = 1) -> None: """Write new line(s). Args: count (int, optional): Number of new lines. Defaults to 1. """ assert count >= 0, "count must be >= 0" self.print(NewLine(count)) def clear(self, home: bool = True) -> None: """Clear the screen. Args: home (bool, optional): Also move the cursor to 'home' position. Defaults to True. """ if home: self.control(Control.clear(), Control.home()) else: self.control(Control.clear()) def status( self, status: RenderableType, , spinner: str = "dots", spinner_style: StyleType = "status.spinner", speed: float = 1.0, refresh_per_second: float = 12.5, ) -> "Status": """Display a status and spinner. Args: status (RenderableType): A status renderable (str or Text typically). spinner (str, optional): Name of spinner animation (see python -m rich.spinner). Defaults to "dots". spinner_style (StyleType, optional): Style of spinner. Defaults to "status.spinner". speed (float, optional): Speed factor for spinner animation. Defaults to 1.0. refresh_per_second (float, optional): Number of refreshes per second. Defaults to 12.5. Returns: Status: A Status object that may be used as a context manager. """ from .status import Status status_renderable = Status( status, console=self, spinner=spinner, spinner_style=spinner_style, speed=speed, refresh_per_second=refresh_per_second, ) return status_renderable def show_cursor(self, show: bool = True) -> bool: """Show or hide the cursor. Args: show (bool, optional): Set visibility of the cursor. """ if self.is_terminal: self.control(Control.show_cursor(show)) return True return False def set_alt_screen(self, enable: bool = True) -> bool: """Enables alternative screen mode. Note, if you enable this mode, you should ensure that is disabled before the application exits. See :meth:`~rich.Console.screen` for a context manager that handles this for you. Args: enable (bool, optional): Enable (True) or disable (False) alternate screen. Defaults to True. Returns: bool: True if the control codes were written. """ changed = False if self.is_terminal and not self.legacy_windows: self.control(Control.alt_screen(enable)) changed = True self._is_alt_screen = enable return changed @property def is_alt_screen(self) -> bool: """Check if the alt screen was enabled. Returns: bool: True if the alt screen was enabled, otherwise False. """ return self._is_alt_screen def set_window_title(self, title: str) -> bool: """Set the title of the console terminal window. Warning: There is no means within Rich of "resetting" the window title to its previous value, meaning the title you set will persist even after your application exits. ``fish`` shell resets the window title before and after each command by default, negating this issue. Windows Terminal and command prompt will also reset the title for you. Most other shells and terminals, however, do not do this. Some terminals may require configuration changes before you can set the title. Some terminals may not support setting the title at all. Other software (including the terminal itself, the shell, custom prompts, plugins, etc.) may also set the terminal window title. This could result in whatever value you write using this method being overwritten. Args: title (str): The new title of the terminal window. Returns: bool: True if the control code to change the terminal title was written, otherwise False. Note that a return value of True does not guarantee that the window title has actually changed, since the feature may be unsupported/disabled in some terminals. """ if self.is_terminal: self.control(Control.title(title)) return True return False def screen( self, hide_cursor: bool = True, style: Optional[StyleType] = None ) -> "ScreenContext": """Context manager to enable and disable 'alternative screen' mode. Args: hide_cursor (bool, optional): Also hide the cursor. Defaults to False. style (Style, optional): Optional style for screen. Defaults to None. Returns: ~ScreenContext: Context which enables alternate screen on enter, and disables it on exit. """ return ScreenContext(self, hide_cursor=hide_cursor, style=style or "") def measure( self, renderable: RenderableType, , options: Optional[ConsoleOptions] = None ) -> Measurement: """Measure a renderable. Returns a :class:`~rich.measure.Measurement` object which contains information regarding the number of characters required to print the renderable. Args: renderable (RenderableType): Any renderable or string. options (Optional[ConsoleOptions], optional): Options to use when measuring, or None to use default options. Defaults to None. Returns: Measurement: A measurement of the renderable. """ measurement = Measurement.get(self, options or self.options, renderable) return measurement def render( self, renderable: RenderableType, options: Optional[ConsoleOptions] = None ) -> Iterable[Segment]: """Render an object in to an iterable of `Segment` instances. This method contains the logic for rendering objects with the console protocol. You are unlikely to need to use it directly, unless you are extending the library. Args: renderable (RenderableType): An object supporting the console protocol, or an object that may be converted to a string. options (ConsoleOptions, optional): An options object, or None to use self.options. Defaults to None. Returns: Iterable[Segment]: An iterable of segments that may be rendered. """ _options = options or self.options if _options.max_width < 1: # No space to render anything. This prevents potential recursion errors. return render_iterable: RenderResult renderable = rich_cast(renderable) if hasattr(renderable, "__rich_console__") and not isclass(renderable): render_iterable = renderable.__rich_console__(self, _options) elif isinstance(renderable, str): text_renderable = self.render_str( renderable, highlight=_options.highlight, markup=_options.markup ) render_iterable = text_renderable.__rich_console__(self, _options) else: raise errors.NotRenderableError( f"Unable to render {renderable!r}; " "A str, Segment or object with __rich_console__ method is required" ) try: iter_render = iter(render_iterable) except TypeError: raise errors.NotRenderableError( f"object {render_iterable!r} is not renderable" ) _Segment = Segment _options = _options.reset_height() for render_output in iter_render: if isinstance(render_output, _Segment): yield render_output else: yield from self.render(render_output, _options) def render_lines( self, renderable: RenderableType, options: Optional[ConsoleOptions] = None, , style: Optional[Style] = None, pad: bool = True, new_lines: bool = False, ) -> List[List[Segment]]: """Render objects in to a list of lines. The output of render_lines is useful when further formatting of rendered console text is required, such as the Panel class which draws a border around any renderable object. Args: renderable (RenderableType): Any object renderable in the console. options (Optional[ConsoleOptions], optional): Console options, or None to use self.options. Default to ``None``. style (Style, optional): Optional style to apply to renderables. Defaults to ``None``. pad (bool, optional): Pad lines shorter than render width. Defaults to ``True``. new_lines (bool, optional): Include "\n" characters at end of lines. Returns: List[List[Segment]]: A list of lines, where a line is a list of Segment objects. """ with self._lock: render_options = options or self.options _rendered = self.render(renderable, render_options) if style: _rendered = Segment.apply_style(_rendered, style) render_height = render_options.height if render_height is not None: render_height = max(0, render_height) lines = list( islice( Segment.split_and_crop_lines( _rendered, render_options.max_width, include_new_lines=new_lines, pad=pad, style=style, ), None, render_height, ) ) if render_options.height is not None: extra_lines = render_options.height - len(lines) if extra_lines > 0: pad_line = [ ( [ Segment(" " render_options.max_width, style), Segment("\n"), ] if new_lines else [Segment(" " * render_options.max_width, style)] ) ] lines.extend(pad_line * extra_lines) return lines def render_str( self, text: str, , style: Union[str, Style] = "", justify: Optional[JustifyMethod] = None, overflow: Optional[OverflowMethod] = None, emoji: Optional[bool] = None, markup: Optional[bool] = None, highlight: Optional[bool] = None, highlighter: Optional[HighlighterType] = None, ) -> "Text": """Convert a string to a Text instance. This is called automatically if you print or log a string. Args: text (str): Text to render. style (Union[str, Style], optional): Style to apply to rendered text. justify (str, optional): Justify method: "default", "left", "center", "full", or "right". Defaults to ``None``. overflow (str, optional): Overflow method: "crop", "fold", or "ellipsis". Defaults to ``None``. emoji (Optional[bool], optional): Enable emoji, or ``None`` to use Console default. markup (Optional[bool], optional): Enable markup, or ``None`` to use Console default. highlight (Optional[bool], optional): Enable highlighting, or ``None`` to use Console default. highlighter (HighlighterType, optional): Optional highlighter to apply. Returns: ConsoleRenderable: Renderable object. """ emoji_enabled = emoji or (emoji is None and self._emoji) markup_enabled = markup or (markup is None and self._markup) highlight_enabled = highlight or (highlight is None and self._highlight) if markup_enabled: rich_text = render_markup( text, style=style, emoji=emoji_enabled, emoji_variant=self._emoji_variant, ) rich_text.justify = justify rich_text.overflow = overflow else: rich_text = Text( ( _emoji_replace(text, default_variant=self._emoji_variant) if emoji_enabled else text ), justify=justify, overflow=overflow, style=style, ) _highlighter = (highlighter or self.highlighter) if highlight_enabled else None if _highlighter is not None: highlight_text = _highlighter(str(rich_text)) highlight_text.copy_styles(rich_text) return highlight_text return rich_text def get_style( self, name: Union[str, Style], , default: Optional[Union[Style, str]] = None ) -> Style: """Get a Style instance by its theme name or parse a definition. Args: name (str): The name of a style or a style definition. Returns: Style: A Style object. Raises: MissingStyle: If no style could be parsed from name. """ if isinstance(name, Style): return name try: style = self._theme_stack.get(name) if style is None: style = Style.parse(name) return style.copy() if style.link else style except errors.StyleSyntaxError as error: if default is not None: return self.get_style(default) raise errors.MissingStyle( f"Failed to get style {name!r}; {error}" ) from None def _collect_renderables( self, objects: Iterable[Any], sep: str, end: str, , justify: Optional[JustifyMethod] = None, emoji: Optional[bool] = None, markup: Optional[bool] = None, highlight: Optional[bool] = None, ) -> List[ConsoleRenderable]: """Combine a number of renderables and text into one renderable. Args: objects (Iterable[Any]): Anything that Rich can render. sep (str): String to write between print data. end (str): String to write at end of print data. justify (str, optional): One of "left", "right", "center", or "full". Defaults to ``None``. emoji (Optional[bool], optional): Enable emoji code, or ``None`` to use console default. markup (Optional[bool], optional): Enable markup, or ``None`` to use console default. highlight (Optional[bool], optional): Enable automatic highlighting, or ``None`` to use console default. Returns: List[ConsoleRenderable]: A list of things to render. """ renderables: List[ConsoleRenderable] = [] _append = renderables.append text: List[Text] = [] append_text = text.append append = _append if justify in ("left", "center", "right"): def align_append(renderable: RenderableType) -> None: _append(Align(renderable, cast(AlignMethod, justify))) append = align_append _highlighter: HighlighterType = _null_highlighter if highlight or (highlight is None and self._highlight): _highlighter = self.highlighter def check_text() -> None: if text: sep_text = Text(sep, justify=justify, end=end) append(sep_text.join(text)) text.clear() for renderable in objects: renderable = rich_cast(renderable) if isinstance(renderable, str): append_text( self.render_str( renderable, emoji=emoji, markup=markup, highlight=highlight, highlighter=_highlighter, ) ) elif isinstance(renderable, Text): append_text(renderable) elif isinstance(renderable, ConsoleRenderable): check_text() append(renderable) elif is_expandable(renderable): check_text() append(Pretty(renderable, highlighter=_highlighter)) else: append_text(_highlighter(str(renderable))) check_text() if self.style is not None: style = self.get_style(self.style) renderables = [Styled(renderable, style) for renderable in renderables] return renderables def rule( self, title: TextType = "", , characters: str = "─", style: Union[str, Style] = "rule.line", align: AlignMethod = "center", ) -> None: """Draw a line with optional centered title. Args: title (str, optional): Text to render over the rule. Defaults to "". characters (str, optional): Character(s) to form the line. Defaults to "─". style (str, optional): Style of line. Defaults to "rule.line". align (str, optional): How to align the title, one of "left", "center", or "right". Defaults to "center". """ from .rule import Rule rule = Rule(title=title, characters=characters, style=style, align=align) self.print(rule) def control(self, control: Control) -> None: """Insert non-printing control codes. Args: control_codes (str): Control codes, such as those that may move the cursor. """ if not self.is_dumb_terminal: with self: self._buffer.extend(_control.segment for _control in control) def out( self, objects: Any, sep: str = " ", end: str = "\n", style: Optional[Union[str, Style]] = None, highlight: Optional[bool] = None, ) -> None: """Output to the terminal. This is a low-level way of writing to the terminal which unlike :meth:`~rich.console.Console.print` won't pretty print, wrap text, or apply markup, but will optionally apply highlighting and a basic style. Args: sep (str, optional): String to write between print data. Defaults to " ". end (str, optional): String to write at end of print data. Defaults to "\\\\n". style (Union[str, Style], optional): A style to apply to output. Defaults to None. highlight (Optional[bool], optional): Enable automatic highlighting, or ``None`` to use console default. Defaults to ``None``. """ raw_output: str = sep.join(str(_object) for _object in objects) self.print( raw_output, style=style, highlight=highlight, emoji=False, markup=False, no_wrap=True, overflow="ignore", crop=False, end=end, ) def print( self, objects: Any, sep: str = " ", end: str = "\n", style: Optional[Union[str, Style]] = None, justify: Optional[JustifyMethod] = None, overflow: Optional[OverflowMethod] = None, no_wrap: Optional[bool] = None, emoji: Optional[bool] = None, markup: Optional[bool] = None, highlight: Optional[bool] = None, width: Optional[int] = None, height: Optional[int] = None, crop: bool = True, soft_wrap: Optional[bool] = None, new_line_start: bool = False, ) -> None: """Print to the console. Args: objects (positional args): Objects to log to the terminal. sep (str, optional): String to write between print data. Defaults to " ". end (str, optional): String to write at end of print data. Defaults to "\\\\n". style (Union[str, Style], optional): A style to apply to output. Defaults to None. justify (str, optional): Justify method: "default", "left", "right", "center", or "full". Defaults to ``None``. overflow (str, optional): Overflow method: "ignore", "crop", "fold", or "ellipsis". Defaults to None. no_wrap (Optional[bool], optional): Disable word wrapping. Defaults to None. emoji (Optional[bool], optional): Enable emoji code, or ``None`` to use console default. Defaults to ``None``. markup (Optional[bool], optional): Enable markup, or ``None`` to use console default. Defaults to ``None``. highlight (Optional[bool], optional): Enable automatic highlighting, or ``None`` to use console default. Defaults to ``None``. width (Optional[int], optional): Width of output, or ``None`` to auto-detect. Defaults to ``None``. crop (Optional[bool], optional): Crop output to width of terminal. Defaults to True. soft_wrap (bool, optional): Enable soft wrap mode which disables word wrapping and cropping of text or ``None`` for Console default. Defaults to ``None``. new_line_start (bool, False): Insert a new line at the start if the output contains more than one line. Defaults to ``False``. """ if not objects: objects = (NewLine(),) if soft_wrap is None: soft_wrap = self.soft_wrap if soft_wrap: if no_wrap is None: no_wrap = True if overflow is None: overflow = "ignore" crop = False render_hooks = self._render_hooks[:] with self: renderables = self._collect_renderables( objects, sep, end, justify=justify, emoji=emoji, markup=markup, highlight=highlight, ) for hook in render_hooks: renderables = hook.process_renderables(renderables) render_options = self.options.update( justify=justify, overflow=overflow, width=min(width, self.width) if width is not None else NO_CHANGE, height=height, no_wrap=no_wrap, markup=markup, highlight=highlight, ) new_segments: List[Segment] = [] extend = new_segments.extend render = self.render if style is None: for renderable in renderables: extend(render(renderable, render_options)) else: for renderable in renderables: extend( Segment.apply_style( render(renderable, render_options), self.get_style(style) ) ) if new_line_start: if ( len("".join(segment.text for segment in new_segments).splitlines()) > 1 ): new_segments.insert(0, Segment.line()) if crop: buffer_extend = self._buffer.extend for line in Segment.split_and_crop_lines( new_segments, self.width, pad=False ): buffer_extend(line) else: self._buffer.extend(new_segments) def print_json( self, json: Optional[str] = None, , data: Any = None, indent: Union[None, int, str] = 2, highlight: bool = True, skip_keys: bool = False, ensure_ascii: bool = False, check_circular: bool = True, allow_nan: bool = True, default: Optional[Callable[[Any], Any]] = None, sort_keys: bool = False, ) -> None: """Pretty prints JSON. Output will be valid JSON. Args: json (Optional[str]): A string containing JSON. data (Any): If json is not supplied, then encode this data. indent (Union[None, int, str], optional): Number of spaces to indent. Defaults to 2. highlight (bool, optional): Enable highlighting of output: Defaults to True. skip_keys (bool, optional): Skip keys not of a basic type. Defaults to False. ensure_ascii (bool, optional): Escape all non-ascii characters. Defaults to False. check_circular (bool, optional): Check for circular references. Defaults to True. allow_nan (bool, optional): Allow NaN and Infinity values. Defaults to True. default (Callable, optional): A callable that converts values that can not be encoded in to something that can be JSON encoded. Defaults to None. sort_keys (bool, optional): Sort dictionary keys. Defaults to False. """ from pip._vendor.rich.json import JSON if json is None: json_renderable = JSON.from_data( data, indent=indent, highlight=highlight, skip_keys=skip_keys, ensure_ascii=ensure_ascii, check_circular=check_circular, allow_nan=allow_nan, default=default, sort_keys=sort_keys, ) else: if not isinstance(json, str): raise TypeError( f"json must be str. Did you mean print_json(data={json!r}) ?" ) json_renderable = JSON( json, indent=indent, highlight=highlight, skip_keys=skip_keys, ensure_ascii=ensure_ascii, check_circular=check_circular, allow_nan=allow_nan, default=default, sort_keys=sort_keys, ) self.print(json_renderable, soft_wrap=True) def update_screen( self, renderable: RenderableType, , region: Optional[Region] = None, options: Optional[ConsoleOptions] = None, ) -> None: """Update the screen at a given offset. Args: renderable (RenderableType): A Rich renderable. region (Region, optional): Region of screen to update, or None for entire screen. Defaults to None. x (int, optional): x offset. Defaults to 0. y (int, optional): y offset. Defaults to 0. Raises: errors.NoAltScreen: If the Console isn't in alt screen mode. """ if not self.is_alt_screen: raise errors.NoAltScreen("Alt screen must be enabled to call update_screen") render_options = options or self.options if region is None: x = y = 0 render_options = render_options.update_dimensions( render_options.max_width, render_options.height or self.height ) else: x, y, width, height = region render_options = render_options.update_dimensions(width, height) lines = self.render_lines(renderable, options=render_options) self.update_screen_lines(lines, x, y) def update_screen_lines( self, lines: List[List[Segment]], x: int = 0, y: int = 0 ) -> None: """Update lines of the screen at a given offset. Args: lines (List[List[Segment]]): Rendered lines (as produced by :meth:`~rich.Console.render_lines`). x (int, optional): x offset (column no). Defaults to 0. y (int, optional): y offset (column no). Defaults to 0. Raises: errors.NoAltScreen: If the Console isn't in alt screen mode. """ if not self.is_alt_screen: raise errors.NoAltScreen("Alt screen must be enabled to call update_screen") screen_update = ScreenUpdate(lines, x, y) segments = self.render(screen_update) self._buffer.extend(segments) self._check_buffer() def print_exception( self, , width: Optional[int] = 100, extra_lines: int = 3, theme: Optional[str] = None, word_wrap: bool = False, show_locals: bool = False, suppress: Iterable[Union[str, ModuleType]] = (), max_frames: int = 100, ) -> None: """Prints a rich render of the last exception and traceback. Args: width (Optional[int], optional): Number of characters used to render code. Defaults to 100. extra_lines (int, optional): Additional lines of code to render. Defaults to 3. theme (str, optional): Override pygments theme used in traceback word_wrap (bool, optional): Enable word wrapping of long lines. Defaults to False. show_locals (bool, optional): Enable display of local variables. Defaults to False. suppress (Iterable[Union[str, ModuleType]]): Optional sequence of modules or paths to exclude from traceback. max_frames (int): Maximum number of frames to show in a traceback, 0 for no maximum. Defaults to 100. """ from .traceback import Traceback traceback = Traceback( width=width, extra_lines=extra_lines, theme=theme, word_wrap=word_wrap, show_locals=show_locals, suppress=suppress, max_frames=max_frames, ) self.print(traceback) @staticmethod def _caller_frame_info( offset: int, currentframe: Callable[[], Optional[FrameType]] = inspect.currentframe, ) -> Tuple[str, int, Dict[str, Any]]: """Get caller frame information. Args: offset (int): the caller offset within the current frame stack. currentframe (Callable[[], Optional[FrameType]], optional): the callable to use to retrieve the current frame. Defaults to ``inspect.currentframe``. Returns: Tuple[str, int, Dict[str, Any]]: A tuple containing the filename, the line number and the dictionary of local variables associated with the caller frame. Raises: RuntimeError: If the stack offset is invalid. """ # Ignore the frame of this local helper offset += 1 frame = currentframe() if frame is not None: # Use the faster currentframe where implemented while offset and frame is not None: frame = frame.f_back offset -= 1 assert frame is not None return frame.f_code.co_filename, frame.f_lineno, frame.f_locals else: # Fallback to the slower stack frame_info = inspect.stack()[offset] return frame_info.filename, frame_info.lineno, frame_info.frame.f_locals def log( self, objects: Any, sep: str = " ", end: str = "\n", style: Optional[Union[str, Style]] = None, justify: Optional[JustifyMethod] = None, emoji: Optional[bool] = None, markup: Optional[bool] = None, highlight: Optional[bool] = None, log_locals: bool = False, _stack_offset: int = 1, ) -> None: """Log rich content to the terminal. Args: objects (positional args): Objects to log to the terminal. sep (str, optional): String to write between print data. Defaults to " ". end (str, optional): String to write at end of print data. Defaults to "\\\\n". style (Union[str, Style], optional): A style to apply to output. Defaults to None. justify (str, optional): One of "left", "right", "center", or "full". Defaults to ``None``. emoji (Optional[bool], optional): Enable emoji code, or ``None`` to use console default. Defaults to None. markup (Optional[bool], optional): Enable markup, or ``None`` to use console default. Defaults to None. highlight (Optional[bool], optional): Enable automatic highlighting, or ``None`` to use console default. Defaults to None. log_locals (bool, optional): Boolean to enable logging of locals where ``log()`` was called. Defaults to False. _stack_offset (int, optional): Offset of caller from end of call stack. Defaults to 1. """ if not objects: objects = (NewLine(),) render_hooks = self._render_hooks[:] with self: renderables = self._collect_renderables( objects, sep, end, justify=justify, emoji=emoji, markup=markup, highlight=highlight, ) if style is not None: renderables = [Styled(renderable, style) for renderable in renderables] filename, line_no, locals = self._caller_frame_info(_stack_offset) link_path = None if filename.startswith("<") else os.path.abspath(filename) path = filename.rpartition(os.sep)[-1] if log_locals: locals_map = { key: value for key, value in locals.items() if not key.startswith("__") } renderables.append(render_scope(locals_map, title="[i]locals")) renderables = [ self._log_render( self, renderables, log_time=self.get_datetime(), path=path, line_no=line_no, link_path=link_path, ) ] for hook in render_hooks: renderables = hook.process_renderables(renderables) new_segments: List[Segment] = [] extend = new_segments.extend render = self.render render_options = self.options for renderable in renderables: extend(render(renderable, render_options)) buffer_extend = self._buffer.extend for line in Segment.split_and_crop_lines( new_segments, self.width, pad=False ): buffer_extend(line) def on_broken_pipe(self) -> None: """This function is called when a `BrokenPipeError` is raised. This can occur when piping Textual output in Linux and macOS. The default implementation is to exit the app, but you could implement this method in a subclass to change the behavior. See https://docs.python.org/3/library/signal.html#note-on-sigpipe for details. """ self.quiet = True devnull = os.open(os.devnull, os.O_WRONLY) os.dup2(devnull, sys.stdout.fileno()) raise SystemExit(1) def _check_buffer(self) -> None: """Check if the buffer may be rendered. Render it if it can (e.g. Console.quiet is False) Rendering is supported on Windows, Unix and Jupyter environments. For legacy Windows consoles, the win32 API is called directly. This method will also record what it renders if recording is enabled via Console.record. """ if self.quiet: del self._buffer[:] return try: self._write_buffer() except BrokenPipeError: self.on_broken_pipe() def _write_buffer(self) -> None: """Write the buffer to the output file.""" with self._lock: if self.record and not self._buffer_index: with self._record_buffer_lock: self._record_buffer.extend(self._buffer[:]) if self._buffer_index == 0: if self.is_jupyter: # pragma: no cover from .jupyter import display display(self._buffer, self._render_buffer(self._buffer[:])) del self._buffer[:] else: if WINDOWS: use_legacy_windows_render = False if self.legacy_windows: fileno = get_fileno(self.file) if fileno is not None: use_legacy_windows_render = ( fileno in _STD_STREAMS_OUTPUT ) if use_legacy_windows_render: from pip._vendor.rich._win32_console import LegacyWindowsTerm from pip._vendor.rich._windows_renderer import legacy_windows_render buffer = self._buffer[:] if self.no_color and self._color_system: buffer = list(Segment.remove_color(buffer)) legacy_windows_render(buffer, LegacyWindowsTerm(self.file)) else: # Either a non-std stream on legacy Windows, or modern Windows. text = self._render_buffer(self._buffer[:]) # https://bugs.python.org/issue37871 # https://github.com/python/cpython/issues/82052 # We need to avoid writing more than 32Kb in a single write, due to the above bug write = self.file.write # Worse case scenario, every character is 4 bytes of utf-8 MAX_WRITE = 32 1024 // 4 try: if len(text) <= MAX_WRITE: write(text) else: batch: List[str] = [] batch_append = batch.append size = 0 for line in text.splitlines(True): if size + len(line) > MAX_WRITE and batch: write("".join(batch)) batch.clear() size = 0 batch_append(line) size += len(line) if batch: write("".join(batch)) batch.clear() except UnicodeEncodeError as error: error.reason = f"{error.reason}\n* You may need to add PYTHONIOENCODING=utf-8 to your environment " raise else: text = self._render_buffer(self._buffer[:]) try: self.file.write(text) except UnicodeEncodeError as error: error.reason = f"{error.reason}\n You may need to add PYTHONIOENCODING=utf-8 to your environment " raise self.file.flush() del self._buffer[:] def _render_buffer(self, buffer: Iterable[Segment]) -> str: """Render buffered output, and clear buffer.""" output: List[str] = [] append = output.append color_system = self._color_system legacy_windows = self.legacy_windows not_terminal = not self.is_terminal if self.no_color and color_system: buffer = Segment.remove_color(buffer) for text, style, control in buffer: if style: append( style.render( text, color_system=color_system, legacy_windows=legacy_windows, ) ) elif not (not_terminal and control): append(text) rendered = "".join(output) return rendered def input( self, prompt: TextType = "", , markup: bool = True, emoji: bool = True, password: bool = False, stream: Optional[TextIO] = None, ) -> str: """Displays a prompt and waits for input from the user. The prompt may contain color / style. It works in the same way as Python's builtin :func:`input` function and provides elaborate line editing and history features if Python's builtin :mod:`readline` module is previously loaded. Args: prompt (Union[str, Text]): Text to render in the prompt. markup (bool, optional): Enable console markup (requires a str prompt). Defaults to True. emoji (bool, optional): Enable emoji (requires a str prompt). Defaults to True. password: (bool, optional): Hide typed text. Defaults to False. stream: (TextIO, optional): Optional file to read input from (rather than stdin). Defaults to None. Returns: str: Text read from stdin. """ if prompt: self.print(prompt, markup=markup, emoji=emoji, end="") if password: result = getpass("", stream=stream) else: if stream: result = stream.readline() else: result = input() return result def export_text(self, , clear: bool = True, styles: bool = False) -> str: """Generate text from console contents (requires record=True argument in constructor). Args: clear (bool, optional): Clear record buffer after exporting. Defaults to ``True``. styles (bool, optional): If ``True``, ansi escape codes will be included. ``False`` for plain text. Defaults to ``False``. Returns: str: String containing console contents. """ assert ( self.record ), "To export console contents set record=True in the constructor or instance" with self._record_buffer_lock: if styles: text = "".join( (style.render(text) if style else text) for text, style, _ in self._record_buffer ) else: text = "".join( segment.text for segment in self._record_buffer if not segment.control ) if clear: del self._record_buffer[:] return text def save_text(self, path: str, , clear: bool = True, styles: bool = False) -> None: """Generate text from console and save to a given location (requires record=True argument in constructor). Args: path (str): Path to write text files. clear (bool, optional): Clear record buffer after exporting. Defaults to ``True``. styles (bool, optional): If ``True``, ansi style codes will be included. ``False`` for plain text. Defaults to ``False``. """ text = self.export_text(clear=clear, styles=styles) with open(path, "w", encoding="utf-8") as write_file: write_file.write(text) def export_html( self, , theme: Optional[TerminalTheme] = None, clear: bool = True, code_format: Optional[str] = None, inline_styles: bool = False, ) -> str: """Generate HTML from console contents (requires record=True argument in constructor). Args: theme (TerminalTheme, optional): TerminalTheme object containing console colors. clear (bool, optional): Clear record buffer after exporting. Defaults to ``True``. code_format (str, optional): Format string to render HTML. In addition to '{foreground}', '{background}', and '{code}', should contain '{stylesheet}' if inline_styles is ``False``. inline_styles (bool, optional): If ``True`` styles will be inlined in to spans, which makes files larger but easier to cut and paste markup. If ``False``, styles will be embedded in a style tag. Defaults to False. Returns: str: String containing console contents as HTML. """ assert ( self.record ), "To export console contents set record=True in the constructor or instance" fragments: List[str] = [] append = fragments.append _theme = theme or DEFAULT_TERMINAL_THEME stylesheet = "" render_code_format = CONSOLE_HTML_FORMAT if code_format is None else code_format with self._record_buffer_lock: if inline_styles: for text, style, _ in Segment.filter_control( Segment.simplify(self._record_buffer) ): text = escape(text) if style: rule = style.get_html_style(_theme) if style.link: text = f'<a href="{style.link}">{text}</a>' text = f'<span style="{rule}">{text}</span>' if rule else text append(text) else: styles: Dict[str, int] = {} for text, style, _ in Segment.filter_control( Segment.simplify(self._record_buffer) ): text = escape(text) if style: rule = style.get_html_style(_theme) style_number = styles.setdefault(rule, len(styles) + 1) if style.link: text = f'<a class="r{style_number}" href="{style.link}">{text}</a>' else: text = f'<span class="r{style_number}">{text}</span>' append(text) stylesheet_rules: List[str] = [] stylesheet_append = stylesheet_rules.append for style_rule, style_number in styles.items(): if style_rule: stylesheet_append(f".r{style_number} {{{style_rule}}}") stylesheet = "\n".join(stylesheet_rules) rendered_code = render_code_format.format( code="".join(fragments), stylesheet=stylesheet, foreground=_theme.foreground_color.hex, background=_theme.background_color.hex, ) if clear: del self._record_buffer[:] return rendered_code def save_html( self, path: str, , theme: Optional[TerminalTheme] = None, clear: bool = True, code_format: str = CONSOLE_HTML_FORMAT, inline_styles: bool = False, ) -> None: """Generate HTML from console contents and write to a file (requires record=True argument in constructor). Args: path (str): Path to write html file. theme (TerminalTheme, optional): TerminalTheme object containing console colors. clear (bool, optional): Clear record buffer after exporting. Defaults to ``True``. code_format (str, optional): Format string to render HTML. In addition to '{foreground}', '{background}', and '{code}', should contain '{stylesheet}' if inline_styles is ``False``. inline_styles (bool, optional): If ``True`` styles will be inlined in to spans, which makes files larger but easier to cut and paste markup. If ``False``, styles will be embedded in a style tag. Defaults to False. """ html = self.export_html( theme=theme, clear=clear, code_format=code_format, inline_styles=inline_styles, ) with open(path, "w", encoding="utf-8") as write_file: write_file.write(html) def export_svg( self, , title: str = "Rich", theme: Optional[TerminalTheme] = None, clear: bool = True, code_format: str = CONSOLE_SVG_FORMAT, font_aspect_ratio: float = 0.61, unique_id: Optional[str] = None, ) -> str: """ Generate an SVG from the console contents (requires record=True in Console constructor). Args: title (str, optional): The title of the tab in the output image theme (TerminalTheme, optional): The ``TerminalTheme`` object to use to style the terminal clear (bool, optional): Clear record buffer after exporting. Defaults to ``True`` code_format (str, optional): Format string used to generate the SVG. Rich will inject a number of variables into the string in order to form the final SVG output. The default template used and the variables injected by Rich can be found by inspecting the ``console.CONSOLE_SVG_FORMAT`` variable. font_aspect_ratio (float, optional): The width to height ratio of the font used in the ``code_format`` string. Defaults to 0.61, which is the width to height ratio of Fira Code (the default font). If you aren't specifying a different font inside ``code_format``, you probably don't need this. unique_id (str, optional): unique id that is used as the prefix for various elements (CSS styles, node ids). If not set, this defaults to a computed value based on the recorded content. """ from pip._vendor.rich.cells import cell_len style_cache: Dict[Style, str] = {} def get_svg_style(style: Style) -> str: """Convert a Style to CSS rules for SVG.""" if style in style_cache: return style_cache[style] css_rules = [] color = ( _theme.foreground_color if (style.color is None or style.color.is_default) else style.color.get_truecolor(_theme) ) bgcolor = ( _theme.background_color if (style.bgcolor is None or style.bgcolor.is_default) else style.bgcolor.get_truecolor(_theme) ) if style.reverse: color, bgcolor = bgcolor, color if style.dim: color = blend_rgb(color, bgcolor, 0.4) css_rules.append(f"fill: {color.hex}") if style.bold: css_rules.append("font-weight: bold") if style.italic: css_rules.append("font-style: italic;") if style.underline: css_rules.append("text-decoration: underline;") if style.strike: css_rules.append("text-decoration: line-through;") css = ";".join(css_rules) style_cache[style] = css return css _theme = theme or SVG_EXPORT_THEME width = self.width char_height = 20 char_width = char_height font_aspect_ratio line_height = char_height * 1.22 margin_top = 1 margin_right = 1 margin_bottom = 1 margin_left = 1 padding_top = 40 padding_right = 8 padding_bottom = 8 padding_left = 8 padding_width = padding_left + padding_right padding_height = padding_top + padding_bottom margin_width = margin_left + margin_right margin_height = margin_top + margin_bottom text_backgrounds: List[str] = [] text_group: List[str] = [] classes: Dict[str, int] = {} style_no = 1 def escape_text(text: str) -> str: """HTML escape text and replace spaces with nbsp.""" return escape(text).replace(" ", " ") def make_tag( name: str, content: Optional[str] = None, *attribs: object ) -> str: """Make a tag from name, content, and attributes.""" def stringify(value: object) -> str: if isinstance(value, (float)): return format(value, "g") return str(value) tag_attribs = " ".join( f'{k.lstrip("_").replace("_", "-")}="{stringify(v)}"' for k, v in attribs.items() ) return ( f"<{name} {tag_attribs}>{content}</{name}>" if content else f"<{name} {tag_attribs}/>" ) with self._record_buffer_lock: segments = list(Segment.filter_control(self._record_buffer)) if clear: self._record_buffer.clear() if unique_id is None: unique_id = "terminal-" + str( zlib.adler32( ("".join(repr(segment) for segment in segments)).encode( "utf-8", "ignore", ) + title.encode("utf-8", "ignore") ) ) y = 0 for y, line in enumerate(Segment.split_and_crop_lines(segments, length=width)): x = 0 for text, style, _control in line: style = style or Style() rules = get_svg_style(style) if rules not in classes: classes[rules] = style_no style_no += 1 class_name = f"r{classes[rules]}" if style.reverse: has_background = True background = ( _theme.foreground_color.hex if style.color is None else style.color.get_truecolor(_theme).hex ) else: bgcolor = style.bgcolor has_background = bgcolor is not None and not bgcolor.is_default background = ( _theme.background_color.hex if style.bgcolor is None else style.bgcolor.get_truecolor(_theme).hex ) text_length = cell_len(text) if has_background: text_backgrounds.append( make_tag( "rect", fill=background, x=x char_width, y=y * line_height + 1.5, width=char_width * text_length, height=line_height + 0.25, shape_rendering="crispEdges", ) ) if text != " " * len(text): text_group.append( make_tag( "text", escape_text(text), _class=f"{unique_id}-{class_name}", x=x * char_width, y=y * line_height + char_height, textLength=char_width * len(text), clip_path=f"url(#{unique_id}-line-{y})", ) ) x += cell_len(text) line_offsets = [line_no * line_height + 1.5 for line_no in range(y)] lines = "\n".join( f"""<clipPath id="{unique_id}-line-{line_no}"> {make_tag("rect", x=0, y=offset, width=char_width * width, height=line_height + 0.25)} </clipPath>""" for line_no, offset in enumerate(line_offsets) ) styles = "\n".join( f".{unique_id}-r{rule_no} {{ {css} }}" for css, rule_no in classes.items() ) backgrounds = "".join(text_backgrounds) matrix = "".join(text_group) terminal_width = ceil(width * char_width + padding_width) terminal_height = (y + 1) * line_height + padding_height chrome = make_tag( "rect", fill=_theme.background_color.hex, stroke="rgba(255,255,255,0.35)", stroke_width="1", x=margin_left, y=margin_top, width=terminal_width, height=terminal_height, rx=8, ) title_color = _theme.foreground_color.hex if title: chrome += make_tag( "text", escape_text(title), _class=f"{unique_id}-title", fill=title_color, text_anchor="middle", x=terminal_width // 2, y=margin_top + char_height + 6, ) chrome += f""" <g transform="translate(26,22)"> <circle cx="0" cy="0" r="7" fill="#ff5f57"/> <circle cx="22" cy="0" r="7" fill="#febc2e"/> <circle cx="44" cy="0" r="7" fill="#28c840"/> </g> """ svg = code_format.format( unique_id=unique_id, char_width=char_width, char_height=char_height, line_height=line_height, terminal_width=char_width * width - 1, terminal_height=(y + 1) * line_height - 1, width=terminal_width + margin_width, height=terminal_height + margin_height, terminal_x=margin_left + padding_left, terminal_y=margin_top + padding_top, styles=styles, chrome=chrome, backgrounds=backgrounds, matrix=matrix, lines=lines, ) return svg def save_svg( self, path: str, *, title: str = "Rich", theme: Optional[TerminalTheme] = None, clear: bool = True, code_format: str = CONSOLE_SVG_FORMAT, font_aspect_ratio: float = 0.61, unique_id: Optional[str] = None, ) -> None: """Generate an SVG file from the console contents (requires record=True in Console constructor). Args: path (str): The path to write the SVG to. title (str, optional): The title of the tab in the output image theme (TerminalTheme, optional): The ``TerminalTheme`` object to use to style the terminal clear (bool, optional): Clear record buffer after exporting. Defaults to ``True`` code_format (str, optional): Format string used to generate the SVG. Rich will inject a number of variables into the string in order to form the final SVG output. The default template used and the variables injected by Rich can be found by inspecting the ``console.CONSOLE_SVG_FORMAT`` variable. font_aspect_ratio (float, optional): The width to height ratio of the font used in the ``code_format`` string. Defaults to 0.61, which is the width to height ratio of Fira Code (the default font). If you aren't specifying a different font inside ``code_format``, you probably don't need this. unique_id (str, optional): unique id that is used as the prefix for various elements (CSS styles, node ids). If not set, this defaults to a computed value based on the recorded content. """ svg = self.export_svg( title=title, theme=theme, clear=clear, code_format=code_format, font_aspect_ratio=font_aspect_ratio, unique_id=unique_id, ) with open(path, "w", encoding="utf-8") as write_file: write_file.write(svg) def _svg_hash(svg_main_code: str) -> str: """Returns a unique hash for the given SVG main code. Args: svg_main_code (str): The content we're going to inject in the SVG envelope. Returns: str: a hash of the given content """ return str(zlib.adler32(svg_main_code.encode())) if __name__ == "__main__": # pragma: no cover console = Console(record=True) console.log( "JSONRPC [i]request[/i]", 5, 1.3, True, False, None, { "jsonrpc": "2.0", "method": "subtract", "params": {"minuend": 42, "subtrahend": 23}, "id": 3, }, ) console.log("Hello, World!", "{'a': 1}", repr(console)) console.print( { "name": None, "empty": [], "quiz": { "sport": { "answered": True, "q1": { "question": "Which one is correct team name in NBA?", "options": [ "New York Bulls", "Los Angeles Kings", "Golden State Warriors", "Huston Rocket", ], "answer": "Huston Rocket", }, }, "maths": { "answered": False, "q1": { "question": "5 + 7 = ?", "options": [10, 11, 12, 13], "answer": 12, }, "q2": { "question": "12 - 8 = ?", "options": [1, 2, 3, 4], "answer": 4, }, }, }, } )	98.49 KB	2026-01-20 12:58
📄 constrain.py from typing import Optional, TYPE_CHECKING from .jupyter import JupyterMixin from .measure import Measurement if TYPE_CHECKING: from .console import Console, ConsoleOptions, RenderableType, RenderResult class Constrain(JupyterMixin): """Constrain the width of a renderable to a given number of characters. Args: renderable (RenderableType): A renderable object. width (int, optional): The maximum width (in characters) to render. Defaults to 80. """ def __init__(self, renderable: "RenderableType", width: Optional[int] = 80) -> None: self.renderable = renderable self.width = width def __rich_console__( self, console: "Console", options: "ConsoleOptions" ) -> "RenderResult": if self.width is None: yield self.renderable else: child_options = options.update_width(min(self.width, options.max_width)) yield from console.render(self.renderable, child_options) def __rich_measure__( self, console: "Console", options: "ConsoleOptions" ) -> "Measurement": if self.width is not None: options = options.update_width(self.width) measurement = Measurement.get(console, options, self.renderable) return measurement	1.26 KB	2026-01-20 12:58
📄 containers.py from itertools import zip_longest from typing import ( TYPE_CHECKING, Iterable, Iterator, List, Optional, TypeVar, Union, overload, ) if TYPE_CHECKING: from .console import ( Console, ConsoleOptions, JustifyMethod, OverflowMethod, RenderResult, RenderableType, ) from .text import Text from .cells import cell_len from .measure import Measurement T = TypeVar("T") class Renderables: """A list subclass which renders its contents to the console.""" def __init__( self, renderables: Optional[Iterable["RenderableType"]] = None ) -> None: self._renderables: List["RenderableType"] = ( list(renderables) if renderables is not None else [] ) def __rich_console__( self, console: "Console", options: "ConsoleOptions" ) -> "RenderResult": """Console render method to insert line-breaks.""" yield from self._renderables def __rich_measure__( self, console: "Console", options: "ConsoleOptions" ) -> "Measurement": dimensions = [ Measurement.get(console, options, renderable) for renderable in self._renderables ] if not dimensions: return Measurement(1, 1) _min = max(dimension.minimum for dimension in dimensions) _max = max(dimension.maximum for dimension in dimensions) return Measurement(_min, _max) def append(self, renderable: "RenderableType") -> None: self._renderables.append(renderable) def __iter__(self) -> Iterable["RenderableType"]: return iter(self._renderables) class Lines: """A list subclass which can render to the console.""" def __init__(self, lines: Iterable["Text"] = ()) -> None: self._lines: List["Text"] = list(lines) def __repr__(self) -> str: return f"Lines({self._lines!r})" def __iter__(self) -> Iterator["Text"]: return iter(self._lines) @overload def __getitem__(self, index: int) -> "Text": ... @overload def __getitem__(self, index: slice) -> List["Text"]: ... def __getitem__(self, index: Union[slice, int]) -> Union["Text", List["Text"]]: return self._lines[index] def __setitem__(self, index: int, value: "Text") -> "Lines": self._lines[index] = value return self def __len__(self) -> int: return self._lines.__len__() def __rich_console__( self, console: "Console", options: "ConsoleOptions" ) -> "RenderResult": """Console render method to insert line-breaks.""" yield from self._lines def append(self, line: "Text") -> None: self._lines.append(line) def extend(self, lines: Iterable["Text"]) -> None: self._lines.extend(lines) def pop(self, index: int = -1) -> "Text": return self._lines.pop(index) def justify( self, console: "Console", width: int, justify: "JustifyMethod" = "left", overflow: "OverflowMethod" = "fold", ) -> None: """Justify and overflow text to a given width. Args: console (Console): Console instance. width (int): Number of cells available per line. justify (str, optional): Default justify method for text: "left", "center", "full" or "right". Defaults to "left". overflow (str, optional): Default overflow for text: "crop", "fold", or "ellipsis". Defaults to "fold". """ from .text import Text if justify == "left": for line in self._lines: line.truncate(width, overflow=overflow, pad=True) elif justify == "center": for line in self._lines: line.rstrip() line.truncate(width, overflow=overflow) line.pad_left((width - cell_len(line.plain)) // 2) line.pad_right(width - cell_len(line.plain)) elif justify == "right": for line in self._lines: line.rstrip() line.truncate(width, overflow=overflow) line.pad_left(width - cell_len(line.plain)) elif justify == "full": for line_index, line in enumerate(self._lines): if line_index == len(self._lines) - 1: break words = line.split(" ") words_size = sum(cell_len(word.plain) for word in words) num_spaces = len(words) - 1 spaces = [1 for _ in range(num_spaces)] index = 0 if spaces: while words_size + num_spaces < width: spaces[len(spaces) - index - 1] += 1 num_spaces += 1 index = (index + 1) % len(spaces) tokens: List[Text] = [] for index, (word, next_word) in enumerate( zip_longest(words, words[1:]) ): tokens.append(word) if index < len(spaces): style = word.get_style_at_offset(console, -1) next_style = next_word.get_style_at_offset(console, 0) space_style = style if style == next_style else line.style tokens.append(Text(" " * spaces[index], style=space_style)) self[line_index] = Text("").join(tokens)	5.37 KB	2026-01-20 12:58
📄 control.py import time from typing import TYPE_CHECKING, Callable, Dict, Iterable, List, Union, Final from .segment import ControlCode, ControlType, Segment if TYPE_CHECKING: from .console import Console, ConsoleOptions, RenderResult STRIP_CONTROL_CODES: Final = [ 7, # Bell 8, # Backspace 11, # Vertical tab 12, # Form feed 13, # Carriage return ] _CONTROL_STRIP_TRANSLATE: Final = { _codepoint: None for _codepoint in STRIP_CONTROL_CODES } CONTROL_ESCAPE: Final = { 7: "\\a", 8: "\\b", 11: "\\v", 12: "\\f", 13: "\\r", } CONTROL_CODES_FORMAT: Dict[int, Callable[..., str]] = { ControlType.BELL: lambda: "\x07", ControlType.CARRIAGE_RETURN: lambda: "\r", ControlType.HOME: lambda: "\x1b[H", ControlType.CLEAR: lambda: "\x1b[2J", ControlType.ENABLE_ALT_SCREEN: lambda: "\x1b[?1049h", ControlType.DISABLE_ALT_SCREEN: lambda: "\x1b[?1049l", ControlType.SHOW_CURSOR: lambda: "\x1b[?25h", ControlType.HIDE_CURSOR: lambda: "\x1b[?25l", ControlType.CURSOR_UP: lambda param: f"\x1b[{param}A", ControlType.CURSOR_DOWN: lambda param: f"\x1b[{param}B", ControlType.CURSOR_FORWARD: lambda param: f"\x1b[{param}C", ControlType.CURSOR_BACKWARD: lambda param: f"\x1b[{param}D", ControlType.CURSOR_MOVE_TO_COLUMN: lambda param: f"\x1b[{param+1}G", ControlType.ERASE_IN_LINE: lambda param: f"\x1b[{param}K", ControlType.CURSOR_MOVE_TO: lambda x, y: f"\x1b[{y+1};{x+1}H", ControlType.SET_WINDOW_TITLE: lambda title: f"\x1b]0;{title}\x07", } class Control: """A renderable that inserts a control code (non printable but may move cursor). Args: codes (str): Positional arguments are either a :class:`~rich.segment.ControlType` enum or a tuple of ControlType and an integer parameter """ __slots__ = ["segment"] def __init__(self, codes: Union[ControlType, ControlCode]) -> None: control_codes: List[ControlCode] = [ (code,) if isinstance(code, ControlType) else code for code in codes ] _format_map = CONTROL_CODES_FORMAT rendered_codes = "".join( _format_map[code](parameters) for code, parameters in control_codes ) self.segment = Segment(rendered_codes, None, control_codes) @classmethod def bell(cls) -> "Control": """Ring the 'bell'.""" return cls(ControlType.BELL) @classmethod def home(cls) -> "Control": """Move cursor to 'home' position.""" return cls(ControlType.HOME) @classmethod def move(cls, x: int = 0, y: int = 0) -> "Control": """Move cursor relative to current position. Args: x (int): X offset. y (int): Y offset. Returns: ~Control: Control object. """ def get_codes() -> Iterable[ControlCode]: control = ControlType if x: yield ( control.CURSOR_FORWARD if x > 0 else control.CURSOR_BACKWARD, abs(x), ) if y: yield ( control.CURSOR_DOWN if y > 0 else control.CURSOR_UP, abs(y), ) control = cls(get_codes()) return control @classmethod def move_to_column(cls, x: int, y: int = 0) -> "Control": """Move to the given column, optionally add offset to row. Returns: x (int): absolute x (column) y (int): optional y offset (row) Returns: ~Control: Control object. """ return ( cls( (ControlType.CURSOR_MOVE_TO_COLUMN, x), ( ControlType.CURSOR_DOWN if y > 0 else ControlType.CURSOR_UP, abs(y), ), ) if y else cls((ControlType.CURSOR_MOVE_TO_COLUMN, x)) ) @classmethod def move_to(cls, x: int, y: int) -> "Control": """Move cursor to absolute position. Args: x (int): x offset (column) y (int): y offset (row) Returns: ~Control: Control object. """ return cls((ControlType.CURSOR_MOVE_TO, x, y)) @classmethod def clear(cls) -> "Control": """Clear the screen.""" return cls(ControlType.CLEAR) @classmethod def show_cursor(cls, show: bool) -> "Control": """Show or hide the cursor.""" return cls(ControlType.SHOW_CURSOR if show else ControlType.HIDE_CURSOR) @classmethod def alt_screen(cls, enable: bool) -> "Control": """Enable or disable alt screen.""" if enable: return cls(ControlType.ENABLE_ALT_SCREEN, ControlType.HOME) else: return cls(ControlType.DISABLE_ALT_SCREEN) @classmethod def title(cls, title: str) -> "Control": """Set the terminal window title Args: title (str): The new terminal window title """ return cls((ControlType.SET_WINDOW_TITLE, title)) def __str__(self) -> str: return self.segment.text def __rich_console__( self, console: "Console", options: "ConsoleOptions" ) -> "RenderResult": if self.segment.text: yield self.segment def strip_control_codes( text: str, _translate_table: Dict[int, None] = _CONTROL_STRIP_TRANSLATE ) -> str: """Remove control codes from text. Args: text (str): A string possibly contain control codes. Returns: str: String with control codes removed. """ return text.translate(_translate_table) def escape_control_codes( text: str, _translate_table: Dict[int, str] = CONTROL_ESCAPE, ) -> str: """Replace control codes with their "escaped" equivalent in the given text. (e.g. "\b" becomes "\\b") Args: text (str): A string possibly containing control codes. Returns: str: String with control codes replaced with their escaped version. """ return text.translate(_translate_table) if __name__ == "__main__": # pragma: no cover from pip._vendor.rich.console import Console console = Console() console.print("Look at the title of your terminal window ^") # console.print(Control((ControlType.SET_WINDOW_TITLE, "Hello, world!"))) for i in range(10): console.set_window_title("🚀 Loading" + "." i) time.sleep(0.5)	6.33 KB	2026-01-20 12:58
📄 default_styles.py from typing import Dict from .style import Style DEFAULT_STYLES: Dict[str, Style] = { "none": Style.null(), "reset": Style( color="default", bgcolor="default", dim=False, bold=False, italic=False, underline=False, blink=False, blink2=False, reverse=False, conceal=False, strike=False, ), "dim": Style(dim=True), "bright": Style(dim=False), "bold": Style(bold=True), "strong": Style(bold=True), "code": Style(reverse=True, bold=True), "italic": Style(italic=True), "emphasize": Style(italic=True), "underline": Style(underline=True), "blink": Style(blink=True), "blink2": Style(blink2=True), "reverse": Style(reverse=True), "strike": Style(strike=True), "black": Style(color="black"), "red": Style(color="red"), "green": Style(color="green"), "yellow": Style(color="yellow"), "magenta": Style(color="magenta"), "cyan": Style(color="cyan"), "white": Style(color="white"), "inspect.attr": Style(color="yellow", italic=True), "inspect.attr.dunder": Style(color="yellow", italic=True, dim=True), "inspect.callable": Style(bold=True, color="red"), "inspect.async_def": Style(italic=True, color="bright_cyan"), "inspect.def": Style(italic=True, color="bright_cyan"), "inspect.class": Style(italic=True, color="bright_cyan"), "inspect.error": Style(bold=True, color="red"), "inspect.equals": Style(), "inspect.help": Style(color="cyan"), "inspect.doc": Style(dim=True), "inspect.value.border": Style(color="green"), "live.ellipsis": Style(bold=True, color="red"), "layout.tree.row": Style(dim=False, color="red"), "layout.tree.column": Style(dim=False, color="blue"), "logging.keyword": Style(bold=True, color="yellow"), "logging.level.notset": Style(dim=True), "logging.level.debug": Style(color="green"), "logging.level.info": Style(color="blue"), "logging.level.warning": Style(color="yellow"), "logging.level.error": Style(color="red", bold=True), "logging.level.critical": Style(color="red", bold=True, reverse=True), "log.level": Style.null(), "log.time": Style(color="cyan", dim=True), "log.message": Style.null(), "log.path": Style(dim=True), "repr.ellipsis": Style(color="yellow"), "repr.indent": Style(color="green", dim=True), "repr.error": Style(color="red", bold=True), "repr.str": Style(color="green", italic=False, bold=False), "repr.brace": Style(bold=True), "repr.comma": Style(bold=True), "repr.ipv4": Style(bold=True, color="bright_green"), "repr.ipv6": Style(bold=True, color="bright_green"), "repr.eui48": Style(bold=True, color="bright_green"), "repr.eui64": Style(bold=True, color="bright_green"), "repr.tag_start": Style(bold=True), "repr.tag_name": Style(color="bright_magenta", bold=True), "repr.tag_contents": Style(color="default"), "repr.tag_end": Style(bold=True), "repr.attrib_name": Style(color="yellow", italic=False), "repr.attrib_equal": Style(bold=True), "repr.attrib_value": Style(color="magenta", italic=False), "repr.number": Style(color="cyan", bold=True, italic=False), "repr.number_complex": Style(color="cyan", bold=True, italic=False), # same "repr.bool_true": Style(color="bright_green", italic=True), "repr.bool_false": Style(color="bright_red", italic=True), "repr.none": Style(color="magenta", italic=True), "repr.url": Style(underline=True, color="bright_blue", italic=False, bold=False), "repr.uuid": Style(color="bright_yellow", bold=False), "repr.call": Style(color="magenta", bold=True), "repr.path": Style(color="magenta"), "repr.filename": Style(color="bright_magenta"), "rule.line": Style(color="bright_green"), "rule.text": Style.null(), "json.brace": Style(bold=True), "json.bool_true": Style(color="bright_green", italic=True), "json.bool_false": Style(color="bright_red", italic=True), "json.null": Style(color="magenta", italic=True), "json.number": Style(color="cyan", bold=True, italic=False), "json.str": Style(color="green", italic=False, bold=False), "json.key": Style(color="blue", bold=True), "prompt": Style.null(), "prompt.choices": Style(color="magenta", bold=True), "prompt.default": Style(color="cyan", bold=True), "prompt.invalid": Style(color="red"), "prompt.invalid.choice": Style(color="red"), "pretty": Style.null(), "scope.border": Style(color="blue"), "scope.key": Style(color="yellow", italic=True), "scope.key.special": Style(color="yellow", italic=True, dim=True), "scope.equals": Style(color="red"), "table.header": Style(bold=True), "table.footer": Style(bold=True), "table.cell": Style.null(), "table.title": Style(italic=True), "table.caption": Style(italic=True, dim=True), "traceback.error": Style(color="red", italic=True), "traceback.border.syntax_error": Style(color="bright_red"), "traceback.border": Style(color="red"), "traceback.text": Style.null(), "traceback.title": Style(color="red", bold=True), "traceback.exc_type": Style(color="bright_red", bold=True), "traceback.exc_value": Style.null(), "traceback.offset": Style(color="bright_red", bold=True), "traceback.error_range": Style(underline=True, bold=True), "traceback.note": Style(color="green", bold=True), "traceback.group.border": Style(color="magenta"), "bar.back": Style(color="grey23"), "bar.complete": Style(color="rgb(249,38,114)"), "bar.finished": Style(color="rgb(114,156,31)"), "bar.pulse": Style(color="rgb(249,38,114)"), "progress.description": Style.null(), "progress.filesize": Style(color="green"), "progress.filesize.total": Style(color="green"), "progress.download": Style(color="green"), "progress.elapsed": Style(color="yellow"), "progress.percentage": Style(color="magenta"), "progress.remaining": Style(color="cyan"), "progress.data.speed": Style(color="red"), "progress.spinner": Style(color="green"), "status.spinner": Style(color="green"), "tree": Style(), "tree.line": Style(), "markdown.paragraph": Style(), "markdown.text": Style(), "markdown.em": Style(italic=True), "markdown.emph": Style(italic=True), # For commonmark backwards compatibility "markdown.strong": Style(bold=True), "markdown.code": Style(bold=True, color="cyan", bgcolor="black"), "markdown.code_block": Style(color="cyan", bgcolor="black"), "markdown.block_quote": Style(color="magenta"), "markdown.list": Style(color="cyan"), "markdown.item": Style(), "markdown.item.bullet": Style(color="yellow", bold=True), "markdown.item.number": Style(color="yellow", bold=True), "markdown.hr": Style(color="yellow"), "markdown.h1.border": Style(), "markdown.h1": Style(bold=True), "markdown.h2": Style(bold=True, underline=True), "markdown.h3": Style(bold=True), "markdown.h4": Style(bold=True, dim=True), "markdown.h5": Style(underline=True), "markdown.h6": Style(italic=True), "markdown.h7": Style(italic=True, dim=True), "markdown.link": Style(color="bright_blue"), "markdown.link_url": Style(color="blue", underline=True), "markdown.s": Style(strike=True), "iso8601.date": Style(color="blue"), "iso8601.time": Style(color="magenta"), "iso8601.timezone": Style(color="yellow"), } if __name__ == "__main__": # pragma: no cover import argparse import io from pip._vendor.rich.console import Console from pip._vendor.rich.table import Table from pip._vendor.rich.text import Text parser = argparse.ArgumentParser() parser.add_argument("--html", action="store_true", help="Export as HTML table") args = parser.parse_args() html: bool = args.html console = Console(record=True, width=70, file=io.StringIO()) if html else Console() table = Table("Name", "Styling") for style_name, style in DEFAULT_STYLES.items(): table.add_row(Text(style_name, style=style), str(style)) console.print(table) if html: print(console.export_html(inline_styles=True))	8.06 KB	2026-01-20 12:58
📄 diagnose.py import os import platform from pip._vendor.rich import inspect from pip._vendor.rich.console import Console, get_windows_console_features from pip._vendor.rich.panel import Panel from pip._vendor.rich.pretty import Pretty def report() -> None: # pragma: no cover """Print a report to the terminal with debugging information""" console = Console() inspect(console) features = get_windows_console_features() inspect(features) env_names = ( "CLICOLOR", "COLORTERM", "COLUMNS", "JPY_PARENT_PID", "JUPYTER_COLUMNS", "JUPYTER_LINES", "LINES", "NO_COLOR", "TERM_PROGRAM", "TERM", "TTY_COMPATIBLE", "TTY_INTERACTIVE", "VSCODE_VERBOSE_LOGGING", ) env = {name: os.getenv(name) for name in env_names} console.print(Panel.fit((Pretty(env)), title="[b]Environment Variables")) console.print(f'platform="{platform.system()}"') if __name__ == "__main__": # pragma: no cover report()	1 KB	2026-01-20 12:58
📄 emoji.py import sys from typing import TYPE_CHECKING, Optional, Union, Literal from .jupyter import JupyterMixin from .segment import Segment from .style import Style from ._emoji_codes import EMOJI from ._emoji_replace import _emoji_replace if TYPE_CHECKING: from .console import Console, ConsoleOptions, RenderResult EmojiVariant = Literal["emoji", "text"] class NoEmoji(Exception): """No emoji by that name.""" class Emoji(JupyterMixin): __slots__ = ["name", "style", "_char", "variant"] VARIANTS = {"text": "\uFE0E", "emoji": "\uFE0F"} def __init__( self, name: str, style: Union[str, Style] = "none", variant: Optional[EmojiVariant] = None, ) -> None: """A single emoji character. Args: name (str): Name of emoji. style (Union[str, Style], optional): Optional style. Defaults to None. Raises: NoEmoji: If the emoji doesn't exist. """ self.name = name self.style = style self.variant = variant try: self._char = EMOJI[name] except KeyError: raise NoEmoji(f"No emoji called {name!r}") if variant is not None: self._char += self.VARIANTS.get(variant, "") @classmethod def replace(cls, text: str) -> str: """Replace emoji markup with corresponding unicode characters. Args: text (str): A string with emojis codes, e.g. "Hello :smiley:!" Returns: str: A string with emoji codes replaces with actual emoji. """ return _emoji_replace(text) def __repr__(self) -> str: return f"<emoji {self.name!r}>" def __str__(self) -> str: return self._char def __rich_console__( self, console: "Console", options: "ConsoleOptions" ) -> "RenderResult": yield Segment(self._char, console.get_style(self.style)) if __name__ == "__main__": # pragma: no cover import sys from pip._vendor.rich.columns import Columns from pip._vendor.rich.console import Console console = Console(record=True) columns = Columns( (f":{name}: {name}" for name in sorted(EMOJI.keys()) if "\u200D" not in name), column_first=True, ) console.print(columns) if len(sys.argv) > 1: console.save_html(sys.argv[1])	2.31 KB	2026-01-20 12:58
📄 errors.py class ConsoleError(Exception): """An error in console operation.""" class StyleError(Exception): """An error in styles.""" class StyleSyntaxError(ConsoleError): """Style was badly formatted.""" class MissingStyle(StyleError): """No such style.""" class StyleStackError(ConsoleError): """Style stack is invalid.""" class NotRenderableError(ConsoleError): """Object is not renderable.""" class MarkupError(ConsoleError): """Markup was badly formatted.""" class LiveError(ConsoleError): """Error related to Live display.""" class NoAltScreen(ConsoleError): """Alt screen mode was required."""	642 B	2026-01-20 12:58
📄 file_proxy.py import io from typing import IO, TYPE_CHECKING, Any, List from .ansi import AnsiDecoder from .text import Text if TYPE_CHECKING: from .console import Console class FileProxy(io.TextIOBase): """Wraps a file (e.g. sys.stdout) and redirects writes to a console.""" def __init__(self, console: "Console", file: IO[str]) -> None: self.__console = console self.__file = file self.__buffer: List[str] = [] self.__ansi_decoder = AnsiDecoder() @property def rich_proxied_file(self) -> IO[str]: """Get proxied file.""" return self.__file def __getattr__(self, name: str) -> Any: return getattr(self.__file, name) def write(self, text: str) -> int: if not isinstance(text, str): raise TypeError(f"write() argument must be str, not {type(text).__name__}") buffer = self.__buffer lines: List[str] = [] while text: line, new_line, text = text.partition("\n") if new_line: lines.append("".join(buffer) + line) buffer.clear() else: buffer.append(line) break if lines: console = self.__console with console: output = Text("\n").join( self.__ansi_decoder.decode_line(line) for line in lines ) console.print(output) return len(text) def flush(self) -> None: output = "".join(self.__buffer) if output: self.__console.print(output) del self.__buffer[:] def fileno(self) -> int: return self.__file.fileno()	1.64 KB	2026-01-20 12:58
📄 filesize.py """Functions for reporting filesizes. Borrowed from https://github.com/PyFilesystem/pyfilesystem2 The functions declared in this module should cover the different use cases needed to generate a string representation of a file size using several different units. Since there are many standards regarding file size units, three different functions have been implemented. See Also: * `Wikipedia: Binary prefix <https://en.wikipedia.org/wiki/Binary_prefix>`_ """ __all__ = ["decimal"] from typing import Iterable, List, Optional, Tuple def _to_str( size: int, suffixes: Iterable[str], base: int, , precision: Optional[int] = 1, separator: Optional[str] = " ", ) -> str: if size == 1: return "1 byte" elif size < base: return f"{size:,} bytes" for i, suffix in enumerate(suffixes, 2): # noqa: B007 unit = basei if size < unit: break return "{:,.{precision}f}{separator}{}".format( (base size / unit), suffix, precision=precision, separator=separator, ) def pick_unit_and_suffix(size: int, suffixes: List[str], base: int) -> Tuple[int, str]: """Pick a suffix and base for the given size.""" for i, suffix in enumerate(suffixes): unit = base*i if size < unit base: break return unit, suffix def decimal( size: int, , precision: Optional[int] = 1, separator: Optional[str] = " ", ) -> str: """Convert a filesize in to a string (powers of 1000, SI prefixes). In this convention, ``1000 B = 1 kB``. This is typically the format used to advertise the storage capacity of USB flash drives and the like (256 MB* meaning actually a storage capacity of more than 256 000 000 B), or used by Mac OS X since v10.6 to report file sizes. Arguments: int (size): A file size. int (precision): The number of decimal places to include (default = 1). str (separator): The string to separate the value from the units (default = " "). Returns: `str`: A string containing a abbreviated file size and units. Example: >>> filesize.decimal(30000) '30.0 kB' >>> filesize.decimal(30000, precision=2, separator="") '30.00kB' """ return _to_str( size, ("kB", "MB", "GB", "TB", "PB", "EB", "ZB", "YB"), 1000, precision=precision, separator=separator, )	2.43 KB	2026-01-20 12:58
📄 highlighter.py import re from abc import ABC, abstractmethod from typing import List, Union from .text import Span, Text def _combine_regex(regexes: str) -> str: """Combine a number of regexes in to a single regex. Returns: str: New regex with all regexes ORed together. """ return "\|".join(regexes) class Highlighter(ABC): """Abstract base class for highlighters.""" def __call__(self, text: Union[str, Text]) -> Text: """Highlight a str or Text instance. Args: text (Union[str, ~Text]): Text to highlight. Raises: TypeError: If not called with text or str. Returns: Text: A test instance with highlighting applied. """ if isinstance(text, str): highlight_text = Text(text) elif isinstance(text, Text): highlight_text = text.copy() else: raise TypeError(f"str or Text instance required, not {text!r}") self.highlight(highlight_text) return highlight_text @abstractmethod def highlight(self, text: Text) -> None: """Apply highlighting in place to text. Args: text (~Text): A text object highlight. """ class NullHighlighter(Highlighter): """A highlighter object that doesn't highlight. May be used to disable highlighting entirely. """ def highlight(self, text: Text) -> None: """Nothing to do""" class RegexHighlighter(Highlighter): """Applies highlighting from a list of regular expressions.""" highlights: List[str] = [] base_style: str = "" def highlight(self, text: Text) -> None: """Highlight :class:`rich.text.Text` using regular expressions. Args: text (~Text): Text to highlighted. """ highlight_regex = text.highlight_regex for re_highlight in self.highlights: highlight_regex(re_highlight, style_prefix=self.base_style) class ReprHighlighter(RegexHighlighter): """Highlights the text typically produced from ``__repr__`` methods.""" base_style = "repr." highlights = [ r"(?P<tag_start><)(?P<tag_name>[-\w.:\|])(?P<tag_contents>[\w\W])(?P<tag_end>>)", r'(?P<attrib_name>[\w_]{1,50})=(?P<attrib_value>"?[\w_]+"?)?', r"(?P<brace>[][{}()])", _combine_regex( r"(?P<ipv4>[0-9]{1,3}\.[0-9]{1,3}\.[0-9]{1,3}\.[0-9]{1,3})", r"(?P<ipv6>([A-Fa-f0-9]{1,4}::?){1,7}[A-Fa-f0-9]{1,4})", r"(?P<eui64>(?:[0-9A-Fa-f]{1,2}-){7}[0-9A-Fa-f]{1,2}\|(?:[0-9A-Fa-f]{1,2}:){7}[0-9A-Fa-f]{1,2}\|(?:[0-9A-Fa-f]{4}\.){3}[0-9A-Fa-f]{4})", r"(?P<eui48>(?:[0-9A-Fa-f]{1,2}-){5}[0-9A-Fa-f]{1,2}\|(?:[0-9A-Fa-f]{1,2}:){5}[0-9A-Fa-f]{1,2}\|(?:[0-9A-Fa-f]{4}\.){2}[0-9A-Fa-f]{4})", r"(?P<uuid>[a-fA-F0-9]{8}-[a-fA-F0-9]{4}-[a-fA-F0-9]{4}-[a-fA-F0-9]{4}-[a-fA-F0-9]{12})", r"(?P<call>[\w.]?)$", r"\b(?P<bool_true>True)\b\|\b(?P<bool_false>False)\b\|\b(?P<none>None)\b", r"(?P<ellipsis>\.\.\.)", r"(?P<number_complex>(?<!\w)(?:\-?[0-9]+\.?[0-9](?:e[-+]?\d+?)?)(?:[-+](?:[0-9]+\.?[0-9](?:e[-+]?\d+)?))?j)", r"(?P<number>(?<!\w)\-?[0-9]+\.?[0-9](e[-+]?\d+?)?\b\|0x[0-9a-fA-F])", r"(?P<path>\B(/[-\w._+]+)\/)(?P<filename>[-\w._+])?", r"(?<![\\\w])(?P<str>b?'''.?(?<!\$'''\|b?'.?(?<!\\)'\|b?\"\"\".?(?<!\\)\"\"\"\|b?\".?(?<!\\)\")", r"(?P<url>(file\|https\|http\|ws\|wss)://[-0-9a-zA-Z$_+!`(),.?/;:&=%#~@])", ), ] class JSONHighlighter(RegexHighlighter): """Highlights JSON""" # Captures the start and end of JSON strings, handling escaped quotes JSON_STR = r"(?<![\\\w])(?P<str>b?\".?(?<!\\)\")" JSON_WHITESPACE = {" ", "\n", "\r", "\t"} base_style = "json." highlights = [ _combine_regex( r"(?P<brace>[\{\[\]\}])", r"\b(?P<bool_true>true)\b\|\b(?P<bool_false>false)\b\|\b(?P<null>null)\b", r"(?P<number>(?<!\w)\-?[0-9]+\.?[0-9](e[\-\+]?\d+?)?\b\|0x[0-9a-fA-F])", JSON_STR, ), ] def highlight(self, text: Text) -> None: super().highlight(text) # Additional work to handle highlighting JSON keys plain = text.plain append = text.spans.append whitespace = self.JSON_WHITESPACE for match in re.finditer(self.JSON_STR, plain): start, end = match.span() cursor = end while cursor < len(plain): char = plain[cursor] cursor += 1 if char == ":": append(Span(start, end, "json.key")) elif char in whitespace: continue break class ISO8601Highlighter(RegexHighlighter): """Highlights the ISO8601 date time strings. Regex reference: https://www.oreilly.com/library/view/regular-expressions-cookbook/9781449327453/ch04s07.html """ base_style = "iso8601." highlights = [ # # Dates # # Calendar month (e.g. 2008-08). The hyphen is required r"^(?P<year>[0-9]{4})-(?P<month>1[0-2]\|0[1-9])$", # Calendar date w/o hyphens (e.g. 20080830) r"^(?P<date>(?P<year>[0-9]{4})(?P<month>1[0-2]\|0[1-9])(?P<day>3[01]\|0[1-9]\|[12][0-9]))$", # Ordinal date (e.g. 2008-243). The hyphen is optional r"^(?P<date>(?P<year>[0-9]{4})-?(?P<day>36[0-6]\|3[0-5][0-9]\|[12][0-9]{2}\|0[1-9][0-9]\|00[1-9]))$", # # Weeks # # Week of the year (e.g., 2008-W35). The hyphen is optional r"^(?P<date>(?P<year>[0-9]{4})-?W(?P<week>5[0-3]\|[1-4][0-9]\|0[1-9]))$", # Week date (e.g., 2008-W35-6). The hyphens are optional r"^(?P<date>(?P<year>[0-9]{4})-?W(?P<week>5[0-3]\|[1-4][0-9]\|0[1-9])-?(?P<day>[1-7]))$", # # Times # # Hours and minutes (e.g., 17:21). The colon is optional r"^(?P<time>(?P<hour>2[0-3]\|[01][0-9]):?(?P<minute>[0-5][0-9]))$", # Hours, minutes, and seconds w/o colons (e.g., 172159) r"^(?P<time>(?P<hour>2[0-3]\|[01][0-9])(?P<minute>[0-5][0-9])(?P<second>[0-5][0-9]))$", # Time zone designator (e.g., Z, +07 or +07:00). The colons and the minutes are optional r"^(?P<timezone>(Z\|[+-](?:2[0-3]\|[01][0-9])(?::?(?:[0-5][0-9]))?))$", # Hours, minutes, and seconds with time zone designator (e.g., 17:21:59+07:00). # All the colons are optional. The minutes in the time zone designator are also optional r"^(?P<time>(?P<hour>2[0-3]\|[01][0-9])(?P<minute>[0-5][0-9])(?P<second>[0-5][0-9]))(?P<timezone>Z\|[+-](?:2[0-3]\|[01][0-9])(?::?(?:[0-5][0-9]))?)$", # # Date and Time # # Calendar date with hours, minutes, and seconds (e.g., 2008-08-30 17:21:59 or 20080830 172159). # A space is required between the date and the time. The hyphens and colons are optional. # This regex matches dates and times that specify some hyphens or colons but omit others. # This does not follow ISO 8601 r"^(?P<date>(?P<year>[0-9]{4})(?P<hyphen>-)?(?P<month>1[0-2]\|0[1-9])(?(hyphen)-)(?P<day>3[01]\|0[1-9]\|[12][0-9])) (?P<time>(?P<hour>2[0-3]\|[01][0-9])(?(hyphen):)(?P<minute>[0-5][0-9])(?(hyphen):)(?P<second>[0-5][0-9]))$", # # XML Schema dates and times # # Date, with optional time zone (e.g., 2008-08-30 or 2008-08-30+07:00). # Hyphens are required. This is the XML Schema 'date' type r"^(?P<date>(?P<year>-?(?:[1-9][0-9])?[0-9]{4})-(?P<month>1[0-2]\|0[1-9])-(?P<day>3[01]\|0[1-9]\|[12][0-9]))(?P<timezone>Z\|[+-](?:2[0-3]\|[01][0-9]):[0-5][0-9])?$", # Time, with optional fractional seconds and time zone (e.g., 01:45:36 or 01:45:36.123+07:00). # There is no limit on the number of digits for the fractional seconds. This is the XML Schema 'time' type r"^(?P<time>(?P<hour>2[0-3]\|[01][0-9]):(?P<minute>[0-5][0-9]):(?P<second>[0-5][0-9])(?P<frac>\.[0-9]+)?)(?P<timezone>Z\|[+-](?:2[0-3]\|[01][0-9]):[0-5][0-9])?$", # Date and time, with optional fractional seconds and time zone (e.g., 2008-08-30T01:45:36 or 2008-08-30T01:45:36.123Z). # This is the XML Schema 'dateTime' type r"^(?P<date>(?P<year>-?(?:[1-9][0-9])?[0-9]{4})-(?P<month>1[0-2]\|0[1-9])-(?P<day>3[01]\|0[1-9]\|[12][0-9]))T(?P<time>(?P<hour>2[0-3]\|[01][0-9]):(?P<minute>[0-5][0-9]):(?P<second>[0-5][0-9])(?P<ms>\.[0-9]+)?)(?P<timezone>Z\|[+-](?:2[0-3]\|[01][0-9]):[0-5][0-9])?$", ] if __name__ == "__main__": # pragma: no cover from .console import Console console = Console() console.print("[bold green]hello world![/bold green]") console.print("'[bold green]hello world![/bold green]'") console.print(" /foo") console.print("/foo/") console.print("/foo/bar") console.print("foo/bar/baz") console.print("/foo/bar/baz?foo=bar+egg&egg=baz") console.print("/foo/bar/baz/") console.print("/foo/bar/baz/egg") console.print("/foo/bar/baz/egg.py") console.print("/foo/bar/baz/egg.py word") console.print(" /foo/bar/baz/egg.py word") console.print("foo /foo/bar/baz/egg.py word") console.print("foo /foo/bar/ba._++z/egg+.py word") console.print("https://example.org?foo=bar#header") console.print(1234567.34) console.print(1 / 2) console.print(-1 / 123123123123) console.print( "127.0.1.1 bar 192.168.1.4 2001:0db8:85a3:0000:0000:8a2e:0370:7334 foo" ) import json console.print_json(json.dumps(obj={"name": "apple", "count": 1}), indent=None)	9.36 KB	2026-01-20 12:58
📄 json.py from pathlib import Path from json import loads, dumps from typing import Any, Callable, Optional, Union from .text import Text from .highlighter import JSONHighlighter, NullHighlighter class JSON: """A renderable which pretty prints JSON. Args: json (str): JSON encoded data. indent (Union[None, int, str], optional): Number of characters to indent by. Defaults to 2. highlight (bool, optional): Enable highlighting. Defaults to True. skip_keys (bool, optional): Skip keys not of a basic type. Defaults to False. ensure_ascii (bool, optional): Escape all non-ascii characters. Defaults to False. check_circular (bool, optional): Check for circular references. Defaults to True. allow_nan (bool, optional): Allow NaN and Infinity values. Defaults to True. default (Callable, optional): A callable that converts values that can not be encoded in to something that can be JSON encoded. Defaults to None. sort_keys (bool, optional): Sort dictionary keys. Defaults to False. """ def __init__( self, json: str, indent: Union[None, int, str] = 2, highlight: bool = True, skip_keys: bool = False, ensure_ascii: bool = False, check_circular: bool = True, allow_nan: bool = True, default: Optional[Callable[[Any], Any]] = None, sort_keys: bool = False, ) -> None: data = loads(json) json = dumps( data, indent=indent, skipkeys=skip_keys, ensure_ascii=ensure_ascii, check_circular=check_circular, allow_nan=allow_nan, default=default, sort_keys=sort_keys, ) highlighter = JSONHighlighter() if highlight else NullHighlighter() self.text = highlighter(json) self.text.no_wrap = True self.text.overflow = None @classmethod def from_data( cls, data: Any, indent: Union[None, int, str] = 2, highlight: bool = True, skip_keys: bool = False, ensure_ascii: bool = False, check_circular: bool = True, allow_nan: bool = True, default: Optional[Callable[[Any], Any]] = None, sort_keys: bool = False, ) -> "JSON": """Encodes a JSON object from arbitrary data. Args: data (Any): An object that may be encoded in to JSON indent (Union[None, int, str], optional): Number of characters to indent by. Defaults to 2. highlight (bool, optional): Enable highlighting. Defaults to True. default (Callable, optional): Optional callable which will be called for objects that cannot be serialized. Defaults to None. skip_keys (bool, optional): Skip keys not of a basic type. Defaults to False. ensure_ascii (bool, optional): Escape all non-ascii characters. Defaults to False. check_circular (bool, optional): Check for circular references. Defaults to True. allow_nan (bool, optional): Allow NaN and Infinity values. Defaults to True. default (Callable, optional): A callable that converts values that can not be encoded in to something that can be JSON encoded. Defaults to None. sort_keys (bool, optional): Sort dictionary keys. Defaults to False. Returns: JSON: New JSON object from the given data. """ json_instance: "JSON" = cls.__new__(cls) json = dumps( data, indent=indent, skipkeys=skip_keys, ensure_ascii=ensure_ascii, check_circular=check_circular, allow_nan=allow_nan, default=default, sort_keys=sort_keys, ) highlighter = JSONHighlighter() if highlight else NullHighlighter() json_instance.text = highlighter(json) json_instance.text.no_wrap = True json_instance.text.overflow = None return json_instance def __rich__(self) -> Text: return self.text if __name__ == "__main__": import argparse import sys parser = argparse.ArgumentParser(description="Pretty print json") parser.add_argument( "path", metavar="PATH", help="path to file, or - for stdin", ) parser.add_argument( "-i", "--indent", metavar="SPACES", type=int, help="Number of spaces in an indent", default=2, ) args = parser.parse_args() from pip._vendor.rich.console import Console console = Console() error_console = Console(stderr=True) try: if args.path == "-": json_data = sys.stdin.read() else: json_data = Path(args.path).read_text() except Exception as error: error_console.print(f"Unable to read {args.path!r}; {error}") sys.exit(-1) console.print(JSON(json_data, indent=args.indent), soft_wrap=True)	4.91 KB	2026-01-20 12:58
📄 jupyter.py from typing import TYPE_CHECKING, Any, Dict, Iterable, List, Sequence if TYPE_CHECKING: from pip._vendor.rich.console import ConsoleRenderable from . import get_console from .segment import Segment from .terminal_theme import DEFAULT_TERMINAL_THEME if TYPE_CHECKING: from pip._vendor.rich.console import ConsoleRenderable JUPYTER_HTML_FORMAT = """\ <pre style="white-space:pre;overflow-x:auto;line-height:normal;font-family:Menlo,'DejaVu Sans Mono',consolas,'Courier New',monospace">{code}</pre> """ class JupyterRenderable: """A shim to write html to Jupyter notebook.""" def __init__(self, html: str, text: str) -> None: self.html = html self.text = text def _repr_mimebundle_( self, include: Sequence[str], exclude: Sequence[str], kwargs: Any ) -> Dict[str, str]: data = {"text/plain": self.text, "text/html": self.html} if include: data = {k: v for (k, v) in data.items() if k in include} if exclude: data = {k: v for (k, v) in data.items() if k not in exclude} return data class JupyterMixin: """Add to an Rich renderable to make it render in Jupyter notebook.""" __slots__ = () def _repr_mimebundle_( self: "ConsoleRenderable", include: Sequence[str], exclude: Sequence[str], kwargs: Any, ) -> Dict[str, str]: console = get_console() segments = list(console.render(self, console.options)) html = _render_segments(segments) text = console._render_buffer(segments) data = {"text/plain": text, "text/html": html} if include: data = {k: v for (k, v) in data.items() if k in include} if exclude: data = {k: v for (k, v) in data.items() if k not in exclude} return data def _render_segments(segments: Iterable[Segment]) -> str: def escape(text: str) -> str: """Escape html.""" return text.replace("&", "&").replace("<", "<").replace(">", ">") fragments: List[str] = [] append_fragment = fragments.append theme = DEFAULT_TERMINAL_THEME for text, style, control in Segment.simplify(segments): if control: continue text = escape(text) if style: rule = style.get_html_style(theme) text = f'<span style="{rule}">{text}</span>' if rule else text if style.link: text = f'<a href="{style.link}" target="_blank">{text}</a>' append_fragment(text) code = "".join(fragments) html = JUPYTER_HTML_FORMAT.format(code=code) return html def display(segments: Iterable[Segment], text: str) -> None: """Render segments to Jupyter.""" html = _render_segments(segments) jupyter_renderable = JupyterRenderable(html, text) try: from IPython.display import display as ipython_display ipython_display(jupyter_renderable) except ModuleNotFoundError: # Handle the case where the Console has force_jupyter=True, # but IPython is not installed. pass def print(args: Any, kwargs: Any) -> None: """Proxy for Console print.""" console = get_console() return console.print(args, **kwargs)	3.18 KB	2026-01-20 12:58
📄 layout.py from abc import ABC, abstractmethod from itertools import islice from operator import itemgetter from threading import RLock from typing import ( TYPE_CHECKING, Dict, Iterable, List, NamedTuple, Optional, Sequence, Tuple, Union, ) from ._ratio import ratio_resolve from .align import Align from .console import Console, ConsoleOptions, RenderableType, RenderResult from .highlighter import ReprHighlighter from .panel import Panel from .pretty import Pretty from .region import Region from .repr import Result, rich_repr from .segment import Segment from .style import StyleType if TYPE_CHECKING: from pip._vendor.rich.tree import Tree class LayoutRender(NamedTuple): """An individual layout render.""" region: Region render: List[List[Segment]] RegionMap = Dict["Layout", Region] RenderMap = Dict["Layout", LayoutRender] class LayoutError(Exception): """Layout related error.""" class NoSplitter(LayoutError): """Requested splitter does not exist.""" class _Placeholder: """An internal renderable used as a Layout placeholder.""" highlighter = ReprHighlighter() def __init__(self, layout: "Layout", style: StyleType = "") -> None: self.layout = layout self.style = style def __rich_console__( self, console: Console, options: ConsoleOptions ) -> RenderResult: width = options.max_width height = options.height or options.size.height layout = self.layout title = ( f"{layout.name!r} ({width} x {height})" if layout.name else f"({width} x {height})" ) yield Panel( Align.center(Pretty(layout), vertical="middle"), style=self.style, title=self.highlighter(title), border_style="blue", height=height, ) class Splitter(ABC): """Base class for a splitter.""" name: str = "" @abstractmethod def get_tree_icon(self) -> str: """Get the icon (emoji) used in layout.tree""" @abstractmethod def divide( self, children: Sequence["Layout"], region: Region ) -> Iterable[Tuple["Layout", Region]]: """Divide a region amongst several child layouts. Args: children (Sequence(Layout)): A number of child layouts. region (Region): A rectangular region to divide. """ class RowSplitter(Splitter): """Split a layout region in to rows.""" name = "row" def get_tree_icon(self) -> str: return "[layout.tree.row]⬌" def divide( self, children: Sequence["Layout"], region: Region ) -> Iterable[Tuple["Layout", Region]]: x, y, width, height = region render_widths = ratio_resolve(width, children) offset = 0 _Region = Region for child, child_width in zip(children, render_widths): yield child, _Region(x + offset, y, child_width, height) offset += child_width class ColumnSplitter(Splitter): """Split a layout region in to columns.""" name = "column" def get_tree_icon(self) -> str: return "[layout.tree.column]⬍" def divide( self, children: Sequence["Layout"], region: Region ) -> Iterable[Tuple["Layout", Region]]: x, y, width, height = region render_heights = ratio_resolve(height, children) offset = 0 _Region = Region for child, child_height in zip(children, render_heights): yield child, _Region(x, y + offset, width, child_height) offset += child_height @rich_repr class Layout: """A renderable to divide a fixed height in to rows or columns. Args: renderable (RenderableType, optional): Renderable content, or None for placeholder. Defaults to None. name (str, optional): Optional identifier for Layout. Defaults to None. size (int, optional): Optional fixed size of layout. Defaults to None. minimum_size (int, optional): Minimum size of layout. Defaults to 1. ratio (int, optional): Optional ratio for flexible layout. Defaults to 1. visible (bool, optional): Visibility of layout. Defaults to True. """ splitters = {"row": RowSplitter, "column": ColumnSplitter} def __init__( self, renderable: Optional[RenderableType] = None, , name: Optional[str] = None, size: Optional[int] = None, minimum_size: int = 1, ratio: int = 1, visible: bool = True, ) -> None: self._renderable = renderable or _Placeholder(self) self.size = size self.minimum_size = minimum_size self.ratio = ratio self.name = name self.visible = visible self.splitter: Splitter = self.splitters["column"]() self._children: List[Layout] = [] self._render_map: RenderMap = {} self._lock = RLock() def __rich_repr__(self) -> Result: yield "name", self.name, None yield "size", self.size, None yield "minimum_size", self.minimum_size, 1 yield "ratio", self.ratio, 1 @property def renderable(self) -> RenderableType: """Layout renderable.""" return self if self._children else self._renderable @property def children(self) -> List["Layout"]: """Gets (visible) layout children.""" return [child for child in self._children if child.visible] @property def map(self) -> RenderMap: """Get a map of the last render.""" return self._render_map def get(self, name: str) -> Optional["Layout"]: """Get a named layout, or None if it doesn't exist. Args: name (str): Name of layout. Returns: Optional[Layout]: Layout instance or None if no layout was found. """ if self.name == name: return self else: for child in self._children: named_layout = child.get(name) if named_layout is not None: return named_layout return None def __getitem__(self, name: str) -> "Layout": layout = self.get(name) if layout is None: raise KeyError(f"No layout with name {name!r}") return layout @property def tree(self) -> "Tree": """Get a tree renderable to show layout structure.""" from pip._vendor.rich.styled import Styled from pip._vendor.rich.table import Table from pip._vendor.rich.tree import Tree def summary(layout: "Layout") -> Table: icon = layout.splitter.get_tree_icon() table = Table.grid(padding=(0, 1, 0, 0)) text: RenderableType = ( Pretty(layout) if layout.visible else Styled(Pretty(layout), "dim") ) table.add_row(icon, text) _summary = table return _summary layout = self tree = Tree( summary(layout), guide_style=f"layout.tree.{layout.splitter.name}", highlight=True, ) def recurse(tree: "Tree", layout: "Layout") -> None: for child in layout._children: recurse( tree.add( summary(child), guide_style=f"layout.tree.{child.splitter.name}", ), child, ) recurse(tree, self) return tree def split( self, layouts: Union["Layout", RenderableType], splitter: Union[Splitter, str] = "column", ) -> None: """Split the layout in to multiple sub-layouts. Args: layouts (Layout): Positional arguments should be (sub) Layout instances. splitter (Union[Splitter, str]): Splitter instance or name of splitter. """ _layouts = [ layout if isinstance(layout, Layout) else Layout(layout) for layout in layouts ] try: self.splitter = ( splitter if isinstance(splitter, Splitter) else self.splitters[splitter]() ) except KeyError: raise NoSplitter(f"No splitter called {splitter!r}") self._children[:] = _layouts def add_split(self, layouts: Union["Layout", RenderableType]) -> None: """Add a new layout(s) to existing split. Args: layouts (Union[Layout, RenderableType]): Positional arguments should be renderables or (sub) Layout instances. """ _layouts = ( layout if isinstance(layout, Layout) else Layout(layout) for layout in layouts ) self._children.extend(_layouts) def split_row(self, layouts: Union["Layout", RenderableType]) -> None: """Split the layout in to a row (layouts side by side). Args: layouts (Layout): Positional arguments should be (sub) Layout instances. """ self.split(layouts, splitter="row") def split_column(self, layouts: Union["Layout", RenderableType]) -> None: """Split the layout in to a column (layouts stacked on top of each other). Args: layouts (Layout): Positional arguments should be (sub) Layout instances. """ self.split(*layouts, splitter="column") def unsplit(self) -> None: """Reset splits to initial state.""" del self._children[:] def update(self, renderable: RenderableType) -> None: """Update renderable. Args: renderable (RenderableType): New renderable object. """ with self._lock: self._renderable = renderable def refresh_screen(self, console: "Console", layout_name: str) -> None: """Refresh a sub-layout. Args: console (Console): Console instance where Layout is to be rendered. layout_name (str): Name of layout. """ with self._lock: layout = self[layout_name] region, _lines = self._render_map[layout] (x, y, width, height) = region lines = console.render_lines( layout, console.options.update_dimensions(width, height) ) self._render_map[layout] = LayoutRender(region, lines) console.update_screen_lines(lines, x, y) def _make_region_map(self, width: int, height: int) -> RegionMap: """Create a dict that maps layout on to Region.""" stack: List[Tuple[Layout, Region]] = [(self, Region(0, 0, width, height))] push = stack.append pop = stack.pop layout_regions: List[Tuple[Layout, Region]] = [] append_layout_region = layout_regions.append while stack: append_layout_region(pop()) layout, region = layout_regions[-1] children = layout.children if children: for child_and_region in layout.splitter.divide(children, region): push(child_and_region) region_map = { layout: region for layout, region in sorted(layout_regions, key=itemgetter(1)) } return region_map def render(self, console: Console, options: ConsoleOptions) -> RenderMap: """Render the sub_layouts. Args: console (Console): Console instance. options (ConsoleOptions): Console options. Returns: RenderMap: A dict that maps Layout on to a tuple of Region, lines """ render_width = options.max_width render_height = options.height or console.height region_map = self._make_region_map(render_width, render_height) layout_regions = [ (layout, region) for layout, region in region_map.items() if not layout.children ] render_map: Dict["Layout", "LayoutRender"] = {} render_lines = console.render_lines update_dimensions = options.update_dimensions for layout, region in layout_regions: lines = render_lines( layout.renderable, update_dimensions(region.width, region.height) ) render_map[layout] = LayoutRender(region, lines) return render_map def __rich_console__( self, console: Console, options: ConsoleOptions ) -> RenderResult: with self._lock: width = options.max_width or console.width height = options.height or console.height render_map = self.render(console, options.update_dimensions(width, height)) self._render_map = render_map layout_lines: List[List[Segment]] = [[] for _ in range(height)] _islice = islice for region, lines in render_map.values(): _x, y, _layout_width, layout_height = region for row, line in zip( _islice(layout_lines, y, y + layout_height), lines ): row.extend(line) new_line = Segment.line() for layout_row in layout_lines: yield from layout_row yield new_line if __name__ == "__main__": from pip._vendor.rich.console import Console console = Console() layout = Layout() layout.split_column( Layout(name="header", size=3), Layout(ratio=1, name="main"), Layout(size=10, name="footer"), ) layout["main"].split_row(Layout(name="side"), Layout(name="body", ratio=2)) layout["body"].split_row(Layout(name="content", ratio=2), Layout(name="s2")) layout["s2"].split_column( Layout(name="top"), Layout(name="middle"), Layout(name="bottom") ) layout["side"].split_column(Layout(layout.tree, name="left1"), Layout(name="left2")) layout["content"].update("foo") console.print(layout)	13.68 KB	2026-01-20 12:58
📄 live.py from __future__ import annotations import sys from threading import Event, RLock, Thread from types import TracebackType from typing import IO, TYPE_CHECKING, Any, Callable, List, Optional, TextIO, Type, cast from . import get_console from .console import Console, ConsoleRenderable, Group, RenderableType, RenderHook from .control import Control from .file_proxy import FileProxy from .jupyter import JupyterMixin from .live_render import LiveRender, VerticalOverflowMethod from .screen import Screen from .text import Text if TYPE_CHECKING: # Can be replaced with `from typing import Self` in Python 3.11+ from typing_extensions import Self # pragma: no cover class _RefreshThread(Thread): """A thread that calls refresh() at regular intervals.""" def __init__(self, live: "Live", refresh_per_second: float) -> None: self.live = live self.refresh_per_second = refresh_per_second self.done = Event() super().__init__(daemon=True) def stop(self) -> None: self.done.set() def run(self) -> None: while not self.done.wait(1 / self.refresh_per_second): with self.live._lock: if not self.done.is_set(): self.live.refresh() class Live(JupyterMixin, RenderHook): """Renders an auto-updating live display of any given renderable. Args: renderable (RenderableType, optional): The renderable to live display. Defaults to displaying nothing. console (Console, optional): Optional Console instance. Defaults to an internal Console instance writing to stdout. screen (bool, optional): Enable alternate screen mode. Defaults to False. auto_refresh (bool, optional): Enable auto refresh. If disabled, you will need to call `refresh()` or `update()` with refresh flag. Defaults to True refresh_per_second (float, optional): Number of times per second to refresh the live display. Defaults to 4. transient (bool, optional): Clear the renderable on exit (has no effect when screen=True). Defaults to False. redirect_stdout (bool, optional): Enable redirection of stdout, so ``print`` may be used. Defaults to True. redirect_stderr (bool, optional): Enable redirection of stderr. Defaults to True. vertical_overflow (VerticalOverflowMethod, optional): How to handle renderable when it is too tall for the console. Defaults to "ellipsis". get_renderable (Callable[[], RenderableType], optional): Optional callable to get renderable. Defaults to None. """ def __init__( self, renderable: Optional[RenderableType] = None, , console: Optional[Console] = None, screen: bool = False, auto_refresh: bool = True, refresh_per_second: float = 4, transient: bool = False, redirect_stdout: bool = True, redirect_stderr: bool = True, vertical_overflow: VerticalOverflowMethod = "ellipsis", get_renderable: Optional[Callable[[], RenderableType]] = None, ) -> None: assert refresh_per_second > 0, "refresh_per_second must be > 0" self._renderable = renderable self.console = console if console is not None else get_console() self._screen = screen self._alt_screen = False self._redirect_stdout = redirect_stdout self._redirect_stderr = redirect_stderr self._restore_stdout: Optional[IO[str]] = None self._restore_stderr: Optional[IO[str]] = None self._lock = RLock() self.ipy_widget: Optional[Any] = None self.auto_refresh = auto_refresh self._started: bool = False self.transient = True if screen else transient self._refresh_thread: Optional[_RefreshThread] = None self.refresh_per_second = refresh_per_second self.vertical_overflow = vertical_overflow self._get_renderable = get_renderable self._live_render = LiveRender( self.get_renderable(), vertical_overflow=vertical_overflow ) self._nested = False @property def is_started(self) -> bool: """Check if live display has been started.""" return self._started def get_renderable(self) -> RenderableType: renderable = ( self._get_renderable() if self._get_renderable is not None else self._renderable ) return renderable or "" def start(self, refresh: bool = False) -> None: """Start live rendering display. Args: refresh (bool, optional): Also refresh. Defaults to False. """ with self._lock: if self._started: return self._started = True if not self.console.set_live(self): self._nested = True return if self._screen: self._alt_screen = self.console.set_alt_screen(True) self.console.show_cursor(False) self._enable_redirect_io() self.console.push_render_hook(self) if refresh: try: self.refresh() except Exception: # If refresh fails, we want to stop the redirection of sys.stderr, # so the error stacktrace is properly displayed in the terminal. # (or, if the code that calls Rich captures the exception and wants to display something, # let this be displayed in the terminal). self.stop() raise if self.auto_refresh: self._refresh_thread = _RefreshThread(self, self.refresh_per_second) self._refresh_thread.start() def stop(self) -> None: """Stop live rendering display.""" with self._lock: if not self._started: return self._started = False self.console.clear_live() if self._nested: if not self.transient: self.console.print(self.renderable) return if self.auto_refresh and self._refresh_thread is not None: self._refresh_thread.stop() self._refresh_thread = None # allow it to fully render on the last even if overflow self.vertical_overflow = "visible" with self.console: try: if not self._alt_screen and not self.console.is_jupyter: self.refresh() finally: self._disable_redirect_io() self.console.pop_render_hook() if not self._alt_screen and self.console.is_terminal: self.console.line() self.console.show_cursor(True) if self._alt_screen: self.console.set_alt_screen(False) if self.transient and not self._alt_screen: self.console.control(self._live_render.restore_cursor()) if self.ipy_widget is not None and self.transient: self.ipy_widget.close() # pragma: no cover def __enter__(self) -> Self: self.start(refresh=self._renderable is not None) return self def __exit__( self, exc_type: Optional[Type[BaseException]], exc_val: Optional[BaseException], exc_tb: Optional[TracebackType], ) -> None: self.stop() def _enable_redirect_io(self) -> None: """Enable redirecting of stdout / stderr.""" if self.console.is_terminal or self.console.is_jupyter: if self._redirect_stdout and not isinstance(sys.stdout, FileProxy): self._restore_stdout = sys.stdout sys.stdout = cast("TextIO", FileProxy(self.console, sys.stdout)) if self._redirect_stderr and not isinstance(sys.stderr, FileProxy): self._restore_stderr = sys.stderr sys.stderr = cast("TextIO", FileProxy(self.console, sys.stderr)) def _disable_redirect_io(self) -> None: """Disable redirecting of stdout / stderr.""" if self._restore_stdout: sys.stdout = cast("TextIO", self._restore_stdout) self._restore_stdout = None if self._restore_stderr: sys.stderr = cast("TextIO", self._restore_stderr) self._restore_stderr = None @property def renderable(self) -> RenderableType: """Get the renderable that is being displayed Returns: RenderableType: Displayed renderable. """ live_stack = self.console._live_stack renderable: RenderableType if live_stack and self is live_stack[0]: # The first Live instance will render everything in the Live stack renderable = Group([live.get_renderable() for live in live_stack]) else: renderable = self.get_renderable() return Screen(renderable) if self._alt_screen else renderable def update(self, renderable: RenderableType, , refresh: bool = False) -> None: """Update the renderable that is being displayed Args: renderable (RenderableType): New renderable to use. refresh (bool, optional): Refresh the display. Defaults to False. """ if isinstance(renderable, str): renderable = self.console.render_str(renderable) with self._lock: self._renderable = renderable if refresh: self.refresh() def refresh(self) -> None: """Update the display of the Live Render.""" with self._lock: self._live_render.set_renderable(self.renderable) if self._nested: if self.console._live_stack: self.console._live_stack[0].refresh() return if self.console.is_jupyter: # pragma: no cover try: from IPython.display import display from ipywidgets import Output except ImportError: import warnings warnings.warn('install "ipywidgets" for Jupyter support') else: if self.ipy_widget is None: self.ipy_widget = Output() display(self.ipy_widget) with self.ipy_widget: self.ipy_widget.clear_output(wait=True) self.console.print(self._live_render.renderable) elif self.console.is_terminal and not self.console.is_dumb_terminal: with self.console: self.console.print(Control()) elif ( not self._started and not self.transient ): # if it is finished allow files or dumb-terminals to see final result with self.console: self.console.print(Control()) def process_renderables( self, renderables: List[ConsoleRenderable] ) -> List[ConsoleRenderable]: """Process renderables to restore cursor and display progress.""" self._live_render.vertical_overflow = self.vertical_overflow if self.console.is_interactive: # lock needs acquiring as user can modify live_render renderable at any time unlike in Progress. with self._lock: reset = ( Control.home() if self._alt_screen else self._live_render.position_cursor() ) renderables = [reset, renderables, self._live_render] elif ( not self._started and not self.transient ): # if it is finished render the final output for files or dumb_terminals renderables = [renderables, self._live_render] return renderables if __name__ == "__main__": # pragma: no cover import random import time from itertools import cycle from typing import Dict, List, Tuple from .align import Align from .console import Console from .live import Live as Live from .panel import Panel from .rule import Rule from .syntax import Syntax from .table import Table console = Console() syntax = Syntax( '''def loop_last(values: Iterable[T]) -> Iterable[Tuple[bool, T]]: """Iterate and generate a tuple with a flag for last value.""" iter_values = iter(values) try: previous_value = next(iter_values) except StopIteration: return for value in iter_values: yield False, previous_value previous_value = value yield True, previous_value''', "python", line_numbers=True, ) table = Table("foo", "bar", "baz") table.add_row("1", "2", "3") progress_renderables = [ "You can make the terminal shorter and taller to see the live table hide" "Text may be printed while the progress bars are rendering.", Panel("In fact, [i]any[/i] renderable will work"), "Such as [magenta]tables[/]...", table, "Pretty printed structures...", {"type": "example", "text": "Pretty printed"}, "Syntax...", syntax, Rule("Give it a try!"), ] examples = cycle(progress_renderables) exchanges = [ "SGD", "MYR", "EUR", "USD", "AUD", "JPY", "CNH", "HKD", "CAD", "INR", "DKK", "GBP", "RUB", "NZD", "MXN", "IDR", "TWD", "THB", "VND", ] with Live(console=console) as live_table: exchange_rate_dict: Dict[Tuple[str, str], float] = {} for index in range(100): select_exchange = exchanges[index % len(exchanges)] for exchange in exchanges: if exchange == select_exchange: continue time.sleep(0.4) if random.randint(0, 10) < 1: console.log(next(examples)) exchange_rate_dict[(select_exchange, exchange)] = 200 / ( (random.random() 320) + 1 ) if len(exchange_rate_dict) > len(exchanges) - 1: exchange_rate_dict.pop(list(exchange_rate_dict.keys())[0]) table = Table(title="Exchange Rates") table.add_column("Source Currency") table.add_column("Destination Currency") table.add_column("Exchange Rate") for (source, dest), exchange_rate in exchange_rate_dict.items(): table.add_row( source, dest, Text( f"{exchange_rate:.4f}", style="red" if exchange_rate < 1.0 else "green", ), ) live_table.update(Align.center(table))	14.82 KB	2026-01-20 12:58
📄 live_render.py from typing import Optional, Tuple, Literal from ._loop import loop_last from .console import Console, ConsoleOptions, RenderableType, RenderResult from .control import Control from .segment import ControlType, Segment from .style import StyleType from .text import Text VerticalOverflowMethod = Literal["crop", "ellipsis", "visible"] class LiveRender: """Creates a renderable that may be updated. Args: renderable (RenderableType): Any renderable object. style (StyleType, optional): An optional style to apply to the renderable. Defaults to "". """ def __init__( self, renderable: RenderableType, style: StyleType = "", vertical_overflow: VerticalOverflowMethod = "ellipsis", ) -> None: self.renderable = renderable self.style = style self.vertical_overflow = vertical_overflow self._shape: Optional[Tuple[int, int]] = None def set_renderable(self, renderable: RenderableType) -> None: """Set a new renderable. Args: renderable (RenderableType): Any renderable object, including str. """ self.renderable = renderable def position_cursor(self) -> Control: """Get control codes to move cursor to beginning of live render. Returns: Control: A control instance that may be printed. """ if self._shape is not None: _, height = self._shape return Control( ControlType.CARRIAGE_RETURN, (ControlType.ERASE_IN_LINE, 2), ( ( (ControlType.CURSOR_UP, 1), (ControlType.ERASE_IN_LINE, 2), ) (height - 1) ) ) return Control() def restore_cursor(self) -> Control: """Get control codes to clear the render and restore the cursor to its previous position. Returns: Control: A Control instance that may be printed. """ if self._shape is not None: _, height = self._shape return Control( ControlType.CARRIAGE_RETURN, ((ControlType.CURSOR_UP, 1), (ControlType.ERASE_IN_LINE, 2)) height ) return Control() def __rich_console__( self, console: Console, options: ConsoleOptions ) -> RenderResult: renderable = self.renderable style = console.get_style(self.style) lines = console.render_lines(renderable, options, style=style, pad=False) shape = Segment.get_shape(lines) _, height = shape if height > options.size.height: if self.vertical_overflow == "crop": lines = lines[: options.size.height] shape = Segment.get_shape(lines) elif self.vertical_overflow == "ellipsis": lines = lines[: (options.size.height - 1)] overflow_text = Text( "...", overflow="crop", justify="center", end="", style="live.ellipsis", ) lines.append(list(console.render(overflow_text))) shape = Segment.get_shape(lines) self._shape = shape new_line = Segment.line() for last, line in loop_last(lines): yield from line if not last: yield new_line	3.44 KB	2026-01-20 12:58
📄 logging.py import logging from datetime import datetime from logging import Handler, LogRecord from pathlib import Path from types import ModuleType from typing import ClassVar, Iterable, List, Optional, Type, Union from pip._vendor.rich._null_file import NullFile from . import get_console from ._log_render import FormatTimeCallable, LogRender from .console import Console, ConsoleRenderable from .highlighter import Highlighter, ReprHighlighter from .text import Text from .traceback import Traceback class RichHandler(Handler): """A logging handler that renders output with Rich. The time / level / message and file are displayed in columns. The level is color coded, and the message is syntax highlighted. Note: Be careful when enabling console markup in log messages if you have configured logging for libraries not under your control. If a dependency writes messages containing square brackets, it may not produce the intended output. Args: level (Union[int, str], optional): Log level. Defaults to logging.NOTSET. console (:class:`~rich.console.Console`, optional): Optional console instance to write logs. Default will use a global console instance writing to stdout. show_time (bool, optional): Show a column for the time. Defaults to True. omit_repeated_times (bool, optional): Omit repetition of the same time. Defaults to True. show_level (bool, optional): Show a column for the level. Defaults to True. show_path (bool, optional): Show the path to the original log call. Defaults to True. enable_link_path (bool, optional): Enable terminal link of path column to file. Defaults to True. highlighter (Highlighter, optional): Highlighter to style log messages, or None to use ReprHighlighter. Defaults to None. markup (bool, optional): Enable console markup in log messages. Defaults to False. rich_tracebacks (bool, optional): Enable rich tracebacks with syntax highlighting and formatting. Defaults to False. tracebacks_width (Optional[int], optional): Number of characters used to render tracebacks, or None for full width. Defaults to None. tracebacks_code_width (int, optional): Number of code characters used to render tracebacks, or None for full width. Defaults to 88. tracebacks_extra_lines (int, optional): Additional lines of code to render tracebacks, or None for full width. Defaults to None. tracebacks_theme (str, optional): Override pygments theme used in traceback. tracebacks_word_wrap (bool, optional): Enable word wrapping of long tracebacks lines. Defaults to True. tracebacks_show_locals (bool, optional): Enable display of locals in tracebacks. Defaults to False. tracebacks_suppress (Sequence[Union[str, ModuleType]]): Optional sequence of modules or paths to exclude from traceback. tracebacks_max_frames (int, optional): Optional maximum number of frames returned by traceback. locals_max_length (int, optional): Maximum length of containers before abbreviating, or None for no abbreviation. Defaults to 10. locals_max_string (int, optional): Maximum length of string before truncating, or None to disable. Defaults to 80. log_time_format (Union[str, TimeFormatterCallable], optional): If ``log_time`` is enabled, either string for strftime or callable that formats the time. Defaults to "[%x %X] ". keywords (List[str], optional): List of words to highlight instead of ``RichHandler.KEYWORDS``. """ KEYWORDS: ClassVar[Optional[List[str]]] = [ "GET", "POST", "HEAD", "PUT", "DELETE", "OPTIONS", "TRACE", "PATCH", ] HIGHLIGHTER_CLASS: ClassVar[Type[Highlighter]] = ReprHighlighter def __init__( self, level: Union[int, str] = logging.NOTSET, console: Optional[Console] = None, , show_time: bool = True, omit_repeated_times: bool = True, show_level: bool = True, show_path: bool = True, enable_link_path: bool = True, highlighter: Optional[Highlighter] = None, markup: bool = False, rich_tracebacks: bool = False, tracebacks_width: Optional[int] = None, tracebacks_code_width: Optional[int] = 88, tracebacks_extra_lines: int = 3, tracebacks_theme: Optional[str] = None, tracebacks_word_wrap: bool = True, tracebacks_show_locals: bool = False, tracebacks_suppress: Iterable[Union[str, ModuleType]] = (), tracebacks_max_frames: int = 100, locals_max_length: int = 10, locals_max_string: int = 80, log_time_format: Union[str, FormatTimeCallable] = "[%x %X]", keywords: Optional[List[str]] = None, ) -> None: super().__init__(level=level) self.console = console or get_console() self.highlighter = highlighter or self.HIGHLIGHTER_CLASS() self._log_render = LogRender( show_time=show_time, show_level=show_level, show_path=show_path, time_format=log_time_format, omit_repeated_times=omit_repeated_times, level_width=None, ) self.enable_link_path = enable_link_path self.markup = markup self.rich_tracebacks = rich_tracebacks self.tracebacks_width = tracebacks_width self.tracebacks_extra_lines = tracebacks_extra_lines self.tracebacks_theme = tracebacks_theme self.tracebacks_word_wrap = tracebacks_word_wrap self.tracebacks_show_locals = tracebacks_show_locals self.tracebacks_suppress = tracebacks_suppress self.tracebacks_max_frames = tracebacks_max_frames self.tracebacks_code_width = tracebacks_code_width self.locals_max_length = locals_max_length self.locals_max_string = locals_max_string self.keywords = keywords def get_level_text(self, record: LogRecord) -> Text: """Get the level name from the record. Args: record (LogRecord): LogRecord instance. Returns: Text: A tuple of the style and level name. """ level_name = record.levelname level_text = Text.styled( level_name.ljust(8), f"logging.level.{level_name.lower()}" ) return level_text def emit(self, record: LogRecord) -> None: """Invoked by logging.""" message = self.format(record) traceback = None if ( self.rich_tracebacks and record.exc_info and record.exc_info != (None, None, None) ): exc_type, exc_value, exc_traceback = record.exc_info assert exc_type is not None assert exc_value is not None traceback = Traceback.from_exception( exc_type, exc_value, exc_traceback, width=self.tracebacks_width, code_width=self.tracebacks_code_width, extra_lines=self.tracebacks_extra_lines, theme=self.tracebacks_theme, word_wrap=self.tracebacks_word_wrap, show_locals=self.tracebacks_show_locals, locals_max_length=self.locals_max_length, locals_max_string=self.locals_max_string, suppress=self.tracebacks_suppress, max_frames=self.tracebacks_max_frames, ) message = record.getMessage() if self.formatter: record.message = record.getMessage() formatter = self.formatter if hasattr(formatter, "usesTime") and formatter.usesTime(): record.asctime = formatter.formatTime(record, formatter.datefmt) message = formatter.formatMessage(record) message_renderable = self.render_message(record, message) log_renderable = self.render( record=record, traceback=traceback, message_renderable=message_renderable ) if isinstance(self.console.file, NullFile): # Handles pythonw, where stdout/stderr are null, and we return NullFile # instance from Console.file. In this case, we still want to make a log record # even though we won't be writing anything to a file. self.handleError(record) else: try: self.console.print(log_renderable) except Exception: self.handleError(record) def render_message(self, record: LogRecord, message: str) -> "ConsoleRenderable": """Render message text in to Text. Args: record (LogRecord): logging Record. message (str): String containing log message. Returns: ConsoleRenderable: Renderable to display log message. """ use_markup = getattr(record, "markup", self.markup) message_text = Text.from_markup(message) if use_markup else Text(message) highlighter = getattr(record, "highlighter", self.highlighter) if highlighter: message_text = highlighter(message_text) if self.keywords is None: self.keywords = self.KEYWORDS if self.keywords: message_text.highlight_words(self.keywords, "logging.keyword") return message_text def render( self, , record: LogRecord, traceback: Optional[Traceback], message_renderable: "ConsoleRenderable", ) -> "ConsoleRenderable": """Render log for display. Args: record (LogRecord): logging Record. traceback (Optional[Traceback]): Traceback instance or None for no Traceback. message_renderable (ConsoleRenderable): Renderable (typically Text) containing log message contents. Returns: ConsoleRenderable: Renderable to display log. """ path = Path(record.pathname).name level = self.get_level_text(record) time_format = None if self.formatter is None else self.formatter.datefmt log_time = datetime.fromtimestamp(record.created) log_renderable = self._log_render( self.console, [message_renderable] if not traceback else [message_renderable, traceback], log_time=log_time, time_format=time_format, level=level, path=path, line_no=record.lineno, link_path=record.pathname if self.enable_link_path else None, ) return log_renderable if __name__ == "__main__": # pragma: no cover from time import sleep FORMAT = "%(message)s" # FORMAT = "%(asctime)-15s - %(levelname)s - %(message)s" logging.basicConfig( level="NOTSET", format=FORMAT, datefmt="[%X]", handlers=[RichHandler(rich_tracebacks=True, tracebacks_show_locals=True)], ) log = logging.getLogger("rich") log.info("Server starting...") log.info("Listening on http://127.0.0.1:8080") sleep(1) log.info("GET /index.html 200 1298") log.info("GET /imgs/backgrounds/back1.jpg 200 54386") log.info("GET /css/styles.css 200 54386") log.warning("GET /favicon.ico 404 242") sleep(1) log.debug( "JSONRPC request\n--> %r\n<-- %r", { "version": "1.1", "method": "confirmFruitPurchase", "params": [["apple", "orange", "mangoes", "pomelo"], 1.123], "id": "194521489", }, {"version": "1.1", "result": True, "error": None, "id": "194521489"}, ) log.debug( "Loading configuration file /adasd/asdasd/qeqwe/qwrqwrqwr/sdgsdgsdg/werwerwer/dfgerert/ertertert/ertetert/werwerwer" ) log.error("Unable to find 'pomelo' in database!") log.info("POST /jsonrpc/ 200 65532") log.info("POST /admin/ 401 42234") log.warning("password was rejected for admin site.") def divide() -> None: number = 1 divisor = 0 foos = ["foo"] * 100 log.debug("in divide") try: number / divisor except: log.exception("An error of some kind occurred!") divide() sleep(1) log.critical("Out of memory!") log.info("Server exited with code=-1") log.info("[bold]EXITING...[/bold]", extra=dict(markup=True))	12.18 KB	2026-01-20 12:58
📄 markup.py import re from ast import literal_eval from operator import attrgetter from typing import Callable, Iterable, List, Match, NamedTuple, Optional, Tuple, Union from ._emoji_replace import _emoji_replace from .emoji import EmojiVariant from .errors import MarkupError from .style import Style from .text import Span, Text RE_TAGS = re.compile( r"""((\\)\[([a-z#/@][^[]?)])""", re.VERBOSE, ) RE_HANDLER = re.compile(r"^([\w.]?)($.?$)?$") class Tag(NamedTuple): """A tag in console markup.""" name: str """The tag name. e.g. 'bold'.""" parameters: Optional[str] """Any additional parameters after the name.""" def __str__(self) -> str: return ( self.name if self.parameters is None else f"{self.name} {self.parameters}" ) @property def markup(self) -> str: """Get the string representation of this tag.""" return ( f"[{self.name}]" if self.parameters is None else f"[{self.name}={self.parameters}]" ) _ReStringMatch = Match[str] # regex match object _ReSubCallable = Callable[[_ReStringMatch], str] # Callable invoked by re.sub _EscapeSubMethod = Callable[[_ReSubCallable, str], str] # Sub method of a compiled re def escape( markup: str, _escape: _EscapeSubMethod = re.compile(r"(\\)(\[[a-z#/@][^[]?])").sub, ) -> str: """Escapes text so that it won't be interpreted as markup. Args: markup (str): Content to be inserted in to markup. Returns: str: Markup with square brackets escaped. """ def escape_backslashes(match: Match[str]) -> str: """Called by re.sub replace matches.""" backslashes, text = match.groups() return f"{backslashes}{backslashes}\\{text}" markup = _escape(escape_backslashes, markup) if markup.endswith("\\") and not markup.endswith("\\\\"): return markup + "\\" return markup def _parse(markup: str) -> Iterable[Tuple[int, Optional[str], Optional[Tag]]]: """Parse markup in to an iterable of tuples of (position, text, tag). Args: markup (str): A string containing console markup """ position = 0 _divmod = divmod _Tag = Tag for match in RE_TAGS.finditer(markup): full_text, escapes, tag_text = match.groups() start, end = match.span() if start > position: yield start, markup[position:start], None if escapes: backslashes, escaped = _divmod(len(escapes), 2) if backslashes: # Literal backslashes yield start, "\\" * backslashes, None start += backslashes * 2 if escaped: # Escape of tag yield start, full_text[len(escapes) :], None position = end continue text, equals, parameters = tag_text.partition("=") yield start, None, _Tag(text, parameters if equals else None) position = end if position < len(markup): yield position, markup[position:], None def render( markup: str, style: Union[str, Style] = "", emoji: bool = True, emoji_variant: Optional[EmojiVariant] = None, ) -> Text: """Render console markup in to a Text instance. Args: markup (str): A string containing console markup. style: (Union[str, Style]): The style to use. emoji (bool, optional): Also render emoji code. Defaults to True. emoji_variant (str, optional): Optional emoji variant, either "text" or "emoji". Defaults to None. Raises: MarkupError: If there is a syntax error in the markup. Returns: Text: A test instance. """ emoji_replace = _emoji_replace if "[" not in markup: return Text( emoji_replace(markup, default_variant=emoji_variant) if emoji else markup, style=style, ) text = Text(style=style) append = text.append normalize = Style.normalize style_stack: List[Tuple[int, Tag]] = [] pop = style_stack.pop spans: List[Span] = [] append_span = spans.append _Span = Span _Tag = Tag def pop_style(style_name: str) -> Tuple[int, Tag]: """Pop tag matching given style name.""" for index, (_, tag) in enumerate(reversed(style_stack), 1): if tag.name == style_name: return pop(-index) raise KeyError(style_name) for position, plain_text, tag in _parse(markup): if plain_text is not None: # Handle open brace escapes, where the brace is not part of a tag. plain_text = plain_text.replace("\\[", "[") append(emoji_replace(plain_text) if emoji else plain_text) elif tag is not None: if tag.name.startswith("/"): # Closing tag style_name = tag.name[1:].strip() if style_name: # explicit close style_name = normalize(style_name) try: start, open_tag = pop_style(style_name) except KeyError: raise MarkupError( f"closing tag '{tag.markup}' at position {position} doesn't match any open tag" ) from None else: # implicit close try: start, open_tag = pop() except IndexError: raise MarkupError( f"closing tag '[/]' at position {position} has nothing to close" ) from None if open_tag.name.startswith("@"): if open_tag.parameters: handler_name = "" parameters = open_tag.parameters.strip() handler_match = RE_HANDLER.match(parameters) if handler_match is not None: handler_name, match_parameters = handler_match.groups() parameters = ( "()" if match_parameters is None else match_parameters ) try: meta_params = literal_eval(parameters) except SyntaxError as error: raise MarkupError( f"error parsing {parameters!r} in {open_tag.parameters!r}; {error.msg}" ) except Exception as error: raise MarkupError( f"error parsing {open_tag.parameters!r}; {error}" ) from None if handler_name: meta_params = ( handler_name, meta_params if isinstance(meta_params, tuple) else (meta_params,), ) else: meta_params = () append_span( _Span( start, len(text), Style(meta={open_tag.name: meta_params}) ) ) else: append_span(_Span(start, len(text), str(open_tag))) else: # Opening tag normalized_tag = _Tag(normalize(tag.name), tag.parameters) style_stack.append((len(text), normalized_tag)) text_length = len(text) while style_stack: start, tag = style_stack.pop() style = str(tag) if style: append_span(_Span(start, text_length, style)) text.spans = sorted(spans[::-1], key=attrgetter("start")) return text if __name__ == "__main__": # pragma: no cover MARKUP = [ "[red]Hello World[/red]", "[magenta]Hello [b]World[/b]", "[bold]Bold[italic] bold and italic [/bold]italic[/italic]", "Click [link=https://www.willmcgugan.com]here[/link] to visit my Blog", ":warning-emoji: [bold red blink] DANGER![/]", ] from pip._vendor.rich import print from pip._vendor.rich.table import Table grid = Table("Markup", "Result", padding=(0, 1)) for markup in MARKUP: grid.add_row(Text(markup), markup) print(grid)	8.25 KB	2026-01-20 12:58
📄 measure.py from operator import itemgetter from typing import TYPE_CHECKING, Callable, NamedTuple, Optional, Sequence from . import errors from .protocol import is_renderable, rich_cast if TYPE_CHECKING: from .console import Console, ConsoleOptions, RenderableType class Measurement(NamedTuple): """Stores the minimum and maximum widths (in characters) required to render an object.""" minimum: int """Minimum number of cells required to render.""" maximum: int """Maximum number of cells required to render.""" @property def span(self) -> int: """Get difference between maximum and minimum.""" return self.maximum - self.minimum def normalize(self) -> "Measurement": """Get measurement that ensures that minimum <= maximum and minimum >= 0 Returns: Measurement: A normalized measurement. """ minimum, maximum = self minimum = min(max(0, minimum), maximum) return Measurement(max(0, minimum), max(0, max(minimum, maximum))) def with_maximum(self, width: int) -> "Measurement": """Get a RenderableWith where the widths are <= width. Args: width (int): Maximum desired width. Returns: Measurement: New Measurement object. """ minimum, maximum = self return Measurement(min(minimum, width), min(maximum, width)) def with_minimum(self, width: int) -> "Measurement": """Get a RenderableWith where the widths are >= width. Args: width (int): Minimum desired width. Returns: Measurement: New Measurement object. """ minimum, maximum = self width = max(0, width) return Measurement(max(minimum, width), max(maximum, width)) def clamp( self, min_width: Optional[int] = None, max_width: Optional[int] = None ) -> "Measurement": """Clamp a measurement within the specified range. Args: min_width (int): Minimum desired width, or ``None`` for no minimum. Defaults to None. max_width (int): Maximum desired width, or ``None`` for no maximum. Defaults to None. Returns: Measurement: New Measurement object. """ measurement = self if min_width is not None: measurement = measurement.with_minimum(min_width) if max_width is not None: measurement = measurement.with_maximum(max_width) return measurement @classmethod def get( cls, console: "Console", options: "ConsoleOptions", renderable: "RenderableType" ) -> "Measurement": """Get a measurement for a renderable. Args: console (~rich.console.Console): Console instance. options (~rich.console.ConsoleOptions): Console options. renderable (RenderableType): An object that may be rendered with Rich. Raises: errors.NotRenderableError: If the object is not renderable. Returns: Measurement: Measurement object containing range of character widths required to render the object. """ _max_width = options.max_width if _max_width < 1: return Measurement(0, 0) if isinstance(renderable, str): renderable = console.render_str( renderable, markup=options.markup, highlight=False ) renderable = rich_cast(renderable) if is_renderable(renderable): get_console_width: Optional[ Callable[["Console", "ConsoleOptions"], "Measurement"] ] = getattr(renderable, "__rich_measure__", None) if get_console_width is not None: render_width = ( get_console_width(console, options) .normalize() .with_maximum(_max_width) ) if render_width.maximum < 1: return Measurement(0, 0) return render_width.normalize() else: return Measurement(0, _max_width) else: raise errors.NotRenderableError( f"Unable to get render width for {renderable!r}; " "a str, Segment, or object with __rich_console__ method is required" ) def measure_renderables( console: "Console", options: "ConsoleOptions", renderables: Sequence["RenderableType"], ) -> "Measurement": """Get a measurement that would fit a number of renderables. Args: console (~rich.console.Console): Console instance. options (~rich.console.ConsoleOptions): Console options. renderables (Iterable[RenderableType]): One or more renderable objects. Returns: Measurement: Measurement object containing range of character widths required to contain all given renderables. """ if not renderables: return Measurement(0, 0) get_measurement = Measurement.get measurements = [ get_measurement(console, options, renderable) for renderable in renderables ] measured_width = Measurement( max(measurements, key=itemgetter(0)).minimum, max(measurements, key=itemgetter(1)).maximum, ) return measured_width	5.18 KB	2026-01-20 12:58
📄 padding.py from typing import TYPE_CHECKING, List, Optional, Tuple, Union if TYPE_CHECKING: from .console import ( Console, ConsoleOptions, RenderableType, RenderResult, ) from .jupyter import JupyterMixin from .measure import Measurement from .segment import Segment from .style import Style PaddingDimensions = Union[int, Tuple[int], Tuple[int, int], Tuple[int, int, int, int]] class Padding(JupyterMixin): """Draw space around content. Example: >>> print(Padding("Hello", (2, 4), style="on blue")) Args: renderable (RenderableType): String or other renderable. pad (Union[int, Tuple[int]]): Padding for top, right, bottom, and left borders. May be specified with 1, 2, or 4 integers (CSS style). style (Union[str, Style], optional): Style for padding characters. Defaults to "none". expand (bool, optional): Expand padding to fit available width. Defaults to True. """ def __init__( self, renderable: "RenderableType", pad: "PaddingDimensions" = (0, 0, 0, 0), , style: Union[str, Style] = "none", expand: bool = True, ): self.renderable = renderable self.top, self.right, self.bottom, self.left = self.unpack(pad) self.style = style self.expand = expand @classmethod def indent(cls, renderable: "RenderableType", level: int) -> "Padding": """Make padding instance to render an indent. Args: renderable (RenderableType): String or other renderable. level (int): Number of characters to indent. Returns: Padding: A Padding instance. """ return Padding(renderable, pad=(0, 0, 0, level), expand=False) @staticmethod def unpack(pad: "PaddingDimensions") -> Tuple[int, int, int, int]: """Unpack padding specified in CSS style.""" if isinstance(pad, int): return (pad, pad, pad, pad) if len(pad) == 1: _pad = pad[0] return (_pad, _pad, _pad, _pad) if len(pad) == 2: pad_top, pad_right = pad return (pad_top, pad_right, pad_top, pad_right) if len(pad) == 4: top, right, bottom, left = pad return (top, right, bottom, left) raise ValueError(f"1, 2 or 4 integers required for padding; {len(pad)} given") def __repr__(self) -> str: return f"Padding({self.renderable!r}, ({self.top},{self.right},{self.bottom},{self.left}))" def __rich_console__( self, console: "Console", options: "ConsoleOptions" ) -> "RenderResult": style = console.get_style(self.style) if self.expand: width = options.max_width else: width = min( Measurement.get(console, options, self.renderable).maximum + self.left + self.right, options.max_width, ) render_options = options.update_width(width - self.left - self.right) if render_options.height is not None: render_options = render_options.update_height( height=render_options.height - self.top - self.bottom ) lines = console.render_lines( self.renderable, render_options, style=style, pad=True ) _Segment = Segment left = _Segment(" " self.left, style) if self.left else None right = ( [_Segment(f'{" " * self.right}', style), _Segment.line()] if self.right else [_Segment.line()] ) blank_line: Optional[List[Segment]] = None if self.top: blank_line = [_Segment(f'{" " * width}\n', style)] yield from blank_line * self.top if left: for line in lines: yield left yield from line yield from right else: for line in lines: yield from line yield from right if self.bottom: blank_line = blank_line or [_Segment(f'{" " * width}\n', style)] yield from blank_line * self.bottom def __rich_measure__( self, console: "Console", options: "ConsoleOptions" ) -> "Measurement": max_width = options.max_width extra_width = self.left + self.right if max_width - extra_width < 1: return Measurement(max_width, max_width) measure_min, measure_max = Measurement.get(console, options, self.renderable) measurement = Measurement(measure_min + extra_width, measure_max + extra_width) measurement = measurement.with_maximum(max_width) return measurement if __name__ == "__main__": # pragma: no cover from pip._vendor.rich import print print(Padding("Hello, World", (2, 4), style="on blue"))	4.79 KB	2026-01-20 12:58
📄 pager.py from abc import ABC, abstractmethod from typing import Any class Pager(ABC): """Base class for a pager.""" @abstractmethod def show(self, content: str) -> None: """Show content in pager. Args: content (str): Content to be displayed. """ class SystemPager(Pager): """Uses the pager installed on the system.""" def _pager(self, content: str) -> Any: # pragma: no cover return __import__("pydoc").pager(content) def show(self, content: str) -> None: """Use the same pager used by pydoc.""" self._pager(content) if __name__ == "__main__": # pragma: no cover from .__main__ import make_test_card from .console import Console console = Console() with console.pager(styles=True): console.print(make_test_card())	828 B	2026-01-20 12:58
📄 palette.py from math import sqrt from functools import lru_cache from typing import Sequence, Tuple, TYPE_CHECKING from .color_triplet import ColorTriplet if TYPE_CHECKING: from pip._vendor.rich.table import Table class Palette: """A palette of available colors.""" def __init__(self, colors: Sequence[Tuple[int, int, int]]): self._colors = colors def __getitem__(self, number: int) -> ColorTriplet: return ColorTriplet(self._colors[number]) def __rich__(self) -> "Table": from pip._vendor.rich.color import Color from pip._vendor.rich.style import Style from pip._vendor.rich.text import Text from pip._vendor.rich.table import Table table = Table( "index", "RGB", "Color", title="Palette", caption=f"{len(self._colors)} colors", highlight=True, caption_justify="right", ) for index, color in enumerate(self._colors): table.add_row( str(index), repr(color), Text(" " 16, style=Style(bgcolor=Color.from_rgb(color))), ) return table # This is somewhat inefficient and needs caching @lru_cache(maxsize=1024) def match(self, color: Tuple[int, int, int]) -> int: """Find a color from a palette that most closely matches a given color. Args: color (Tuple[int, int, int]): RGB components in range 0 > 255. Returns: int: Index of closes matching color. """ red1, green1, blue1 = color _sqrt = sqrt get_color = self._colors.__getitem__ def get_color_distance(index: int) -> float: """Get the distance to a color.""" red2, green2, blue2 = get_color(index) red_mean = (red1 + red2) // 2 red = red1 - red2 green = green1 - green2 blue = blue1 - blue2 return _sqrt( (((512 + red_mean) red * red) >> 8) + 4 * green * green + (((767 - red_mean) * blue * blue) >> 8) ) min_index = min(range(len(self._colors)), key=get_color_distance) return min_index if __name__ == "__main__": # pragma: no cover import colorsys from typing import Iterable from pip._vendor.rich.color import Color from pip._vendor.rich.console import Console, ConsoleOptions from pip._vendor.rich.segment import Segment from pip._vendor.rich.style import Style class ColorBox: def __rich_console__( self, console: Console, options: ConsoleOptions ) -> Iterable[Segment]: height = console.size.height - 3 for y in range(0, height): for x in range(options.max_width): h = x / options.max_width l = y / (height + 1) r1, g1, b1 = colorsys.hls_to_rgb(h, l, 1.0) r2, g2, b2 = colorsys.hls_to_rgb(h, l + (1 / height / 2), 1.0) bgcolor = Color.from_rgb(r1 * 255, g1 * 255, b1 * 255) color = Color.from_rgb(r2 * 255, g2 * 255, b2 * 255) yield Segment("▄", Style(color=color, bgcolor=bgcolor)) yield Segment.line() console = Console() console.print(ColorBox())	3.32 KB	2026-01-20 12:58
📄 panel.py from typing import TYPE_CHECKING, Optional from .align import AlignMethod from .box import ROUNDED, Box from .cells import cell_len from .jupyter import JupyterMixin from .measure import Measurement, measure_renderables from .padding import Padding, PaddingDimensions from .segment import Segment from .style import Style, StyleType from .text import Text, TextType if TYPE_CHECKING: from .console import Console, ConsoleOptions, RenderableType, RenderResult class Panel(JupyterMixin): """A console renderable that draws a border around its contents. Example: >>> console.print(Panel("Hello, World!")) Args: renderable (RenderableType): A console renderable object. box (Box): A Box instance that defines the look of the border (see :ref:`appendix_box`. Defaults to box.ROUNDED. title (Optional[TextType], optional): Optional title displayed in panel header. Defaults to None. title_align (AlignMethod, optional): Alignment of title. Defaults to "center". subtitle (Optional[TextType], optional): Optional subtitle displayed in panel footer. Defaults to None. subtitle_align (AlignMethod, optional): Alignment of subtitle. Defaults to "center". safe_box (bool, optional): Disable box characters that don't display on windows legacy terminal with raster fonts. Defaults to True. expand (bool, optional): If True the panel will stretch to fill the console width, otherwise it will be sized to fit the contents. Defaults to True. style (str, optional): The style of the panel (border and contents). Defaults to "none". border_style (str, optional): The style of the border. Defaults to "none". width (Optional[int], optional): Optional width of panel. Defaults to None to auto-detect. height (Optional[int], optional): Optional height of panel. Defaults to None to auto-detect. padding (Optional[PaddingDimensions]): Optional padding around renderable. Defaults to 0. highlight (bool, optional): Enable automatic highlighting of panel title (if str). Defaults to False. """ def __init__( self, renderable: "RenderableType", box: Box = ROUNDED, , title: Optional[TextType] = None, title_align: AlignMethod = "center", subtitle: Optional[TextType] = None, subtitle_align: AlignMethod = "center", safe_box: Optional[bool] = None, expand: bool = True, style: StyleType = "none", border_style: StyleType = "none", width: Optional[int] = None, height: Optional[int] = None, padding: PaddingDimensions = (0, 1), highlight: bool = False, ) -> None: self.renderable = renderable self.box = box self.title = title self.title_align: AlignMethod = title_align self.subtitle = subtitle self.subtitle_align = subtitle_align self.safe_box = safe_box self.expand = expand self.style = style self.border_style = border_style self.width = width self.height = height self.padding = padding self.highlight = highlight @classmethod def fit( cls, renderable: "RenderableType", box: Box = ROUNDED, , title: Optional[TextType] = None, title_align: AlignMethod = "center", subtitle: Optional[TextType] = None, subtitle_align: AlignMethod = "center", safe_box: Optional[bool] = None, style: StyleType = "none", border_style: StyleType = "none", width: Optional[int] = None, height: Optional[int] = None, padding: PaddingDimensions = (0, 1), highlight: bool = False, ) -> "Panel": """An alternative constructor that sets expand=False.""" return cls( renderable, box, title=title, title_align=title_align, subtitle=subtitle, subtitle_align=subtitle_align, safe_box=safe_box, style=style, border_style=border_style, width=width, height=height, padding=padding, highlight=highlight, expand=False, ) @property def _title(self) -> Optional[Text]: if self.title: title_text = ( Text.from_markup(self.title) if isinstance(self.title, str) else self.title.copy() ) title_text.end = "" title_text.plain = title_text.plain.replace("\n", " ") title_text.no_wrap = True title_text.expand_tabs() title_text.pad(1) return title_text return None @property def _subtitle(self) -> Optional[Text]: if self.subtitle: subtitle_text = ( Text.from_markup(self.subtitle) if isinstance(self.subtitle, str) else self.subtitle.copy() ) subtitle_text.end = "" subtitle_text.plain = subtitle_text.plain.replace("\n", " ") subtitle_text.no_wrap = True subtitle_text.expand_tabs() subtitle_text.pad(1) return subtitle_text return None def __rich_console__( self, console: "Console", options: "ConsoleOptions" ) -> "RenderResult": _padding = Padding.unpack(self.padding) renderable = ( Padding(self.renderable, _padding) if any(_padding) else self.renderable ) style = console.get_style(self.style) border_style = style + console.get_style(self.border_style) width = ( options.max_width if self.width is None else min(options.max_width, self.width) ) safe_box: bool = console.safe_box if self.safe_box is None else self.safe_box box = self.box.substitute(options, safe=safe_box) def align_text( text: Text, width: int, align: str, character: str, style: Style ) -> Text: """Gets new aligned text. Args: text (Text): Title or subtitle text. width (int): Desired width. align (str): Alignment. character (str): Character for alignment. style (Style): Border style Returns: Text: New text instance """ text = text.copy() text.truncate(width) excess_space = width - cell_len(text.plain) if text.style: text.stylize(console.get_style(text.style)) if excess_space: if align == "left": return Text.assemble( text, (character * excess_space, style), no_wrap=True, end="", ) elif align == "center": left = excess_space // 2 return Text.assemble( (character * left, style), text, (character * (excess_space - left), style), no_wrap=True, end="", ) else: return Text.assemble( (character * excess_space, style), text, no_wrap=True, end="", ) return text title_text = self._title if title_text is not None: title_text.stylize_before(border_style) child_width = ( width - 2 if self.expand else console.measure( renderable, options=options.update_width(width - 2) ).maximum ) child_height = self.height or options.height or None if child_height: child_height -= 2 if title_text is not None: child_width = min( options.max_width - 2, max(child_width, title_text.cell_len + 2) ) width = child_width + 2 child_options = options.update( width=child_width, height=child_height, highlight=self.highlight ) lines = console.render_lines(renderable, child_options, style=style) line_start = Segment(box.mid_left, border_style) line_end = Segment(f"{box.mid_right}", border_style) new_line = Segment.line() if title_text is None or width <= 4: yield Segment(box.get_top([width - 2]), border_style) else: title_text = align_text( title_text, width - 4, self.title_align, box.top, border_style, ) yield Segment(box.top_left + box.top, border_style) yield from console.render(title_text, child_options.update_width(width - 4)) yield Segment(box.top + box.top_right, border_style) yield new_line for line in lines: yield line_start yield from line yield line_end yield new_line subtitle_text = self._subtitle if subtitle_text is not None: subtitle_text.stylize_before(border_style) if subtitle_text is None or width <= 4: yield Segment(box.get_bottom([width - 2]), border_style) else: subtitle_text = align_text( subtitle_text, width - 4, self.subtitle_align, box.bottom, border_style, ) yield Segment(box.bottom_left + box.bottom, border_style) yield from console.render( subtitle_text, child_options.update_width(width - 4) ) yield Segment(box.bottom + box.bottom_right, border_style) yield new_line def __rich_measure__( self, console: "Console", options: "ConsoleOptions" ) -> "Measurement": _title = self._title _, right, _, left = Padding.unpack(self.padding) padding = left + right renderables = [self.renderable, _title] if _title else [self.renderable] if self.width is None: width = ( measure_renderables( console, options.update_width(options.max_width - padding - 2), renderables, ).maximum + padding + 2 ) else: width = self.width return Measurement(width, width) if __name__ == "__main__": # pragma: no cover from .console import Console c = Console() from .box import DOUBLE, ROUNDED from .padding import Padding p = Panel( "Hello, World!", title="rich.Panel", style="white on blue", box=DOUBLE, padding=1, ) c.print() c.print(p)	10.9 KB	2026-01-20 12:58
📄 pretty.py import builtins import collections import dataclasses import inspect import os import reprlib import sys from array import array from collections import Counter, UserDict, UserList, defaultdict, deque from dataclasses import dataclass, fields, is_dataclass from inspect import isclass from itertools import islice from types import MappingProxyType from typing import ( TYPE_CHECKING, Any, Callable, DefaultDict, Deque, Dict, Iterable, List, Optional, Sequence, Set, Tuple, Union, ) from pip._vendor.rich.repr import RichReprResult try: import attr as _attr_module _has_attrs = hasattr(_attr_module, "ib") except ImportError: # pragma: no cover _has_attrs = False from . import get_console from ._loop import loop_last from ._pick import pick_bool from .abc import RichRenderable from .cells import cell_len from .highlighter import ReprHighlighter from .jupyter import JupyterMixin, JupyterRenderable from .measure import Measurement from .text import Text if TYPE_CHECKING: from .console import ( Console, ConsoleOptions, HighlighterType, JustifyMethod, OverflowMethod, RenderResult, ) def _is_attr_object(obj: Any) -> bool: """Check if an object was created with attrs module.""" return _has_attrs and _attr_module.has(type(obj)) def _get_attr_fields(obj: Any) -> Sequence["_attr_module.Attribute[Any]"]: """Get fields for an attrs object.""" return _attr_module.fields(type(obj)) if _has_attrs else [] def _is_dataclass_repr(obj: object) -> bool: """Check if an instance of a dataclass contains the default repr. Args: obj (object): A dataclass instance. Returns: bool: True if the default repr is used, False if there is a custom repr. """ # Digging in to a lot of internals here # Catching all exceptions in case something is missing on a non CPython implementation try: return obj.__repr__.__code__.co_filename in ( dataclasses.__file__, reprlib.__file__, ) except Exception: # pragma: no coverage return False _dummy_namedtuple = collections.namedtuple("_dummy_namedtuple", []) def _has_default_namedtuple_repr(obj: object) -> bool: """Check if an instance of namedtuple contains the default repr Args: obj (object): A namedtuple Returns: bool: True if the default repr is used, False if there's a custom repr. """ obj_file = None try: obj_file = inspect.getfile(obj.__repr__) except (OSError, TypeError): # OSError handles case where object is defined in __main__ scope, e.g. REPL - no filename available. # TypeError trapped defensively, in case of object without filename slips through. pass default_repr_file = inspect.getfile(_dummy_namedtuple.__repr__) return obj_file == default_repr_file def _ipy_display_hook( value: Any, console: Optional["Console"] = None, overflow: "OverflowMethod" = "ignore", crop: bool = False, indent_guides: bool = False, max_length: Optional[int] = None, max_string: Optional[int] = None, max_depth: Optional[int] = None, expand_all: bool = False, ) -> Union[str, None]: # needed here to prevent circular import: from .console import ConsoleRenderable # always skip rich generated jupyter renderables or None values if _safe_isinstance(value, JupyterRenderable) or value is None: return None console = console or get_console() with console.capture() as capture: # certain renderables should start on a new line if _safe_isinstance(value, ConsoleRenderable): console.line() console.print( ( value if _safe_isinstance(value, RichRenderable) else Pretty( value, overflow=overflow, indent_guides=indent_guides, max_length=max_length, max_string=max_string, max_depth=max_depth, expand_all=expand_all, margin=12, ) ), crop=crop, new_line_start=True, end="", ) # strip trailing newline, not usually part of a text repr # I'm not sure if this should be prevented at a lower level return capture.get().rstrip("\n") def _safe_isinstance( obj: object, class_or_tuple: Union[type, Tuple[type, ...]] ) -> bool: """isinstance can fail in rare cases, for example types with no __class__""" try: return isinstance(obj, class_or_tuple) except Exception: return False def install( console: Optional["Console"] = None, overflow: "OverflowMethod" = "ignore", crop: bool = False, indent_guides: bool = False, max_length: Optional[int] = None, max_string: Optional[int] = None, max_depth: Optional[int] = None, expand_all: bool = False, ) -> None: """Install automatic pretty printing in the Python REPL. Args: console (Console, optional): Console instance or ``None`` to use global console. Defaults to None. overflow (Optional[OverflowMethod], optional): Overflow method. Defaults to "ignore". crop (Optional[bool], optional): Enable cropping of long lines. Defaults to False. indent_guides (bool, optional): Enable indentation guides. Defaults to False. max_length (int, optional): Maximum length of containers before abbreviating, or None for no abbreviation. Defaults to None. max_string (int, optional): Maximum length of string before truncating, or None to disable. Defaults to None. max_depth (int, optional): Maximum depth of nested data structures, or None for no maximum. Defaults to None. expand_all (bool, optional): Expand all containers. Defaults to False. max_frames (int): Maximum number of frames to show in a traceback, 0 for no maximum. Defaults to 100. """ from pip._vendor.rich import get_console console = console or get_console() assert console is not None def display_hook(value: Any) -> None: """Replacement sys.displayhook which prettifies objects with Rich.""" if value is not None: assert console is not None builtins._ = None # type: ignore[attr-defined] console.print( ( value if _safe_isinstance(value, RichRenderable) else Pretty( value, overflow=overflow, indent_guides=indent_guides, max_length=max_length, max_string=max_string, max_depth=max_depth, expand_all=expand_all, ) ), crop=crop, ) builtins._ = value # type: ignore[attr-defined] try: ip = get_ipython() # type: ignore[name-defined] except NameError: sys.displayhook = display_hook else: from IPython.core.formatters import BaseFormatter class RichFormatter(BaseFormatter): # type: ignore[misc] pprint: bool = True def __call__(self, value: Any) -> Any: if self.pprint: return _ipy_display_hook( value, console=get_console(), overflow=overflow, indent_guides=indent_guides, max_length=max_length, max_string=max_string, max_depth=max_depth, expand_all=expand_all, ) else: return repr(value) # replace plain text formatter with rich formatter rich_formatter = RichFormatter() ip.display_formatter.formatters["text/plain"] = rich_formatter class Pretty(JupyterMixin): """A rich renderable that pretty prints an object. Args: _object (Any): An object to pretty print. highlighter (HighlighterType, optional): Highlighter object to apply to result, or None for ReprHighlighter. Defaults to None. indent_size (int, optional): Number of spaces in indent. Defaults to 4. justify (JustifyMethod, optional): Justify method, or None for default. Defaults to None. overflow (OverflowMethod, optional): Overflow method, or None for default. Defaults to None. no_wrap (Optional[bool], optional): Disable word wrapping. Defaults to False. indent_guides (bool, optional): Enable indentation guides. Defaults to False. max_length (int, optional): Maximum length of containers before abbreviating, or None for no abbreviation. Defaults to None. max_string (int, optional): Maximum length of string before truncating, or None to disable. Defaults to None. max_depth (int, optional): Maximum depth of nested data structures, or None for no maximum. Defaults to None. expand_all (bool, optional): Expand all containers. Defaults to False. margin (int, optional): Subtrace a margin from width to force containers to expand earlier. Defaults to 0. insert_line (bool, optional): Insert a new line if the output has multiple new lines. Defaults to False. """ def __init__( self, _object: Any, highlighter: Optional["HighlighterType"] = None, , indent_size: int = 4, justify: Optional["JustifyMethod"] = None, overflow: Optional["OverflowMethod"] = None, no_wrap: Optional[bool] = False, indent_guides: bool = False, max_length: Optional[int] = None, max_string: Optional[int] = None, max_depth: Optional[int] = None, expand_all: bool = False, margin: int = 0, insert_line: bool = False, ) -> None: self._object = _object self.highlighter = highlighter or ReprHighlighter() self.indent_size = indent_size self.justify: Optional["JustifyMethod"] = justify self.overflow: Optional["OverflowMethod"] = overflow self.no_wrap = no_wrap self.indent_guides = indent_guides self.max_length = max_length self.max_string = max_string self.max_depth = max_depth self.expand_all = expand_all self.margin = margin self.insert_line = insert_line def __rich_console__( self, console: "Console", options: "ConsoleOptions" ) -> "RenderResult": pretty_str = pretty_repr( self._object, max_width=options.max_width - self.margin, indent_size=self.indent_size, max_length=self.max_length, max_string=self.max_string, max_depth=self.max_depth, expand_all=self.expand_all, ) pretty_text = Text.from_ansi( pretty_str, justify=self.justify or options.justify, overflow=self.overflow or options.overflow, no_wrap=pick_bool(self.no_wrap, options.no_wrap), style="pretty", ) pretty_text = ( self.highlighter(pretty_text) if pretty_text else Text( f"{type(self._object)}.__repr__ returned empty string", style="dim italic", ) ) if self.indent_guides and not options.ascii_only: pretty_text = pretty_text.with_indent_guides( self.indent_size, style="repr.indent" ) if self.insert_line and "\n" in pretty_text: yield "" yield pretty_text def __rich_measure__( self, console: "Console", options: "ConsoleOptions" ) -> "Measurement": pretty_str = pretty_repr( self._object, max_width=options.max_width, indent_size=self.indent_size, max_length=self.max_length, max_string=self.max_string, max_depth=self.max_depth, expand_all=self.expand_all, ) text_width = ( max(cell_len(line) for line in pretty_str.splitlines()) if pretty_str else 0 ) return Measurement(text_width, text_width) def _get_braces_for_defaultdict(_object: DefaultDict[Any, Any]) -> Tuple[str, str, str]: return ( f"defaultdict({_object.default_factory!r}, {{", "})", f"defaultdict({_object.default_factory!r}, {{}})", ) def _get_braces_for_deque(_object: Deque[Any]) -> Tuple[str, str, str]: if _object.maxlen is None: return ("deque([", "])", "deque()") return ( "deque([", f"], maxlen={_object.maxlen})", f"deque(maxlen={_object.maxlen})", ) def _get_braces_for_array(_object: "array[Any]") -> Tuple[str, str, str]: return (f"array({_object.typecode!r}, [", "])", f"array({_object.typecode!r})") _BRACES: Dict[type, Callable[[Any], Tuple[str, str, str]]] = { os._Environ: lambda _object: ("environ({", "})", "environ({})"), array: _get_braces_for_array, defaultdict: _get_braces_for_defaultdict, Counter: lambda _object: ("Counter({", "})", "Counter()"), deque: _get_braces_for_deque, dict: lambda _object: ("{", "}", "{}"), UserDict: lambda _object: ("{", "}", "{}"), frozenset: lambda _object: ("frozenset({", "})", "frozenset()"), list: lambda _object: ("[", "]", "[]"), UserList: lambda _object: ("[", "]", "[]"), set: lambda _object: ("{", "}", "set()"), tuple: lambda _object: ("(", ")", "()"), MappingProxyType: lambda _object: ("mappingproxy({", "})", "mappingproxy({})"), } _CONTAINERS = tuple(_BRACES.keys()) _MAPPING_CONTAINERS = (dict, os._Environ, MappingProxyType, UserDict) def is_expandable(obj: Any) -> bool: """Check if an object may be expanded by pretty print.""" return ( _safe_isinstance(obj, _CONTAINERS) or (is_dataclass(obj)) or (hasattr(obj, "__rich_repr__")) or _is_attr_object(obj) ) and not isclass(obj) @dataclass class Node: """A node in a repr tree. May be atomic or a container.""" key_repr: str = "" value_repr: str = "" open_brace: str = "" close_brace: str = "" empty: str = "" last: bool = False is_tuple: bool = False is_namedtuple: bool = False children: Optional[List["Node"]] = None key_separator: str = ": " separator: str = ", " def iter_tokens(self) -> Iterable[str]: """Generate tokens for this node.""" if self.key_repr: yield self.key_repr yield self.key_separator if self.value_repr: yield self.value_repr elif self.children is not None: if self.children: yield self.open_brace if self.is_tuple and not self.is_namedtuple and len(self.children) == 1: yield from self.children[0].iter_tokens() yield "," else: for child in self.children: yield from child.iter_tokens() if not child.last: yield self.separator yield self.close_brace else: yield self.empty def check_length(self, start_length: int, max_length: int) -> bool: """Check the length fits within a limit. Args: start_length (int): Starting length of the line (indent, prefix, suffix). max_length (int): Maximum length. Returns: bool: True if the node can be rendered within max length, otherwise False. """ total_length = start_length for token in self.iter_tokens(): total_length += cell_len(token) if total_length > max_length: return False return True def __str__(self) -> str: repr_text = "".join(self.iter_tokens()) return repr_text def render( self, max_width: int = 80, indent_size: int = 4, expand_all: bool = False ) -> str: """Render the node to a pretty repr. Args: max_width (int, optional): Maximum width of the repr. Defaults to 80. indent_size (int, optional): Size of indents. Defaults to 4. expand_all (bool, optional): Expand all levels. Defaults to False. Returns: str: A repr string of the original object. """ lines = [_Line(node=self, is_root=True)] line_no = 0 while line_no < len(lines): line = lines[line_no] if line.expandable and not line.expanded: if expand_all or not line.check_length(max_width): lines[line_no : line_no + 1] = line.expand(indent_size) line_no += 1 repr_str = "\n".join(str(line) for line in lines) return repr_str @dataclass class _Line: """A line in repr output.""" parent: Optional["_Line"] = None is_root: bool = False node: Optional[Node] = None text: str = "" suffix: str = "" whitespace: str = "" expanded: bool = False last: bool = False @property def expandable(self) -> bool: """Check if the line may be expanded.""" return bool(self.node is not None and self.node.children) def check_length(self, max_length: int) -> bool: """Check this line fits within a given number of cells.""" start_length = ( len(self.whitespace) + cell_len(self.text) + cell_len(self.suffix) ) assert self.node is not None return self.node.check_length(start_length, max_length) def expand(self, indent_size: int) -> Iterable["_Line"]: """Expand this line by adding children on their own line.""" node = self.node assert node is not None whitespace = self.whitespace assert node.children if node.key_repr: new_line = yield _Line( text=f"{node.key_repr}{node.key_separator}{node.open_brace}", whitespace=whitespace, ) else: new_line = yield _Line(text=node.open_brace, whitespace=whitespace) child_whitespace = self.whitespace + " " indent_size tuple_of_one = node.is_tuple and len(node.children) == 1 for last, child in loop_last(node.children): separator = "," if tuple_of_one else node.separator line = _Line( parent=new_line, node=child, whitespace=child_whitespace, suffix=separator, last=last and not tuple_of_one, ) yield line yield _Line( text=node.close_brace, whitespace=whitespace, suffix=self.suffix, last=self.last, ) def __str__(self) -> str: if self.last: return f"{self.whitespace}{self.text}{self.node or ''}" else: return ( f"{self.whitespace}{self.text}{self.node or ''}{self.suffix.rstrip()}" ) def _is_namedtuple(obj: Any) -> bool: """Checks if an object is most likely a namedtuple. It is possible to craft an object that passes this check and isn't a namedtuple, but there is only a minuscule chance of this happening unintentionally. Args: obj (Any): The object to test Returns: bool: True if the object is a namedtuple. False otherwise. """ try: fields = getattr(obj, "_fields", None) except Exception: # Being very defensive - if we cannot get the attr then its not a namedtuple return False return isinstance(obj, tuple) and isinstance(fields, tuple) def traverse( _object: Any, max_length: Optional[int] = None, max_string: Optional[int] = None, max_depth: Optional[int] = None, ) -> Node: """Traverse object and generate a tree. Args: _object (Any): Object to be traversed. max_length (int, optional): Maximum length of containers before abbreviating, or None for no abbreviation. Defaults to None. max_string (int, optional): Maximum length of string before truncating, or None to disable truncating. Defaults to None. max_depth (int, optional): Maximum depth of data structures, or None for no maximum. Defaults to None. Returns: Node: The root of a tree structure which can be used to render a pretty repr. """ def to_repr(obj: Any) -> str: """Get repr string for an object, but catch errors.""" if ( max_string is not None and _safe_isinstance(obj, (bytes, str)) and len(obj) > max_string ): truncated = len(obj) - max_string obj_repr = f"{obj[:max_string]!r}+{truncated}" else: try: obj_repr = repr(obj) except Exception as error: obj_repr = f"<repr-error {str(error)!r}>" return obj_repr visited_ids: Set[int] = set() push_visited = visited_ids.add pop_visited = visited_ids.remove def _traverse(obj: Any, root: bool = False, depth: int = 0) -> Node: """Walk the object depth first.""" obj_id = id(obj) if obj_id in visited_ids: # Recursion detected return Node(value_repr="...") obj_type = type(obj) children: List[Node] reached_max_depth = max_depth is not None and depth >= max_depth def iter_rich_args(rich_args: Any) -> Iterable[Union[Any, Tuple[str, Any]]]: for arg in rich_args: if _safe_isinstance(arg, tuple): if len(arg) == 3: key, child, default = arg if default == child: continue yield key, child elif len(arg) == 2: key, child = arg yield key, child elif len(arg) == 1: yield arg[0] else: yield arg try: fake_attributes = hasattr( obj, "awehoi234_wdfjwljet234_234wdfoijsdfmmnxpi492" ) except Exception: fake_attributes = False rich_repr_result: Optional[RichReprResult] = None if not fake_attributes: try: if hasattr(obj, "__rich_repr__") and not isclass(obj): rich_repr_result = obj.__rich_repr__() except Exception: pass if rich_repr_result is not None: push_visited(obj_id) angular = getattr(obj.__rich_repr__, "angular", False) args = list(iter_rich_args(rich_repr_result)) class_name = obj.__class__.__name__ if args: children = [] append = children.append if reached_max_depth: if angular: node = Node(value_repr=f"<{class_name}...>") else: node = Node(value_repr=f"{class_name}(...)") else: if angular: node = Node( open_brace=f"<{class_name} ", close_brace=">", children=children, last=root, separator=" ", ) else: node = Node( open_brace=f"{class_name}(", close_brace=")", children=children, last=root, ) for last, arg in loop_last(args): if _safe_isinstance(arg, tuple): key, child = arg child_node = _traverse(child, depth=depth + 1) child_node.last = last child_node.key_repr = key child_node.key_separator = "=" append(child_node) else: child_node = _traverse(arg, depth=depth + 1) child_node.last = last append(child_node) else: node = Node( value_repr=f"<{class_name}>" if angular else f"{class_name}()", children=[], last=root, ) pop_visited(obj_id) elif _is_attr_object(obj) and not fake_attributes: push_visited(obj_id) children = [] append = children.append attr_fields = _get_attr_fields(obj) if attr_fields: if reached_max_depth: node = Node(value_repr=f"{obj.__class__.__name__}(...)") else: node = Node( open_brace=f"{obj.__class__.__name__}(", close_brace=")", children=children, last=root, ) def iter_attrs() -> ( Iterable[Tuple[str, Any, Optional[Callable[[Any], str]]]] ): """Iterate over attr fields and values.""" for attr in attr_fields: if attr.repr: try: value = getattr(obj, attr.name) except Exception as error: # Can happen, albeit rarely yield (attr.name, error, None) else: yield ( attr.name, value, attr.repr if callable(attr.repr) else None, ) for last, (name, value, repr_callable) in loop_last(iter_attrs()): if repr_callable: child_node = Node(value_repr=str(repr_callable(value))) else: child_node = _traverse(value, depth=depth + 1) child_node.last = last child_node.key_repr = name child_node.key_separator = "=" append(child_node) else: node = Node( value_repr=f"{obj.__class__.__name__}()", children=[], last=root ) pop_visited(obj_id) elif ( is_dataclass(obj) and not _safe_isinstance(obj, type) and not fake_attributes and _is_dataclass_repr(obj) ): push_visited(obj_id) children = [] append = children.append if reached_max_depth: node = Node(value_repr=f"{obj.__class__.__name__}(...)") else: node = Node( open_brace=f"{obj.__class__.__name__}(", close_brace=")", children=children, last=root, empty=f"{obj.__class__.__name__}()", ) for last, field in loop_last( field for field in fields(obj) if field.repr and hasattr(obj, field.name) ): child_node = _traverse(getattr(obj, field.name), depth=depth + 1) child_node.key_repr = field.name child_node.last = last child_node.key_separator = "=" append(child_node) pop_visited(obj_id) elif _is_namedtuple(obj) and _has_default_namedtuple_repr(obj): push_visited(obj_id) class_name = obj.__class__.__name__ if reached_max_depth: # If we've reached the max depth, we still show the class name, but not its contents node = Node( value_repr=f"{class_name}(...)", ) else: children = [] append = children.append node = Node( open_brace=f"{class_name}(", close_brace=")", children=children, empty=f"{class_name}()", ) for last, (key, value) in loop_last(obj._asdict().items()): child_node = _traverse(value, depth=depth + 1) child_node.key_repr = key child_node.last = last child_node.key_separator = "=" append(child_node) pop_visited(obj_id) elif _safe_isinstance(obj, _CONTAINERS): for container_type in _CONTAINERS: if _safe_isinstance(obj, container_type): obj_type = container_type break push_visited(obj_id) open_brace, close_brace, empty = _BRACES[obj_type](obj) if reached_max_depth: node = Node(value_repr=f"{open_brace}...{close_brace}") elif obj_type.__repr__ != type(obj).__repr__: node = Node(value_repr=to_repr(obj), last=root) elif obj: children = [] node = Node( open_brace=open_brace, close_brace=close_brace, children=children, last=root, ) append = children.append num_items = len(obj) last_item_index = num_items - 1 if _safe_isinstance(obj, _MAPPING_CONTAINERS): iter_items = iter(obj.items()) if max_length is not None: iter_items = islice(iter_items, max_length) for index, (key, child) in enumerate(iter_items): child_node = _traverse(child, depth=depth + 1) child_node.key_repr = to_repr(key) child_node.last = index == last_item_index append(child_node) else: iter_values = iter(obj) if max_length is not None: iter_values = islice(iter_values, max_length) for index, child in enumerate(iter_values): child_node = _traverse(child, depth=depth + 1) child_node.last = index == last_item_index append(child_node) if max_length is not None and num_items > max_length: append(Node(value_repr=f"... +{num_items - max_length}", last=True)) else: node = Node(empty=empty, children=[], last=root) pop_visited(obj_id) else: node = Node(value_repr=to_repr(obj), last=root) node.is_tuple = type(obj) == tuple node.is_namedtuple = _is_namedtuple(obj) return node node = _traverse(_object, root=True) return node def pretty_repr( _object: Any, , max_width: int = 80, indent_size: int = 4, max_length: Optional[int] = None, max_string: Optional[int] = None, max_depth: Optional[int] = None, expand_all: bool = False, ) -> str: """Prettify repr string by expanding on to new lines to fit within a given width. Args: _object (Any): Object to repr. max_width (int, optional): Desired maximum width of repr string. Defaults to 80. indent_size (int, optional): Number of spaces to indent. Defaults to 4. max_length (int, optional): Maximum length of containers before abbreviating, or None for no abbreviation. Defaults to None. max_string (int, optional): Maximum length of string before truncating, or None to disable truncating. Defaults to None. max_depth (int, optional): Maximum depth of nested data structure, or None for no depth. Defaults to None. expand_all (bool, optional): Expand all containers regardless of available width. Defaults to False. Returns: str: A possibly multi-line representation of the object. """ if _safe_isinstance(_object, Node): node = _object else: node = traverse( _object, max_length=max_length, max_string=max_string, max_depth=max_depth ) repr_str: str = node.render( max_width=max_width, indent_size=indent_size, expand_all=expand_all ) return repr_str def pprint( _object: Any, , console: Optional["Console"] = None, indent_guides: bool = True, max_length: Optional[int] = None, max_string: Optional[int] = None, max_depth: Optional[int] = None, expand_all: bool = False, ) -> None: """A convenience function for pretty printing. Args: _object (Any): Object to pretty print. console (Console, optional): Console instance, or None to use default. Defaults to None. max_length (int, optional): Maximum length of containers before abbreviating, or None for no abbreviation. Defaults to None. max_string (int, optional): Maximum length of strings before truncating, or None to disable. Defaults to None. max_depth (int, optional): Maximum depth for nested data structures, or None for unlimited depth. Defaults to None. indent_guides (bool, optional): Enable indentation guides. Defaults to True. expand_all (bool, optional): Expand all containers. Defaults to False. """ _console = get_console() if console is None else console _console.print( Pretty( _object, max_length=max_length, max_string=max_string, max_depth=max_depth, indent_guides=indent_guides, expand_all=expand_all, overflow="ignore", ), soft_wrap=True, ) if __name__ == "__main__": # pragma: no cover class BrokenRepr: def __repr__(self) -> str: 1 / 0 return "this will fail" from typing import NamedTuple class StockKeepingUnit(NamedTuple): name: str description: str price: float category: str reviews: List[str] d = defaultdict(int) d["foo"] = 5 data = { "foo": [ 1, "Hello World!", 100.123, 323.232, 432324.0, {5, 6, 7, (1, 2, 3, 4), 8}, ], "bar": frozenset({1, 2, 3}), "defaultdict": defaultdict( list, {"crumble": ["apple", "rhubarb", "butter", "sugar", "flour"]} ), "counter": Counter( [ "apple", "orange", "pear", "kumquat", "kumquat", "durian" * 100, ] ), "atomic": (False, True, None), "namedtuple": StockKeepingUnit( "Sparkling British Spring Water", "Carbonated spring water", 0.9, "water", ["its amazing!", "its terrible!"], ), "Broken": BrokenRepr(), } data["foo"].append(data) # type: ignore[attr-defined] from pip._vendor.rich import print print(Pretty(data, indent_guides=True, max_string=20)) class Thing: def __repr__(self) -> str: return "Hello\x1b[38;5;239m World!" print(Pretty(Thing()))	35.54 KB	2026-01-20 12:58
📄 progress.py from __future__ import annotations import io import typing import warnings from abc import ABC, abstractmethod from collections import deque from dataclasses import dataclass, field from datetime import timedelta from io import RawIOBase, UnsupportedOperation from math import ceil from mmap import mmap from operator import length_hint from os import PathLike, stat from threading import Event, RLock, Thread from types import TracebackType from typing import ( TYPE_CHECKING, Any, BinaryIO, Callable, ContextManager, Deque, Dict, Generic, Iterable, List, Literal, NamedTuple, NewType, Optional, TextIO, Tuple, Type, TypeVar, Union, ) if TYPE_CHECKING: # Can be replaced with `from typing import Self` in Python 3.11+ from typing_extensions import Self # pragma: no cover from . import filesize, get_console from .console import Console, Group, JustifyMethod, RenderableType from .highlighter import Highlighter from .jupyter import JupyterMixin from .live import Live from .progress_bar import ProgressBar from .spinner import Spinner from .style import StyleType from .table import Column, Table from .text import Text, TextType TaskID = NewType("TaskID", int) ProgressType = TypeVar("ProgressType") GetTimeCallable = Callable[[], float] _I = typing.TypeVar("_I", TextIO, BinaryIO) class _TrackThread(Thread): """A thread to periodically update progress.""" def __init__(self, progress: "Progress", task_id: "TaskID", update_period: float): self.progress = progress self.task_id = task_id self.update_period = update_period self.done = Event() self.completed = 0 super().__init__(daemon=True) def run(self) -> None: task_id = self.task_id advance = self.progress.advance update_period = self.update_period last_completed = 0 wait = self.done.wait while not wait(update_period) and self.progress.live.is_started: completed = self.completed if last_completed != completed: advance(task_id, completed - last_completed) last_completed = completed self.progress.update(self.task_id, completed=self.completed, refresh=True) def __enter__(self) -> "_TrackThread": self.start() return self def __exit__( self, exc_type: Optional[Type[BaseException]], exc_val: Optional[BaseException], exc_tb: Optional[TracebackType], ) -> None: self.done.set() self.join() def track( sequence: Iterable[ProgressType], description: str = "Working...", total: Optional[float] = None, completed: int = 0, auto_refresh: bool = True, console: Optional[Console] = None, transient: bool = False, get_time: Optional[Callable[[], float]] = None, refresh_per_second: float = 10, style: StyleType = "bar.back", complete_style: StyleType = "bar.complete", finished_style: StyleType = "bar.finished", pulse_style: StyleType = "bar.pulse", update_period: float = 0.1, disable: bool = False, show_speed: bool = True, ) -> Iterable[ProgressType]: """Track progress by iterating over a sequence. You can also track progress of an iterable, which might require that you additionally specify ``total``. Args: sequence (Iterable[ProgressType]): Values you wish to iterate over and track progress. description (str, optional): Description of task show next to progress bar. Defaults to "Working". total: (float, optional): Total number of steps. Default is len(sequence). completed (int, optional): Number of steps completed so far. Defaults to 0. auto_refresh (bool, optional): Automatic refresh, disable to force a refresh after each iteration. Default is True. transient: (bool, optional): Clear the progress on exit. Defaults to False. console (Console, optional): Console to write to. Default creates internal Console instance. refresh_per_second (float): Number of times per second to refresh the progress information. Defaults to 10. style (StyleType, optional): Style for the bar background. Defaults to "bar.back". complete_style (StyleType, optional): Style for the completed bar. Defaults to "bar.complete". finished_style (StyleType, optional): Style for a finished bar. Defaults to "bar.finished". pulse_style (StyleType, optional): Style for pulsing bars. Defaults to "bar.pulse". update_period (float, optional): Minimum time (in seconds) between calls to update(). Defaults to 0.1. disable (bool, optional): Disable display of progress. show_speed (bool, optional): Show speed if total isn't known. Defaults to True. Returns: Iterable[ProgressType]: An iterable of the values in the sequence. """ columns: List["ProgressColumn"] = ( [TextColumn("[progress.description]{task.description}")] if description else [] ) columns.extend( ( BarColumn( style=style, complete_style=complete_style, finished_style=finished_style, pulse_style=pulse_style, ), TaskProgressColumn(show_speed=show_speed), TimeRemainingColumn(elapsed_when_finished=True), ) ) progress = Progress( columns, auto_refresh=auto_refresh, console=console, transient=transient, get_time=get_time, refresh_per_second=refresh_per_second or 10, disable=disable, ) with progress: yield from progress.track( sequence, total=total, completed=completed, description=description, update_period=update_period, ) class _Reader(RawIOBase, BinaryIO): """A reader that tracks progress while it's being read from.""" def __init__( self, handle: BinaryIO, progress: "Progress", task: TaskID, close_handle: bool = True, ) -> None: self.handle = handle self.progress = progress self.task = task self.close_handle = close_handle self._closed = False def __enter__(self) -> "_Reader": self.handle.__enter__() return self def __exit__( self, exc_type: Optional[Type[BaseException]], exc_val: Optional[BaseException], exc_tb: Optional[TracebackType], ) -> None: self.close() def __iter__(self) -> BinaryIO: return self def __next__(self) -> bytes: line = next(self.handle) self.progress.advance(self.task, advance=len(line)) return line @property def closed(self) -> bool: return self._closed def fileno(self) -> int: return self.handle.fileno() def isatty(self) -> bool: return self.handle.isatty() @property def mode(self) -> str: return self.handle.mode @property def name(self) -> str: return self.handle.name def readable(self) -> bool: return self.handle.readable() def seekable(self) -> bool: return self.handle.seekable() def writable(self) -> bool: return False def read(self, size: int = -1) -> bytes: block = self.handle.read(size) self.progress.advance(self.task, advance=len(block)) return block def readinto(self, b: Union[bytearray, memoryview, mmap]): # type: ignore[no-untyped-def, override] n = self.handle.readinto(b) # type: ignore[attr-defined] self.progress.advance(self.task, advance=n) return n def readline(self, size: int = -1) -> bytes: # type: ignore[override] line = self.handle.readline(size) self.progress.advance(self.task, advance=len(line)) return line def readlines(self, hint: int = -1) -> List[bytes]: lines = self.handle.readlines(hint) self.progress.advance(self.task, advance=sum(map(len, lines))) return lines def close(self) -> None: if self.close_handle: self.handle.close() self._closed = True def seek(self, offset: int, whence: int = 0) -> int: pos = self.handle.seek(offset, whence) self.progress.update(self.task, completed=pos) return pos def tell(self) -> int: return self.handle.tell() def write(self, s: Any) -> int: raise UnsupportedOperation("write") def writelines(self, lines: Iterable[Any]) -> None: raise UnsupportedOperation("writelines") class _ReadContext(ContextManager[_I], Generic[_I]): """A utility class to handle a context for both a reader and a progress.""" def __init__(self, progress: "Progress", reader: _I) -> None: self.progress = progress self.reader: _I = reader def __enter__(self) -> _I: self.progress.start() return self.reader.__enter__() def __exit__( self, exc_type: Optional[Type[BaseException]], exc_val: Optional[BaseException], exc_tb: Optional[TracebackType], ) -> None: self.progress.stop() self.reader.__exit__(exc_type, exc_val, exc_tb) def wrap_file( file: BinaryIO, total: int, , description: str = "Reading...", auto_refresh: bool = True, console: Optional[Console] = None, transient: bool = False, get_time: Optional[Callable[[], float]] = None, refresh_per_second: float = 10, style: StyleType = "bar.back", complete_style: StyleType = "bar.complete", finished_style: StyleType = "bar.finished", pulse_style: StyleType = "bar.pulse", disable: bool = False, ) -> ContextManager[BinaryIO]: """Read bytes from a file while tracking progress. Args: file (Union[str, PathLike[str], BinaryIO]): The path to the file to read, or a file-like object in binary mode. total (int): Total number of bytes to read. description (str, optional): Description of task show next to progress bar. Defaults to "Reading". auto_refresh (bool, optional): Automatic refresh, disable to force a refresh after each iteration. Default is True. transient: (bool, optional): Clear the progress on exit. Defaults to False. console (Console, optional): Console to write to. Default creates internal Console instance. refresh_per_second (float): Number of times per second to refresh the progress information. Defaults to 10. style (StyleType, optional): Style for the bar background. Defaults to "bar.back". complete_style (StyleType, optional): Style for the completed bar. Defaults to "bar.complete". finished_style (StyleType, optional): Style for a finished bar. Defaults to "bar.finished". pulse_style (StyleType, optional): Style for pulsing bars. Defaults to "bar.pulse". disable (bool, optional): Disable display of progress. Returns: ContextManager[BinaryIO]: A context manager yielding a progress reader. """ columns: List["ProgressColumn"] = ( [TextColumn("[progress.description]{task.description}")] if description else [] ) columns.extend( ( BarColumn( style=style, complete_style=complete_style, finished_style=finished_style, pulse_style=pulse_style, ), DownloadColumn(), TimeRemainingColumn(), ) ) progress = Progress( columns, auto_refresh=auto_refresh, console=console, transient=transient, get_time=get_time, refresh_per_second=refresh_per_second or 10, disable=disable, ) reader = progress.wrap_file(file, total=total, description=description) return _ReadContext(progress, reader) @typing.overload def open( file: Union[str, "PathLike[str]", bytes], mode: Union[Literal["rt"], Literal["r"]], buffering: int = -1, encoding: Optional[str] = None, errors: Optional[str] = None, newline: Optional[str] = None, , total: Optional[int] = None, description: str = "Reading...", auto_refresh: bool = True, console: Optional[Console] = None, transient: bool = False, get_time: Optional[Callable[[], float]] = None, refresh_per_second: float = 10, style: StyleType = "bar.back", complete_style: StyleType = "bar.complete", finished_style: StyleType = "bar.finished", pulse_style: StyleType = "bar.pulse", disable: bool = False, ) -> ContextManager[TextIO]: pass @typing.overload def open( file: Union[str, "PathLike[str]", bytes], mode: Literal["rb"], buffering: int = -1, encoding: Optional[str] = None, errors: Optional[str] = None, newline: Optional[str] = None, , total: Optional[int] = None, description: str = "Reading...", auto_refresh: bool = True, console: Optional[Console] = None, transient: bool = False, get_time: Optional[Callable[[], float]] = None, refresh_per_second: float = 10, style: StyleType = "bar.back", complete_style: StyleType = "bar.complete", finished_style: StyleType = "bar.finished", pulse_style: StyleType = "bar.pulse", disable: bool = False, ) -> ContextManager[BinaryIO]: pass def open( file: Union[str, "PathLike[str]", bytes], mode: Union[Literal["rb"], Literal["rt"], Literal["r"]] = "r", buffering: int = -1, encoding: Optional[str] = None, errors: Optional[str] = None, newline: Optional[str] = None, , total: Optional[int] = None, description: str = "Reading...", auto_refresh: bool = True, console: Optional[Console] = None, transient: bool = False, get_time: Optional[Callable[[], float]] = None, refresh_per_second: float = 10, style: StyleType = "bar.back", complete_style: StyleType = "bar.complete", finished_style: StyleType = "bar.finished", pulse_style: StyleType = "bar.pulse", disable: bool = False, ) -> Union[ContextManager[BinaryIO], ContextManager[TextIO]]: """Read bytes from a file while tracking progress. Args: path (Union[str, PathLike[str], BinaryIO]): The path to the file to read, or a file-like object in binary mode. mode (str): The mode to use to open the file. Only supports "r", "rb" or "rt". buffering (int): The buffering strategy to use, see :func:`io.open`. encoding (str, optional): The encoding to use when reading in text mode, see :func:`io.open`. errors (str, optional): The error handling strategy for decoding errors, see :func:`io.open`. newline (str, optional): The strategy for handling newlines in text mode, see :func:`io.open` total: (int, optional): Total number of bytes to read. Must be provided if reading from a file handle. Default for a path is os.stat(file).st_size. description (str, optional): Description of task show next to progress bar. Defaults to "Reading". auto_refresh (bool, optional): Automatic refresh, disable to force a refresh after each iteration. Default is True. transient: (bool, optional): Clear the progress on exit. Defaults to False. console (Console, optional): Console to write to. Default creates internal Console instance. refresh_per_second (float): Number of times per second to refresh the progress information. Defaults to 10. style (StyleType, optional): Style for the bar background. Defaults to "bar.back". complete_style (StyleType, optional): Style for the completed bar. Defaults to "bar.complete". finished_style (StyleType, optional): Style for a finished bar. Defaults to "bar.finished". pulse_style (StyleType, optional): Style for pulsing bars. Defaults to "bar.pulse". disable (bool, optional): Disable display of progress. encoding (str, optional): The encoding to use when reading in text mode. Returns: ContextManager[BinaryIO]: A context manager yielding a progress reader. """ columns: List["ProgressColumn"] = ( [TextColumn("[progress.description]{task.description}")] if description else [] ) columns.extend( ( BarColumn( style=style, complete_style=complete_style, finished_style=finished_style, pulse_style=pulse_style, ), DownloadColumn(), TimeRemainingColumn(), ) ) progress = Progress( columns, auto_refresh=auto_refresh, console=console, transient=transient, get_time=get_time, refresh_per_second=refresh_per_second or 10, disable=disable, ) reader = progress.open( file, mode=mode, buffering=buffering, encoding=encoding, errors=errors, newline=newline, total=total, description=description, ) return _ReadContext(progress, reader) # type: ignore[return-value, type-var] class ProgressColumn(ABC): """Base class for a widget to use in progress display.""" max_refresh: Optional[float] = None def __init__(self, table_column: Optional[Column] = None) -> None: self._table_column = table_column self._renderable_cache: Dict[TaskID, Tuple[float, RenderableType]] = {} self._update_time: Optional[float] = None def get_table_column(self) -> Column: """Get a table column, used to build tasks table.""" return self._table_column or Column() def __call__(self, task: "Task") -> RenderableType: """Called by the Progress object to return a renderable for the given task. Args: task (Task): An object containing information regarding the task. Returns: RenderableType: Anything renderable (including str). """ current_time = task.get_time() if self.max_refresh is not None and not task.completed: try: timestamp, renderable = self._renderable_cache[task.id] except KeyError: pass else: if timestamp + self.max_refresh > current_time: return renderable renderable = self.render(task) self._renderable_cache[task.id] = (current_time, renderable) return renderable @abstractmethod def render(self, task: "Task") -> RenderableType: """Should return a renderable object.""" class RenderableColumn(ProgressColumn): """A column to insert an arbitrary column. Args: renderable (RenderableType, optional): Any renderable. Defaults to empty string. """ def __init__( self, renderable: RenderableType = "", , table_column: Optional[Column] = None ): self.renderable = renderable super().__init__(table_column=table_column) def render(self, task: "Task") -> RenderableType: return self.renderable class SpinnerColumn(ProgressColumn): """A column with a 'spinner' animation. Args: spinner_name (str, optional): Name of spinner animation. Defaults to "dots". style (StyleType, optional): Style of spinner. Defaults to "progress.spinner". speed (float, optional): Speed factor of spinner. Defaults to 1.0. finished_text (TextType, optional): Text used when task is finished. Defaults to " ". """ def __init__( self, spinner_name: str = "dots", style: Optional[StyleType] = "progress.spinner", speed: float = 1.0, finished_text: TextType = " ", table_column: Optional[Column] = None, ): self.spinner = Spinner(spinner_name, style=style, speed=speed) self.finished_text = ( Text.from_markup(finished_text) if isinstance(finished_text, str) else finished_text ) super().__init__(table_column=table_column) def set_spinner( self, spinner_name: str, spinner_style: Optional[StyleType] = "progress.spinner", speed: float = 1.0, ) -> None: """Set a new spinner. Args: spinner_name (str): Spinner name, see python -m rich.spinner. spinner_style (Optional[StyleType], optional): Spinner style. Defaults to "progress.spinner". speed (float, optional): Speed factor of spinner. Defaults to 1.0. """ self.spinner = Spinner(spinner_name, style=spinner_style, speed=speed) def render(self, task: "Task") -> RenderableType: text = ( self.finished_text if task.finished else self.spinner.render(task.get_time()) ) return text class TextColumn(ProgressColumn): """A column containing text.""" def __init__( self, text_format: str, style: StyleType = "none", justify: JustifyMethod = "left", markup: bool = True, highlighter: Optional[Highlighter] = None, table_column: Optional[Column] = None, ) -> None: self.text_format = text_format self.justify: JustifyMethod = justify self.style = style self.markup = markup self.highlighter = highlighter super().__init__(table_column=table_column or Column(no_wrap=True)) def render(self, task: "Task") -> Text: _text = self.text_format.format(task=task) if self.markup: text = Text.from_markup(_text, style=self.style, justify=self.justify) else: text = Text(_text, style=self.style, justify=self.justify) if self.highlighter: self.highlighter.highlight(text) return text class BarColumn(ProgressColumn): """Renders a visual progress bar. Args: bar_width (Optional[int], optional): Width of bar or None for full width. Defaults to 40. style (StyleType, optional): Style for the bar background. Defaults to "bar.back". complete_style (StyleType, optional): Style for the completed bar. Defaults to "bar.complete". finished_style (StyleType, optional): Style for a finished bar. Defaults to "bar.finished". pulse_style (StyleType, optional): Style for pulsing bars. Defaults to "bar.pulse". """ def __init__( self, bar_width: Optional[int] = 40, style: StyleType = "bar.back", complete_style: StyleType = "bar.complete", finished_style: StyleType = "bar.finished", pulse_style: StyleType = "bar.pulse", table_column: Optional[Column] = None, ) -> None: self.bar_width = bar_width self.style = style self.complete_style = complete_style self.finished_style = finished_style self.pulse_style = pulse_style super().__init__(table_column=table_column) def render(self, task: "Task") -> ProgressBar: """Gets a progress bar widget for a task.""" return ProgressBar( total=max(0, task.total) if task.total is not None else None, completed=max(0, task.completed), width=None if self.bar_width is None else max(1, self.bar_width), pulse=not task.started, animation_time=task.get_time(), style=self.style, complete_style=self.complete_style, finished_style=self.finished_style, pulse_style=self.pulse_style, ) class TimeElapsedColumn(ProgressColumn): """Renders time elapsed.""" def render(self, task: "Task") -> Text: """Show time elapsed.""" elapsed = task.finished_time if task.finished else task.elapsed if elapsed is None: return Text("-:--:--", style="progress.elapsed") delta = timedelta(seconds=max(0, int(elapsed))) return Text(str(delta), style="progress.elapsed") class TaskProgressColumn(TextColumn): """Show task progress as a percentage. Args: text_format (str, optional): Format for percentage display. Defaults to "[progress.percentage]{task.percentage:>3.0f}%". text_format_no_percentage (str, optional): Format if percentage is unknown. Defaults to "". style (StyleType, optional): Style of output. Defaults to "none". justify (JustifyMethod, optional): Text justification. Defaults to "left". markup (bool, optional): Enable markup. Defaults to True. highlighter (Optional[Highlighter], optional): Highlighter to apply to output. Defaults to None. table_column (Optional[Column], optional): Table Column to use. Defaults to None. show_speed (bool, optional): Show speed if total is unknown. Defaults to False. """ def __init__( self, text_format: str = "[progress.percentage]{task.percentage:>3.0f}%", text_format_no_percentage: str = "", style: StyleType = "none", justify: JustifyMethod = "left", markup: bool = True, highlighter: Optional[Highlighter] = None, table_column: Optional[Column] = None, show_speed: bool = False, ) -> None: self.text_format_no_percentage = text_format_no_percentage self.show_speed = show_speed super().__init__( text_format=text_format, style=style, justify=justify, markup=markup, highlighter=highlighter, table_column=table_column, ) @classmethod def render_speed(cls, speed: Optional[float]) -> Text: """Render the speed in iterations per second. Args: task (Task): A Task object. Returns: Text: Text object containing the task speed. """ if speed is None: return Text("", style="progress.percentage") unit, suffix = filesize.pick_unit_and_suffix( int(speed), ["", "×10³", "×10⁶", "×10⁹", "×10¹²"], 1000, ) data_speed = speed / unit return Text(f"{data_speed:.1f}{suffix} it/s", style="progress.percentage") def render(self, task: "Task") -> Text: if task.total is None and self.show_speed: return self.render_speed(task.finished_speed or task.speed) text_format = ( self.text_format_no_percentage if task.total is None else self.text_format ) _text = text_format.format(task=task) if self.markup: text = Text.from_markup(_text, style=self.style, justify=self.justify) else: text = Text(_text, style=self.style, justify=self.justify) if self.highlighter: self.highlighter.highlight(text) return text class TimeRemainingColumn(ProgressColumn): """Renders estimated time remaining. Args: compact (bool, optional): Render MM:SS when time remaining is less than an hour. Defaults to False. elapsed_when_finished (bool, optional): Render time elapsed when the task is finished. Defaults to False. """ # Only refresh twice a second to prevent jitter max_refresh = 0.5 def __init__( self, compact: bool = False, elapsed_when_finished: bool = False, table_column: Optional[Column] = None, ): self.compact = compact self.elapsed_when_finished = elapsed_when_finished super().__init__(table_column=table_column) def render(self, task: "Task") -> Text: """Show time remaining.""" if self.elapsed_when_finished and task.finished: task_time = task.finished_time style = "progress.elapsed" else: task_time = task.time_remaining style = "progress.remaining" if task.total is None: return Text("", style=style) if task_time is None: return Text("--:--" if self.compact else "-:--:--", style=style) # Based on https://github.com/tqdm/tqdm/blob/master/tqdm/std.py minutes, seconds = divmod(int(task_time), 60) hours, minutes = divmod(minutes, 60) if self.compact and not hours: formatted = f"{minutes:02d}:{seconds:02d}" else: formatted = f"{hours:d}:{minutes:02d}:{seconds:02d}" return Text(formatted, style=style) class FileSizeColumn(ProgressColumn): """Renders completed filesize.""" def render(self, task: "Task") -> Text: """Show data completed.""" data_size = filesize.decimal(int(task.completed)) return Text(data_size, style="progress.filesize") class TotalFileSizeColumn(ProgressColumn): """Renders total filesize.""" def render(self, task: "Task") -> Text: """Show data completed.""" data_size = filesize.decimal(int(task.total)) if task.total is not None else "" return Text(data_size, style="progress.filesize.total") class MofNCompleteColumn(ProgressColumn): """Renders completed count/total, e.g. ' 10/1000'. Best for bounded tasks with int quantities. Space pads the completed count so that progress length does not change as task progresses past powers of 10. Args: separator (str, optional): Text to separate completed and total values. Defaults to "/". """ def __init__(self, separator: str = "/", table_column: Optional[Column] = None): self.separator = separator super().__init__(table_column=table_column) def render(self, task: "Task") -> Text: """Show completed/total.""" completed = int(task.completed) total = int(task.total) if task.total is not None else "?" total_width = len(str(total)) return Text( f"{completed:{total_width}d}{self.separator}{total}", style="progress.download", ) class DownloadColumn(ProgressColumn): """Renders file size downloaded and total, e.g. '0.5/2.3 GB'. Args: binary_units (bool, optional): Use binary units, KiB, MiB etc. Defaults to False. """ def __init__( self, binary_units: bool = False, table_column: Optional[Column] = None ) -> None: self.binary_units = binary_units super().__init__(table_column=table_column) def render(self, task: "Task") -> Text: """Calculate common unit for completed and total.""" completed = int(task.completed) unit_and_suffix_calculation_base = ( int(task.total) if task.total is not None else completed ) if self.binary_units: unit, suffix = filesize.pick_unit_and_suffix( unit_and_suffix_calculation_base, ["bytes", "KiB", "MiB", "GiB", "TiB", "PiB", "EiB", "ZiB", "YiB"], 1024, ) else: unit, suffix = filesize.pick_unit_and_suffix( unit_and_suffix_calculation_base, ["bytes", "kB", "MB", "GB", "TB", "PB", "EB", "ZB", "YB"], 1000, ) precision = 0 if unit == 1 else 1 completed_ratio = completed / unit completed_str = f"{completed_ratio:,.{precision}f}" if task.total is not None: total = int(task.total) total_ratio = total / unit total_str = f"{total_ratio:,.{precision}f}" else: total_str = "?" download_status = f"{completed_str}/{total_str} {suffix}" download_text = Text(download_status, style="progress.download") return download_text class TransferSpeedColumn(ProgressColumn): """Renders human readable transfer speed.""" def render(self, task: "Task") -> Text: """Show data transfer speed.""" speed = task.finished_speed or task.speed if speed is None: return Text("?", style="progress.data.speed") data_speed = filesize.decimal(int(speed)) return Text(f"{data_speed}/s", style="progress.data.speed") class ProgressSample(NamedTuple): """Sample of progress for a given time.""" timestamp: float """Timestamp of sample.""" completed: float """Number of steps completed.""" @dataclass class Task: """Information regarding a progress task. This object should be considered read-only outside of the :class:`~Progress` class. """ id: TaskID """Task ID associated with this task (used in Progress methods).""" description: str """str: Description of the task.""" total: Optional[float] """Optional[float]: Total number of steps in this task.""" completed: float """float: Number of steps completed""" _get_time: GetTimeCallable """Callable to get the current time.""" finished_time: Optional[float] = None """float: Time task was finished.""" visible: bool = True """bool: Indicates if this task is visible in the progress display.""" fields: Dict[str, Any] = field(default_factory=dict) """dict: Arbitrary fields passed in via Progress.update.""" start_time: Optional[float] = field(default=None, init=False, repr=False) """Optional[float]: Time this task was started, or None if not started.""" stop_time: Optional[float] = field(default=None, init=False, repr=False) """Optional[float]: Time this task was stopped, or None if not stopped.""" finished_speed: Optional[float] = None """Optional[float]: The last speed for a finished task.""" _progress: Deque[ProgressSample] = field( default_factory=lambda: deque(maxlen=1000), init=False, repr=False ) _lock: RLock = field(repr=False, default_factory=RLock) """Thread lock.""" def get_time(self) -> float: """float: Get the current time, in seconds.""" return self._get_time() @property def started(self) -> bool: """bool: Check if the task as started.""" return self.start_time is not None @property def remaining(self) -> Optional[float]: """Optional[float]: Get the number of steps remaining, if a non-None total was set.""" if self.total is None: return None return self.total - self.completed @property def elapsed(self) -> Optional[float]: """Optional[float]: Time elapsed since task was started, or ``None`` if the task hasn't started.""" if self.start_time is None: return None if self.stop_time is not None: return self.stop_time - self.start_time return self.get_time() - self.start_time @property def finished(self) -> bool: """Check if the task has finished.""" return self.finished_time is not None @property def percentage(self) -> float: """float: Get progress of task as a percentage. If a None total was set, returns 0""" if not self.total: return 0.0 completed = (self.completed / self.total) * 100.0 completed = min(100.0, max(0.0, completed)) return completed @property def speed(self) -> Optional[float]: """Optional[float]: Get the estimated speed in steps per second.""" if self.start_time is None: return None with self._lock: progress = self._progress if not progress: return None total_time = progress[-1].timestamp - progress[0].timestamp if total_time == 0: return None iter_progress = iter(progress) next(iter_progress) total_completed = sum(sample.completed for sample in iter_progress) speed = total_completed / total_time return speed @property def time_remaining(self) -> Optional[float]: """Optional[float]: Get estimated time to completion, or ``None`` if no data.""" if self.finished: return 0.0 speed = self.speed if not speed: return None remaining = self.remaining if remaining is None: return None estimate = ceil(remaining / speed) return estimate def _reset(self) -> None: """Reset progress.""" self._progress.clear() self.finished_time = None self.finished_speed = None class Progress(JupyterMixin): """Renders an auto-updating progress bar(s). Args: console (Console, optional): Optional Console instance. Defaults to an internal Console instance writing to stdout. auto_refresh (bool, optional): Enable auto refresh. If disabled, you will need to call `refresh()`. refresh_per_second (Optional[float], optional): Number of times per second to refresh the progress information or None to use default (10). Defaults to None. speed_estimate_period: (float, optional): Period (in seconds) used to calculate the speed estimate. Defaults to 30. transient: (bool, optional): Clear the progress on exit. Defaults to False. redirect_stdout: (bool, optional): Enable redirection of stdout, so ``print`` may be used. Defaults to True. redirect_stderr: (bool, optional): Enable redirection of stderr. Defaults to True. get_time: (Callable, optional): A callable that gets the current time, or None to use Console.get_time. Defaults to None. disable (bool, optional): Disable progress display. Defaults to False expand (bool, optional): Expand tasks table to fit width. Defaults to False. """ def __init__( self, columns: Union[str, ProgressColumn], console: Optional[Console] = None, auto_refresh: bool = True, refresh_per_second: float = 10, speed_estimate_period: float = 30.0, transient: bool = False, redirect_stdout: bool = True, redirect_stderr: bool = True, get_time: Optional[GetTimeCallable] = None, disable: bool = False, expand: bool = False, ) -> None: assert refresh_per_second > 0, "refresh_per_second must be > 0" self._lock = RLock() self.columns = columns or self.get_default_columns() self.speed_estimate_period = speed_estimate_period self.disable = disable self.expand = expand self._tasks: Dict[TaskID, Task] = {} self._task_index: TaskID = TaskID(0) self.live = Live( console=console or get_console(), auto_refresh=auto_refresh, refresh_per_second=refresh_per_second, transient=transient, redirect_stdout=redirect_stdout, redirect_stderr=redirect_stderr, get_renderable=self.get_renderable, ) self.get_time = get_time or self.console.get_time self.print = self.console.print self.log = self.console.log @classmethod def get_default_columns(cls) -> Tuple[ProgressColumn, ...]: """Get the default columns used for a new Progress instance: - a text column for the description (TextColumn) - the bar itself (BarColumn) - a text column showing completion percentage (TextColumn) - an estimated-time-remaining column (TimeRemainingColumn) If the Progress instance is created without passing a columns argument, the default columns defined here will be used. You can also create a Progress instance using custom columns before and/or after the defaults, as in this example: progress = Progress( SpinnerColumn(), Progress.get_default_columns(), "Elapsed:", TimeElapsedColumn(), ) This code shows the creation of a Progress display, containing a spinner to the left, the default columns, and a labeled elapsed time column. """ return ( TextColumn("[progress.description]{task.description}"), BarColumn(), TaskProgressColumn(), TimeRemainingColumn(), ) @property def console(self) -> Console: return self.live.console @property def tasks(self) -> List[Task]: """Get a list of Task instances.""" with self._lock: return list(self._tasks.values()) @property def task_ids(self) -> List[TaskID]: """A list of task IDs.""" with self._lock: return list(self._tasks.keys()) @property def finished(self) -> bool: """Check if all tasks have been completed.""" with self._lock: if not self._tasks: return True return all(task.finished for task in self._tasks.values()) def start(self) -> None: """Start the progress display.""" if not self.disable: self.live.start(refresh=True) def stop(self) -> None: """Stop the progress display.""" self.live.stop() if not self.console.is_interactive and not self.console.is_jupyter: self.console.print() def __enter__(self) -> Self: self.start() return self def __exit__( self, exc_type: Optional[Type[BaseException]], exc_val: Optional[BaseException], exc_tb: Optional[TracebackType], ) -> None: self.stop() def track( self, sequence: Iterable[ProgressType], total: Optional[float] = None, completed: int = 0, task_id: Optional[TaskID] = None, description: str = "Working...", update_period: float = 0.1, ) -> Iterable[ProgressType]: """Track progress by iterating over a sequence. You can also track progress of an iterable, which might require that you additionally specify ``total``. Args: sequence (Iterable[ProgressType]): Values you want to iterate over and track progress. total: (float, optional): Total number of steps. Default is len(sequence). completed (int, optional): Number of steps completed so far. Defaults to 0. task_id: (TaskID): Task to track. Default is new task. description: (str, optional): Description of task, if new task is created. update_period (float, optional): Minimum time (in seconds) between calls to update(). Defaults to 0.1. Returns: Iterable[ProgressType]: An iterable of values taken from the provided sequence. """ if total is None: total = float(length_hint(sequence)) or None if task_id is None: task_id = self.add_task(description, total=total, completed=completed) else: self.update(task_id, total=total, completed=completed) if self.live.auto_refresh: with _TrackThread(self, task_id, update_period) as track_thread: for value in sequence: yield value track_thread.completed += 1 else: advance = self.advance refresh = self.refresh for value in sequence: yield value advance(task_id, 1) refresh() def wrap_file( self, file: BinaryIO, total: Optional[int] = None, , task_id: Optional[TaskID] = None, description: str = "Reading...", ) -> BinaryIO: """Track progress file reading from a binary file. Args: file (BinaryIO): A file-like object opened in binary mode. total (int, optional): Total number of bytes to read. This must be provided unless a task with a total is also given. task_id (TaskID): Task to track. Default is new task. description (str, optional): Description of task, if new task is created. Returns: BinaryIO: A readable file-like object in binary mode. Raises: ValueError: When no total value can be extracted from the arguments or the task. """ # attempt to recover the total from the task total_bytes: Optional[float] = None if total is not None: total_bytes = total elif task_id is not None: with self._lock: total_bytes = self._tasks[task_id].total if total_bytes is None: raise ValueError( f"unable to get the total number of bytes, please specify 'total'" ) # update total of task or create new task if task_id is None: task_id = self.add_task(description, total=total_bytes) else: self.update(task_id, total=total_bytes) return _Reader(file, self, task_id, close_handle=False) @typing.overload def open( self, file: Union[str, "PathLike[str]", bytes], mode: Literal["rb"], buffering: int = -1, encoding: Optional[str] = None, errors: Optional[str] = None, newline: Optional[str] = None, , total: Optional[int] = None, task_id: Optional[TaskID] = None, description: str = "Reading...", ) -> BinaryIO: pass @typing.overload def open( self, file: Union[str, "PathLike[str]", bytes], mode: Union[Literal["r"], Literal["rt"]], buffering: int = -1, encoding: Optional[str] = None, errors: Optional[str] = None, newline: Optional[str] = None, , total: Optional[int] = None, task_id: Optional[TaskID] = None, description: str = "Reading...", ) -> TextIO: pass def open( self, file: Union[str, "PathLike[str]", bytes], mode: Union[Literal["rb"], Literal["rt"], Literal["r"]] = "r", buffering: int = -1, encoding: Optional[str] = None, errors: Optional[str] = None, newline: Optional[str] = None, , total: Optional[int] = None, task_id: Optional[TaskID] = None, description: str = "Reading...", ) -> Union[BinaryIO, TextIO]: """Track progress while reading from a binary file. Args: path (Union[str, PathLike[str]]): The path to the file to read. mode (str): The mode to use to open the file. Only supports "r", "rb" or "rt". buffering (int): The buffering strategy to use, see :func:`io.open`. encoding (str, optional): The encoding to use when reading in text mode, see :func:`io.open`. errors (str, optional): The error handling strategy for decoding errors, see :func:`io.open`. newline (str, optional): The strategy for handling newlines in text mode, see :func:`io.open`. total (int, optional): Total number of bytes to read. If none given, os.stat(path).st_size is used. task_id (TaskID): Task to track. Default is new task. description (str, optional): Description of task, if new task is created. Returns: BinaryIO: A readable file-like object in binary mode. Raises: ValueError: When an invalid mode is given. """ # normalize the mode (always rb, rt) _mode = "".join(sorted(mode, reverse=False)) if _mode not in ("br", "rt", "r"): raise ValueError(f"invalid mode {mode!r}") # patch buffering to provide the same behaviour as the builtin `open` line_buffering = buffering == 1 if _mode == "br" and buffering == 1: warnings.warn( "line buffering (buffering=1) isn't supported in binary mode, the default buffer size will be used", RuntimeWarning, ) buffering = -1 elif _mode in ("rt", "r"): if buffering == 0: raise ValueError("can't have unbuffered text I/O") elif buffering == 1: buffering = -1 # attempt to get the total with `os.stat` if total is None: total = stat(file).st_size # update total of task or create new task if task_id is None: task_id = self.add_task(description, total=total) else: self.update(task_id, total=total) # open the file in binary mode, handle = io.open(file, "rb", buffering=buffering) reader = _Reader(handle, self, task_id, close_handle=True) # wrap the reader in a `TextIOWrapper` if text mode if mode in ("r", "rt"): return io.TextIOWrapper( reader, encoding=encoding, errors=errors, newline=newline, line_buffering=line_buffering, ) return reader def start_task(self, task_id: TaskID) -> None: """Start a task. Starts a task (used when calculating elapsed time). You may need to call this manually, if you called ``add_task`` with ``start=False``. Args: task_id (TaskID): ID of task. """ with self._lock: task = self._tasks[task_id] if task.start_time is None: task.start_time = self.get_time() def stop_task(self, task_id: TaskID) -> None: """Stop a task. This will freeze the elapsed time on the task. Args: task_id (TaskID): ID of task. """ with self._lock: task = self._tasks[task_id] current_time = self.get_time() if task.start_time is None: task.start_time = current_time task.stop_time = current_time def update( self, task_id: TaskID, , total: Optional[float] = None, completed: Optional[float] = None, advance: Optional[float] = None, description: Optional[str] = None, visible: Optional[bool] = None, refresh: bool = False, fields: Any, ) -> None: """Update information associated with a task. Args: task_id (TaskID): Task id (returned by add_task). total (float, optional): Updates task.total if not None. completed (float, optional): Updates task.completed if not None. advance (float, optional): Add a value to task.completed if not None. description (str, optional): Change task description if not None. visible (bool, optional): Set visible flag if not None. refresh (bool): Force a refresh of progress information. Default is False. fields (Any): Additional data fields required for rendering. """ with self._lock: task = self._tasks[task_id] completed_start = task.completed if total is not None and total != task.total: task.total = total task._reset() if advance is not None: task.completed += advance if completed is not None: task.completed = completed if description is not None: task.description = description if visible is not None: task.visible = visible task.fields.update(fields) update_completed = task.completed - completed_start current_time = self.get_time() old_sample_time = current_time - self.speed_estimate_period _progress = task._progress popleft = _progress.popleft while _progress and _progress[0].timestamp < old_sample_time: popleft() if update_completed > 0: _progress.append(ProgressSample(current_time, update_completed)) if ( task.total is not None and task.completed >= task.total and task.finished_time is None ): task.finished_time = task.elapsed if refresh: self.refresh() def reset( self, task_id: TaskID, , start: bool = True, total: Optional[float] = None, completed: int = 0, visible: Optional[bool] = None, description: Optional[str] = None, fields: Any, ) -> None: """Reset a task so completed is 0 and the clock is reset. Args: task_id (TaskID): ID of task. start (bool, optional): Start the task after reset. Defaults to True. total (float, optional): New total steps in task, or None to use current total. Defaults to None. completed (int, optional): Number of steps completed. Defaults to 0. visible (bool, optional): Enable display of the task. Defaults to True. description (str, optional): Change task description if not None. Defaults to None. fields (str): Additional data fields required for rendering. """ current_time = self.get_time() with self._lock: task = self._tasks[task_id] task._reset() task.start_time = current_time if start else None if total is not None: task.total = total task.completed = completed if visible is not None: task.visible = visible if fields: task.fields = fields if description is not None: task.description = description task.finished_time = None self.refresh() def advance(self, task_id: TaskID, advance: float = 1) -> None: """Advance task by a number of steps. Args: task_id (TaskID): ID of task. advance (float): Number of steps to advance. Default is 1. """ current_time = self.get_time() with self._lock: task = self._tasks[task_id] completed_start = task.completed task.completed += advance update_completed = task.completed - completed_start old_sample_time = current_time - self.speed_estimate_period _progress = task._progress popleft = _progress.popleft while _progress and _progress[0].timestamp < old_sample_time: popleft() while len(_progress) > 1000: popleft() _progress.append(ProgressSample(current_time, update_completed)) if ( task.total is not None and task.completed >= task.total and task.finished_time is None ): task.finished_time = task.elapsed task.finished_speed = task.speed def refresh(self) -> None: """Refresh (render) the progress information.""" if not self.disable and self.live.is_started: self.live.refresh() def get_renderable(self) -> RenderableType: """Get a renderable for the progress display.""" renderable = Group(self.get_renderables()) return renderable def get_renderables(self) -> Iterable[RenderableType]: """Get a number of renderables for the progress display.""" table = self.make_tasks_table(self.tasks) yield table def make_tasks_table(self, tasks: Iterable[Task]) -> Table: """Get a table to render the Progress display. Args: tasks (Iterable[Task]): An iterable of Task instances, one per row of the table. Returns: Table: A table instance. """ table_columns = ( ( Column(no_wrap=True) if isinstance(_column, str) else _column.get_table_column().copy() ) for _column in self.columns ) table = Table.grid(table_columns, padding=(0, 1), expand=self.expand) for task in tasks: if task.visible: table.add_row( ( ( column.format(task=task) if isinstance(column, str) else column(task) ) for column in self.columns ) ) return table def __rich__(self) -> RenderableType: """Makes the Progress class itself renderable.""" with self._lock: return self.get_renderable() def add_task( self, description: str, start: bool = True, total: Optional[float] = 100.0, completed: int = 0, visible: bool = True, fields: Any, ) -> TaskID: """Add a new 'task' to the Progress display. Args: description (str): A description of the task. start (bool, optional): Start the task immediately (to calculate elapsed time). If set to False, you will need to call `start` manually. Defaults to True. total (float, optional): Number of total steps in the progress if known. Set to None to render a pulsing animation. Defaults to 100. completed (int, optional): Number of steps completed so far. Defaults to 0. visible (bool, optional): Enable display of the task. Defaults to True. fields (str): Additional data fields required for rendering. Returns: TaskID: An ID you can use when calling `update`. """ with self._lock: task = Task( self._task_index, description, total, completed, visible=visible, fields=fields, _get_time=self.get_time, _lock=self._lock, ) self._tasks[self._task_index] = task if start: self.start_task(self._task_index) new_task_index = self._task_index self._task_index = TaskID(int(self._task_index) + 1) self.refresh() return new_task_index def remove_task(self, task_id: TaskID) -> None: """Delete a task if it exists. Args: task_id (TaskID): A task ID. """ with self._lock: del self._tasks[task_id] if __name__ == "__main__": # pragma: no coverage import random import time from .panel import Panel from .rule import Rule from .syntax import Syntax from .table import Table syntax = Syntax( '''def loop_last(values: Iterable[T]) -> Iterable[Tuple[bool, T]]: """Iterate and generate a tuple with a flag for last value.""" iter_values = iter(values) try: previous_value = next(iter_values) except StopIteration: return for value in iter_values: yield False, previous_value previous_value = value yield True, previous_value''', "python", line_numbers=True, ) table = Table("foo", "bar", "baz") table.add_row("1", "2", "3") progress_renderables = [ "Text may be printed while the progress bars are rendering.", Panel("In fact, [i]any[/i] renderable will work"), "Such as [magenta]tables[/]...", table, "Pretty printed structures...", {"type": "example", "text": "Pretty printed"}, "Syntax...", syntax, Rule("Give it a try!"), ] from itertools import cycle examples = cycle(progress_renderables) console = Console(record=True) with Progress( SpinnerColumn(), Progress.get_default_columns(), TimeElapsedColumn(), console=console, transient=False, ) as progress: task1 = progress.add_task("[red]Downloading", total=1000) task2 = progress.add_task("[green]Processing", total=1000) task3 = progress.add_task("[yellow]Thinking", total=None) while not progress.finished: progress.update(task1, advance=0.5) progress.update(task2, advance=0.3) time.sleep(0.01) if random.randint(0, 100) < 1: progress.log(next(examples))	58.99 KB	2026-01-20 12:58
📄 progress_bar.py import math from functools import lru_cache from time import monotonic from typing import Iterable, List, Optional from .color import Color, blend_rgb from .color_triplet import ColorTriplet from .console import Console, ConsoleOptions, RenderResult from .jupyter import JupyterMixin from .measure import Measurement from .segment import Segment from .style import Style, StyleType # Number of characters before 'pulse' animation repeats PULSE_SIZE = 20 class ProgressBar(JupyterMixin): """Renders a (progress) bar. Used by rich.progress. Args: total (float, optional): Number of steps in the bar. Defaults to 100. Set to None to render a pulsing animation. completed (float, optional): Number of steps completed. Defaults to 0. width (int, optional): Width of the bar, or ``None`` for maximum width. Defaults to None. pulse (bool, optional): Enable pulse effect. Defaults to False. Will pulse if a None total was passed. style (StyleType, optional): Style for the bar background. Defaults to "bar.back". complete_style (StyleType, optional): Style for the completed bar. Defaults to "bar.complete". finished_style (StyleType, optional): Style for a finished bar. Defaults to "bar.finished". pulse_style (StyleType, optional): Style for pulsing bars. Defaults to "bar.pulse". animation_time (Optional[float], optional): Time in seconds to use for animation, or None to use system time. """ def __init__( self, total: Optional[float] = 100.0, completed: float = 0, width: Optional[int] = None, pulse: bool = False, style: StyleType = "bar.back", complete_style: StyleType = "bar.complete", finished_style: StyleType = "bar.finished", pulse_style: StyleType = "bar.pulse", animation_time: Optional[float] = None, ): self.total = total self.completed = completed self.width = width self.pulse = pulse self.style = style self.complete_style = complete_style self.finished_style = finished_style self.pulse_style = pulse_style self.animation_time = animation_time self._pulse_segments: Optional[List[Segment]] = None def __repr__(self) -> str: return f"<Bar {self.completed!r} of {self.total!r}>" @property def percentage_completed(self) -> Optional[float]: """Calculate percentage complete.""" if self.total is None: return None completed = (self.completed / self.total) * 100.0 completed = min(100, max(0.0, completed)) return completed @lru_cache(maxsize=16) def _get_pulse_segments( self, fore_style: Style, back_style: Style, color_system: str, no_color: bool, ascii: bool = False, ) -> List[Segment]: """Get a list of segments to render a pulse animation. Returns: List[Segment]: A list of segments, one segment per character. """ bar = "-" if ascii else "━" segments: List[Segment] = [] if color_system not in ("standard", "eight_bit", "truecolor") or no_color: segments += [Segment(bar, fore_style)] * (PULSE_SIZE // 2) segments += [Segment(" " if no_color else bar, back_style)] * ( PULSE_SIZE - (PULSE_SIZE // 2) ) return segments append = segments.append fore_color = ( fore_style.color.get_truecolor() if fore_style.color else ColorTriplet(255, 0, 255) ) back_color = ( back_style.color.get_truecolor() if back_style.color else ColorTriplet(0, 0, 0) ) cos = math.cos pi = math.pi _Segment = Segment _Style = Style from_triplet = Color.from_triplet for index in range(PULSE_SIZE): position = index / PULSE_SIZE fade = 0.5 + cos(position * pi * 2) / 2.0 color = blend_rgb(fore_color, back_color, cross_fade=fade) append(_Segment(bar, _Style(color=from_triplet(color)))) return segments def update(self, completed: float, total: Optional[float] = None) -> None: """Update progress with new values. Args: completed (float): Number of steps completed. total (float, optional): Total number of steps, or ``None`` to not change. Defaults to None. """ self.completed = completed self.total = total if total is not None else self.total def _render_pulse( self, console: Console, width: int, ascii: bool = False ) -> Iterable[Segment]: """Renders the pulse animation. Args: console (Console): Console instance. width (int): Width in characters of pulse animation. Returns: RenderResult: [description] Yields: Iterator[Segment]: Segments to render pulse """ fore_style = console.get_style(self.pulse_style, default="white") back_style = console.get_style(self.style, default="black") pulse_segments = self._get_pulse_segments( fore_style, back_style, console.color_system, console.no_color, ascii=ascii ) segment_count = len(pulse_segments) current_time = ( monotonic() if self.animation_time is None else self.animation_time ) segments = pulse_segments * (int(width / segment_count) + 2) offset = int(-current_time * 15) % segment_count segments = segments[offset : offset + width] yield from segments def __rich_console__( self, console: Console, options: ConsoleOptions ) -> RenderResult: width = min(self.width or options.max_width, options.max_width) ascii = options.legacy_windows or options.ascii_only should_pulse = self.pulse or self.total is None if should_pulse: yield from self._render_pulse(console, width, ascii=ascii) return completed: Optional[float] = ( min(self.total, max(0, self.completed)) if self.total is not None else None ) bar = "-" if ascii else "━" half_bar_right = " " if ascii else "╸" half_bar_left = " " if ascii else "╺" complete_halves = ( int(width * 2 * completed / self.total) if self.total and completed is not None else width * 2 ) bar_count = complete_halves // 2 half_bar_count = complete_halves % 2 style = console.get_style(self.style) is_finished = self.total is None or self.completed >= self.total complete_style = console.get_style( self.finished_style if is_finished else self.complete_style ) _Segment = Segment if bar_count: yield _Segment(bar * bar_count, complete_style) if half_bar_count: yield _Segment(half_bar_right * half_bar_count, complete_style) if not console.no_color: remaining_bars = width - bar_count - half_bar_count if remaining_bars and console.color_system is not None: if not half_bar_count and bar_count: yield _Segment(half_bar_left, style) remaining_bars -= 1 if remaining_bars: yield _Segment(bar * remaining_bars, style) def __rich_measure__( self, console: Console, options: ConsoleOptions ) -> Measurement: return ( Measurement(self.width, self.width) if self.width is not None else Measurement(4, options.max_width) ) if __name__ == "__main__": # pragma: no cover console = Console() bar = ProgressBar(width=50, total=100) import time console.show_cursor(False) for n in range(0, 101, 1): bar.update(n) console.print(bar) console.file.write("\r") time.sleep(0.05) console.show_cursor(True) console.print()	7.97 KB	2026-01-20 12:58
📄 prompt.py from typing import Any, Generic, List, Optional, TextIO, TypeVar, Union, overload from . import get_console from .console import Console from .text import Text, TextType PromptType = TypeVar("PromptType") DefaultType = TypeVar("DefaultType") class PromptError(Exception): """Exception base class for prompt related errors.""" class InvalidResponse(PromptError): """Exception to indicate a response was invalid. Raise this within process_response() to indicate an error and provide an error message. Args: message (Union[str, Text]): Error message. """ def __init__(self, message: TextType) -> None: self.message = message def __rich__(self) -> TextType: return self.message class PromptBase(Generic[PromptType]): """Ask the user for input until a valid response is received. This is the base class, see one of the concrete classes for examples. Args: prompt (TextType, optional): Prompt text. Defaults to "". console (Console, optional): A Console instance or None to use global console. Defaults to None. password (bool, optional): Enable password input. Defaults to False. choices (List[str], optional): A list of valid choices. Defaults to None. case_sensitive (bool, optional): Matching of choices should be case-sensitive. Defaults to True. show_default (bool, optional): Show default in prompt. Defaults to True. show_choices (bool, optional): Show choices in prompt. Defaults to True. """ response_type: type = str validate_error_message = "[prompt.invalid]Please enter a valid value" illegal_choice_message = ( "[prompt.invalid.choice]Please select one of the available options" ) prompt_suffix = ": " choices: Optional[List[str]] = None def __init__( self, prompt: TextType = "", , console: Optional[Console] = None, password: bool = False, choices: Optional[List[str]] = None, case_sensitive: bool = True, show_default: bool = True, show_choices: bool = True, ) -> None: self.console = console or get_console() self.prompt = ( Text.from_markup(prompt, style="prompt") if isinstance(prompt, str) else prompt ) self.password = password if choices is not None: self.choices = choices self.case_sensitive = case_sensitive self.show_default = show_default self.show_choices = show_choices @classmethod @overload def ask( cls, prompt: TextType = "", , console: Optional[Console] = None, password: bool = False, choices: Optional[List[str]] = None, case_sensitive: bool = True, show_default: bool = True, show_choices: bool = True, default: DefaultType, stream: Optional[TextIO] = None, ) -> Union[DefaultType, PromptType]: ... @classmethod @overload def ask( cls, prompt: TextType = "", , console: Optional[Console] = None, password: bool = False, choices: Optional[List[str]] = None, case_sensitive: bool = True, show_default: bool = True, show_choices: bool = True, stream: Optional[TextIO] = None, ) -> PromptType: ... @classmethod def ask( cls, prompt: TextType = "", , console: Optional[Console] = None, password: bool = False, choices: Optional[List[str]] = None, case_sensitive: bool = True, show_default: bool = True, show_choices: bool = True, default: Any = ..., stream: Optional[TextIO] = None, ) -> Any: """Shortcut to construct and run a prompt loop and return the result. Example: >>> filename = Prompt.ask("Enter a filename") Args: prompt (TextType, optional): Prompt text. Defaults to "". console (Console, optional): A Console instance or None to use global console. Defaults to None. password (bool, optional): Enable password input. Defaults to False. choices (List[str], optional): A list of valid choices. Defaults to None. case_sensitive (bool, optional): Matching of choices should be case-sensitive. Defaults to True. show_default (bool, optional): Show default in prompt. Defaults to True. show_choices (bool, optional): Show choices in prompt. Defaults to True. stream (TextIO, optional): Optional text file open for reading to get input. Defaults to None. """ _prompt = cls( prompt, console=console, password=password, choices=choices, case_sensitive=case_sensitive, show_default=show_default, show_choices=show_choices, ) return _prompt(default=default, stream=stream) def render_default(self, default: DefaultType) -> Text: """Turn the supplied default in to a Text instance. Args: default (DefaultType): Default value. Returns: Text: Text containing rendering of default value. """ return Text(f"({default})", "prompt.default") def make_prompt(self, default: DefaultType) -> Text: """Make prompt text. Args: default (DefaultType): Default value. Returns: Text: Text to display in prompt. """ prompt = self.prompt.copy() prompt.end = "" if self.show_choices and self.choices: _choices = "/".join(self.choices) choices = f"[{_choices}]" prompt.append(" ") prompt.append(choices, "prompt.choices") if ( default != ... and self.show_default and isinstance(default, (str, self.response_type)) ): prompt.append(" ") _default = self.render_default(default) prompt.append(_default) prompt.append(self.prompt_suffix) return prompt @classmethod def get_input( cls, console: Console, prompt: TextType, password: bool, stream: Optional[TextIO] = None, ) -> str: """Get input from user. Args: console (Console): Console instance. prompt (TextType): Prompt text. password (bool): Enable password entry. Returns: str: String from user. """ return console.input(prompt, password=password, stream=stream) def check_choice(self, value: str) -> bool: """Check value is in the list of valid choices. Args: value (str): Value entered by user. Returns: bool: True if choice was valid, otherwise False. """ assert self.choices is not None if self.case_sensitive: return value.strip() in self.choices return value.strip().lower() in [choice.lower() for choice in self.choices] def process_response(self, value: str) -> PromptType: """Process response from user, convert to prompt type. Args: value (str): String typed by user. Raises: InvalidResponse: If ``value`` is invalid. Returns: PromptType: The value to be returned from ask method. """ value = value.strip() try: return_value: PromptType = self.response_type(value) except ValueError: raise InvalidResponse(self.validate_error_message) if self.choices is not None: if not self.check_choice(value): raise InvalidResponse(self.illegal_choice_message) if not self.case_sensitive: # return the original choice, not the lower case version return_value = self.response_type( self.choices[ [choice.lower() for choice in self.choices].index(value.lower()) ] ) return return_value def on_validate_error(self, value: str, error: InvalidResponse) -> None: """Called to handle validation error. Args: value (str): String entered by user. error (InvalidResponse): Exception instance the initiated the error. """ self.console.print(error) def pre_prompt(self) -> None: """Hook to display something before the prompt.""" @overload def __call__(self, , stream: Optional[TextIO] = None) -> PromptType: ... @overload def __call__( self, , default: DefaultType, stream: Optional[TextIO] = None ) -> Union[PromptType, DefaultType]: ... def __call__(self, *, default: Any = ..., stream: Optional[TextIO] = None) -> Any: """Run the prompt loop. Args: default (Any, optional): Optional default value. Returns: PromptType: Processed value. """ while True: self.pre_prompt() prompt = self.make_prompt(default) value = self.get_input(self.console, prompt, self.password, stream=stream) if value == "" and default != ...: return default try: return_value = self.process_response(value) except InvalidResponse as error: self.on_validate_error(value, error) continue else: return return_value class Prompt(PromptBase[str]): """A prompt that returns a str. Example: >>> name = Prompt.ask("Enter your name") """ response_type = str class IntPrompt(PromptBase[int]): """A prompt that returns an integer. Example: >>> burrito_count = IntPrompt.ask("How many burritos do you want to order") """ response_type = int validate_error_message = "[prompt.invalid]Please enter a valid integer number" class FloatPrompt(PromptBase[float]): """A prompt that returns a float. Example: >>> temperature = FloatPrompt.ask("Enter desired temperature") """ response_type = float validate_error_message = "[prompt.invalid]Please enter a number" class Confirm(PromptBase[bool]): """A yes / no confirmation prompt. Example: >>> if Confirm.ask("Continue"): run_job() """ response_type = bool validate_error_message = "[prompt.invalid]Please enter Y or N" choices: List[str] = ["y", "n"] def render_default(self, default: DefaultType) -> Text: """Render the default as (y) or (n) rather than True/False.""" yes, no = self.choices return Text(f"({yes})" if default else f"({no})", style="prompt.default") def process_response(self, value: str) -> bool: """Convert choices to a bool.""" value = value.strip().lower() if value not in self.choices: raise InvalidResponse(self.validate_error_message) return value == self.choices[0] if __name__ == "__main__": # pragma: no cover from pip._vendor.rich import print if Confirm.ask("Run [i]prompt[/i] tests?", default=True): while True: result = IntPrompt.ask( ":rocket: Enter a number between [b]1[/b] and [b]10[/b]", default=5 ) if result >= 1 and result <= 10: break print(":pile_of_poo: [prompt.invalid]Number must be between 1 and 10") print(f"number={result}") while True: password = Prompt.ask( "Please enter a password [cyan](must be at least 5 characters)", password=True, ) if len(password) >= 5: break print("[prompt.invalid]password too short") print(f"password={password!r}") fruit = Prompt.ask("Enter a fruit", choices=["apple", "orange", "pear"]) print(f"fruit={fruit!r}") doggie = Prompt.ask( "What's the best Dog? (Case INSENSITIVE)", choices=["Border Terrier", "Collie", "Labradoodle"], case_sensitive=False, ) print(f"doggie={doggie!r}") else: print("[b]OK :loudly_crying_face:")	12.16 KB	2026-01-20 12:58
📄 protocol.py from typing import Any, cast, Set, TYPE_CHECKING from inspect import isclass if TYPE_CHECKING: from pip._vendor.rich.console import RenderableType _GIBBERISH = """aihwerij235234ljsdnp34ksodfipwoe234234jlskjdf""" def is_renderable(check_object: Any) -> bool: """Check if an object may be rendered by Rich.""" return ( isinstance(check_object, str) or hasattr(check_object, "__rich__") or hasattr(check_object, "__rich_console__") ) def rich_cast(renderable: object) -> "RenderableType": """Cast an object to a renderable by calling __rich__ if present. Args: renderable (object): A potentially renderable object Returns: object: The result of recursively calling __rich__. """ from pip._vendor.rich.console import RenderableType rich_visited_set: Set[type] = set() # Prevent potential infinite loop while hasattr(renderable, "__rich__") and not isclass(renderable): # Detect object which claim to have all the attributes if hasattr(renderable, _GIBBERISH): return repr(renderable) cast_method = getattr(renderable, "__rich__") renderable = cast_method() renderable_type = type(renderable) if renderable_type in rich_visited_set: break rich_visited_set.add(renderable_type) return cast(RenderableType, renderable)	1.36 KB	2026-01-20 12:58
📄 py.typed	0 B	2026-01-20 12:58
📄 region.py from typing import NamedTuple class Region(NamedTuple): """Defines a rectangular region of the screen.""" x: int y: int width: int height: int	166 B	2026-01-20 12:58
📄 repr.py import inspect from functools import partial from typing import ( Any, Callable, Iterable, List, Optional, Tuple, Type, TypeVar, Union, overload, ) T = TypeVar("T") Result = Iterable[Union[Any, Tuple[Any], Tuple[str, Any], Tuple[str, Any, Any]]] RichReprResult = Result class ReprError(Exception): """An error occurred when attempting to build a repr.""" @overload def auto(cls: Optional[Type[T]]) -> Type[T]: ... @overload def auto(, angular: bool = False) -> Callable[[Type[T]], Type[T]]: ... def auto( cls: Optional[Type[T]] = None, , angular: Optional[bool] = None ) -> Union[Type[T], Callable[[Type[T]], Type[T]]]: """Class decorator to create __repr__ from __rich_repr__""" def do_replace(cls: Type[T], angular: Optional[bool] = None) -> Type[T]: def auto_repr(self: T) -> str: """Create repr string from __rich_repr__""" repr_str: List[str] = [] append = repr_str.append angular: bool = getattr(self.__rich_repr__, "angular", False) # type: ignore[attr-defined] for arg in self.__rich_repr__(): # type: ignore[attr-defined] if isinstance(arg, tuple): if len(arg) == 1: append(repr(arg[0])) else: key, value, default = arg if key is None: append(repr(value)) else: if default and default[0] == value: continue append(f"{key}={value!r}") else: append(repr(arg)) if angular: return f"<{self.__class__.__name__} {' '.join(repr_str)}>" else: return f"{self.__class__.__name__}({', '.join(repr_str)})" def auto_rich_repr(self: Type[T]) -> Result: """Auto generate __rich_rep__ from signature of __init__""" try: signature = inspect.signature(self.__init__) for name, param in signature.parameters.items(): if param.kind == param.POSITIONAL_ONLY: yield getattr(self, name) elif param.kind in ( param.POSITIONAL_OR_KEYWORD, param.KEYWORD_ONLY, ): if param.default is param.empty: yield getattr(self, param.name) else: yield param.name, getattr(self, param.name), param.default except Exception as error: raise ReprError( f"Failed to auto generate __rich_repr__; {error}" ) from None if not hasattr(cls, "__rich_repr__"): auto_rich_repr.__doc__ = "Build a rich repr" cls.__rich_repr__ = auto_rich_repr # type: ignore[attr-defined] auto_repr.__doc__ = "Return repr(self)" cls.__repr__ = auto_repr # type: ignore[assignment] if angular is not None: cls.__rich_repr__.angular = angular # type: ignore[attr-defined] return cls if cls is None: return partial(do_replace, angular=angular) else: return do_replace(cls, angular=angular) @overload def rich_repr(cls: Optional[Type[T]]) -> Type[T]: ... @overload def rich_repr(, angular: bool = False) -> Callable[[Type[T]], Type[T]]: ... def rich_repr( cls: Optional[Type[T]] = None, *, angular: bool = False ) -> Union[Type[T], Callable[[Type[T]], Type[T]]]: if cls is None: return auto(angular=angular) else: return auto(cls) if __name__ == "__main__": @auto class Foo: def __rich_repr__(self) -> Result: yield "foo" yield "bar", {"shopping": ["eggs", "ham", "pineapple"]} yield "buy", "hand sanitizer" foo = Foo() from pip._vendor.rich.console import Console console = Console() console.rule("Standard repr") console.print(foo) console.print(foo, width=60) console.print(foo, width=30) console.rule("Angular repr") Foo.__rich_repr__.angular = True # type: ignore[attr-defined] console.print(foo) console.print(foo, width=60) console.print(foo, width=30)	4.33 KB	2026-01-20 12:58
📄 rule.py from typing import Union from .align import AlignMethod from .cells import cell_len, set_cell_size from .console import Console, ConsoleOptions, RenderResult from .jupyter import JupyterMixin from .measure import Measurement from .style import Style from .text import Text class Rule(JupyterMixin): """A console renderable to draw a horizontal rule (line). Args: title (Union[str, Text], optional): Text to render in the rule. Defaults to "". characters (str, optional): Character(s) used to draw the line. Defaults to "─". style (StyleType, optional): Style of Rule. Defaults to "rule.line". end (str, optional): Character at end of Rule. defaults to "\\\\n" align (str, optional): How to align the title, one of "left", "center", or "right". Defaults to "center". """ def __init__( self, title: Union[str, Text] = "", , characters: str = "─", style: Union[str, Style] = "rule.line", end: str = "\n", align: AlignMethod = "center", ) -> None: if cell_len(characters) < 1: raise ValueError( "'characters' argument must have a cell width of at least 1" ) if align not in ("left", "center", "right"): raise ValueError( f'invalid value for align, expected "left", "center", "right" (not {align!r})' ) self.title = title self.characters = characters self.style = style self.end = end self.align = align def __repr__(self) -> str: return f"Rule({self.title!r}, {self.characters!r})" def __rich_console__( self, console: Console, options: ConsoleOptions ) -> RenderResult: width = options.max_width characters = ( "-" if (options.ascii_only and not self.characters.isascii()) else self.characters ) chars_len = cell_len(characters) if not self.title: yield self._rule_line(chars_len, width) return if isinstance(self.title, Text): title_text = self.title else: title_text = console.render_str(self.title, style="rule.text") title_text.plain = title_text.plain.replace("\n", " ") title_text.expand_tabs() required_space = 4 if self.align == "center" else 2 truncate_width = max(0, width - required_space) if not truncate_width: yield self._rule_line(chars_len, width) return rule_text = Text(end=self.end) if self.align == "center": title_text.truncate(truncate_width, overflow="ellipsis") side_width = (width - cell_len(title_text.plain)) // 2 left = Text(characters (side_width // chars_len + 1)) left.truncate(side_width - 1) right_length = width - cell_len(left.plain) - cell_len(title_text.plain) right = Text(characters * (side_width // chars_len + 1)) right.truncate(right_length) rule_text.append(left.plain + " ", self.style) rule_text.append(title_text) rule_text.append(" " + right.plain, self.style) elif self.align == "left": title_text.truncate(truncate_width, overflow="ellipsis") rule_text.append(title_text) rule_text.append(" ") rule_text.append(characters * (width - rule_text.cell_len), self.style) elif self.align == "right": title_text.truncate(truncate_width, overflow="ellipsis") rule_text.append(characters * (width - title_text.cell_len - 1), self.style) rule_text.append(" ") rule_text.append(title_text) rule_text.plain = set_cell_size(rule_text.plain, width) yield rule_text def _rule_line(self, chars_len: int, width: int) -> Text: rule_text = Text(self.characters * ((width // chars_len) + 1), self.style) rule_text.truncate(width) rule_text.plain = set_cell_size(rule_text.plain, width) return rule_text def __rich_measure__( self, console: Console, options: ConsoleOptions ) -> Measurement: return Measurement(1, 1) if __name__ == "__main__": # pragma: no cover import sys from pip._vendor.rich.console import Console try: text = sys.argv[1] except IndexError: text = "Hello, World" console = Console() console.print(Rule(title=text)) console = Console() console.print(Rule("foo"), width=4)	4.49 KB	2026-01-20 12:58
📄 scope.py from collections.abc import Mapping from typing import TYPE_CHECKING, Any, Optional, Tuple from .highlighter import ReprHighlighter from .panel import Panel from .pretty import Pretty from .table import Table from .text import Text, TextType if TYPE_CHECKING: from .console import ConsoleRenderable def render_scope( scope: "Mapping[str, Any]", *, title: Optional[TextType] = None, sort_keys: bool = True, indent_guides: bool = False, max_length: Optional[int] = None, max_string: Optional[int] = None, ) -> "ConsoleRenderable": """Render python variables in a given scope. Args: scope (Mapping): A mapping containing variable names and values. title (str, optional): Optional title. Defaults to None. sort_keys (bool, optional): Enable sorting of items. Defaults to True. indent_guides (bool, optional): Enable indentation guides. Defaults to False. max_length (int, optional): Maximum length of containers before abbreviating, or None for no abbreviation. Defaults to None. max_string (int, optional): Maximum length of string before truncating, or None to disable. Defaults to None. Returns: ConsoleRenderable: A renderable object. """ highlighter = ReprHighlighter() items_table = Table.grid(padding=(0, 1), expand=False) items_table.add_column(justify="right") def sort_items(item: Tuple[str, Any]) -> Tuple[bool, str]: """Sort special variables first, then alphabetically.""" key, _ = item return (not key.startswith("__"), key.lower()) items = sorted(scope.items(), key=sort_items) if sort_keys else scope.items() for key, value in items: key_text = Text.assemble( (key, "scope.key.special" if key.startswith("__") else "scope.key"), (" =", "scope.equals"), ) items_table.add_row( key_text, Pretty( value, highlighter=highlighter, indent_guides=indent_guides, max_length=max_length, max_string=max_string, ), ) return Panel.fit( items_table, title=title, border_style="scope.border", padding=(0, 1), ) if __name__ == "__main__": # pragma: no cover from pip._vendor.rich import print print() def test(foo: float, bar: float) -> None: list_of_things = [1, 2, 3, None, 4, True, False, "Hello World"] dict_of_things = { "version": "1.1", "method": "confirmFruitPurchase", "params": [["apple", "orange", "mangoes", "pomelo"], 1.123], "id": "194521489", } print(render_scope(locals(), title="[i]locals", sort_keys=False)) test(20.3423, 3.1427) print()	2.78 KB	2026-01-20 12:58
📄 screen.py from typing import Optional, TYPE_CHECKING from .segment import Segment from .style import StyleType from ._loop import loop_last if TYPE_CHECKING: from .console import ( Console, ConsoleOptions, RenderResult, RenderableType, Group, ) class Screen: """A renderable that fills the terminal screen and crops excess. Args: renderable (RenderableType): Child renderable. style (StyleType, optional): Optional background style. Defaults to None. """ renderable: "RenderableType" def __init__( self, renderables: "RenderableType", style: Optional[StyleType] = None, application_mode: bool = False, ) -> None: from pip._vendor.rich.console import Group self.renderable = Group(renderables) self.style = style self.application_mode = application_mode def __rich_console__( self, console: "Console", options: "ConsoleOptions" ) -> "RenderResult": width, height = options.size style = console.get_style(self.style) if self.style else None render_options = options.update(width=width, height=height) lines = console.render_lines( self.renderable or "", render_options, style=style, pad=True ) lines = Segment.set_shape(lines, width, height, style=style) new_line = Segment("\n\r") if self.application_mode else Segment.line() for last, line in loop_last(lines): yield from line if not last: yield new_line	1.55 KB	2026-01-20 12:58
📄 segment.py from enum import IntEnum from functools import lru_cache from itertools import filterfalse from logging import getLogger from operator import attrgetter from typing import ( TYPE_CHECKING, Dict, Iterable, List, NamedTuple, Optional, Sequence, Tuple, Type, Union, ) from .cells import ( _is_single_cell_widths, cached_cell_len, cell_len, get_character_cell_size, set_cell_size, ) from .repr import Result, rich_repr from .style import Style if TYPE_CHECKING: from .console import Console, ConsoleOptions, RenderResult log = getLogger("rich") class ControlType(IntEnum): """Non-printable control codes which typically translate to ANSI codes.""" BELL = 1 CARRIAGE_RETURN = 2 HOME = 3 CLEAR = 4 SHOW_CURSOR = 5 HIDE_CURSOR = 6 ENABLE_ALT_SCREEN = 7 DISABLE_ALT_SCREEN = 8 CURSOR_UP = 9 CURSOR_DOWN = 10 CURSOR_FORWARD = 11 CURSOR_BACKWARD = 12 CURSOR_MOVE_TO_COLUMN = 13 CURSOR_MOVE_TO = 14 ERASE_IN_LINE = 15 SET_WINDOW_TITLE = 16 ControlCode = Union[ Tuple[ControlType], Tuple[ControlType, Union[int, str]], Tuple[ControlType, int, int], ] @rich_repr() class Segment(NamedTuple): """A piece of text with associated style. Segments are produced by the Console render process and are ultimately converted in to strings to be written to the terminal. Args: text (str): A piece of text. style (:class:`~rich.style.Style`, optional): An optional style to apply to the text. control (Tuple[ControlCode], optional): Optional sequence of control codes. Attributes: cell_length (int): The cell length of this Segment. """ text: str style: Optional[Style] = None control: Optional[Sequence[ControlCode]] = None @property def cell_length(self) -> int: """The number of terminal cells required to display self.text. Returns: int: A number of cells. """ text, _style, control = self return 0 if control else cell_len(text) def __rich_repr__(self) -> Result: yield self.text if self.control is None: if self.style is not None: yield self.style else: yield self.style yield self.control def __bool__(self) -> bool: """Check if the segment contains text.""" return bool(self.text) @property def is_control(self) -> bool: """Check if the segment contains control codes.""" return self.control is not None @classmethod @lru_cache(1024 * 16) def _split_cells(cls, segment: "Segment", cut: int) -> Tuple["Segment", "Segment"]: """Split a segment in to two at a given cell position. Note that splitting a double-width character, may result in that character turning into two spaces. Args: segment (Segment): A segment to split. cut (int): A cell position to cut on. Returns: A tuple of two segments. """ text, style, control = segment _Segment = Segment cell_length = segment.cell_length if cut >= cell_length: return segment, _Segment("", style, control) cell_size = get_character_cell_size pos = int((cut / cell_length) * len(text)) while True: before = text[:pos] cell_pos = cell_len(before) out_by = cell_pos - cut if not out_by: return ( _Segment(before, style, control), _Segment(text[pos:], style, control), ) if out_by == -1 and cell_size(text[pos]) == 2: return ( _Segment(text[:pos] + " ", style, control), _Segment(" " + text[pos + 1 :], style, control), ) if out_by == +1 and cell_size(text[pos - 1]) == 2: return ( _Segment(text[: pos - 1] + " ", style, control), _Segment(" " + text[pos:], style, control), ) if cell_pos < cut: pos += 1 else: pos -= 1 def split_cells(self, cut: int) -> Tuple["Segment", "Segment"]: """Split segment in to two segments at the specified column. If the cut point falls in the middle of a 2-cell wide character then it is replaced by two spaces, to preserve the display width of the parent segment. Args: cut (int): Offset within the segment to cut. Returns: Tuple[Segment, Segment]: Two segments. """ text, style, control = self assert cut >= 0 if _is_single_cell_widths(text): # Fast path with all 1 cell characters if cut >= len(text): return self, Segment("", style, control) return ( Segment(text[:cut], style, control), Segment(text[cut:], style, control), ) return self._split_cells(self, cut) @classmethod def line(cls) -> "Segment": """Make a new line segment.""" return cls("\n") @classmethod def apply_style( cls, segments: Iterable["Segment"], style: Optional[Style] = None, post_style: Optional[Style] = None, ) -> Iterable["Segment"]: """Apply style(s) to an iterable of segments. Returns an iterable of segments where the style is replaced by ``style + segment.style + post_style``. Args: segments (Iterable[Segment]): Segments to process. style (Style, optional): Base style. Defaults to None. post_style (Style, optional): Style to apply on top of segment style. Defaults to None. Returns: Iterable[Segments]: A new iterable of segments (possibly the same iterable). """ result_segments = segments if style: apply = style.__add__ result_segments = ( cls(text, None if control else apply(_style), control) for text, _style, control in result_segments ) if post_style: result_segments = ( cls( text, ( None if control else (_style + post_style if _style else post_style) ), control, ) for text, _style, control in result_segments ) return result_segments @classmethod def filter_control( cls, segments: Iterable["Segment"], is_control: bool = False ) -> Iterable["Segment"]: """Filter segments by ``is_control`` attribute. Args: segments (Iterable[Segment]): An iterable of Segment instances. is_control (bool, optional): is_control flag to match in search. Returns: Iterable[Segment]: And iterable of Segment instances. """ if is_control: return filter(attrgetter("control"), segments) else: return filterfalse(attrgetter("control"), segments) @classmethod def split_lines(cls, segments: Iterable["Segment"]) -> Iterable[List["Segment"]]: """Split a sequence of segments in to a list of lines. Args: segments (Iterable[Segment]): Segments potentially containing line feeds. Yields: Iterable[List[Segment]]: Iterable of segment lists, one per line. """ line: List[Segment] = [] append = line.append for segment in segments: if "\n" in segment.text and not segment.control: text, style, _ = segment while text: _text, new_line, text = text.partition("\n") if _text: append(cls(_text, style)) if new_line: yield line line = [] append = line.append else: append(segment) if line: yield line @classmethod def split_and_crop_lines( cls, segments: Iterable["Segment"], length: int, style: Optional[Style] = None, pad: bool = True, include_new_lines: bool = True, ) -> Iterable[List["Segment"]]: """Split segments in to lines, and crop lines greater than a given length. Args: segments (Iterable[Segment]): An iterable of segments, probably generated from console.render. length (int): Desired line length. style (Style, optional): Style to use for any padding. pad (bool): Enable padding of lines that are less than `length`. Returns: Iterable[List[Segment]]: An iterable of lines of segments. """ line: List[Segment] = [] append = line.append adjust_line_length = cls.adjust_line_length new_line_segment = cls("\n") for segment in segments: if "\n" in segment.text and not segment.control: text, segment_style, _ = segment while text: _text, new_line, text = text.partition("\n") if _text: append(cls(_text, segment_style)) if new_line: cropped_line = adjust_line_length( line, length, style=style, pad=pad ) if include_new_lines: cropped_line.append(new_line_segment) yield cropped_line line.clear() else: append(segment) if line: yield adjust_line_length(line, length, style=style, pad=pad) @classmethod def adjust_line_length( cls, line: List["Segment"], length: int, style: Optional[Style] = None, pad: bool = True, ) -> List["Segment"]: """Adjust a line to a given width (cropping or padding as required). Args: segments (Iterable[Segment]): A list of segments in a single line. length (int): The desired width of the line. style (Style, optional): The style of padding if used (space on the end). Defaults to None. pad (bool, optional): Pad lines with spaces if they are shorter than `length`. Defaults to True. Returns: List[Segment]: A line of segments with the desired length. """ line_length = sum(segment.cell_length for segment in line) new_line: List[Segment] if line_length < length: if pad: new_line = line + [cls(" " * (length - line_length), style)] else: new_line = line[:] elif line_length > length: new_line = [] append = new_line.append line_length = 0 for segment in line: segment_length = segment.cell_length if line_length + segment_length < length or segment.control: append(segment) line_length += segment_length else: text, segment_style, _ = segment text = set_cell_size(text, length - line_length) append(cls(text, segment_style)) break else: new_line = line[:] return new_line @classmethod def get_line_length(cls, line: List["Segment"]) -> int: """Get the length of list of segments. Args: line (List[Segment]): A line encoded as a list of Segments (assumes no '\\\\n' characters), Returns: int: The length of the line. """ _cell_len = cell_len return sum(_cell_len(text) for text, style, control in line if not control) @classmethod def get_shape(cls, lines: List[List["Segment"]]) -> Tuple[int, int]: """Get the shape (enclosing rectangle) of a list of lines. Args: lines (List[List[Segment]]): A list of lines (no '\\\\n' characters). Returns: Tuple[int, int]: Width and height in characters. """ get_line_length = cls.get_line_length max_width = max(get_line_length(line) for line in lines) if lines else 0 return (max_width, len(lines)) @classmethod def set_shape( cls, lines: List[List["Segment"]], width: int, height: Optional[int] = None, style: Optional[Style] = None, new_lines: bool = False, ) -> List[List["Segment"]]: """Set the shape of a list of lines (enclosing rectangle). Args: lines (List[List[Segment]]): A list of lines. width (int): Desired width. height (int, optional): Desired height or None for no change. style (Style, optional): Style of any padding added. new_lines (bool, optional): Padded lines should include "\n". Defaults to False. Returns: List[List[Segment]]: New list of lines. """ _height = height or len(lines) blank = ( [cls(" " * width + "\n", style)] if new_lines else [cls(" " * width, style)] ) adjust_line_length = cls.adjust_line_length shaped_lines = lines[:_height] shaped_lines[:] = [ adjust_line_length(line, width, style=style) for line in lines ] if len(shaped_lines) < _height: shaped_lines.extend([blank] * (_height - len(shaped_lines))) return shaped_lines @classmethod def align_top( cls: Type["Segment"], lines: List[List["Segment"]], width: int, height: int, style: Style, new_lines: bool = False, ) -> List[List["Segment"]]: """Aligns lines to top (adds extra lines to bottom as required). Args: lines (List[List[Segment]]): A list of lines. width (int): Desired width. height (int, optional): Desired height or None for no change. style (Style): Style of any padding added. new_lines (bool, optional): Padded lines should include "\n". Defaults to False. Returns: List[List[Segment]]: New list of lines. """ extra_lines = height - len(lines) if not extra_lines: return lines[:] lines = lines[:height] blank = cls(" " * width + "\n", style) if new_lines else cls(" " * width, style) lines = lines + [[blank]] * extra_lines return lines @classmethod def align_bottom( cls: Type["Segment"], lines: List[List["Segment"]], width: int, height: int, style: Style, new_lines: bool = False, ) -> List[List["Segment"]]: """Aligns render to bottom (adds extra lines above as required). Args: lines (List[List[Segment]]): A list of lines. width (int): Desired width. height (int, optional): Desired height or None for no change. style (Style): Style of any padding added. Defaults to None. new_lines (bool, optional): Padded lines should include "\n". Defaults to False. Returns: List[List[Segment]]: New list of lines. """ extra_lines = height - len(lines) if not extra_lines: return lines[:] lines = lines[:height] blank = cls(" " * width + "\n", style) if new_lines else cls(" " * width, style) lines = [[blank]] * extra_lines + lines return lines @classmethod def align_middle( cls: Type["Segment"], lines: List[List["Segment"]], width: int, height: int, style: Style, new_lines: bool = False, ) -> List[List["Segment"]]: """Aligns lines to middle (adds extra lines to above and below as required). Args: lines (List[List[Segment]]): A list of lines. width (int): Desired width. height (int, optional): Desired height or None for no change. style (Style): Style of any padding added. new_lines (bool, optional): Padded lines should include "\n". Defaults to False. Returns: List[List[Segment]]: New list of lines. """ extra_lines = height - len(lines) if not extra_lines: return lines[:] lines = lines[:height] blank = cls(" " * width + "\n", style) if new_lines else cls(" " * width, style) top_lines = extra_lines // 2 bottom_lines = extra_lines - top_lines lines = [[blank]] * top_lines + lines + [[blank]] * bottom_lines return lines @classmethod def simplify(cls, segments: Iterable["Segment"]) -> Iterable["Segment"]: """Simplify an iterable of segments by combining contiguous segments with the same style. Args: segments (Iterable[Segment]): An iterable of segments. Returns: Iterable[Segment]: A possibly smaller iterable of segments that will render the same way. """ iter_segments = iter(segments) try: last_segment = next(iter_segments) except StopIteration: return _Segment = Segment for segment in iter_segments: if last_segment.style == segment.style and not segment.control: last_segment = _Segment( last_segment.text + segment.text, last_segment.style ) else: yield last_segment last_segment = segment yield last_segment @classmethod def strip_links(cls, segments: Iterable["Segment"]) -> Iterable["Segment"]: """Remove all links from an iterable of styles. Args: segments (Iterable[Segment]): An iterable segments. Yields: Segment: Segments with link removed. """ for segment in segments: if segment.control or segment.style is None: yield segment else: text, style, _control = segment yield cls(text, style.update_link(None) if style else None) @classmethod def strip_styles(cls, segments: Iterable["Segment"]) -> Iterable["Segment"]: """Remove all styles from an iterable of segments. Args: segments (Iterable[Segment]): An iterable segments. Yields: Segment: Segments with styles replace with None """ for text, _style, control in segments: yield cls(text, None, control) @classmethod def remove_color(cls, segments: Iterable["Segment"]) -> Iterable["Segment"]: """Remove all color from an iterable of segments. Args: segments (Iterable[Segment]): An iterable segments. Yields: Segment: Segments with colorless style. """ cache: Dict[Style, Style] = {} for text, style, control in segments: if style: colorless_style = cache.get(style) if colorless_style is None: colorless_style = style.without_color cache[style] = colorless_style yield cls(text, colorless_style, control) else: yield cls(text, None, control) @classmethod def divide( cls, segments: Iterable["Segment"], cuts: Iterable[int] ) -> Iterable[List["Segment"]]: """Divides an iterable of segments in to portions. Args: cuts (Iterable[int]): Cell positions where to divide. Yields: [Iterable[List[Segment]]]: An iterable of Segments in List. """ split_segments: List["Segment"] = [] add_segment = split_segments.append iter_cuts = iter(cuts) while True: cut = next(iter_cuts, -1) if cut == -1: return if cut != 0: break yield [] pos = 0 segments_clear = split_segments.clear segments_copy = split_segments.copy _cell_len = cached_cell_len for segment in segments: text, _style, control = segment while text: end_pos = pos if control else pos + _cell_len(text) if end_pos < cut: add_segment(segment) pos = end_pos break if end_pos == cut: add_segment(segment) yield segments_copy() segments_clear() pos = end_pos cut = next(iter_cuts, -1) if cut == -1: if split_segments: yield segments_copy() return break else: before, segment = segment.split_cells(cut - pos) text, _style, control = segment add_segment(before) yield segments_copy() segments_clear() pos = cut cut = next(iter_cuts, -1) if cut == -1: if split_segments: yield segments_copy() return yield segments_copy() class Segments: """A simple renderable to render an iterable of segments. This class may be useful if you want to print segments outside of a __rich_console__ method. Args: segments (Iterable[Segment]): An iterable of segments. new_lines (bool, optional): Add new lines between segments. Defaults to False. """ def __init__(self, segments: Iterable[Segment], new_lines: bool = False) -> None: self.segments = list(segments) self.new_lines = new_lines def __rich_console__( self, console: "Console", options: "ConsoleOptions" ) -> "RenderResult": if self.new_lines: line = Segment.line() for segment in self.segments: yield segment yield line else: yield from self.segments class SegmentLines: def __init__(self, lines: Iterable[List[Segment]], new_lines: bool = False) -> None: """A simple renderable containing a number of lines of segments. May be used as an intermediate in rendering process. Args: lines (Iterable[List[Segment]]): Lists of segments forming lines. new_lines (bool, optional): Insert new lines after each line. Defaults to False. """ self.lines = list(lines) self.new_lines = new_lines def __rich_console__( self, console: "Console", options: "ConsoleOptions" ) -> "RenderResult": if self.new_lines: new_line = Segment.line() for line in self.lines: yield from line yield new_line else: for line in self.lines: yield from line if __name__ == "__main__": # pragma: no cover from pip._vendor.rich.console import Console from pip._vendor.rich.syntax import Syntax from pip._vendor.rich.text import Text code = """from rich.console import Console console = Console() text = Text.from_markup("Hello, [bold magenta]World[/]!") console.print(text)""" text = Text.from_markup("Hello, [bold magenta]World[/]!") console = Console() console.rule("rich.Segment") console.print( "A Segment is the last step in the Rich render process before generating text with ANSI codes." ) console.print("\nConsider the following code:\n") console.print(Syntax(code, "python", line_numbers=True)) console.print() console.print( "When you call [b]print()[/b], Rich [i]renders[/i] the object in to the following:\n" ) fragments = list(console.render(text)) console.print(fragments) console.print() console.print("The Segments are then processed to produce the following output:\n") console.print(text) console.print( "\nYou will only need to know this if you are implementing your own Rich renderables." )	24.16 KB	2026-01-20 12:58
📄 spinner.py from typing import TYPE_CHECKING, List, Optional, Union, cast from ._spinners import SPINNERS from .measure import Measurement from .table import Table from .text import Text if TYPE_CHECKING: from .console import Console, ConsoleOptions, RenderableType, RenderResult from .style import StyleType class Spinner: """A spinner animation. Args: name (str): Name of spinner (run python -m rich.spinner). text (RenderableType, optional): A renderable to display at the right of the spinner (str or Text typically). Defaults to "". style (StyleType, optional): Style for spinner animation. Defaults to None. speed (float, optional): Speed factor for animation. Defaults to 1.0. Raises: KeyError: If name isn't one of the supported spinner animations. """ def __init__( self, name: str, text: "RenderableType" = "", , style: Optional["StyleType"] = None, speed: float = 1.0, ) -> None: try: spinner = SPINNERS[name] except KeyError: raise KeyError(f"no spinner called {name!r}") self.text: "Union[RenderableType, Text]" = ( Text.from_markup(text) if isinstance(text, str) else text ) self.name = name self.frames = cast(List[str], spinner["frames"])[:] self.interval = cast(float, spinner["interval"]) self.start_time: Optional[float] = None self.style = style self.speed = speed self.frame_no_offset: float = 0.0 self._update_speed = 0.0 def __rich_console__( self, console: "Console", options: "ConsoleOptions" ) -> "RenderResult": yield self.render(console.get_time()) def __rich_measure__( self, console: "Console", options: "ConsoleOptions" ) -> Measurement: text = self.render(0) return Measurement.get(console, options, text) def render(self, time: float) -> "RenderableType": """Render the spinner for a given time. Args: time (float): Time in seconds. Returns: RenderableType: A renderable containing animation frame. """ if self.start_time is None: self.start_time = time frame_no = ((time - self.start_time) self.speed) / ( self.interval / 1000.0 ) + self.frame_no_offset frame = Text( self.frames[int(frame_no) % len(self.frames)], style=self.style or "" ) if self._update_speed: self.frame_no_offset = frame_no self.start_time = time self.speed = self._update_speed self._update_speed = 0.0 if not self.text: return frame elif isinstance(self.text, (str, Text)): return Text.assemble(frame, " ", self.text) else: table = Table.grid(padding=1) table.add_row(frame, self.text) return table def update( self, , text: "RenderableType" = "", style: Optional["StyleType"] = None, speed: Optional[float] = None, ) -> None: """Updates attributes of a spinner after it has been started. Args: text (RenderableType, optional): A renderable to display at the right of the spinner (str or Text typically). Defaults to "". style (StyleType, optional): Style for spinner animation. Defaults to None. speed (float, optional): Speed factor for animation. Defaults to None. """ if text: self.text = Text.from_markup(text) if isinstance(text, str) else text if style: self.style = style if speed: self._update_speed = speed if __name__ == "__main__": # pragma: no cover from time import sleep from .console import Group from .live import Live all_spinners = Group( [ Spinner(spinner_name, text=Text(repr(spinner_name), style="green")) for spinner_name in sorted(SPINNERS.keys()) ] ) with Live(all_spinners, refresh_per_second=20) as live: while True: sleep(0.1)	4.12 KB	2026-01-20 12:58
📄 status.py from types import TracebackType from typing import Optional, Type from .console import Console, RenderableType from .jupyter import JupyterMixin from .live import Live from .spinner import Spinner from .style import StyleType class Status(JupyterMixin): """Displays a status indicator with a 'spinner' animation. Args: status (RenderableType): A status renderable (str or Text typically). console (Console, optional): Console instance to use, or None for global console. Defaults to None. spinner (str, optional): Name of spinner animation (see python -m rich.spinner). Defaults to "dots". spinner_style (StyleType, optional): Style of spinner. Defaults to "status.spinner". speed (float, optional): Speed factor for spinner animation. Defaults to 1.0. refresh_per_second (float, optional): Number of refreshes per second. Defaults to 12.5. """ def __init__( self, status: RenderableType, , console: Optional[Console] = None, spinner: str = "dots", spinner_style: StyleType = "status.spinner", speed: float = 1.0, refresh_per_second: float = 12.5, ): self.status = status self.spinner_style = spinner_style self.speed = speed self._spinner = Spinner(spinner, text=status, style=spinner_style, speed=speed) self._live = Live( self.renderable, console=console, refresh_per_second=refresh_per_second, transient=True, ) @property def renderable(self) -> Spinner: return self._spinner @property def console(self) -> "Console": """Get the Console used by the Status objects.""" return self._live.console def update( self, status: Optional[RenderableType] = None, , spinner: Optional[str] = None, spinner_style: Optional[StyleType] = None, speed: Optional[float] = None, ) -> None: """Update status. Args: status (Optional[RenderableType], optional): New status renderable or None for no change. Defaults to None. spinner (Optional[str], optional): New spinner or None for no change. Defaults to None. spinner_style (Optional[StyleType], optional): New spinner style or None for no change. Defaults to None. speed (Optional[float], optional): Speed factor for spinner animation or None for no change. Defaults to None. """ if status is not None: self.status = status if spinner_style is not None: self.spinner_style = spinner_style if speed is not None: self.speed = speed if spinner is not None: self._spinner = Spinner( spinner, text=self.status, style=self.spinner_style, speed=self.speed ) self._live.update(self.renderable, refresh=True) else: self._spinner.update( text=self.status, style=self.spinner_style, speed=self.speed ) def start(self) -> None: """Start the status animation.""" self._live.start() def stop(self) -> None: """Stop the spinner animation.""" self._live.stop() def __rich__(self) -> RenderableType: return self.renderable def __enter__(self) -> "Status": self.start() return self def __exit__( self, exc_type: Optional[Type[BaseException]], exc_val: Optional[BaseException], exc_tb: Optional[TracebackType], ) -> None: self.stop() if __name__ == "__main__": # pragma: no cover from time import sleep from .console import Console console = Console() with console.status("[magenta]Covid detector booting up") as status: sleep(3) console.log("Importing advanced AI") sleep(3) console.log("Advanced Covid AI Ready") sleep(3) status.update(status="[bold blue] Scanning for Covid", spinner="earth") sleep(3) console.log("Found 10,000,000,000 copies of Covid32.exe") sleep(3) status.update( status="[bold red]Moving Covid32.exe to Trash", spinner="bouncingBall", spinner_style="yellow", ) sleep(5) console.print("[bold green]Covid deleted successfully")	4.32 KB	2026-01-20 12:58
📄 style.py import sys from functools import lru_cache from operator import attrgetter from pickle import dumps, loads from random import randint from typing import Any, Dict, Iterable, List, Optional, Type, Union, cast from . import errors from .color import Color, ColorParseError, ColorSystem, blend_rgb from .repr import Result, rich_repr from .terminal_theme import DEFAULT_TERMINAL_THEME, TerminalTheme _hash_getter = attrgetter( "_color", "_bgcolor", "_attributes", "_set_attributes", "_link", "_meta" ) # Style instances and style definitions are often interchangeable StyleType = Union[str, "Style"] class _Bit: """A descriptor to get/set a style attribute bit.""" __slots__ = ["bit"] def __init__(self, bit_no: int) -> None: self.bit = 1 << bit_no def __get__(self, obj: "Style", objtype: Type["Style"]) -> Optional[bool]: if obj._set_attributes & self.bit: return obj._attributes & self.bit != 0 return None @rich_repr class Style: """A terminal style. A terminal style consists of a color (`color`), a background color (`bgcolor`), and a number of attributes, such as bold, italic etc. The attributes have 3 states: they can either be on (``True``), off (``False``), or not set (``None``). Args: color (Union[Color, str], optional): Color of terminal text. Defaults to None. bgcolor (Union[Color, str], optional): Color of terminal background. Defaults to None. bold (bool, optional): Enable bold text. Defaults to None. dim (bool, optional): Enable dim text. Defaults to None. italic (bool, optional): Enable italic text. Defaults to None. underline (bool, optional): Enable underlined text. Defaults to None. blink (bool, optional): Enabled blinking text. Defaults to None. blink2 (bool, optional): Enable fast blinking text. Defaults to None. reverse (bool, optional): Enabled reverse text. Defaults to None. conceal (bool, optional): Enable concealed text. Defaults to None. strike (bool, optional): Enable strikethrough text. Defaults to None. underline2 (bool, optional): Enable doubly underlined text. Defaults to None. frame (bool, optional): Enable framed text. Defaults to None. encircle (bool, optional): Enable encircled text. Defaults to None. overline (bool, optional): Enable overlined text. Defaults to None. link (str, link): Link URL. Defaults to None. """ _color: Optional[Color] _bgcolor: Optional[Color] _attributes: int _set_attributes: int _hash: Optional[int] _null: bool _meta: Optional[bytes] __slots__ = [ "_color", "_bgcolor", "_attributes", "_set_attributes", "_link", "_link_id", "_ansi", "_style_definition", "_hash", "_null", "_meta", ] # maps bits on to SGR parameter _style_map = { 0: "1", 1: "2", 2: "3", 3: "4", 4: "5", 5: "6", 6: "7", 7: "8", 8: "9", 9: "21", 10: "51", 11: "52", 12: "53", } STYLE_ATTRIBUTES = { "dim": "dim", "d": "dim", "bold": "bold", "b": "bold", "italic": "italic", "i": "italic", "underline": "underline", "u": "underline", "blink": "blink", "blink2": "blink2", "reverse": "reverse", "r": "reverse", "conceal": "conceal", "c": "conceal", "strike": "strike", "s": "strike", "underline2": "underline2", "uu": "underline2", "frame": "frame", "encircle": "encircle", "overline": "overline", "o": "overline", } def __init__( self, , color: Optional[Union[Color, str]] = None, bgcolor: Optional[Union[Color, str]] = None, bold: Optional[bool] = None, dim: Optional[bool] = None, italic: Optional[bool] = None, underline: Optional[bool] = None, blink: Optional[bool] = None, blink2: Optional[bool] = None, reverse: Optional[bool] = None, conceal: Optional[bool] = None, strike: Optional[bool] = None, underline2: Optional[bool] = None, frame: Optional[bool] = None, encircle: Optional[bool] = None, overline: Optional[bool] = None, link: Optional[str] = None, meta: Optional[Dict[str, Any]] = None, ): self._ansi: Optional[str] = None self._style_definition: Optional[str] = None def _make_color(color: Union[Color, str]) -> Color: return color if isinstance(color, Color) else Color.parse(color) self._color = None if color is None else _make_color(color) self._bgcolor = None if bgcolor is None else _make_color(bgcolor) self._set_attributes = sum( ( bold is not None, dim is not None and 2, italic is not None and 4, underline is not None and 8, blink is not None and 16, blink2 is not None and 32, reverse is not None and 64, conceal is not None and 128, strike is not None and 256, underline2 is not None and 512, frame is not None and 1024, encircle is not None and 2048, overline is not None and 4096, ) ) self._attributes = ( sum( ( bold and 1 or 0, dim and 2 or 0, italic and 4 or 0, underline and 8 or 0, blink and 16 or 0, blink2 and 32 or 0, reverse and 64 or 0, conceal and 128 or 0, strike and 256 or 0, underline2 and 512 or 0, frame and 1024 or 0, encircle and 2048 or 0, overline and 4096 or 0, ) ) if self._set_attributes else 0 ) self._link = link self._meta = None if meta is None else dumps(meta) self._link_id = ( f"{randint(0, 999999)}{hash(self._meta)}" if (link or meta) else "" ) self._hash: Optional[int] = None self._null = not (self._set_attributes or color or bgcolor or link or meta) @classmethod def null(cls) -> "Style": """Create an 'null' style, equivalent to Style(), but more performant.""" return NULL_STYLE @classmethod def from_color( cls, color: Optional[Color] = None, bgcolor: Optional[Color] = None ) -> "Style": """Create a new style with colors and no attributes. Returns: color (Optional[Color]): A (foreground) color, or None for no color. Defaults to None. bgcolor (Optional[Color]): A (background) color, or None for no color. Defaults to None. """ style: Style = cls.__new__(Style) style._ansi = None style._style_definition = None style._color = color style._bgcolor = bgcolor style._set_attributes = 0 style._attributes = 0 style._link = None style._link_id = "" style._meta = None style._null = not (color or bgcolor) style._hash = None return style @classmethod def from_meta(cls, meta: Optional[Dict[str, Any]]) -> "Style": """Create a new style with meta data. Returns: meta (Optional[Dict[str, Any]]): A dictionary of meta data. Defaults to None. """ style: Style = cls.__new__(Style) style._ansi = None style._style_definition = None style._color = None style._bgcolor = None style._set_attributes = 0 style._attributes = 0 style._link = None style._meta = dumps(meta) style._link_id = f"{randint(0, 999999)}{hash(style._meta)}" style._hash = None style._null = not (meta) return style @classmethod def on(cls, meta: Optional[Dict[str, Any]] = None, handlers: Any) -> "Style": """Create a blank style with meta information. Example: style = Style.on(click=self.on_click) Args: meta (Optional[Dict[str, Any]], optional): An optional dict of meta information. handlers (Any): Keyword arguments are translated in to handlers. Returns: Style: A Style with meta information attached. """ meta = {} if meta is None else meta meta.update({f"@{key}": value for key, value in handlers.items()}) return cls.from_meta(meta) bold = _Bit(0) dim = _Bit(1) italic = _Bit(2) underline = _Bit(3) blink = _Bit(4) blink2 = _Bit(5) reverse = _Bit(6) conceal = _Bit(7) strike = _Bit(8) underline2 = _Bit(9) frame = _Bit(10) encircle = _Bit(11) overline = _Bit(12) @property def link_id(self) -> str: """Get a link id, used in ansi code for links.""" return self._link_id def __str__(self) -> str: """Re-generate style definition from attributes.""" if self._style_definition is None: attributes: List[str] = [] append = attributes.append bits = self._set_attributes if bits & 0b0000000001111: if bits & 1: append("bold" if self.bold else "not bold") if bits & (1 << 1): append("dim" if self.dim else "not dim") if bits & (1 << 2): append("italic" if self.italic else "not italic") if bits & (1 << 3): append("underline" if self.underline else "not underline") if bits & 0b0000111110000: if bits & (1 << 4): append("blink" if self.blink else "not blink") if bits & (1 << 5): append("blink2" if self.blink2 else "not blink2") if bits & (1 << 6): append("reverse" if self.reverse else "not reverse") if bits & (1 << 7): append("conceal" if self.conceal else "not conceal") if bits & (1 << 8): append("strike" if self.strike else "not strike") if bits & 0b1111000000000: if bits & (1 << 9): append("underline2" if self.underline2 else "not underline2") if bits & (1 << 10): append("frame" if self.frame else "not frame") if bits & (1 << 11): append("encircle" if self.encircle else "not encircle") if bits & (1 << 12): append("overline" if self.overline else "not overline") if self._color is not None: append(self._color.name) if self._bgcolor is not None: append("on") append(self._bgcolor.name) if self._link: append("link") append(self._link) self._style_definition = " ".join(attributes) or "none" return self._style_definition def __bool__(self) -> bool: """A Style is false if it has no attributes, colors, or links.""" return not self._null def _make_ansi_codes(self, color_system: ColorSystem) -> str: """Generate ANSI codes for this style. Args: color_system (ColorSystem): Color system. Returns: str: String containing codes. """ if self._ansi is None: sgr: List[str] = [] append = sgr.append _style_map = self._style_map attributes = self._attributes & self._set_attributes if attributes: if attributes & 1: append(_style_map[0]) if attributes & 2: append(_style_map[1]) if attributes & 4: append(_style_map[2]) if attributes & 8: append(_style_map[3]) if attributes & 0b0000111110000: for bit in range(4, 9): if attributes & (1 << bit): append(_style_map[bit]) if attributes & 0b1111000000000: for bit in range(9, 13): if attributes & (1 << bit): append(_style_map[bit]) if self._color is not None: sgr.extend(self._color.downgrade(color_system).get_ansi_codes()) if self._bgcolor is not None: sgr.extend( self._bgcolor.downgrade(color_system).get_ansi_codes( foreground=False ) ) self._ansi = ";".join(sgr) return self._ansi @classmethod @lru_cache(maxsize=1024) def normalize(cls, style: str) -> str: """Normalize a style definition so that styles with the same effect have the same string representation. Args: style (str): A style definition. Returns: str: Normal form of style definition. """ try: return str(cls.parse(style)) except errors.StyleSyntaxError: return style.strip().lower() @classmethod def pick_first(cls, values: Optional[StyleType]) -> StyleType: """Pick first non-None style.""" for value in values: if value is not None: return value raise ValueError("expected at least one non-None style") def __rich_repr__(self) -> Result: yield "color", self.color, None yield "bgcolor", self.bgcolor, None yield "bold", self.bold, None, yield "dim", self.dim, None, yield "italic", self.italic, None yield "underline", self.underline, None, yield "blink", self.blink, None yield "blink2", self.blink2, None yield "reverse", self.reverse, None yield "conceal", self.conceal, None yield "strike", self.strike, None yield "underline2", self.underline2, None yield "frame", self.frame, None yield "encircle", self.encircle, None yield "link", self.link, None if self._meta: yield "meta", self.meta def __eq__(self, other: Any) -> bool: if not isinstance(other, Style): return NotImplemented return self.__hash__() == other.__hash__() def __ne__(self, other: Any) -> bool: if not isinstance(other, Style): return NotImplemented return self.__hash__() != other.__hash__() def __hash__(self) -> int: if self._hash is not None: return self._hash self._hash = hash(_hash_getter(self)) return self._hash @property def color(self) -> Optional[Color]: """The foreground color or None if it is not set.""" return self._color @property def bgcolor(self) -> Optional[Color]: """The background color or None if it is not set.""" return self._bgcolor @property def link(self) -> Optional[str]: """Link text, if set.""" return self._link @property def transparent_background(self) -> bool: """Check if the style specified a transparent background.""" return self.bgcolor is None or self.bgcolor.is_default @property def background_style(self) -> "Style": """A Style with background only.""" return Style(bgcolor=self.bgcolor) @property def meta(self) -> Dict[str, Any]: """Get meta information (can not be changed after construction).""" return {} if self._meta is None else cast(Dict[str, Any], loads(self._meta)) @property def without_color(self) -> "Style": """Get a copy of the style with color removed.""" if self._null: return NULL_STYLE style: Style = self.__new__(Style) style._ansi = None style._style_definition = None style._color = None style._bgcolor = None style._attributes = self._attributes style._set_attributes = self._set_attributes style._link = self._link style._link_id = f"{randint(0, 999999)}" if self._link else "" style._null = False style._meta = None style._hash = None return style @classmethod @lru_cache(maxsize=4096) def parse(cls, style_definition: str) -> "Style": """Parse a style definition. Args: style_definition (str): A string containing a style. Raises: errors.StyleSyntaxError: If the style definition syntax is invalid. Returns: `Style`: A Style instance. """ if style_definition.strip() == "none" or not style_definition: return cls.null() STYLE_ATTRIBUTES = cls.STYLE_ATTRIBUTES color: Optional[str] = None bgcolor: Optional[str] = None attributes: Dict[str, Optional[Any]] = {} link: Optional[str] = None words = iter(style_definition.split()) for original_word in words: word = original_word.lower() if word == "on": word = next(words, "") if not word: raise errors.StyleSyntaxError("color expected after 'on'") try: Color.parse(word) except ColorParseError as error: raise errors.StyleSyntaxError( f"unable to parse {word!r} as background color; {error}" ) from None bgcolor = word elif word == "not": word = next(words, "") attribute = STYLE_ATTRIBUTES.get(word) if attribute is None: raise errors.StyleSyntaxError( f"expected style attribute after 'not', found {word!r}" ) attributes[attribute] = False elif word == "link": word = next(words, "") if not word: raise errors.StyleSyntaxError("URL expected after 'link'") link = word elif word in STYLE_ATTRIBUTES: attributes[STYLE_ATTRIBUTES[word]] = True else: try: Color.parse(word) except ColorParseError as error: raise errors.StyleSyntaxError( f"unable to parse {word!r} as color; {error}" ) from None color = word style = Style(color=color, bgcolor=bgcolor, link=link, *attributes) return style @lru_cache(maxsize=1024) def get_html_style(self, theme: Optional[TerminalTheme] = None) -> str: """Get a CSS style rule.""" theme = theme or DEFAULT_TERMINAL_THEME css: List[str] = [] append = css.append color = self.color bgcolor = self.bgcolor if self.reverse: color, bgcolor = bgcolor, color if self.dim: foreground_color = ( theme.foreground_color if color is None else color.get_truecolor(theme) ) color = Color.from_triplet( blend_rgb(foreground_color, theme.background_color, 0.5) ) if color is not None: theme_color = color.get_truecolor(theme) append(f"color: {theme_color.hex}") append(f"text-decoration-color: {theme_color.hex}") if bgcolor is not None: theme_color = bgcolor.get_truecolor(theme, foreground=False) append(f"background-color: {theme_color.hex}") if self.bold: append("font-weight: bold") if self.italic: append("font-style: italic") if self.underline: append("text-decoration: underline") if self.strike: append("text-decoration: line-through") if self.overline: append("text-decoration: overline") return "; ".join(css) @classmethod def combine(cls, styles: Iterable["Style"]) -> "Style": """Combine styles and get result. Args: styles (Iterable[Style]): Styles to combine. Returns: Style: A new style instance. """ iter_styles = iter(styles) return sum(iter_styles, next(iter_styles)) @classmethod def chain(cls, styles: "Style") -> "Style": """Combine styles from positional argument in to a single style. Args: styles (Iterable[Style]): Styles to combine. Returns: Style: A new style instance. """ iter_styles = iter(styles) return sum(iter_styles, next(iter_styles)) def copy(self) -> "Style": """Get a copy of this style. Returns: Style: A new Style instance with identical attributes. """ if self._null: return NULL_STYLE style: Style = self.__new__(Style) style._ansi = self._ansi style._style_definition = self._style_definition style._color = self._color style._bgcolor = self._bgcolor style._attributes = self._attributes style._set_attributes = self._set_attributes style._link = self._link style._link_id = f"{randint(0, 999999)}" if self._link else "" style._hash = self._hash style._null = False style._meta = self._meta return style @lru_cache(maxsize=128) def clear_meta_and_links(self) -> "Style": """Get a copy of this style with link and meta information removed. Returns: Style: New style object. """ if self._null: return NULL_STYLE style: Style = self.__new__(Style) style._ansi = self._ansi style._style_definition = self._style_definition style._color = self._color style._bgcolor = self._bgcolor style._attributes = self._attributes style._set_attributes = self._set_attributes style._link = None style._link_id = "" style._hash = None style._null = False style._meta = None return style def update_link(self, link: Optional[str] = None) -> "Style": """Get a copy with a different value for link. Args: link (str, optional): New value for link. Defaults to None. Returns: Style: A new Style instance. """ style: Style = self.__new__(Style) style._ansi = self._ansi style._style_definition = self._style_definition style._color = self._color style._bgcolor = self._bgcolor style._attributes = self._attributes style._set_attributes = self._set_attributes style._link = link style._link_id = f"{randint(0, 999999)}" if link else "" style._hash = None style._null = False style._meta = self._meta return style def render( self, text: str = "", , color_system: Optional[ColorSystem] = ColorSystem.TRUECOLOR, legacy_windows: bool = False, ) -> str: """Render the ANSI codes for the style. Args: text (str, optional): A string to style. Defaults to "". color_system (Optional[ColorSystem], optional): Color system to render to. Defaults to ColorSystem.TRUECOLOR. Returns: str: A string containing ANSI style codes. """ if not text or color_system is None: return text attrs = self._ansi or self._make_ansi_codes(color_system) rendered = f"\x1b[{attrs}m{text}\x1b[0m" if attrs else text if self._link and not legacy_windows: rendered = ( f"\x1b]8;id={self._link_id};{self._link}\x1b\\{rendered}\x1b]8;;\x1b\\" ) return rendered def test(self, text: Optional[str] = None) -> None: """Write text with style directly to terminal. This method is for testing purposes only. Args: text (Optional[str], optional): Text to style or None for style name. """ text = text or str(self) sys.stdout.write(f"{self.render(text)}\n") @lru_cache(maxsize=1024) def _add(self, style: Optional["Style"]) -> "Style": if style is None or style._null: return self if self._null: return style new_style: Style = self.__new__(Style) new_style._ansi = None new_style._style_definition = None new_style._color = style._color or self._color new_style._bgcolor = style._bgcolor or self._bgcolor new_style._attributes = (self._attributes & ~style._set_attributes) \| ( style._attributes & style._set_attributes ) new_style._set_attributes = self._set_attributes \| style._set_attributes new_style._link = style._link or self._link new_style._link_id = style._link_id or self._link_id new_style._null = style._null if self._meta and style._meta: new_style._meta = dumps({self.meta, style.meta}) else: new_style._meta = self._meta or style._meta new_style._hash = None return new_style def __add__(self, style: Optional["Style"]) -> "Style": combined_style = self._add(style) return combined_style.copy() if combined_style.link else combined_style NULL_STYLE = Style() class StyleStack: """A stack of styles.""" __slots__ = ["_stack"] def __init__(self, default_style: "Style") -> None: self._stack: List[Style] = [default_style] def __repr__(self) -> str: return f"<stylestack {self._stack!r}>" @property def current(self) -> Style: """Get the Style at the top of the stack.""" return self._stack[-1] def push(self, style: Style) -> None: """Push a new style on to the stack. Args: style (Style): New style to combine with current style. """ self._stack.append(self._stack[-1] + style) def pop(self) -> Style: """Pop last style and discard. Returns: Style: New current style (also available as stack.current) """ self._stack.pop() return self._stack[-1]	26.36 KB	2026-01-20 12:58
📄 styled.py from typing import TYPE_CHECKING from .measure import Measurement from .segment import Segment from .style import StyleType if TYPE_CHECKING: from .console import Console, ConsoleOptions, RenderResult, RenderableType class Styled: """Apply a style to a renderable. Args: renderable (RenderableType): Any renderable. style (StyleType): A style to apply across the entire renderable. """ def __init__(self, renderable: "RenderableType", style: "StyleType") -> None: self.renderable = renderable self.style = style def __rich_console__( self, console: "Console", options: "ConsoleOptions" ) -> "RenderResult": style = console.get_style(self.style) rendered_segments = console.render(self.renderable, options) segments = Segment.apply_style(rendered_segments, style) return segments def __rich_measure__( self, console: "Console", options: "ConsoleOptions" ) -> Measurement: return Measurement.get(console, options, self.renderable) if __name__ == "__main__": # pragma: no cover from pip._vendor.rich import print from pip._vendor.rich.panel import Panel panel = Styled(Panel("hello"), "on blue") print(panel)	1.23 KB	2026-01-20 12:58
📄 syntax.py from __future__ import annotations import os.path import re import sys import textwrap from abc import ABC, abstractmethod from pathlib import Path from typing import ( Any, Dict, Iterable, List, NamedTuple, Optional, Sequence, Set, Tuple, Type, Union, ) from pip._vendor.pygments.lexer import Lexer from pip._vendor.pygments.lexers import get_lexer_by_name, guess_lexer_for_filename from pip._vendor.pygments.style import Style as PygmentsStyle from pip._vendor.pygments.styles import get_style_by_name from pip._vendor.pygments.token import ( Comment, Error, Generic, Keyword, Name, Number, Operator, String, Token, Whitespace, ) from pip._vendor.pygments.util import ClassNotFound from pip._vendor.rich.containers import Lines from pip._vendor.rich.padding import Padding, PaddingDimensions from ._loop import loop_first from .cells import cell_len from .color import Color, blend_rgb from .console import Console, ConsoleOptions, JustifyMethod, RenderResult from .jupyter import JupyterMixin from .measure import Measurement from .segment import Segment, Segments from .style import Style, StyleType from .text import Text TokenType = Tuple[str, ...] WINDOWS = sys.platform == "win32" DEFAULT_THEME = "monokai" # The following styles are based on https://github.com/pygments/pygments/blob/master/pygments/formatters/terminal.py # A few modifications were made ANSI_LIGHT: Dict[TokenType, Style] = { Token: Style(), Whitespace: Style(color="white"), Comment: Style(dim=True), Comment.Preproc: Style(color="cyan"), Keyword: Style(color="blue"), Keyword.Type: Style(color="cyan"), Operator.Word: Style(color="magenta"), Name.Builtin: Style(color="cyan"), Name.Function: Style(color="green"), Name.Namespace: Style(color="cyan", underline=True), Name.Class: Style(color="green", underline=True), Name.Exception: Style(color="cyan"), Name.Decorator: Style(color="magenta", bold=True), Name.Variable: Style(color="red"), Name.Constant: Style(color="red"), Name.Attribute: Style(color="cyan"), Name.Tag: Style(color="bright_blue"), String: Style(color="yellow"), Number: Style(color="blue"), Generic.Deleted: Style(color="bright_red"), Generic.Inserted: Style(color="green"), Generic.Heading: Style(bold=True), Generic.Subheading: Style(color="magenta", bold=True), Generic.Prompt: Style(bold=True), Generic.Error: Style(color="bright_red"), Error: Style(color="red", underline=True), } ANSI_DARK: Dict[TokenType, Style] = { Token: Style(), Whitespace: Style(color="bright_black"), Comment: Style(dim=True), Comment.Preproc: Style(color="bright_cyan"), Keyword: Style(color="bright_blue"), Keyword.Type: Style(color="bright_cyan"), Operator.Word: Style(color="bright_magenta"), Name.Builtin: Style(color="bright_cyan"), Name.Function: Style(color="bright_green"), Name.Namespace: Style(color="bright_cyan", underline=True), Name.Class: Style(color="bright_green", underline=True), Name.Exception: Style(color="bright_cyan"), Name.Decorator: Style(color="bright_magenta", bold=True), Name.Variable: Style(color="bright_red"), Name.Constant: Style(color="bright_red"), Name.Attribute: Style(color="bright_cyan"), Name.Tag: Style(color="bright_blue"), String: Style(color="yellow"), Number: Style(color="bright_blue"), Generic.Deleted: Style(color="bright_red"), Generic.Inserted: Style(color="bright_green"), Generic.Heading: Style(bold=True), Generic.Subheading: Style(color="bright_magenta", bold=True), Generic.Prompt: Style(bold=True), Generic.Error: Style(color="bright_red"), Error: Style(color="red", underline=True), } RICH_SYNTAX_THEMES = {"ansi_light": ANSI_LIGHT, "ansi_dark": ANSI_DARK} NUMBERS_COLUMN_DEFAULT_PADDING = 2 class SyntaxTheme(ABC): """Base class for a syntax theme.""" @abstractmethod def get_style_for_token(self, token_type: TokenType) -> Style: """Get a style for a given Pygments token.""" raise NotImplementedError # pragma: no cover @abstractmethod def get_background_style(self) -> Style: """Get the background color.""" raise NotImplementedError # pragma: no cover class PygmentsSyntaxTheme(SyntaxTheme): """Syntax theme that delegates to Pygments theme.""" def __init__(self, theme: Union[str, Type[PygmentsStyle]]) -> None: self._style_cache: Dict[TokenType, Style] = {} if isinstance(theme, str): try: self._pygments_style_class = get_style_by_name(theme) except ClassNotFound: self._pygments_style_class = get_style_by_name("default") else: self._pygments_style_class = theme self._background_color = self._pygments_style_class.background_color self._background_style = Style(bgcolor=self._background_color) def get_style_for_token(self, token_type: TokenType) -> Style: """Get a style from a Pygments class.""" try: return self._style_cache[token_type] except KeyError: try: pygments_style = self._pygments_style_class.style_for_token(token_type) except KeyError: style = Style.null() else: color = pygments_style["color"] bgcolor = pygments_style["bgcolor"] style = Style( color="#" + color if color else "#000000", bgcolor="#" + bgcolor if bgcolor else self._background_color, bold=pygments_style["bold"], italic=pygments_style["italic"], underline=pygments_style["underline"], ) self._style_cache[token_type] = style return style def get_background_style(self) -> Style: return self._background_style class ANSISyntaxTheme(SyntaxTheme): """Syntax theme to use standard colors.""" def __init__(self, style_map: Dict[TokenType, Style]) -> None: self.style_map = style_map self._missing_style = Style.null() self._background_style = Style.null() self._style_cache: Dict[TokenType, Style] = {} def get_style_for_token(self, token_type: TokenType) -> Style: """Look up style in the style map.""" try: return self._style_cache[token_type] except KeyError: # Styles form a hierarchy # We need to go from most to least specific # e.g. ("foo", "bar", "baz") to ("foo", "bar") to ("foo",) get_style = self.style_map.get token = tuple(token_type) style = self._missing_style while token: _style = get_style(token) if _style is not None: style = _style break token = token[:-1] self._style_cache[token_type] = style return style def get_background_style(self) -> Style: return self._background_style SyntaxPosition = Tuple[int, int] class _SyntaxHighlightRange(NamedTuple): """ A range to highlight in a Syntax object. `start` and `end` are 2-integers tuples, where the first integer is the line number (starting from 1) and the second integer is the column index (starting from 0). """ style: StyleType start: SyntaxPosition end: SyntaxPosition style_before: bool = False class PaddingProperty: """Descriptor to get and set padding.""" def __get__(self, obj: Syntax, objtype: Type[Syntax]) -> Tuple[int, int, int, int]: """Space around the Syntax.""" return obj._padding def __set__(self, obj: Syntax, padding: PaddingDimensions) -> None: obj._padding = Padding.unpack(padding) class Syntax(JupyterMixin): """Construct a Syntax object to render syntax highlighted code. Args: code (str): Code to highlight. lexer (Lexer \| str): Lexer to use (see https://pygments.org/docs/lexers/) theme (str, optional): Color theme, aka Pygments style (see https://pygments.org/docs/styles/#getting-a-list-of-available-styles). Defaults to "monokai". dedent (bool, optional): Enable stripping of initial whitespace. Defaults to False. line_numbers (bool, optional): Enable rendering of line numbers. Defaults to False. start_line (int, optional): Starting number for line numbers. Defaults to 1. line_range (Tuple[int \| None, int \| None], optional): If given should be a tuple of the start and end line to render. A value of None in the tuple indicates the range is open in that direction. highlight_lines (Set[int]): A set of line numbers to highlight. code_width: Width of code to render (not including line numbers), or ``None`` to use all available width. tab_size (int, optional): Size of tabs. Defaults to 4. word_wrap (bool, optional): Enable word wrapping. background_color (str, optional): Optional background color, or None to use theme color. Defaults to None. indent_guides (bool, optional): Show indent guides. Defaults to False. padding (PaddingDimensions): Padding to apply around the syntax. Defaults to 0 (no padding). """ _pygments_style_class: Type[PygmentsStyle] _theme: SyntaxTheme @classmethod def get_theme(cls, name: Union[str, SyntaxTheme]) -> SyntaxTheme: """Get a syntax theme instance.""" if isinstance(name, SyntaxTheme): return name theme: SyntaxTheme if name in RICH_SYNTAX_THEMES: theme = ANSISyntaxTheme(RICH_SYNTAX_THEMES[name]) else: theme = PygmentsSyntaxTheme(name) return theme def __init__( self, code: str, lexer: Union[Lexer, str], , theme: Union[str, SyntaxTheme] = DEFAULT_THEME, dedent: bool = False, line_numbers: bool = False, start_line: int = 1, line_range: Optional[Tuple[Optional[int], Optional[int]]] = None, highlight_lines: Optional[Set[int]] = None, code_width: Optional[int] = None, tab_size: int = 4, word_wrap: bool = False, background_color: Optional[str] = None, indent_guides: bool = False, padding: PaddingDimensions = 0, ) -> None: self.code = code self._lexer = lexer self.dedent = dedent self.line_numbers = line_numbers self.start_line = start_line self.line_range = line_range self.highlight_lines = highlight_lines or set() self.code_width = code_width self.tab_size = tab_size self.word_wrap = word_wrap self.background_color = background_color self.background_style = ( Style(bgcolor=background_color) if background_color else Style() ) self.indent_guides = indent_guides self._padding = Padding.unpack(padding) self._theme = self.get_theme(theme) self._stylized_ranges: List[_SyntaxHighlightRange] = [] padding = PaddingProperty() @classmethod def from_path( cls, path: str, encoding: str = "utf-8", lexer: Optional[Union[Lexer, str]] = None, theme: Union[str, SyntaxTheme] = DEFAULT_THEME, dedent: bool = False, line_numbers: bool = False, line_range: Optional[Tuple[int, int]] = None, start_line: int = 1, highlight_lines: Optional[Set[int]] = None, code_width: Optional[int] = None, tab_size: int = 4, word_wrap: bool = False, background_color: Optional[str] = None, indent_guides: bool = False, padding: PaddingDimensions = 0, ) -> "Syntax": """Construct a Syntax object from a file. Args: path (str): Path to file to highlight. encoding (str): Encoding of file. lexer (str \| Lexer, optional): Lexer to use. If None, lexer will be auto-detected from path/file content. theme (str, optional): Color theme, aka Pygments style (see https://pygments.org/docs/styles/#getting-a-list-of-available-styles). Defaults to "emacs". dedent (bool, optional): Enable stripping of initial whitespace. Defaults to True. line_numbers (bool, optional): Enable rendering of line numbers. Defaults to False. start_line (int, optional): Starting number for line numbers. Defaults to 1. line_range (Tuple[int, int], optional): If given should be a tuple of the start and end line to render. highlight_lines (Set[int]): A set of line numbers to highlight. code_width: Width of code to render (not including line numbers), or ``None`` to use all available width. tab_size (int, optional): Size of tabs. Defaults to 4. word_wrap (bool, optional): Enable word wrapping of code. background_color (str, optional): Optional background color, or None to use theme color. Defaults to None. indent_guides (bool, optional): Show indent guides. Defaults to False. padding (PaddingDimensions): Padding to apply around the syntax. Defaults to 0 (no padding). Returns: [Syntax]: A Syntax object that may be printed to the console """ code = Path(path).read_text(encoding=encoding) if not lexer: lexer = cls.guess_lexer(path, code=code) return cls( code, lexer, theme=theme, dedent=dedent, line_numbers=line_numbers, line_range=line_range, start_line=start_line, highlight_lines=highlight_lines, code_width=code_width, tab_size=tab_size, word_wrap=word_wrap, background_color=background_color, indent_guides=indent_guides, padding=padding, ) @classmethod def guess_lexer(cls, path: str, code: Optional[str] = None) -> str: """Guess the alias of the Pygments lexer to use based on a path and an optional string of code. If code is supplied, it will use a combination of the code and the filename to determine the best lexer to use. For example, if the file is ``index.html`` and the file contains Django templating syntax, then "html+django" will be returned. If the file is ``index.html``, and no templating language is used, the "html" lexer will be used. If no string of code is supplied, the lexer will be chosen based on the file extension.. Args: path (AnyStr): The path to the file containing the code you wish to know the lexer for. code (str, optional): Optional string of code that will be used as a fallback if no lexer is found for the supplied path. Returns: str: The name of the Pygments lexer that best matches the supplied path/code. """ lexer: Optional[Lexer] = None lexer_name = "default" if code: try: lexer = guess_lexer_for_filename(path, code) except ClassNotFound: pass if not lexer: try: _, ext = os.path.splitext(path) if ext: extension = ext.lstrip(".").lower() lexer = get_lexer_by_name(extension) except ClassNotFound: pass if lexer: if lexer.aliases: lexer_name = lexer.aliases[0] else: lexer_name = lexer.name return lexer_name def _get_base_style(self) -> Style: """Get the base style.""" default_style = self._theme.get_background_style() + self.background_style return default_style def _get_token_color(self, token_type: TokenType) -> Optional[Color]: """Get a color (if any) for the given token. Args: token_type (TokenType): A token type tuple from Pygments. Returns: Optional[Color]: Color from theme, or None for no color. """ style = self._theme.get_style_for_token(token_type) return style.color @property def lexer(self) -> Optional[Lexer]: """The lexer for this syntax, or None if no lexer was found. Tries to find the lexer by name if a string was passed to the constructor. """ if isinstance(self._lexer, Lexer): return self._lexer try: return get_lexer_by_name( self._lexer, stripnl=False, ensurenl=True, tabsize=self.tab_size, ) except ClassNotFound: return None @property def default_lexer(self) -> Lexer: """A Pygments Lexer to use if one is not specified or invalid.""" return get_lexer_by_name( "text", stripnl=False, ensurenl=True, tabsize=self.tab_size, ) def highlight( self, code: str, line_range: Optional[Tuple[Optional[int], Optional[int]]] = None, ) -> Text: """Highlight code and return a Text instance. Args: code (str): Code to highlight. line_range(Tuple[int, int], optional): Optional line range to highlight. Returns: Text: A text instance containing highlighted syntax. """ base_style = self._get_base_style() justify: JustifyMethod = ( "default" if base_style.transparent_background else "left" ) text = Text( justify=justify, style=base_style, tab_size=self.tab_size, no_wrap=not self.word_wrap, ) _get_theme_style = self._theme.get_style_for_token lexer = self.lexer or self.default_lexer if lexer is None: text.append(code) else: if line_range: # More complicated path to only stylize a portion of the code # This speeds up further operations as there are less spans to process line_start, line_end = line_range def line_tokenize() -> Iterable[Tuple[Any, str]]: """Split tokens to one per line.""" assert lexer # required to make MyPy happy - we know lexer is not None at this point for token_type, token in lexer.get_tokens(code): while token: line_token, new_line, token = token.partition("\n") yield token_type, line_token + new_line def tokens_to_spans() -> Iterable[Tuple[str, Optional[Style]]]: """Convert tokens to spans.""" tokens = iter(line_tokenize()) line_no = 0 _line_start = line_start - 1 if line_start else 0 # Skip over tokens until line start while line_no < _line_start: try: _token_type, token = next(tokens) except StopIteration: break yield (token, None) if token.endswith("\n"): line_no += 1 # Generate spans until line end for token_type, token in tokens: yield (token, _get_theme_style(token_type)) if token.endswith("\n"): line_no += 1 if line_end and line_no >= line_end: break text.append_tokens(tokens_to_spans()) else: text.append_tokens( (token, _get_theme_style(token_type)) for token_type, token in lexer.get_tokens(code) ) if self.background_color is not None: text.stylize(f"on {self.background_color}") if self._stylized_ranges: self._apply_stylized_ranges(text) return text def stylize_range( self, style: StyleType, start: SyntaxPosition, end: SyntaxPosition, style_before: bool = False, ) -> None: """ Adds a custom style on a part of the code, that will be applied to the syntax display when it's rendered. Line numbers are 1-based, while column indexes are 0-based. Args: style (StyleType): The style to apply. start (Tuple[int, int]): The start of the range, in the form `[line number, column index]`. end (Tuple[int, int]): The end of the range, in the form `[line number, column index]`. style_before (bool): Apply the style before any existing styles. """ self._stylized_ranges.append( _SyntaxHighlightRange(style, start, end, style_before) ) def _get_line_numbers_color(self, blend: float = 0.3) -> Color: background_style = self._theme.get_background_style() + self.background_style background_color = background_style.bgcolor if background_color is None or background_color.is_system_defined: return Color.default() foreground_color = self._get_token_color(Token.Text) if foreground_color is None or foreground_color.is_system_defined: return foreground_color or Color.default() new_color = blend_rgb( background_color.get_truecolor(), foreground_color.get_truecolor(), cross_fade=blend, ) return Color.from_triplet(new_color) @property def _numbers_column_width(self) -> int: """Get the number of characters used to render the numbers column.""" column_width = 0 if self.line_numbers: column_width = ( len(str(self.start_line + self.code.count("\n"))) + NUMBERS_COLUMN_DEFAULT_PADDING ) return column_width def _get_number_styles(self, console: Console) -> Tuple[Style, Style, Style]: """Get background, number, and highlight styles for line numbers.""" background_style = self._get_base_style() if background_style.transparent_background: return Style.null(), Style(dim=True), Style.null() if console.color_system in ("256", "truecolor"): number_style = Style.chain( background_style, self._theme.get_style_for_token(Token.Text), Style(color=self._get_line_numbers_color()), self.background_style, ) highlight_number_style = Style.chain( background_style, self._theme.get_style_for_token(Token.Text), Style(bold=True, color=self._get_line_numbers_color(0.9)), self.background_style, ) else: number_style = background_style + Style(dim=True) highlight_number_style = background_style + Style(dim=False) return background_style, number_style, highlight_number_style def __rich_measure__( self, console: "Console", options: "ConsoleOptions" ) -> "Measurement": _, right, _, left = self.padding padding = left + right if self.code_width is not None: width = self.code_width + self._numbers_column_width + padding + 1 return Measurement(self._numbers_column_width, width) lines = self.code.splitlines() width = ( self._numbers_column_width + padding + (max(cell_len(line) for line in lines) if lines else 0) ) if self.line_numbers: width += 1 return Measurement(self._numbers_column_width, width) def __rich_console__( self, console: Console, options: ConsoleOptions ) -> RenderResult: segments = Segments(self._get_syntax(console, options)) if any(self.padding): yield Padding(segments, style=self._get_base_style(), pad=self.padding) else: yield segments def _get_syntax( self, console: Console, options: ConsoleOptions, ) -> Iterable[Segment]: """ Get the Segments for the Syntax object, excluding any vertical/horizontal padding """ transparent_background = self._get_base_style().transparent_background _pad_top, pad_right, _pad_bottom, pad_left = self.padding horizontal_padding = pad_left + pad_right code_width = ( ( (options.max_width - self._numbers_column_width - 1) if self.line_numbers else options.max_width ) - horizontal_padding if self.code_width is None else self.code_width ) code_width = max(0, code_width) ends_on_nl, processed_code = self._process_code(self.code) text = self.highlight(processed_code, self.line_range) if not self.line_numbers and not self.word_wrap and not self.line_range: if not ends_on_nl: text.remove_suffix("\n") # Simple case of just rendering text style = ( self._get_base_style() + self._theme.get_style_for_token(Comment) + Style(dim=True) + self.background_style ) if self.indent_guides and not options.ascii_only: text = text.with_indent_guides(self.tab_size, style=style) text.overflow = "crop" if style.transparent_background: yield from console.render( text, options=options.update(width=code_width) ) else: syntax_lines = console.render_lines( text, options.update(width=code_width, height=None, justify="left"), style=self.background_style, pad=True, new_lines=True, ) for syntax_line in syntax_lines: yield from syntax_line return start_line, end_line = self.line_range or (None, None) line_offset = 0 if start_line: line_offset = max(0, start_line - 1) lines: Union[List[Text], Lines] = text.split("\n", allow_blank=ends_on_nl) if self.line_range: if line_offset > len(lines): return lines = lines[line_offset:end_line] if self.indent_guides and not options.ascii_only: style = ( self._get_base_style() + self._theme.get_style_for_token(Comment) + Style(dim=True) + self.background_style ) lines = ( Text("\n") .join(lines) .with_indent_guides(self.tab_size, style=style + Style(italic=False)) .split("\n", allow_blank=True) ) numbers_column_width = self._numbers_column_width render_options = options.update(width=code_width) highlight_line = self.highlight_lines.__contains__ _Segment = Segment new_line = _Segment("\n") line_pointer = "> " if options.legacy_windows else "❱ " ( background_style, number_style, highlight_number_style, ) = self._get_number_styles(console) for line_no, line in enumerate(lines, self.start_line + line_offset): if self.word_wrap: wrapped_lines = console.render_lines( line, render_options.update(height=None, justify="left"), style=background_style, pad=not transparent_background, ) else: segments = list(line.render(console, end="")) if options.no_wrap: wrapped_lines = [segments] else: wrapped_lines = [ _Segment.adjust_line_length( segments, render_options.max_width, style=background_style, pad=not transparent_background, ) ] if self.line_numbers: wrapped_line_left_pad = _Segment( " " numbers_column_width + " ", background_style ) for first, wrapped_line in loop_first(wrapped_lines): if first: line_column = str(line_no).rjust(numbers_column_width - 2) + " " if highlight_line(line_no): yield _Segment(line_pointer, Style(color="red")) yield _Segment(line_column, highlight_number_style) else: yield _Segment(" ", highlight_number_style) yield _Segment(line_column, number_style) else: yield wrapped_line_left_pad yield from wrapped_line yield new_line else: for wrapped_line in wrapped_lines: yield from wrapped_line yield new_line def _apply_stylized_ranges(self, text: Text) -> None: """ Apply stylized ranges to a text instance, using the given code to determine the right portion to apply the style to. Args: text (Text): Text instance to apply the style to. """ code = text.plain newlines_offsets = [ # Let's add outer boundaries at each side of the list: 0, # N.B. using "\n" here is much faster than using metacharacters such as "^" or "\Z": *[ match.start() + 1 for match in re.finditer("\n", code, flags=re.MULTILINE) ], len(code) + 1, ] for stylized_range in self._stylized_ranges: start = _get_code_index_for_syntax_position( newlines_offsets, stylized_range.start ) end = _get_code_index_for_syntax_position( newlines_offsets, stylized_range.end ) if start is not None and end is not None: if stylized_range.style_before: text.stylize_before(stylized_range.style, start, end) else: text.stylize(stylized_range.style, start, end) def _process_code(self, code: str) -> Tuple[bool, str]: """ Applies various processing to a raw code string (normalises it so it always ends with a line return, dedents it if necessary, etc.) Args: code (str): The raw code string to process Returns: Tuple[bool, str]: the boolean indicates whether the raw code ends with a line return, while the string is the processed code. """ ends_on_nl = code.endswith("\n") processed_code = code if ends_on_nl else code + "\n" processed_code = ( textwrap.dedent(processed_code) if self.dedent else processed_code ) processed_code = processed_code.expandtabs(self.tab_size) return ends_on_nl, processed_code def _get_code_index_for_syntax_position( newlines_offsets: Sequence[int], position: SyntaxPosition ) -> Optional[int]: """ Returns the index of the code string for the given positions. Args: newlines_offsets (Sequence[int]): The offset of each newline character found in the code snippet. position (SyntaxPosition): The position to search for. Returns: Optional[int]: The index of the code string for this position, or `None` if the given position's line number is out of range (if it's the column that is out of range we silently clamp its value so that it reaches the end of the line) """ lines_count = len(newlines_offsets) line_number, column_index = position if line_number > lines_count or len(newlines_offsets) < (line_number + 1): return None # `line_number` is out of range line_index = line_number - 1 line_length = newlines_offsets[line_index + 1] - newlines_offsets[line_index] - 1 # If `column_index` is out of range: let's silently clamp it: column_index = min(line_length, column_index) return newlines_offsets[line_index] + column_index if __name__ == "__main__": # pragma: no cover import argparse import sys parser = argparse.ArgumentParser( description="Render syntax to the console with Rich" ) parser.add_argument( "path", metavar="PATH", help="path to file, or - for stdin", ) parser.add_argument( "-c", "--force-color", dest="force_color", action="store_true", default=None, help="force color for non-terminals", ) parser.add_argument( "-i", "--indent-guides", dest="indent_guides", action="store_true", default=False, help="display indent guides", ) parser.add_argument( "-l", "--line-numbers", dest="line_numbers", action="store_true", help="render line numbers", ) parser.add_argument( "-w", "--width", type=int, dest="width", default=None, help="width of output (default will auto-detect)", ) parser.add_argument( "-r", "--wrap", dest="word_wrap", action="store_true", default=False, help="word wrap long lines", ) parser.add_argument( "-s", "--soft-wrap", action="store_true", dest="soft_wrap", default=False, help="enable soft wrapping mode", ) parser.add_argument( "-t", "--theme", dest="theme", default="monokai", help="pygments theme" ) parser.add_argument( "-b", "--background-color", dest="background_color", default=None, help="Override background color", ) parser.add_argument( "-x", "--lexer", default=None, dest="lexer_name", help="Lexer name", ) parser.add_argument( "-p", "--padding", type=int, default=0, dest="padding", help="Padding" ) parser.add_argument( "--highlight-line", type=int, default=None, dest="highlight_line", help="The line number (not index!) to highlight", ) args = parser.parse_args() from pip._vendor.rich.console import Console console = Console(force_terminal=args.force_color, width=args.width) if args.path == "-": code = sys.stdin.read() syntax = Syntax( code=code, lexer=args.lexer_name, line_numbers=args.line_numbers, word_wrap=args.word_wrap, theme=args.theme, background_color=args.background_color, indent_guides=args.indent_guides, padding=args.padding, highlight_lines={args.highlight_line}, ) else: syntax = Syntax.from_path( args.path, lexer=args.lexer_name, line_numbers=args.line_numbers, word_wrap=args.word_wrap, theme=args.theme, background_color=args.background_color, indent_guides=args.indent_guides, padding=args.padding, highlight_lines={args.highlight_line}, ) console.print(syntax, soft_wrap=args.soft_wrap)	35.52 KB	2026-01-20 12:58
📄 table.py from dataclasses import dataclass, field, replace from typing import ( TYPE_CHECKING, Dict, Iterable, List, NamedTuple, Optional, Sequence, Tuple, Union, ) from . import box, errors from ._loop import loop_first_last, loop_last from ._pick import pick_bool from ._ratio import ratio_distribute, ratio_reduce from .align import VerticalAlignMethod from .jupyter import JupyterMixin from .measure import Measurement from .padding import Padding, PaddingDimensions from .protocol import is_renderable from .segment import Segment from .style import Style, StyleType from .text import Text, TextType if TYPE_CHECKING: from .console import ( Console, ConsoleOptions, JustifyMethod, OverflowMethod, RenderableType, RenderResult, ) @dataclass class Column: """Defines a column within a ~Table. Args: title (Union[str, Text], optional): The title of the table rendered at the top. Defaults to None. caption (Union[str, Text], optional): The table caption rendered below. Defaults to None. width (int, optional): The width in characters of the table, or ``None`` to automatically fit. Defaults to None. min_width (Optional[int], optional): The minimum width of the table, or ``None`` for no minimum. Defaults to None. box (box.Box, optional): One of the constants in box.py used to draw the edges (see :ref:`appendix_box`), or ``None`` for no box lines. Defaults to box.HEAVY_HEAD. safe_box (Optional[bool], optional): Disable box characters that don't display on windows legacy terminal with raster fonts. Defaults to True. padding (PaddingDimensions, optional): Padding for cells (top, right, bottom, left). Defaults to (0, 1). collapse_padding (bool, optional): Enable collapsing of padding around cells. Defaults to False. pad_edge (bool, optional): Enable padding of edge cells. Defaults to True. expand (bool, optional): Expand the table to fit the available space if ``True``, otherwise the table width will be auto-calculated. Defaults to False. show_header (bool, optional): Show a header row. Defaults to True. show_footer (bool, optional): Show a footer row. Defaults to False. show_edge (bool, optional): Draw a box around the outside of the table. Defaults to True. show_lines (bool, optional): Draw lines between every row. Defaults to False. leading (int, optional): Number of blank lines between rows (precludes ``show_lines``). Defaults to 0. style (Union[str, Style], optional): Default style for the table. Defaults to "none". row_styles (List[Union, str], optional): Optional list of row styles, if more than one style is given then the styles will alternate. Defaults to None. header_style (Union[str, Style], optional): Style of the header. Defaults to "table.header". footer_style (Union[str, Style], optional): Style of the footer. Defaults to "table.footer". border_style (Union[str, Style], optional): Style of the border. Defaults to None. title_style (Union[str, Style], optional): Style of the title. Defaults to None. caption_style (Union[str, Style], optional): Style of the caption. Defaults to None. title_justify (str, optional): Justify method for title. Defaults to "center". caption_justify (str, optional): Justify method for caption. Defaults to "center". highlight (bool, optional): Highlight cell contents (if str). Defaults to False. """ header: "RenderableType" = "" """RenderableType: Renderable for the header (typically a string)""" footer: "RenderableType" = "" """RenderableType: Renderable for the footer (typically a string)""" header_style: StyleType = "" """StyleType: The style of the header.""" footer_style: StyleType = "" """StyleType: The style of the footer.""" style: StyleType = "" """StyleType: The style of the column.""" justify: "JustifyMethod" = "left" """str: How to justify text within the column ("left", "center", "right", or "full")""" vertical: "VerticalAlignMethod" = "top" """str: How to vertically align content ("top", "middle", or "bottom")""" overflow: "OverflowMethod" = "ellipsis" """str: Overflow method.""" width: Optional[int] = None """Optional[int]: Width of the column, or ``None`` (default) to auto calculate width.""" min_width: Optional[int] = None """Optional[int]: Minimum width of column, or ``None`` for no minimum. Defaults to None.""" max_width: Optional[int] = None """Optional[int]: Maximum width of column, or ``None`` for no maximum. Defaults to None.""" ratio: Optional[int] = None """Optional[int]: Ratio to use when calculating column width, or ``None`` (default) to adapt to column contents.""" no_wrap: bool = False """bool: Prevent wrapping of text within the column. Defaults to ``False``.""" highlight: bool = False """bool: Apply highlighter to column. Defaults to ``False``.""" _index: int = 0 """Index of column.""" _cells: List["RenderableType"] = field(default_factory=list) def copy(self) -> "Column": """Return a copy of this Column.""" return replace(self, _cells=[]) @property def cells(self) -> Iterable["RenderableType"]: """Get all cells in the column, not including header.""" yield from self._cells @property def flexible(self) -> bool: """Check if this column is flexible.""" return self.ratio is not None @dataclass class Row: """Information regarding a row.""" style: Optional[StyleType] = None """Style to apply to row.""" end_section: bool = False """Indicated end of section, which will force a line beneath the row.""" class _Cell(NamedTuple): """A single cell in a table.""" style: StyleType """Style to apply to cell.""" renderable: "RenderableType" """Cell renderable.""" vertical: VerticalAlignMethod """Cell vertical alignment.""" class Table(JupyterMixin): """A console renderable to draw a table. Args: headers (Union[Column, str]): Column headers, either as a string, or :class:`~rich.table.Column` instance. title (Union[str, Text], optional): The title of the table rendered at the top. Defaults to None. caption (Union[str, Text], optional): The table caption rendered below. Defaults to None. width (int, optional): The width in characters of the table, or ``None`` to automatically fit. Defaults to None. min_width (Optional[int], optional): The minimum width of the table, or ``None`` for no minimum. Defaults to None. box (box.Box, optional): One of the constants in box.py used to draw the edges (see :ref:`appendix_box`), or ``None`` for no box lines. Defaults to box.HEAVY_HEAD. safe_box (Optional[bool], optional): Disable box characters that don't display on windows legacy terminal with raster* fonts. Defaults to True. padding (PaddingDimensions, optional): Padding for cells (top, right, bottom, left). Defaults to (0, 1). collapse_padding (bool, optional): Enable collapsing of padding around cells. Defaults to False. pad_edge (bool, optional): Enable padding of edge cells. Defaults to True. expand (bool, optional): Expand the table to fit the available space if ``True``, otherwise the table width will be auto-calculated. Defaults to False. show_header (bool, optional): Show a header row. Defaults to True. show_footer (bool, optional): Show a footer row. Defaults to False. show_edge (bool, optional): Draw a box around the outside of the table. Defaults to True. show_lines (bool, optional): Draw lines between every row. Defaults to False. leading (int, optional): Number of blank lines between rows (precludes ``show_lines``). Defaults to 0. style (Union[str, Style], optional): Default style for the table. Defaults to "none". row_styles (List[Union, str], optional): Optional list of row styles, if more than one style is given then the styles will alternate. Defaults to None. header_style (Union[str, Style], optional): Style of the header. Defaults to "table.header". footer_style (Union[str, Style], optional): Style of the footer. Defaults to "table.footer". border_style (Union[str, Style], optional): Style of the border. Defaults to None. title_style (Union[str, Style], optional): Style of the title. Defaults to None. caption_style (Union[str, Style], optional): Style of the caption. Defaults to None. title_justify (str, optional): Justify method for title. Defaults to "center". caption_justify (str, optional): Justify method for caption. Defaults to "center". highlight (bool, optional): Highlight cell contents (if str). Defaults to False. """ columns: List[Column] rows: List[Row] def __init__( self, headers: Union[Column, str], title: Optional[TextType] = None, caption: Optional[TextType] = None, width: Optional[int] = None, min_width: Optional[int] = None, box: Optional[box.Box] = box.HEAVY_HEAD, safe_box: Optional[bool] = None, padding: PaddingDimensions = (0, 1), collapse_padding: bool = False, pad_edge: bool = True, expand: bool = False, show_header: bool = True, show_footer: bool = False, show_edge: bool = True, show_lines: bool = False, leading: int = 0, style: StyleType = "none", row_styles: Optional[Iterable[StyleType]] = None, header_style: Optional[StyleType] = "table.header", footer_style: Optional[StyleType] = "table.footer", border_style: Optional[StyleType] = None, title_style: Optional[StyleType] = None, caption_style: Optional[StyleType] = None, title_justify: "JustifyMethod" = "center", caption_justify: "JustifyMethod" = "center", highlight: bool = False, ) -> None: self.columns: List[Column] = [] self.rows: List[Row] = [] self.title = title self.caption = caption self.width = width self.min_width = min_width self.box = box self.safe_box = safe_box self._padding = Padding.unpack(padding) self.pad_edge = pad_edge self._expand = expand self.show_header = show_header self.show_footer = show_footer self.show_edge = show_edge self.show_lines = show_lines self.leading = leading self.collapse_padding = collapse_padding self.style = style self.header_style = header_style or "" self.footer_style = footer_style or "" self.border_style = border_style self.title_style = title_style self.caption_style = caption_style self.title_justify: "JustifyMethod" = title_justify self.caption_justify: "JustifyMethod" = caption_justify self.highlight = highlight self.row_styles: Sequence[StyleType] = list(row_styles or []) append_column = self.columns.append for header in headers: if isinstance(header, str): self.add_column(header=header) else: header._index = len(self.columns) append_column(header) @classmethod def grid( cls, headers: Union[Column, str], padding: PaddingDimensions = 0, collapse_padding: bool = True, pad_edge: bool = False, expand: bool = False, ) -> "Table": """Get a table with no lines, headers, or footer. Args: headers (Union[Column, str]): Column headers, either as a string, or :class:`~rich.table.Column` instance. padding (PaddingDimensions, optional): Get padding around cells. Defaults to 0. collapse_padding (bool, optional): Enable collapsing of padding around cells. Defaults to True. pad_edge (bool, optional): Enable padding around edges of table. Defaults to False. expand (bool, optional): Expand the table to fit the available space if ``True``, otherwise the table width will be auto-calculated. Defaults to False. Returns: Table: A table instance. """ return cls( headers, box=None, padding=padding, collapse_padding=collapse_padding, show_header=False, show_footer=False, show_edge=False, pad_edge=pad_edge, expand=expand, ) @property def expand(self) -> bool: """Setting a non-None self.width implies expand.""" return self._expand or self.width is not None @expand.setter def expand(self, expand: bool) -> None: """Set expand.""" self._expand = expand @property def _extra_width(self) -> int: """Get extra width to add to cell content.""" width = 0 if self.box and self.show_edge: width += 2 if self.box: width += len(self.columns) - 1 return width @property def row_count(self) -> int: """Get the current number of rows.""" return len(self.rows) def get_row_style(self, console: "Console", index: int) -> StyleType: """Get the current row style.""" style = Style.null() if self.row_styles: style += console.get_style(self.row_styles[index % len(self.row_styles)]) row_style = self.rows[index].style if row_style is not None: style += console.get_style(row_style) return style def __rich_measure__( self, console: "Console", options: "ConsoleOptions" ) -> Measurement: max_width = options.max_width if self.width is not None: max_width = self.width if max_width < 0: return Measurement(0, 0) extra_width = self._extra_width max_width = sum( self._calculate_column_widths( console, options.update_width(max_width - extra_width) ) ) _measure_column = self._measure_column measurements = [ _measure_column(console, options.update_width(max_width), column) for column in self.columns ] minimum_width = ( sum(measurement.minimum for measurement in measurements) + extra_width ) maximum_width = ( sum(measurement.maximum for measurement in measurements) + extra_width if (self.width is None) else self.width ) measurement = Measurement(minimum_width, maximum_width) measurement = measurement.clamp(self.min_width) return measurement @property def padding(self) -> Tuple[int, int, int, int]: """Get cell padding.""" return self._padding @padding.setter def padding(self, padding: PaddingDimensions) -> "Table": """Set cell padding.""" self._padding = Padding.unpack(padding) return self def add_column( self, header: "RenderableType" = "", footer: "RenderableType" = "", , header_style: Optional[StyleType] = None, highlight: Optional[bool] = None, footer_style: Optional[StyleType] = None, style: Optional[StyleType] = None, justify: "JustifyMethod" = "left", vertical: "VerticalAlignMethod" = "top", overflow: "OverflowMethod" = "ellipsis", width: Optional[int] = None, min_width: Optional[int] = None, max_width: Optional[int] = None, ratio: Optional[int] = None, no_wrap: bool = False, ) -> None: """Add a column to the table. Args: header (RenderableType, optional): Text or renderable for the header. Defaults to "". footer (RenderableType, optional): Text or renderable for the footer. Defaults to "". header_style (Union[str, Style], optional): Style for the header, or None for default. Defaults to None. highlight (bool, optional): Whether to highlight the text. The default of None uses the value of the table (self) object. footer_style (Union[str, Style], optional): Style for the footer, or None for default. Defaults to None. style (Union[str, Style], optional): Style for the column cells, or None for default. Defaults to None. justify (JustifyMethod, optional): Alignment for cells. Defaults to "left". vertical (VerticalAlignMethod, optional): Vertical alignment, one of "top", "middle", or "bottom". Defaults to "top". overflow (OverflowMethod): Overflow method: "crop", "fold", "ellipsis". Defaults to "ellipsis". width (int, optional): Desired width of column in characters, or None to fit to contents. Defaults to None. min_width (Optional[int], optional): Minimum width of column, or ``None`` for no minimum. Defaults to None. max_width (Optional[int], optional): Maximum width of column, or ``None`` for no maximum. Defaults to None. ratio (int, optional): Flexible ratio for the column (requires ``Table.expand`` or ``Table.width``). Defaults to None. no_wrap (bool, optional): Set to ``True`` to disable wrapping of this column. """ column = Column( _index=len(self.columns), header=header, footer=footer, header_style=header_style or "", highlight=highlight if highlight is not None else self.highlight, footer_style=footer_style or "", style=style or "", justify=justify, vertical=vertical, overflow=overflow, width=width, min_width=min_width, max_width=max_width, ratio=ratio, no_wrap=no_wrap, ) self.columns.append(column) def add_row( self, renderables: Optional["RenderableType"], style: Optional[StyleType] = None, end_section: bool = False, ) -> None: """Add a row of renderables. Args: renderables (None or renderable): Each cell in a row must be a renderable object (including str), or ``None`` for a blank cell. style (StyleType, optional): An optional style to apply to the entire row. Defaults to None. end_section (bool, optional): End a section and draw a line. Defaults to False. Raises: errors.NotRenderableError: If you add something that can't be rendered. """ def add_cell(column: Column, renderable: "RenderableType") -> None: column._cells.append(renderable) cell_renderables: List[Optional["RenderableType"]] = list(renderables) columns = self.columns if len(cell_renderables) < len(columns): cell_renderables = [ cell_renderables, [None] (len(columns) - len(cell_renderables)), ] for index, renderable in enumerate(cell_renderables): if index == len(columns): column = Column(_index=index, highlight=self.highlight) for _ in self.rows: add_cell(column, Text("")) self.columns.append(column) else: column = columns[index] if renderable is None: add_cell(column, "") elif is_renderable(renderable): add_cell(column, renderable) else: raise errors.NotRenderableError( f"unable to render {type(renderable).__name__}; a string or other renderable object is required" ) self.rows.append(Row(style=style, end_section=end_section)) def add_section(self) -> None: """Add a new section (draw a line after current row).""" if self.rows: self.rows[-1].end_section = True def __rich_console__( self, console: "Console", options: "ConsoleOptions" ) -> "RenderResult": if not self.columns: yield Segment("\n") return max_width = options.max_width if self.width is not None: max_width = self.width extra_width = self._extra_width widths = self._calculate_column_widths( console, options.update_width(max_width - extra_width) ) table_width = sum(widths) + extra_width render_options = options.update( width=table_width, highlight=self.highlight, height=None ) def render_annotation( text: TextType, style: StyleType, justify: "JustifyMethod" = "center" ) -> "RenderResult": render_text = ( console.render_str(text, style=style, highlight=False) if isinstance(text, str) else text ) return console.render( render_text, options=render_options.update(justify=justify) ) if self.title: yield from render_annotation( self.title, style=Style.pick_first(self.title_style, "table.title"), justify=self.title_justify, ) yield from self._render(console, render_options, widths) if self.caption: yield from render_annotation( self.caption, style=Style.pick_first(self.caption_style, "table.caption"), justify=self.caption_justify, ) def _calculate_column_widths( self, console: "Console", options: "ConsoleOptions" ) -> List[int]: """Calculate the widths of each column, including padding, not including borders.""" max_width = options.max_width columns = self.columns width_ranges = [ self._measure_column(console, options, column) for column in columns ] widths = [_range.maximum or 1 for _range in width_ranges] get_padding_width = self._get_padding_width extra_width = self._extra_width if self.expand: ratios = [col.ratio or 0 for col in columns if col.flexible] if any(ratios): fixed_widths = [ 0 if column.flexible else _range.maximum for _range, column in zip(width_ranges, columns) ] flex_minimum = [ (column.width or 1) + get_padding_width(column._index) for column in columns if column.flexible ] flexible_width = max_width - sum(fixed_widths) flex_widths = ratio_distribute(flexible_width, ratios, flex_minimum) iter_flex_widths = iter(flex_widths) for index, column in enumerate(columns): if column.flexible: widths[index] = fixed_widths[index] + next(iter_flex_widths) table_width = sum(widths) if table_width > max_width: widths = self._collapse_widths( widths, [(column.width is None and not column.no_wrap) for column in columns], max_width, ) table_width = sum(widths) # last resort, reduce columns evenly if table_width > max_width: excess_width = table_width - max_width widths = ratio_reduce(excess_width, [1] * len(widths), widths, widths) table_width = sum(widths) width_ranges = [ self._measure_column(console, options.update_width(width), column) for width, column in zip(widths, columns) ] widths = [_range.maximum or 0 for _range in width_ranges] if (table_width < max_width and self.expand) or ( self.min_width is not None and table_width < (self.min_width - extra_width) ): _max_width = ( max_width if self.min_width is None else min(self.min_width - extra_width, max_width) ) pad_widths = ratio_distribute(_max_width - table_width, widths) widths = [_width + pad for _width, pad in zip(widths, pad_widths)] return widths @classmethod def _collapse_widths( cls, widths: List[int], wrapable: List[bool], max_width: int ) -> List[int]: """Reduce widths so that the total is under max_width. Args: widths (List[int]): List of widths. wrapable (List[bool]): List of booleans that indicate if a column may shrink. max_width (int): Maximum width to reduce to. Returns: List[int]: A new list of widths. """ total_width = sum(widths) excess_width = total_width - max_width if any(wrapable): while total_width and excess_width > 0: max_column = max( width for width, allow_wrap in zip(widths, wrapable) if allow_wrap ) second_max_column = max( width if allow_wrap and width != max_column else 0 for width, allow_wrap in zip(widths, wrapable) ) column_difference = max_column - second_max_column ratios = [ (1 if (width == max_column and allow_wrap) else 0) for width, allow_wrap in zip(widths, wrapable) ] if not any(ratios) or not column_difference: break max_reduce = [min(excess_width, column_difference)] * len(widths) widths = ratio_reduce(excess_width, ratios, max_reduce, widths) total_width = sum(widths) excess_width = total_width - max_width return widths def _get_cells( self, console: "Console", column_index: int, column: Column ) -> Iterable[_Cell]: """Get all the cells with padding and optional header.""" collapse_padding = self.collapse_padding pad_edge = self.pad_edge padding = self.padding any_padding = any(padding) first_column = column_index == 0 last_column = column_index == len(self.columns) - 1 _padding_cache: Dict[Tuple[bool, bool], Tuple[int, int, int, int]] = {} def get_padding(first_row: bool, last_row: bool) -> Tuple[int, int, int, int]: cached = _padding_cache.get((first_row, last_row)) if cached: return cached top, right, bottom, left = padding if collapse_padding: if not first_column: left = max(0, left - right) if not last_row: bottom = max(0, top - bottom) if not pad_edge: if first_column: left = 0 if last_column: right = 0 if first_row: top = 0 if last_row: bottom = 0 _padding = (top, right, bottom, left) _padding_cache[(first_row, last_row)] = _padding return _padding raw_cells: List[Tuple[StyleType, "RenderableType"]] = [] _append = raw_cells.append get_style = console.get_style if self.show_header: header_style = get_style(self.header_style or "") + get_style( column.header_style ) _append((header_style, column.header)) cell_style = get_style(column.style or "") for cell in column.cells: _append((cell_style, cell)) if self.show_footer: footer_style = get_style(self.footer_style or "") + get_style( column.footer_style ) _append((footer_style, column.footer)) if any_padding: _Padding = Padding for first, last, (style, renderable) in loop_first_last(raw_cells): yield _Cell( style, _Padding(renderable, get_padding(first, last)), getattr(renderable, "vertical", None) or column.vertical, ) else: for style, renderable in raw_cells: yield _Cell( style, renderable, getattr(renderable, "vertical", None) or column.vertical, ) def _get_padding_width(self, column_index: int) -> int: """Get extra width from padding.""" _, pad_right, _, pad_left = self.padding if self.collapse_padding: if column_index > 0: pad_left = max(0, pad_left - pad_right) return pad_left + pad_right def _measure_column( self, console: "Console", options: "ConsoleOptions", column: Column, ) -> Measurement: """Get the minimum and maximum width of the column.""" max_width = options.max_width if max_width < 1: return Measurement(0, 0) padding_width = self._get_padding_width(column._index) if column.width is not None: # Fixed width column return Measurement( column.width + padding_width, column.width + padding_width ).with_maximum(max_width) # Flexible column, we need to measure contents min_widths: List[int] = [] max_widths: List[int] = [] append_min = min_widths.append append_max = max_widths.append get_render_width = Measurement.get for cell in self._get_cells(console, column._index, column): _min, _max = get_render_width(console, options, cell.renderable) append_min(_min) append_max(_max) measurement = Measurement( max(min_widths) if min_widths else 1, max(max_widths) if max_widths else max_width, ).with_maximum(max_width) measurement = measurement.clamp( None if column.min_width is None else column.min_width + padding_width, None if column.max_width is None else column.max_width + padding_width, ) return measurement def _render( self, console: "Console", options: "ConsoleOptions", widths: List[int] ) -> "RenderResult": table_style = console.get_style(self.style or "") border_style = table_style + console.get_style(self.border_style or "") _column_cells = ( self._get_cells(console, column_index, column) for column_index, column in enumerate(self.columns) ) row_cells: List[Tuple[_Cell, ...]] = list(zip(_column_cells)) _box = ( self.box.substitute( options, safe=pick_bool(self.safe_box, console.safe_box) ) if self.box else None ) _box = _box.get_plain_headed_box() if _box and not self.show_header else _box new_line = Segment.line() columns = self.columns show_header = self.show_header show_footer = self.show_footer show_edge = self.show_edge show_lines = self.show_lines leading = self.leading _Segment = Segment if _box: box_segments = [ ( _Segment(_box.head_left, border_style), _Segment(_box.head_right, border_style), _Segment(_box.head_vertical, border_style), ), ( _Segment(_box.mid_left, border_style), _Segment(_box.mid_right, border_style), _Segment(_box.mid_vertical, border_style), ), ( _Segment(_box.foot_left, border_style), _Segment(_box.foot_right, border_style), _Segment(_box.foot_vertical, border_style), ), ] if show_edge: yield _Segment(_box.get_top(widths), border_style) yield new_line else: box_segments = [] get_row_style = self.get_row_style get_style = console.get_style for index, (first, last, row_cell) in enumerate(loop_first_last(row_cells)): header_row = first and show_header footer_row = last and show_footer row = ( self.rows[index - show_header] if (not header_row and not footer_row) else None ) max_height = 1 cells: List[List[List[Segment]]] = [] if header_row or footer_row: row_style = Style.null() else: row_style = get_style( get_row_style(console, index - 1 if show_header else index) ) for width, cell, column in zip(widths, row_cell, columns): render_options = options.update( width=width, justify=column.justify, no_wrap=column.no_wrap, overflow=column.overflow, height=None, highlight=column.highlight, ) lines = console.render_lines( cell.renderable, render_options, style=get_style(cell.style) + row_style, ) max_height = max(max_height, len(lines)) cells.append(lines) row_height = max(len(cell) for cell in cells) def align_cell( cell: List[List[Segment]], vertical: "VerticalAlignMethod", width: int, style: Style, ) -> List[List[Segment]]: if header_row: vertical = "bottom" elif footer_row: vertical = "top" if vertical == "top": return _Segment.align_top(cell, width, row_height, style) elif vertical == "middle": return _Segment.align_middle(cell, width, row_height, style) return _Segment.align_bottom(cell, width, row_height, style) cells[:] = [ _Segment.set_shape( align_cell( cell, _cell.vertical, width, get_style(_cell.style) + row_style, ), width, max_height, ) for width, _cell, cell, column in zip(widths, row_cell, cells, columns) ] if _box: if last and show_footer: yield _Segment( _box.get_row(widths, "foot", edge=show_edge), border_style ) yield new_line left, right, _divider = box_segments[0 if first else (2 if last else 1)] # If the column divider is whitespace also style it with the row background divider = ( _divider if _divider.text.strip() else _Segment( _divider.text, row_style.background_style + _divider.style ) ) for line_no in range(max_height): if show_edge: yield left for last_cell, rendered_cell in loop_last(cells): yield from rendered_cell[line_no] if not last_cell: yield divider if show_edge: yield right yield new_line else: for line_no in range(max_height): for rendered_cell in cells: yield from rendered_cell[line_no] yield new_line if _box and first and show_header: yield _Segment( _box.get_row(widths, "head", edge=show_edge), border_style ) yield new_line end_section = row and row.end_section if _box and (show_lines or leading or end_section): if ( not last and not (show_footer and index >= len(row_cells) - 2) and not (show_header and header_row) ): if leading: yield _Segment( _box.get_row(widths, "mid", edge=show_edge) leading, border_style, ) else: yield _Segment( _box.get_row(widths, "row", edge=show_edge), border_style ) yield new_line if _box and show_edge: yield _Segment(_box.get_bottom(widths), border_style) yield new_line if __name__ == "__main__": # pragma: no cover from pip._vendor.rich.console import Console from pip._vendor.rich.highlighter import ReprHighlighter from ._timer import timer with timer("Table render"): table = Table( title="Star Wars Movies", caption="Rich example table", caption_justify="right", ) table.add_column( "Released", header_style="bright_cyan", style="cyan", no_wrap=True ) table.add_column("Title", style="magenta") table.add_column("Box Office", justify="right", style="green") table.add_row( "Dec 20, 2019", "Star Wars: The Rise of Skywalker", "$952,110,690", ) table.add_row("May 25, 2018", "Solo: A Star Wars Story", "$393,151,347") table.add_row( "Dec 15, 2017", "Star Wars Ep. V111: The Last Jedi", "$1,332,539,889", style="on black", end_section=True, ) table.add_row( "Dec 16, 2016", "Rogue One: A Star Wars Story", "$1,332,439,889", ) def header(text: str) -> None: console.print() console.rule(highlight(text)) console.print() console = Console() highlight = ReprHighlighter() header("Example Table") console.print(table, justify="center") table.expand = True header("expand=True") console.print(table) table.width = 50 header("width=50") console.print(table, justify="center") table.width = None table.expand = False table.row_styles = ["dim", "none"] header("row_styles=['dim', 'none']") console.print(table, justify="center") table.width = None table.expand = False table.row_styles = ["dim", "none"] table.leading = 1 header("leading=1, row_styles=['dim', 'none']") console.print(table, justify="center") table.width = None table.expand = False table.row_styles = ["dim", "none"] table.show_lines = True table.leading = 0 header("show_lines=True, row_styles=['dim', 'none']") console.print(table, justify="center")	39.11 KB	2026-01-20 12:58
📄 terminal_theme.py from typing import List, Optional, Tuple from .color_triplet import ColorTriplet from .palette import Palette _ColorTuple = Tuple[int, int, int] class TerminalTheme: """A color theme used when exporting console content. Args: background (Tuple[int, int, int]): The background color. foreground (Tuple[int, int, int]): The foreground (text) color. normal (List[Tuple[int, int, int]]): A list of 8 normal intensity colors. bright (List[Tuple[int, int, int]], optional): A list of 8 bright colors, or None to repeat normal intensity. Defaults to None. """ def __init__( self, background: _ColorTuple, foreground: _ColorTuple, normal: List[_ColorTuple], bright: Optional[List[_ColorTuple]] = None, ) -> None: self.background_color = ColorTriplet(background) self.foreground_color = ColorTriplet(foreground) self.ansi_colors = Palette(normal + (bright or normal)) DEFAULT_TERMINAL_THEME = TerminalTheme( (255, 255, 255), (0, 0, 0), [ (0, 0, 0), (128, 0, 0), (0, 128, 0), (128, 128, 0), (0, 0, 128), (128, 0, 128), (0, 128, 128), (192, 192, 192), ], [ (128, 128, 128), (255, 0, 0), (0, 255, 0), (255, 255, 0), (0, 0, 255), (255, 0, 255), (0, 255, 255), (255, 255, 255), ], ) MONOKAI = TerminalTheme( (12, 12, 12), (217, 217, 217), [ (26, 26, 26), (244, 0, 95), (152, 224, 36), (253, 151, 31), (157, 101, 255), (244, 0, 95), (88, 209, 235), (196, 197, 181), (98, 94, 76), ], [ (244, 0, 95), (152, 224, 36), (224, 213, 97), (157, 101, 255), (244, 0, 95), (88, 209, 235), (246, 246, 239), ], ) DIMMED_MONOKAI = TerminalTheme( (25, 25, 25), (185, 188, 186), [ (58, 61, 67), (190, 63, 72), (135, 154, 59), (197, 166, 53), (79, 118, 161), (133, 92, 141), (87, 143, 164), (185, 188, 186), (136, 137, 135), ], [ (251, 0, 31), (15, 114, 47), (196, 112, 51), (24, 109, 227), (251, 0, 103), (46, 112, 109), (253, 255, 185), ], ) NIGHT_OWLISH = TerminalTheme( (255, 255, 255), (64, 63, 83), [ (1, 22, 39), (211, 66, 62), (42, 162, 152), (218, 170, 1), (72, 118, 214), (64, 63, 83), (8, 145, 106), (122, 129, 129), (122, 129, 129), ], [ (247, 110, 110), (73, 208, 197), (218, 194, 107), (92, 167, 228), (105, 112, 152), (0, 201, 144), (152, 159, 177), ], ) SVG_EXPORT_THEME = TerminalTheme( (41, 41, 41), (197, 200, 198), [ (75, 78, 85), (204, 85, 90), (152, 168, 75), (208, 179, 68), (96, 138, 177), (152, 114, 159), (104, 160, 179), (197, 200, 198), (154, 155, 153), ], [ (255, 38, 39), (0, 130, 61), (208, 132, 66), (25, 132, 233), (255, 44, 122), (57, 130, 128), (253, 253, 197), ], )	3.29 KB	2026-01-20 12:58
📄 text.py import re from functools import partial, reduce from math import gcd from operator import itemgetter from typing import ( TYPE_CHECKING, Any, Callable, Dict, Iterable, List, NamedTuple, Optional, Pattern, Tuple, Union, ) from ._loop import loop_last from ._pick import pick_bool from ._wrap import divide_line from .align import AlignMethod from .cells import cell_len, set_cell_size from .containers import Lines from .control import strip_control_codes from .emoji import EmojiVariant from .jupyter import JupyterMixin from .measure import Measurement from .segment import Segment from .style import Style, StyleType if TYPE_CHECKING: # pragma: no cover from .console import Console, ConsoleOptions, JustifyMethod, OverflowMethod DEFAULT_JUSTIFY: "JustifyMethod" = "default" DEFAULT_OVERFLOW: "OverflowMethod" = "fold" _re_whitespace = re.compile(r"\s+$") TextType = Union[str, "Text"] """A plain string or a :class:`Text` instance.""" GetStyleCallable = Callable[[str], Optional[StyleType]] class Span(NamedTuple): """A marked up region in some text.""" start: int """Span start index.""" end: int """Span end index.""" style: Union[str, Style] """Style associated with the span.""" def __repr__(self) -> str: return f"Span({self.start}, {self.end}, {self.style!r})" def __bool__(self) -> bool: return self.end > self.start def split(self, offset: int) -> Tuple["Span", Optional["Span"]]: """Split a span in to 2 from a given offset.""" if offset < self.start: return self, None if offset >= self.end: return self, None start, end, style = self span1 = Span(start, min(end, offset), style) span2 = Span(span1.end, end, style) return span1, span2 def move(self, offset: int) -> "Span": """Move start and end by a given offset. Args: offset (int): Number of characters to add to start and end. Returns: TextSpan: A new TextSpan with adjusted position. """ start, end, style = self return Span(start + offset, end + offset, style) def right_crop(self, offset: int) -> "Span": """Crop the span at the given offset. Args: offset (int): A value between start and end. Returns: Span: A new (possibly smaller) span. """ start, end, style = self if offset >= end: return self return Span(start, min(offset, end), style) def extend(self, cells: int) -> "Span": """Extend the span by the given number of cells. Args: cells (int): Additional space to add to end of span. Returns: Span: A span. """ if cells: start, end, style = self return Span(start, end + cells, style) else: return self class Text(JupyterMixin): """Text with color / style. Args: text (str, optional): Default unstyled text. Defaults to "". style (Union[str, Style], optional): Base style for text. Defaults to "". justify (str, optional): Justify method: "left", "center", "full", "right". Defaults to None. overflow (str, optional): Overflow method: "crop", "fold", "ellipsis". Defaults to None. no_wrap (bool, optional): Disable text wrapping, or None for default. Defaults to None. end (str, optional): Character to end text with. Defaults to "\\\\n". tab_size (int): Number of spaces per tab, or ``None`` to use ``console.tab_size``. Defaults to None. spans (List[Span], optional). A list of predefined style spans. Defaults to None. """ __slots__ = [ "_text", "style", "justify", "overflow", "no_wrap", "end", "tab_size", "_spans", "_length", ] def __init__( self, text: str = "", style: Union[str, Style] = "", , justify: Optional["JustifyMethod"] = None, overflow: Optional["OverflowMethod"] = None, no_wrap: Optional[bool] = None, end: str = "\n", tab_size: Optional[int] = None, spans: Optional[List[Span]] = None, ) -> None: sanitized_text = strip_control_codes(text) self._text = [sanitized_text] self.style = style self.justify: Optional["JustifyMethod"] = justify self.overflow: Optional["OverflowMethod"] = overflow self.no_wrap = no_wrap self.end = end self.tab_size = tab_size self._spans: List[Span] = spans or [] self._length: int = len(sanitized_text) def __len__(self) -> int: return self._length def __bool__(self) -> bool: return bool(self._length) def __str__(self) -> str: return self.plain def __repr__(self) -> str: return f"<text {self.plain!r} {self._spans!r} {self.style!r}>" def __add__(self, other: Any) -> "Text": if isinstance(other, (str, Text)): result = self.copy() result.append(other) return result return NotImplemented def __eq__(self, other: object) -> bool: if not isinstance(other, Text): return NotImplemented return self.plain == other.plain and self._spans == other._spans def __contains__(self, other: object) -> bool: if isinstance(other, str): return other in self.plain elif isinstance(other, Text): return other.plain in self.plain return False def __getitem__(self, slice: Union[int, slice]) -> "Text": def get_text_at(offset: int) -> "Text": _Span = Span text = Text( self.plain[offset], spans=[ _Span(0, 1, style) for start, end, style in self._spans if end > offset >= start ], end="", ) return text if isinstance(slice, int): return get_text_at(slice) else: start, stop, step = slice.indices(len(self.plain)) if step == 1: lines = self.divide([start, stop]) return lines[1] else: # This would be a bit of work to implement efficiently # For now, its not required raise TypeError("slices with step!=1 are not supported") @property def cell_len(self) -> int: """Get the number of cells required to render this text.""" return cell_len(self.plain) @property def markup(self) -> str: """Get console markup to render this Text. Returns: str: A string potentially creating markup tags. """ from .markup import escape output: List[str] = [] plain = self.plain markup_spans = [ (0, False, self.style), ((span.start, False, span.style) for span in self._spans), ((span.end, True, span.style) for span in self._spans), (len(plain), True, self.style), ] markup_spans.sort(key=itemgetter(0, 1)) position = 0 append = output.append for offset, closing, style in markup_spans: if offset > position: append(escape(plain[position:offset])) position = offset if style: append(f"[/{style}]" if closing else f"[{style}]") markup = "".join(output) return markup @classmethod def from_markup( cls, text: str, , style: Union[str, Style] = "", emoji: bool = True, emoji_variant: Optional[EmojiVariant] = None, justify: Optional["JustifyMethod"] = None, overflow: Optional["OverflowMethod"] = None, end: str = "\n", ) -> "Text": """Create Text instance from markup. Args: text (str): A string containing console markup. style (Union[str, Style], optional): Base style for text. Defaults to "". emoji (bool, optional): Also render emoji code. Defaults to True. emoji_variant (str, optional): Optional emoji variant, either "text" or "emoji". Defaults to None. justify (str, optional): Justify method: "left", "center", "full", "right". Defaults to None. overflow (str, optional): Overflow method: "crop", "fold", "ellipsis". Defaults to None. end (str, optional): Character to end text with. Defaults to "\\\\n". Returns: Text: A Text instance with markup rendered. """ from .markup import render rendered_text = render(text, style, emoji=emoji, emoji_variant=emoji_variant) rendered_text.justify = justify rendered_text.overflow = overflow rendered_text.end = end return rendered_text @classmethod def from_ansi( cls, text: str, , style: Union[str, Style] = "", justify: Optional["JustifyMethod"] = None, overflow: Optional["OverflowMethod"] = None, no_wrap: Optional[bool] = None, end: str = "\n", tab_size: Optional[int] = 8, ) -> "Text": """Create a Text object from a string containing ANSI escape codes. Args: text (str): A string containing escape codes. style (Union[str, Style], optional): Base style for text. Defaults to "". justify (str, optional): Justify method: "left", "center", "full", "right". Defaults to None. overflow (str, optional): Overflow method: "crop", "fold", "ellipsis". Defaults to None. no_wrap (bool, optional): Disable text wrapping, or None for default. Defaults to None. end (str, optional): Character to end text with. Defaults to "\\\\n". tab_size (int): Number of spaces per tab, or ``None`` to use ``console.tab_size``. Defaults to None. """ from .ansi import AnsiDecoder joiner = Text( "\n", justify=justify, overflow=overflow, no_wrap=no_wrap, end=end, tab_size=tab_size, style=style, ) decoder = AnsiDecoder() result = joiner.join(line for line in decoder.decode(text)) return result @classmethod def styled( cls, text: str, style: StyleType = "", , justify: Optional["JustifyMethod"] = None, overflow: Optional["OverflowMethod"] = None, ) -> "Text": """Construct a Text instance with a pre-applied styled. A style applied in this way won't be used to pad the text when it is justified. Args: text (str): A string containing console markup. style (Union[str, Style]): Style to apply to the text. Defaults to "". justify (str, optional): Justify method: "left", "center", "full", "right". Defaults to None. overflow (str, optional): Overflow method: "crop", "fold", "ellipsis". Defaults to None. Returns: Text: A text instance with a style applied to the entire string. """ styled_text = cls(text, justify=justify, overflow=overflow) styled_text.stylize(style) return styled_text @classmethod def assemble( cls, parts: Union[str, "Text", Tuple[str, StyleType]], style: Union[str, Style] = "", justify: Optional["JustifyMethod"] = None, overflow: Optional["OverflowMethod"] = None, no_wrap: Optional[bool] = None, end: str = "\n", tab_size: int = 8, meta: Optional[Dict[str, Any]] = None, ) -> "Text": """Construct a text instance by combining a sequence of strings with optional styles. The positional arguments should be either strings, or a tuple of string + style. Args: style (Union[str, Style], optional): Base style for text. Defaults to "". justify (str, optional): Justify method: "left", "center", "full", "right". Defaults to None. overflow (str, optional): Overflow method: "crop", "fold", "ellipsis". Defaults to None. no_wrap (bool, optional): Disable text wrapping, or None for default. Defaults to None. end (str, optional): Character to end text with. Defaults to "\\\\n". tab_size (int): Number of spaces per tab, or ``None`` to use ``console.tab_size``. Defaults to None. meta (Dict[str, Any], optional). Meta data to apply to text, or None for no meta data. Default to None Returns: Text: A new text instance. """ text = cls( style=style, justify=justify, overflow=overflow, no_wrap=no_wrap, end=end, tab_size=tab_size, ) append = text.append _Text = Text for part in parts: if isinstance(part, (_Text, str)): append(part) else: append(part) if meta: text.apply_meta(meta) return text @property def plain(self) -> str: """Get the text as a single string.""" if len(self._text) != 1: self._text[:] = ["".join(self._text)] return self._text[0] @plain.setter def plain(self, new_text: str) -> None: """Set the text to a new value.""" if new_text != self.plain: sanitized_text = strip_control_codes(new_text) self._text[:] = [sanitized_text] old_length = self._length self._length = len(sanitized_text) if old_length > self._length: self._trim_spans() @property def spans(self) -> List[Span]: """Get a reference to the internal list of spans.""" return self._spans @spans.setter def spans(self, spans: List[Span]) -> None: """Set spans.""" self._spans = spans[:] def blank_copy(self, plain: str = "") -> "Text": """Return a new Text instance with copied metadata (but not the string or spans).""" copy_self = Text( plain, style=self.style, justify=self.justify, overflow=self.overflow, no_wrap=self.no_wrap, end=self.end, tab_size=self.tab_size, ) return copy_self def copy(self) -> "Text": """Return a copy of this instance.""" copy_self = Text( self.plain, style=self.style, justify=self.justify, overflow=self.overflow, no_wrap=self.no_wrap, end=self.end, tab_size=self.tab_size, ) copy_self._spans[:] = self._spans return copy_self def stylize( self, style: Union[str, Style], start: int = 0, end: Optional[int] = None, ) -> None: """Apply a style to the text, or a portion of the text. Args: style (Union[str, Style]): Style instance or style definition to apply. start (int): Start offset (negative indexing is supported). Defaults to 0. end (Optional[int], optional): End offset (negative indexing is supported), or None for end of text. Defaults to None. """ if style: length = len(self) if start < 0: start = length + start if end is None: end = length if end < 0: end = length + end if start >= length or end <= start: # Span not in text or not valid return self._spans.append(Span(start, min(length, end), style)) def stylize_before( self, style: Union[str, Style], start: int = 0, end: Optional[int] = None, ) -> None: """Apply a style to the text, or a portion of the text. Styles will be applied before other styles already present. Args: style (Union[str, Style]): Style instance or style definition to apply. start (int): Start offset (negative indexing is supported). Defaults to 0. end (Optional[int], optional): End offset (negative indexing is supported), or None for end of text. Defaults to None. """ if style: length = len(self) if start < 0: start = length + start if end is None: end = length if end < 0: end = length + end if start >= length or end <= start: # Span not in text or not valid return self._spans.insert(0, Span(start, min(length, end), style)) def apply_meta( self, meta: Dict[str, Any], start: int = 0, end: Optional[int] = None ) -> None: """Apply metadata to the text, or a portion of the text. Args: meta (Dict[str, Any]): A dict of meta information. start (int): Start offset (negative indexing is supported). Defaults to 0. end (Optional[int], optional): End offset (negative indexing is supported), or None for end of text. Defaults to None. """ style = Style.from_meta(meta) self.stylize(style, start=start, end=end) def on(self, meta: Optional[Dict[str, Any]] = None, handlers: Any) -> "Text": """Apply event handlers (used by Textual project). Example: >>> from rich.text import Text >>> text = Text("hello world") >>> text.on(click="view.toggle('world')") Args: meta (Dict[str, Any]): Mapping of meta information. handlers: Keyword args are prefixed with "@" to defined handlers. Returns: Text: Self is returned to method may be chained. """ meta = {} if meta is None else meta meta.update({f"@{key}": value for key, value in handlers.items()}) self.stylize(Style.from_meta(meta)) return self def remove_suffix(self, suffix: str) -> None: """Remove a suffix if it exists. Args: suffix (str): Suffix to remove. """ if self.plain.endswith(suffix): self.right_crop(len(suffix)) def get_style_at_offset(self, console: "Console", offset: int) -> Style: """Get the style of a character at give offset. Args: console (~Console): Console where text will be rendered. offset (int): Offset in to text (negative indexing supported) Returns: Style: A Style instance. """ # TODO: This is a little inefficient, it is only used by full justify if offset < 0: offset = len(self) + offset get_style = console.get_style style = get_style(self.style).copy() for start, end, span_style in self._spans: if end > offset >= start: style += get_style(span_style, default="") return style def extend_style(self, spaces: int) -> None: """Extend the Text given number of spaces where the spaces have the same style as the last character. Args: spaces (int): Number of spaces to add to the Text. """ if spaces <= 0: return spans = self.spans new_spaces = " " * spaces if spans: end_offset = len(self) self._spans[:] = [ span.extend(spaces) if span.end >= end_offset else span for span in spans ] self._text.append(new_spaces) self._length += spaces else: self.plain += new_spaces def highlight_regex( self, re_highlight: Union[Pattern[str], str], style: Optional[Union[GetStyleCallable, StyleType]] = None, , style_prefix: str = "", ) -> int: """Highlight text with a regular expression, where group names are translated to styles. Args: re_highlight (Union[re.Pattern, str]): A regular expression object or string. style (Union[GetStyleCallable, StyleType]): Optional style to apply to whole match, or a callable which accepts the matched text and returns a style. Defaults to None. style_prefix (str, optional): Optional prefix to add to style group names. Returns: int: Number of regex matches """ count = 0 append_span = self._spans.append _Span = Span plain = self.plain if isinstance(re_highlight, str): re_highlight = re.compile(re_highlight) for match in re_highlight.finditer(plain): get_span = match.span if style: start, end = get_span() match_style = style(plain[start:end]) if callable(style) else style if match_style is not None and end > start: append_span(_Span(start, end, match_style)) count += 1 for name in match.groupdict().keys(): start, end = get_span(name) if start != -1 and end > start: append_span(_Span(start, end, f"{style_prefix}{name}")) return count def highlight_words( self, words: Iterable[str], style: Union[str, Style], , case_sensitive: bool = True, ) -> int: """Highlight words with a style. Args: words (Iterable[str]): Words to highlight. style (Union[str, Style]): Style to apply. case_sensitive (bool, optional): Enable case sensitive matching. Defaults to True. Returns: int: Number of words highlighted. """ re_words = "\|".join(re.escape(word) for word in words) add_span = self._spans.append count = 0 _Span = Span for match in re.finditer( re_words, self.plain, flags=0 if case_sensitive else re.IGNORECASE ): start, end = match.span(0) add_span(_Span(start, end, style)) count += 1 return count def rstrip(self) -> None: """Strip whitespace from end of text.""" self.plain = self.plain.rstrip() def rstrip_end(self, size: int) -> None: """Remove whitespace beyond a certain width at the end of the text. Args: size (int): The desired size of the text. """ text_length = len(self) if text_length > size: excess = text_length - size whitespace_match = _re_whitespace.search(self.plain) if whitespace_match is not None: whitespace_count = len(whitespace_match.group(0)) self.right_crop(min(whitespace_count, excess)) def set_length(self, new_length: int) -> None: """Set new length of the text, clipping or padding is required.""" length = len(self) if length != new_length: if length < new_length: self.pad_right(new_length - length) else: self.right_crop(length - new_length) def __rich_console__( self, console: "Console", options: "ConsoleOptions" ) -> Iterable[Segment]: tab_size: int = console.tab_size if self.tab_size is None else self.tab_size justify = self.justify or options.justify or DEFAULT_JUSTIFY overflow = self.overflow or options.overflow or DEFAULT_OVERFLOW lines = self.wrap( console, options.max_width, justify=justify, overflow=overflow, tab_size=tab_size or 8, no_wrap=pick_bool(self.no_wrap, options.no_wrap, False), ) all_lines = Text("\n").join(lines) yield from all_lines.render(console, end=self.end) def __rich_measure__( self, console: "Console", options: "ConsoleOptions" ) -> Measurement: text = self.plain lines = text.splitlines() max_text_width = max(cell_len(line) for line in lines) if lines else 0 words = text.split() min_text_width = ( max(cell_len(word) for word in words) if words else max_text_width ) return Measurement(min_text_width, max_text_width) def render(self, console: "Console", end: str = "") -> Iterable["Segment"]: """Render the text as Segments. Args: console (Console): Console instance. end (Optional[str], optional): Optional end character. Returns: Iterable[Segment]: Result of render that may be written to the console. """ _Segment = Segment text = self.plain if not self._spans: yield Segment(text) if end: yield _Segment(end) return get_style = partial(console.get_style, default=Style.null()) enumerated_spans = list(enumerate(self._spans, 1)) style_map = {index: get_style(span.style) for index, span in enumerated_spans} style_map[0] = get_style(self.style) spans = [ (0, False, 0), ((span.start, False, index) for index, span in enumerated_spans), ((span.end, True, index) for index, span in enumerated_spans), (len(text), True, 0), ] spans.sort(key=itemgetter(0, 1)) stack: List[int] = [] stack_append = stack.append stack_pop = stack.remove style_cache: Dict[Tuple[Style, ...], Style] = {} style_cache_get = style_cache.get combine = Style.combine def get_current_style() -> Style: """Construct current style from stack.""" styles = tuple(style_map[_style_id] for _style_id in sorted(stack)) cached_style = style_cache_get(styles) if cached_style is not None: return cached_style current_style = combine(styles) style_cache[styles] = current_style return current_style for (offset, leaving, style_id), (next_offset, _, _) in zip(spans, spans[1:]): if leaving: stack_pop(style_id) else: stack_append(style_id) if next_offset > offset: yield _Segment(text[offset:next_offset], get_current_style()) if end: yield _Segment(end) def join(self, lines: Iterable["Text"]) -> "Text": """Join text together with this instance as the separator. Args: lines (Iterable[Text]): An iterable of Text instances to join. Returns: Text: A new text instance containing join text. """ new_text = self.blank_copy() def iter_text() -> Iterable["Text"]: if self.plain: for last, line in loop_last(lines): yield line if not last: yield self else: yield from lines extend_text = new_text._text.extend append_span = new_text._spans.append extend_spans = new_text._spans.extend offset = 0 _Span = Span for text in iter_text(): extend_text(text._text) if text.style: append_span(_Span(offset, offset + len(text), text.style)) extend_spans( _Span(offset + start, offset + end, style) for start, end, style in text._spans ) offset += len(text) new_text._length = offset return new_text def expand_tabs(self, tab_size: Optional[int] = None) -> None: """Converts tabs to spaces. Args: tab_size (int, optional): Size of tabs. Defaults to 8. """ if "\t" not in self.plain: return if tab_size is None: tab_size = self.tab_size if tab_size is None: tab_size = 8 new_text: List[Text] = [] append = new_text.append for line in self.split("\n", include_separator=True): if "\t" not in line.plain: append(line) else: cell_position = 0 parts = line.split("\t", include_separator=True) for part in parts: if part.plain.endswith("\t"): part._text[-1] = part._text[-1][:-1] + " " cell_position += part.cell_len tab_remainder = cell_position % tab_size if tab_remainder: spaces = tab_size - tab_remainder part.extend_style(spaces) cell_position += spaces else: cell_position += part.cell_len append(part) result = Text("").join(new_text) self._text = [result.plain] self._length = len(self.plain) self._spans[:] = result._spans def truncate( self, max_width: int, , overflow: Optional["OverflowMethod"] = None, pad: bool = False, ) -> None: """Truncate text if it is longer that a given width. Args: max_width (int): Maximum number of characters in text. overflow (str, optional): Overflow method: "crop", "fold", or "ellipsis". Defaults to None, to use self.overflow. pad (bool, optional): Pad with spaces if the length is less than max_width. Defaults to False. """ _overflow = overflow or self.overflow or DEFAULT_OVERFLOW if _overflow != "ignore": length = cell_len(self.plain) if length > max_width: if _overflow == "ellipsis": self.plain = set_cell_size(self.plain, max_width - 1) + "…" else: self.plain = set_cell_size(self.plain, max_width) if pad and length < max_width: spaces = max_width - length self._text = [f"{self.plain}{' ' spaces}"] self._length = len(self.plain) def _trim_spans(self) -> None: """Remove or modify any spans that are over the end of the text.""" max_offset = len(self.plain) _Span = Span self._spans[:] = [ ( span if span.end < max_offset else _Span(span.start, min(max_offset, span.end), span.style) ) for span in self._spans if span.start < max_offset ] def pad(self, count: int, character: str = " ") -> None: """Pad left and right with a given number of characters. Args: count (int): Width of padding. character (str): The character to pad with. Must be a string of length 1. """ assert len(character) == 1, "Character must be a string of length 1" if count: pad_characters = character * count self.plain = f"{pad_characters}{self.plain}{pad_characters}" _Span = Span self._spans[:] = [ _Span(start + count, end + count, style) for start, end, style in self._spans ] def pad_left(self, count: int, character: str = " ") -> None: """Pad the left with a given character. Args: count (int): Number of characters to pad. character (str, optional): Character to pad with. Defaults to " ". """ assert len(character) == 1, "Character must be a string of length 1" if count: self.plain = f"{character * count}{self.plain}" _Span = Span self._spans[:] = [ _Span(start + count, end + count, style) for start, end, style in self._spans ] def pad_right(self, count: int, character: str = " ") -> None: """Pad the right with a given character. Args: count (int): Number of characters to pad. character (str, optional): Character to pad with. Defaults to " ". """ assert len(character) == 1, "Character must be a string of length 1" if count: self.plain = f"{self.plain}{character * count}" def align(self, align: AlignMethod, width: int, character: str = " ") -> None: """Align text to a given width. Args: align (AlignMethod): One of "left", "center", or "right". width (int): Desired width. character (str, optional): Character to pad with. Defaults to " ". """ self.truncate(width) excess_space = width - cell_len(self.plain) if excess_space: if align == "left": self.pad_right(excess_space, character) elif align == "center": left = excess_space // 2 self.pad_left(left, character) self.pad_right(excess_space - left, character) else: self.pad_left(excess_space, character) def append( self, text: Union["Text", str], style: Optional[Union[str, "Style"]] = None ) -> "Text": """Add text with an optional style. Args: text (Union[Text, str]): A str or Text to append. style (str, optional): A style name. Defaults to None. Returns: Text: Returns self for chaining. """ if not isinstance(text, (str, Text)): raise TypeError("Only str or Text can be appended to Text") if len(text): if isinstance(text, str): sanitized_text = strip_control_codes(text) self._text.append(sanitized_text) offset = len(self) text_length = len(sanitized_text) if style: self._spans.append(Span(offset, offset + text_length, style)) self._length += text_length elif isinstance(text, Text): _Span = Span if style is not None: raise ValueError( "style must not be set when appending Text instance" ) text_length = self._length if text.style: self._spans.append( _Span(text_length, text_length + len(text), text.style) ) self._text.append(text.plain) self._spans.extend( _Span(start + text_length, end + text_length, style) for start, end, style in text._spans.copy() ) self._length += len(text) return self def append_text(self, text: "Text") -> "Text": """Append another Text instance. This method is more performant that Text.append, but only works for Text. Args: text (Text): The Text instance to append to this instance. Returns: Text: Returns self for chaining. """ _Span = Span text_length = self._length if text.style: self._spans.append(_Span(text_length, text_length + len(text), text.style)) self._text.append(text.plain) self._spans.extend( _Span(start + text_length, end + text_length, style) for start, end, style in text._spans.copy() ) self._length += len(text) return self def append_tokens( self, tokens: Iterable[Tuple[str, Optional[StyleType]]] ) -> "Text": """Append iterable of str and style. Style may be a Style instance or a str style definition. Args: tokens (Iterable[Tuple[str, Optional[StyleType]]]): An iterable of tuples containing str content and style. Returns: Text: Returns self for chaining. """ append_text = self._text.append append_span = self._spans.append _Span = Span offset = len(self) for content, style in tokens: content = strip_control_codes(content) append_text(content) if style: append_span(_Span(offset, offset + len(content), style)) offset += len(content) self._length = offset return self def copy_styles(self, text: "Text") -> None: """Copy styles from another Text instance. Args: text (Text): A Text instance to copy styles from, must be the same length. """ self._spans.extend(text._spans) def split( self, separator: str = "\n", , include_separator: bool = False, allow_blank: bool = False, ) -> Lines: """Split rich text in to lines, preserving styles. Args: separator (str, optional): String to split on. Defaults to "\\\\n". include_separator (bool, optional): Include the separator in the lines. Defaults to False. allow_blank (bool, optional): Return a blank line if the text ends with a separator. Defaults to False. Returns: List[RichText]: A list of rich text, one per line of the original. """ assert separator, "separator must not be empty" text = self.plain if separator not in text: return Lines([self.copy()]) if include_separator: lines = self.divide( match.end() for match in re.finditer(re.escape(separator), text) ) else: def flatten_spans() -> Iterable[int]: for match in re.finditer(re.escape(separator), text): start, end = match.span() yield start yield end lines = Lines( line for line in self.divide(flatten_spans()) if line.plain != separator ) if not allow_blank and text.endswith(separator): lines.pop() return lines def divide(self, offsets: Iterable[int]) -> Lines: """Divide text in to a number of lines at given offsets. Args: offsets (Iterable[int]): Offsets used to divide text. Returns: Lines: New RichText instances between offsets. """ _offsets = list(offsets) if not _offsets: return Lines([self.copy()]) text = self.plain text_length = len(text) divide_offsets = [0, _offsets, text_length] line_ranges = list(zip(divide_offsets, divide_offsets[1:])) style = self.style justify = self.justify overflow = self.overflow _Text = Text new_lines = Lines( _Text( text[start:end], style=style, justify=justify, overflow=overflow, ) for start, end in line_ranges ) if not self._spans: return new_lines _line_appends = [line._spans.append for line in new_lines._lines] line_count = len(line_ranges) _Span = Span for span_start, span_end, style in self._spans: lower_bound = 0 upper_bound = line_count start_line_no = (lower_bound + upper_bound) // 2 while True: line_start, line_end = line_ranges[start_line_no] if span_start < line_start: upper_bound = start_line_no - 1 elif span_start > line_end: lower_bound = start_line_no + 1 else: break start_line_no = (lower_bound + upper_bound) // 2 if span_end < line_end: end_line_no = start_line_no else: end_line_no = lower_bound = start_line_no upper_bound = line_count while True: line_start, line_end = line_ranges[end_line_no] if span_end < line_start: upper_bound = end_line_no - 1 elif span_end > line_end: lower_bound = end_line_no + 1 else: break end_line_no = (lower_bound + upper_bound) // 2 for line_no in range(start_line_no, end_line_no + 1): line_start, line_end = line_ranges[line_no] new_start = max(0, span_start - line_start) new_end = min(span_end - line_start, line_end - line_start) if new_end > new_start: _line_appends[line_no](_Span(new_start, new_end, style)) return new_lines def right_crop(self, amount: int = 1) -> None: """Remove a number of characters from the end of the text.""" max_offset = len(self.plain) - amount _Span = Span self._spans[:] = [ ( span if span.end < max_offset else _Span(span.start, min(max_offset, span.end), span.style) ) for span in self._spans if span.start < max_offset ] self._text = [self.plain[:-amount]] self._length -= amount def wrap( self, console: "Console", width: int, , justify: Optional["JustifyMethod"] = None, overflow: Optional["OverflowMethod"] = None, tab_size: int = 8, no_wrap: Optional[bool] = None, ) -> Lines: """Word wrap the text. Args: console (Console): Console instance. width (int): Number of cells available per line. justify (str, optional): Justify method: "default", "left", "center", "full", "right". Defaults to "default". overflow (str, optional): Overflow method: "crop", "fold", or "ellipsis". Defaults to None. tab_size (int, optional): Default tab size. Defaults to 8. no_wrap (bool, optional): Disable wrapping, Defaults to False. Returns: Lines: Number of lines. """ wrap_justify = justify or self.justify or DEFAULT_JUSTIFY wrap_overflow = overflow or self.overflow or DEFAULT_OVERFLOW no_wrap = pick_bool(no_wrap, self.no_wrap, False) or overflow == "ignore" lines = Lines() for line in self.split(allow_blank=True): if "\t" in line: line.expand_tabs(tab_size) if no_wrap: new_lines = Lines([line]) else: offsets = divide_line(str(line), width, fold=wrap_overflow == "fold") new_lines = line.divide(offsets) for line in new_lines: line.rstrip_end(width) if wrap_justify: new_lines.justify( console, width, justify=wrap_justify, overflow=wrap_overflow ) for line in new_lines: line.truncate(width, overflow=wrap_overflow) lines.extend(new_lines) return lines def fit(self, width: int) -> Lines: """Fit the text in to given width by chopping in to lines. Args: width (int): Maximum characters in a line. Returns: Lines: Lines container. """ lines: Lines = Lines() append = lines.append for line in self.split(): line.set_length(width) append(line) return lines def detect_indentation(self) -> int: """Auto-detect indentation of code. Returns: int: Number of spaces used to indent code. """ _indentations = { len(match.group(1)) for match in re.finditer(r"^( )(.)$", self.plain, flags=re.MULTILINE) } try: indentation = ( reduce(gcd, [indent for indent in _indentations if not indent % 2]) or 1 ) except TypeError: indentation = 1 return indentation def with_indent_guides( self, indent_size: Optional[int] = None, , character: str = "│", style: StyleType = "dim green", ) -> "Text": """Adds indent guide lines to text. Args: indent_size (Optional[int]): Size of indentation, or None to auto detect. Defaults to None. character (str, optional): Character to use for indentation. Defaults to "│". style (Union[Style, str], optional): Style of indent guides. Returns: Text: New text with indentation guides. """ _indent_size = self.detect_indentation() if indent_size is None else indent_size text = self.copy() text.expand_tabs() indent_line = f"{character}{' ' * (_indent_size - 1)}" re_indent = re.compile(r"^( )(.)$") new_lines: List[Text] = [] add_line = new_lines.append blank_lines = 0 for line in text.split(allow_blank=True): match = re_indent.match(line.plain) if not match or not match.group(2): blank_lines += 1 continue indent = match.group(1) full_indents, remaining_space = divmod(len(indent), _indent_size) new_indent = f"{indent_line * full_indents}{' ' * remaining_space}" line.plain = new_indent + line.plain[len(new_indent) :] line.stylize(style, 0, len(new_indent)) if blank_lines: new_lines.extend([Text(new_indent, style=style)] * blank_lines) blank_lines = 0 add_line(line) if blank_lines: new_lines.extend([Text("", style=style)] * blank_lines) new_text = text.blank_copy("\n").join(new_lines) return new_text if __name__ == "__main__": # pragma: no cover from pip._vendor.rich.console import Console text = Text( """\nLorem ipsum dolor sit amet, consectetur adipiscing elit, sed do eiusmod tempor incididunt ut labore et dolore magna aliqua. Ut enim ad minim veniam, quis nostrud exercitation ullamco laboris nisi ut aliquip ex ea commodo consequat. Duis aute irure dolor in reprehenderit in voluptate velit esse cillum dolore eu fugiat nulla pariatur. Excepteur sint occaecat cupidatat non proident, sunt in culpa qui officia deserunt mollit anim id est laborum.\n""" ) text.highlight_words(["Lorem"], "bold") text.highlight_words(["ipsum"], "italic") console = Console() console.rule("justify='left'") console.print(text, style="red") console.print() console.rule("justify='center'") console.print(text, style="green", justify="center") console.print() console.rule("justify='right'") console.print(text, style="blue", justify="right") console.print() console.rule("justify='full'") console.print(text, style="magenta", justify="full") console.print()	46.44 KB	2026-01-20 12:58
📄 theme.py import configparser from typing import IO, Dict, List, Mapping, Optional from .default_styles import DEFAULT_STYLES from .style import Style, StyleType class Theme: """A container for style information, used by :class:`~rich.console.Console`. Args: styles (Dict[str, Style], optional): A mapping of style names on to styles. Defaults to None for a theme with no styles. inherit (bool, optional): Inherit default styles. Defaults to True. """ styles: Dict[str, Style] def __init__( self, styles: Optional[Mapping[str, StyleType]] = None, inherit: bool = True ): self.styles = DEFAULT_STYLES.copy() if inherit else {} if styles is not None: self.styles.update( { name: style if isinstance(style, Style) else Style.parse(style) for name, style in styles.items() } ) @property def config(self) -> str: """Get contents of a config file for this theme.""" config = "[styles]\n" + "\n".join( f"{name} = {style}" for name, style in sorted(self.styles.items()) ) return config @classmethod def from_file( cls, config_file: IO[str], source: Optional[str] = None, inherit: bool = True ) -> "Theme": """Load a theme from a text mode file. Args: config_file (IO[str]): An open conf file. source (str, optional): The filename of the open file. Defaults to None. inherit (bool, optional): Inherit default styles. Defaults to True. Returns: Theme: A New theme instance. """ config = configparser.ConfigParser() config.read_file(config_file, source=source) styles = {name: Style.parse(value) for name, value in config.items("styles")} theme = Theme(styles, inherit=inherit) return theme @classmethod def read( cls, path: str, inherit: bool = True, encoding: Optional[str] = None ) -> "Theme": """Read a theme from a path. Args: path (str): Path to a config file readable by Python configparser module. inherit (bool, optional): Inherit default styles. Defaults to True. encoding (str, optional): Encoding of the config file. Defaults to None. Returns: Theme: A new theme instance. """ with open(path, encoding=encoding) as config_file: return cls.from_file(config_file, source=path, inherit=inherit) class ThemeStackError(Exception): """Base exception for errors related to the theme stack.""" class ThemeStack: """A stack of themes. Args: theme (Theme): A theme instance """ def __init__(self, theme: Theme) -> None: self._entries: List[Dict[str, Style]] = [theme.styles] self.get = self._entries[-1].get def push_theme(self, theme: Theme, inherit: bool = True) -> None: """Push a theme on the top of the stack. Args: theme (Theme): A Theme instance. inherit (boolean, optional): Inherit styles from current top of stack. """ styles: Dict[str, Style] styles = ( {self._entries[-1], theme.styles} if inherit else theme.styles.copy() ) self._entries.append(styles) self.get = self._entries[-1].get def pop_theme(self) -> None: """Pop (and discard) the top-most theme.""" if len(self._entries) == 1: raise ThemeStackError("Unable to pop base theme") self._entries.pop() self.get = self._entries[-1].get if __name__ == "__main__": # pragma: no cover theme = Theme() print(theme.config)	3.68 KB	2026-01-20 12:58
📄 themes.py from .default_styles import DEFAULT_STYLES from .theme import Theme DEFAULT = Theme(DEFAULT_STYLES)	102 B	2026-01-20 12:58
📄 traceback.py import inspect import linecache import os import sys from dataclasses import dataclass, field from itertools import islice from traceback import walk_tb from types import ModuleType, TracebackType from typing import ( Any, Callable, Dict, Iterable, List, Optional, Sequence, Set, Tuple, Type, Union, ) from pip._vendor.pygments.lexers import guess_lexer_for_filename from pip._vendor.pygments.token import Comment, Keyword, Name, Number, Operator, String from pip._vendor.pygments.token import Text as TextToken from pip._vendor.pygments.token import Token from pip._vendor.pygments.util import ClassNotFound from . import pretty from ._loop import loop_first_last, loop_last from .columns import Columns from .console import ( Console, ConsoleOptions, ConsoleRenderable, Group, RenderResult, group, ) from .constrain import Constrain from .highlighter import RegexHighlighter, ReprHighlighter from .panel import Panel from .scope import render_scope from .style import Style from .syntax import Syntax, SyntaxPosition from .text import Text from .theme import Theme WINDOWS = sys.platform == "win32" LOCALS_MAX_LENGTH = 10 LOCALS_MAX_STRING = 80 def _iter_syntax_lines( start: SyntaxPosition, end: SyntaxPosition ) -> Iterable[Tuple[int, int, int]]: """Yield start and end positions per line. Args: start: Start position. end: End position. Returns: Iterable of (LINE, COLUMN1, COLUMN2). """ line1, column1 = start line2, column2 = end if line1 == line2: yield line1, column1, column2 else: for first, last, line_no in loop_first_last(range(line1, line2 + 1)): if first: yield line_no, column1, -1 elif last: yield line_no, 0, column2 else: yield line_no, 0, -1 def install( , console: Optional[Console] = None, width: Optional[int] = 100, code_width: Optional[int] = 88, extra_lines: int = 3, theme: Optional[str] = None, word_wrap: bool = False, show_locals: bool = False, locals_max_length: int = LOCALS_MAX_LENGTH, locals_max_string: int = LOCALS_MAX_STRING, locals_hide_dunder: bool = True, locals_hide_sunder: Optional[bool] = None, indent_guides: bool = True, suppress: Iterable[Union[str, ModuleType]] = (), max_frames: int = 100, ) -> Callable[[Type[BaseException], BaseException, Optional[TracebackType]], Any]: """Install a rich traceback handler. Once installed, any tracebacks will be printed with syntax highlighting and rich formatting. Args: console (Optional[Console], optional): Console to write exception to. Default uses internal Console instance. width (Optional[int], optional): Width (in characters) of traceback. Defaults to 100. code_width (Optional[int], optional): Code width (in characters) of traceback. Defaults to 88. extra_lines (int, optional): Extra lines of code. Defaults to 3. theme (Optional[str], optional): Pygments theme to use in traceback. Defaults to ``None`` which will pick a theme appropriate for the platform. word_wrap (bool, optional): Enable word wrapping of long lines. Defaults to False. show_locals (bool, optional): Enable display of local variables. Defaults to False. locals_max_length (int, optional): Maximum length of containers before abbreviating, or None for no abbreviation. Defaults to 10. locals_max_string (int, optional): Maximum length of string before truncating, or None to disable. Defaults to 80. locals_hide_dunder (bool, optional): Hide locals prefixed with double underscore. Defaults to True. locals_hide_sunder (bool, optional): Hide locals prefixed with single underscore. Defaults to False. indent_guides (bool, optional): Enable indent guides in code and locals. Defaults to True. suppress (Sequence[Union[str, ModuleType]]): Optional sequence of modules or paths to exclude from traceback. Returns: Callable: The previous exception handler that was replaced. """ traceback_console = Console(stderr=True) if console is None else console locals_hide_sunder = ( True if (traceback_console.is_jupyter and locals_hide_sunder is None) else locals_hide_sunder ) def excepthook( type_: Type[BaseException], value: BaseException, traceback: Optional[TracebackType], ) -> None: exception_traceback = Traceback.from_exception( type_, value, traceback, width=width, code_width=code_width, extra_lines=extra_lines, theme=theme, word_wrap=word_wrap, show_locals=show_locals, locals_max_length=locals_max_length, locals_max_string=locals_max_string, locals_hide_dunder=locals_hide_dunder, locals_hide_sunder=bool(locals_hide_sunder), indent_guides=indent_guides, suppress=suppress, max_frames=max_frames, ) traceback_console.print(exception_traceback) def ipy_excepthook_closure(ip: Any) -> None: # pragma: no cover tb_data = {} # store information about showtraceback call default_showtraceback = ip.showtraceback # keep reference of default traceback def ipy_show_traceback(args: Any, *kwargs: Any) -> None: """wrap the default ip.showtraceback to store info for ip._showtraceback""" nonlocal tb_data tb_data = kwargs default_showtraceback(args, *kwargs) def ipy_display_traceback( args: Any, is_syntax: bool = False, *kwargs: Any ) -> None: """Internally called traceback from ip._showtraceback""" nonlocal tb_data exc_tuple = ip._get_exc_info() # do not display trace on syntax error tb: Optional[TracebackType] = None if is_syntax else exc_tuple[2] # determine correct tb_offset compiled = tb_data.get("running_compiled_code", False) tb_offset = tb_data.get("tb_offset") if tb_offset is None: tb_offset = 1 if compiled else 0 # remove ipython internal frames from trace with tb_offset for _ in range(tb_offset): if tb is None: break tb = tb.tb_next excepthook(exc_tuple[0], exc_tuple[1], tb) tb_data = {} # clear data upon usage # replace _showtraceback instead of showtraceback to allow ipython features such as debugging to work # this is also what the ipython docs recommends to modify when subclassing InteractiveShell ip._showtraceback = ipy_display_traceback # add wrapper to capture tb_data ip.showtraceback = ipy_show_traceback ip.showsyntaxerror = lambda args, *kwargs: ipy_display_traceback( args, is_syntax=True, *kwargs ) try: # pragma: no cover # if within ipython, use customized traceback ip = get_ipython() # type: ignore[name-defined] ipy_excepthook_closure(ip) return sys.excepthook except Exception: # otherwise use default system hook old_excepthook = sys.excepthook sys.excepthook = excepthook return old_excepthook @dataclass class Frame: filename: str lineno: int name: str line: str = "" locals: Optional[Dict[str, pretty.Node]] = None last_instruction: Optional[Tuple[Tuple[int, int], Tuple[int, int]]] = None @dataclass class _SyntaxError: offset: int filename: str line: str lineno: int msg: str notes: List[str] = field(default_factory=list) @dataclass class Stack: exc_type: str exc_value: str syntax_error: Optional[_SyntaxError] = None is_cause: bool = False frames: List[Frame] = field(default_factory=list) notes: List[str] = field(default_factory=list) is_group: bool = False exceptions: List["Trace"] = field(default_factory=list) @dataclass class Trace: stacks: List[Stack] class PathHighlighter(RegexHighlighter): highlights = [r"(?P<dim>./)(?P<bold>.+)"] class Traceback: """A Console renderable that renders a traceback. Args: trace (Trace, optional): A `Trace` object produced from `extract`. Defaults to None, which uses the last exception. width (Optional[int], optional): Number of characters used to traceback. Defaults to 100. code_width (Optional[int], optional): Number of code characters used to traceback. Defaults to 88. extra_lines (int, optional): Additional lines of code to render. Defaults to 3. theme (str, optional): Override pygments theme used in traceback. word_wrap (bool, optional): Enable word wrapping of long lines. Defaults to False. show_locals (bool, optional): Enable display of local variables. Defaults to False. indent_guides (bool, optional): Enable indent guides in code and locals. Defaults to True. locals_max_length (int, optional): Maximum length of containers before abbreviating, or None for no abbreviation. Defaults to 10. locals_max_string (int, optional): Maximum length of string before truncating, or None to disable. Defaults to 80. locals_hide_dunder (bool, optional): Hide locals prefixed with double underscore. Defaults to True. locals_hide_sunder (bool, optional): Hide locals prefixed with single underscore. Defaults to False. suppress (Sequence[Union[str, ModuleType]]): Optional sequence of modules or paths to exclude from traceback. max_frames (int): Maximum number of frames to show in a traceback, 0 for no maximum. Defaults to 100. """ LEXERS = { "": "text", ".py": "python", ".pxd": "cython", ".pyx": "cython", ".pxi": "pyrex", } def __init__( self, trace: Optional[Trace] = None, , width: Optional[int] = 100, code_width: Optional[int] = 88, extra_lines: int = 3, theme: Optional[str] = None, word_wrap: bool = False, show_locals: bool = False, locals_max_length: int = LOCALS_MAX_LENGTH, locals_max_string: int = LOCALS_MAX_STRING, locals_hide_dunder: bool = True, locals_hide_sunder: bool = False, indent_guides: bool = True, suppress: Iterable[Union[str, ModuleType]] = (), max_frames: int = 100, ): if trace is None: exc_type, exc_value, traceback = sys.exc_info() if exc_type is None or exc_value is None or traceback is None: raise ValueError( "Value for 'trace' required if not called in except: block" ) trace = self.extract( exc_type, exc_value, traceback, show_locals=show_locals ) self.trace = trace self.width = width self.code_width = code_width self.extra_lines = extra_lines self.theme = Syntax.get_theme(theme or "ansi_dark") self.word_wrap = word_wrap self.show_locals = show_locals self.indent_guides = indent_guides self.locals_max_length = locals_max_length self.locals_max_string = locals_max_string self.locals_hide_dunder = locals_hide_dunder self.locals_hide_sunder = locals_hide_sunder self.suppress: Sequence[str] = [] for suppress_entity in suppress: if not isinstance(suppress_entity, str): assert ( suppress_entity.__file__ is not None ), f"{suppress_entity!r} must be a module with '__file__' attribute" path = os.path.dirname(suppress_entity.__file__) else: path = suppress_entity path = os.path.normpath(os.path.abspath(path)) self.suppress.append(path) self.max_frames = max(4, max_frames) if max_frames > 0 else 0 @classmethod def from_exception( cls, exc_type: Type[Any], exc_value: BaseException, traceback: Optional[TracebackType], , width: Optional[int] = 100, code_width: Optional[int] = 88, extra_lines: int = 3, theme: Optional[str] = None, word_wrap: bool = False, show_locals: bool = False, locals_max_length: int = LOCALS_MAX_LENGTH, locals_max_string: int = LOCALS_MAX_STRING, locals_hide_dunder: bool = True, locals_hide_sunder: bool = False, indent_guides: bool = True, suppress: Iterable[Union[str, ModuleType]] = (), max_frames: int = 100, ) -> "Traceback": """Create a traceback from exception info Args: exc_type (Type[BaseException]): Exception type. exc_value (BaseException): Exception value. traceback (TracebackType): Python Traceback object. width (Optional[int], optional): Number of characters used to traceback. Defaults to 100. code_width (Optional[int], optional): Number of code characters used to traceback. Defaults to 88. extra_lines (int, optional): Additional lines of code to render. Defaults to 3. theme (str, optional): Override pygments theme used in traceback. word_wrap (bool, optional): Enable word wrapping of long lines. Defaults to False. show_locals (bool, optional): Enable display of local variables. Defaults to False. indent_guides (bool, optional): Enable indent guides in code and locals. Defaults to True. locals_max_length (int, optional): Maximum length of containers before abbreviating, or None for no abbreviation. Defaults to 10. locals_max_string (int, optional): Maximum length of string before truncating, or None to disable. Defaults to 80. locals_hide_dunder (bool, optional): Hide locals prefixed with double underscore. Defaults to True. locals_hide_sunder (bool, optional): Hide locals prefixed with single underscore. Defaults to False. suppress (Iterable[Union[str, ModuleType]]): Optional sequence of modules or paths to exclude from traceback. max_frames (int): Maximum number of frames to show in a traceback, 0 for no maximum. Defaults to 100. Returns: Traceback: A Traceback instance that may be printed. """ rich_traceback = cls.extract( exc_type, exc_value, traceback, show_locals=show_locals, locals_max_length=locals_max_length, locals_max_string=locals_max_string, locals_hide_dunder=locals_hide_dunder, locals_hide_sunder=locals_hide_sunder, ) return cls( rich_traceback, width=width, code_width=code_width, extra_lines=extra_lines, theme=theme, word_wrap=word_wrap, show_locals=show_locals, indent_guides=indent_guides, locals_max_length=locals_max_length, locals_max_string=locals_max_string, locals_hide_dunder=locals_hide_dunder, locals_hide_sunder=locals_hide_sunder, suppress=suppress, max_frames=max_frames, ) @classmethod def extract( cls, exc_type: Type[BaseException], exc_value: BaseException, traceback: Optional[TracebackType], , show_locals: bool = False, locals_max_length: int = LOCALS_MAX_LENGTH, locals_max_string: int = LOCALS_MAX_STRING, locals_hide_dunder: bool = True, locals_hide_sunder: bool = False, _visited_exceptions: Optional[Set[BaseException]] = None, ) -> Trace: """Extract traceback information. Args: exc_type (Type[BaseException]): Exception type. exc_value (BaseException): Exception value. traceback (TracebackType): Python Traceback object. show_locals (bool, optional): Enable display of local variables. Defaults to False. locals_max_length (int, optional): Maximum length of containers before abbreviating, or None for no abbreviation. Defaults to 10. locals_max_string (int, optional): Maximum length of string before truncating, or None to disable. Defaults to 80. locals_hide_dunder (bool, optional): Hide locals prefixed with double underscore. Defaults to True. locals_hide_sunder (bool, optional): Hide locals prefixed with single underscore. Defaults to False. Returns: Trace: A Trace instance which you can use to construct a `Traceback`. """ stacks: List[Stack] = [] is_cause = False from pip._vendor.rich import _IMPORT_CWD notes: List[str] = getattr(exc_value, "__notes__", None) or [] grouped_exceptions: Set[BaseException] = ( set() if _visited_exceptions is None else _visited_exceptions ) def safe_str(_object: Any) -> str: """Don't allow exceptions from __str__ to propagate.""" try: return str(_object) except Exception: return "<exception str() failed>" while True: stack = Stack( exc_type=safe_str(exc_type.__name__), exc_value=safe_str(exc_value), is_cause=is_cause, notes=notes, ) if sys.version_info >= (3, 11): if isinstance(exc_value, (BaseExceptionGroup, ExceptionGroup)): stack.is_group = True for exception in exc_value.exceptions: if exception in grouped_exceptions: continue grouped_exceptions.add(exception) stack.exceptions.append( Traceback.extract( type(exception), exception, exception.__traceback__, show_locals=show_locals, locals_max_length=locals_max_length, locals_hide_dunder=locals_hide_dunder, locals_hide_sunder=locals_hide_sunder, _visited_exceptions=grouped_exceptions, ) ) if isinstance(exc_value, SyntaxError): stack.syntax_error = _SyntaxError( offset=exc_value.offset or 0, filename=exc_value.filename or "?", lineno=exc_value.lineno or 0, line=exc_value.text or "", msg=exc_value.msg, notes=notes, ) stacks.append(stack) append = stack.frames.append def get_locals( iter_locals: Iterable[Tuple[str, object]], ) -> Iterable[Tuple[str, object]]: """Extract locals from an iterator of key pairs.""" if not (locals_hide_dunder or locals_hide_sunder): yield from iter_locals return for key, value in iter_locals: if locals_hide_dunder and key.startswith("__"): continue if locals_hide_sunder and key.startswith("_"): continue yield key, value for frame_summary, line_no in walk_tb(traceback): filename = frame_summary.f_code.co_filename last_instruction: Optional[Tuple[Tuple[int, int], Tuple[int, int]]] last_instruction = None if sys.version_info >= (3, 11): instruction_index = frame_summary.f_lasti // 2 instruction_position = next( islice( frame_summary.f_code.co_positions(), instruction_index, instruction_index + 1, ) ) ( start_line, end_line, start_column, end_column, ) = instruction_position if ( start_line is not None and end_line is not None and start_column is not None and end_column is not None ): last_instruction = ( (start_line, start_column), (end_line, end_column), ) if filename and not filename.startswith("<"): if not os.path.isabs(filename): filename = os.path.join(_IMPORT_CWD, filename) if frame_summary.f_locals.get("_rich_traceback_omit", False): continue frame = Frame( filename=filename or "?", lineno=line_no, name=frame_summary.f_code.co_name, locals=( { key: pretty.traverse( value, max_length=locals_max_length, max_string=locals_max_string, ) for key, value in get_locals(frame_summary.f_locals.items()) if not (inspect.isfunction(value) or inspect.isclass(value)) } if show_locals else None ), last_instruction=last_instruction, ) append(frame) if frame_summary.f_locals.get("_rich_traceback_guard", False): del stack.frames[:] if not grouped_exceptions: cause = getattr(exc_value, "__cause__", None) if cause is not None and cause is not exc_value: exc_type = cause.__class__ exc_value = cause # __traceback__ can be None, e.g. for exceptions raised by the # 'multiprocessing' module traceback = cause.__traceback__ is_cause = True continue cause = exc_value.__context__ if cause is not None and not getattr( exc_value, "__suppress_context__", False ): exc_type = cause.__class__ exc_value = cause traceback = cause.__traceback__ is_cause = False continue # No cover, code is reached but coverage doesn't recognize it. break # pragma: no cover trace = Trace(stacks=stacks) return trace def __rich_console__( self, console: Console, options: ConsoleOptions ) -> RenderResult: theme = self.theme background_style = theme.get_background_style() token_style = theme.get_style_for_token traceback_theme = Theme( { "pretty": token_style(TextToken), "pygments.text": token_style(Token), "pygments.string": token_style(String), "pygments.function": token_style(Name.Function), "pygments.number": token_style(Number), "repr.indent": token_style(Comment) + Style(dim=True), "repr.str": token_style(String), "repr.brace": token_style(TextToken) + Style(bold=True), "repr.number": token_style(Number), "repr.bool_true": token_style(Keyword.Constant), "repr.bool_false": token_style(Keyword.Constant), "repr.none": token_style(Keyword.Constant), "scope.border": token_style(String.Delimiter), "scope.equals": token_style(Operator), "scope.key": token_style(Name), "scope.key.special": token_style(Name.Constant) + Style(dim=True), }, inherit=False, ) highlighter = ReprHighlighter() @group() def render_stack(stack: Stack, last: bool) -> RenderResult: if stack.frames: stack_renderable: ConsoleRenderable = Panel( self._render_stack(stack), title="[traceback.title]Traceback [dim](most recent call last)", style=background_style, border_style="traceback.border", expand=True, padding=(0, 1), ) stack_renderable = Constrain(stack_renderable, self.width) with console.use_theme(traceback_theme): yield stack_renderable if stack.syntax_error is not None: with console.use_theme(traceback_theme): yield Constrain( Panel( self._render_syntax_error(stack.syntax_error), style=background_style, border_style="traceback.border.syntax_error", expand=True, padding=(0, 1), width=self.width, ), self.width, ) yield Text.assemble( (f"{stack.exc_type}: ", "traceback.exc_type"), highlighter(stack.syntax_error.msg), ) elif stack.exc_value: yield Text.assemble( (f"{stack.exc_type}: ", "traceback.exc_type"), highlighter(stack.exc_value), ) else: yield Text.assemble((f"{stack.exc_type}", "traceback.exc_type")) for note in stack.notes: yield Text.assemble(("[NOTE] ", "traceback.note"), highlighter(note)) if stack.is_group: for group_no, group_exception in enumerate(stack.exceptions, 1): grouped_exceptions: List[Group] = [] for group_last, group_stack in loop_last(group_exception.stacks): grouped_exceptions.append(render_stack(group_stack, group_last)) yield "" yield Constrain( Panel( Group(grouped_exceptions), title=f"Sub-exception #{group_no}", border_style="traceback.group.border", ), self.width, ) if not last: if stack.is_cause: yield Text.from_markup( "\n[i]The above exception was the direct cause of the following exception:\n", ) else: yield Text.from_markup( "\n[i]During handling of the above exception, another exception occurred:\n", ) for last, stack in loop_last(reversed(self.trace.stacks)): yield render_stack(stack, last) @group() def _render_syntax_error(self, syntax_error: _SyntaxError) -> RenderResult: highlighter = ReprHighlighter() path_highlighter = PathHighlighter() if syntax_error.filename != "<stdin>": if os.path.exists(syntax_error.filename): text = Text.assemble( (f" {syntax_error.filename}", "pygments.string"), (":", "pygments.text"), (str(syntax_error.lineno), "pygments.number"), style="pygments.text", ) yield path_highlighter(text) syntax_error_text = highlighter(syntax_error.line.rstrip()) syntax_error_text.no_wrap = True offset = min(syntax_error.offset - 1, len(syntax_error_text)) syntax_error_text.stylize("bold underline", offset, offset) syntax_error_text += Text.from_markup( "\n" + " " * offset + "[traceback.offset]▲[/]", style="pygments.text", ) yield syntax_error_text @classmethod def _guess_lexer(cls, filename: str, code: str) -> str: ext = os.path.splitext(filename)[-1] if not ext: # No extension, look at first line to see if it is a hashbang # Note, this is an educated guess and not a guarantee # If it fails, the only downside is that the code is highlighted strangely new_line_index = code.index("\n") first_line = code[:new_line_index] if new_line_index != -1 else code if first_line.startswith("#!") and "python" in first_line.lower(): return "python" try: return cls.LEXERS.get(ext) or guess_lexer_for_filename(filename, code).name except ClassNotFound: return "text" @group() def _render_stack(self, stack: Stack) -> RenderResult: path_highlighter = PathHighlighter() theme = self.theme def render_locals(frame: Frame) -> Iterable[ConsoleRenderable]: if frame.locals: yield render_scope( frame.locals, title="locals", indent_guides=self.indent_guides, max_length=self.locals_max_length, max_string=self.locals_max_string, ) exclude_frames: Optional[range] = None if self.max_frames != 0: exclude_frames = range( self.max_frames // 2, len(stack.frames) - self.max_frames // 2, ) excluded = False for frame_index, frame in enumerate(stack.frames): if exclude_frames and frame_index in exclude_frames: excluded = True continue if excluded: assert exclude_frames is not None yield Text( f"\n... {len(exclude_frames)} frames hidden ...", justify="center", style="traceback.error", ) excluded = False first = frame_index == 0 frame_filename = frame.filename suppressed = any(frame_filename.startswith(path) for path in self.suppress) if os.path.exists(frame.filename): text = Text.assemble( path_highlighter(Text(frame.filename, style="pygments.string")), (":", "pygments.text"), (str(frame.lineno), "pygments.number"), " in ", (frame.name, "pygments.function"), style="pygments.text", ) else: text = Text.assemble( "in ", (frame.name, "pygments.function"), (":", "pygments.text"), (str(frame.lineno), "pygments.number"), style="pygments.text", ) if not frame.filename.startswith("<") and not first: yield "" yield text if frame.filename.startswith("<"): yield from render_locals(frame) continue if not suppressed: try: code_lines = linecache.getlines(frame.filename) code = "".join(code_lines) if not code: # code may be an empty string if the file doesn't exist, OR # if the traceback filename is generated dynamically continue lexer_name = self._guess_lexer(frame.filename, code) syntax = Syntax( code, lexer_name, theme=theme, line_numbers=True, line_range=( frame.lineno - self.extra_lines, frame.lineno + self.extra_lines, ), highlight_lines={frame.lineno}, word_wrap=self.word_wrap, code_width=self.code_width, indent_guides=self.indent_guides, dedent=False, ) yield "" except Exception as error: yield Text.assemble( (f"\n{error}", "traceback.error"), ) else: if frame.last_instruction is not None: start, end = frame.last_instruction # Stylize a line at a time # So that indentation isn't underlined (which looks bad) for line1, column1, column2 in _iter_syntax_lines(start, end): try: if column1 == 0: line = code_lines[line1 - 1] column1 = len(line) - len(line.lstrip()) if column2 == -1: column2 = len(code_lines[line1 - 1]) except IndexError: # Being defensive here # If last_instruction reports a line out-of-bounds, we don't want to crash continue syntax.stylize_range( style="traceback.error_range", start=(line1, column1), end=(line1, column2), ) yield ( Columns( [ syntax, *render_locals(frame), ], padding=1, ) if frame.locals else syntax ) if __name__ == "__main__": # pragma: no cover install(show_locals=True) import sys def bar( a: Any, ) -> None: # 这是对亚洲语言支持的测试。面对模棱两可的想法，拒绝猜测的诱惑 one = 1 print(one / a) def foo(a: Any) -> None: _rich_traceback_guard = True zed = { "characters": { "Paul Atreides", "Vladimir Harkonnen", "Thufir Hawat", "Duncan Idaho", }, "atomic_types": (None, False, True), } bar(a) def error() -> None: foo(0) error()	35.02 KB	2026-01-20 12:58
📄 tree.py from typing import Iterator, List, Optional, Tuple from ._loop import loop_first, loop_last from .console import Console, ConsoleOptions, RenderableType, RenderResult from .jupyter import JupyterMixin from .measure import Measurement from .segment import Segment from .style import Style, StyleStack, StyleType from .styled import Styled GuideType = Tuple[str, str, str, str] class Tree(JupyterMixin): """A renderable for a tree structure. Attributes: ASCII_GUIDES (GuideType): Guide lines used when Console.ascii_only is True. TREE_GUIDES (List[GuideType, GuideType, GuideType]): Default guide lines. Args: label (RenderableType): The renderable or str for the tree label. style (StyleType, optional): Style of this tree. Defaults to "tree". guide_style (StyleType, optional): Style of the guide lines. Defaults to "tree.line". expanded (bool, optional): Also display children. Defaults to True. highlight (bool, optional): Highlight renderable (if str). Defaults to False. hide_root (bool, optional): Hide the root node. Defaults to False. """ ASCII_GUIDES = (" ", "\| ", "+-- ", "`-- ") TREE_GUIDES = [ (" ", "│ ", "├── ", "└── "), (" ", "┃ ", "┣━━ ", "┗━━ "), (" ", "║ ", "╠══ ", "╚══ "), ] def __init__( self, label: RenderableType, , style: StyleType = "tree", guide_style: StyleType = "tree.line", expanded: bool = True, highlight: bool = False, hide_root: bool = False, ) -> None: self.label = label self.style = style self.guide_style = guide_style self.children: List[Tree] = [] self.expanded = expanded self.highlight = highlight self.hide_root = hide_root def add( self, label: RenderableType, , style: Optional[StyleType] = None, guide_style: Optional[StyleType] = None, expanded: bool = True, highlight: Optional[bool] = False, ) -> "Tree": """Add a child tree. Args: label (RenderableType): The renderable or str for the tree label. style (StyleType, optional): Style of this tree. Defaults to "tree". guide_style (StyleType, optional): Style of the guide lines. Defaults to "tree.line". expanded (bool, optional): Also display children. Defaults to True. highlight (Optional[bool], optional): Highlight renderable (if str). Defaults to False. Returns: Tree: A new child Tree, which may be further modified. """ node = Tree( label, style=self.style if style is None else style, guide_style=self.guide_style if guide_style is None else guide_style, expanded=expanded, highlight=self.highlight if highlight is None else highlight, ) self.children.append(node) return node def __rich_console__( self, console: "Console", options: "ConsoleOptions" ) -> "RenderResult": stack: List[Iterator[Tuple[bool, Tree]]] = [] pop = stack.pop push = stack.append new_line = Segment.line() get_style = console.get_style null_style = Style.null() guide_style = get_style(self.guide_style, default="") or null_style SPACE, CONTINUE, FORK, END = range(4) _Segment = Segment def make_guide(index: int, style: Style) -> Segment: """Make a Segment for a level of the guide lines.""" if options.ascii_only: line = self.ASCII_GUIDES[index] else: guide = 1 if style.bold else (2 if style.underline2 else 0) line = self.TREE_GUIDES[0 if options.legacy_windows else guide][index] return _Segment(line, style) levels: List[Segment] = [make_guide(CONTINUE, guide_style)] push(iter(loop_last([self]))) guide_style_stack = StyleStack(get_style(self.guide_style)) style_stack = StyleStack(get_style(self.style)) remove_guide_styles = Style(bold=False, underline2=False) depth = 0 while stack: stack_node = pop() try: last, node = next(stack_node) except StopIteration: levels.pop() if levels: guide_style = levels[-1].style or null_style levels[-1] = make_guide(FORK, guide_style) guide_style_stack.pop() style_stack.pop() continue push(stack_node) if last: levels[-1] = make_guide(END, levels[-1].style or null_style) guide_style = guide_style_stack.current + get_style(node.guide_style) style = style_stack.current + get_style(node.style) prefix = levels[(2 if self.hide_root else 1) :] renderable_lines = console.render_lines( Styled(node.label, style), options.update( width=options.max_width - sum(level.cell_length for level in prefix), highlight=self.highlight, height=None, ), pad=options.justify is not None, ) if not (depth == 0 and self.hide_root): for first, line in loop_first(renderable_lines): if prefix: yield from _Segment.apply_style( prefix, style.background_style, post_style=remove_guide_styles, ) yield from line yield new_line if first and prefix: prefix[-1] = make_guide( SPACE if last else CONTINUE, prefix[-1].style or null_style ) if node.expanded and node.children: levels[-1] = make_guide( SPACE if last else CONTINUE, levels[-1].style or null_style ) levels.append( make_guide(END if len(node.children) == 1 else FORK, guide_style) ) style_stack.push(get_style(node.style)) guide_style_stack.push(get_style(node.guide_style)) push(iter(loop_last(node.children))) depth += 1 def __rich_measure__( self, console: "Console", options: "ConsoleOptions" ) -> "Measurement": stack: List[Iterator[Tree]] = [iter([self])] pop = stack.pop push = stack.append minimum = 0 maximum = 0 measure = Measurement.get level = 0 while stack: iter_tree = pop() try: tree = next(iter_tree) except StopIteration: level -= 1 continue push(iter_tree) min_measure, max_measure = measure(console, options, tree.label) indent = level * 4 minimum = max(min_measure + indent, minimum) maximum = max(max_measure + indent, maximum) if tree.expanded and tree.children: push(iter(tree.children)) level += 1 return Measurement(minimum, maximum) if __name__ == "__main__": # pragma: no cover from pip._vendor.rich.console import Group from pip._vendor.rich.markdown import Markdown from pip._vendor.rich.panel import Panel from pip._vendor.rich.syntax import Syntax from pip._vendor.rich.table import Table table = Table(row_styles=["", "dim"]) table.add_column("Released", style="cyan", no_wrap=True) table.add_column("Title", style="magenta") table.add_column("Box Office", justify="right", style="green") table.add_row("Dec 20, 2019", "Star Wars: The Rise of Skywalker", "$952,110,690") table.add_row("May 25, 2018", "Solo: A Star Wars Story", "$393,151,347") table.add_row("Dec 15, 2017", "Star Wars Ep. V111: The Last Jedi", "$1,332,539,889") table.add_row("Dec 16, 2016", "Rogue One: A Star Wars Story", "$1,332,439,889") code = """\ class Segment(NamedTuple): text: str = "" style: Optional[Style] = None is_control: bool = False """ syntax = Syntax(code, "python", theme="monokai", line_numbers=True) markdown = Markdown( """\ ### example.md > Hello, World! > > Markdown _all_ the things """ ) root = Tree("🌲 [b green]Rich Tree", highlight=True, hide_root=True) node = root.add(":file_folder: Renderables", guide_style="red") simple_node = node.add(":file_folder: [bold yellow]Atomic", guide_style="uu green") simple_node.add(Group("📄 Syntax", syntax)) simple_node.add(Group("📄 Markdown", Panel(markdown, border_style="green"))) containers_node = node.add( ":file_folder: [bold magenta]Containers", guide_style="bold magenta" ) containers_node.expanded = True panel = Panel.fit("Just a panel", border_style="red") containers_node.add(Group("📄 Panels", panel)) containers_node.add(Group("📄 [b magenta]Table", table)) console = Console() console.print(root)	9.23 KB	2026-01-20 12:58

Edit File:

Terminal